DE2149504A1 - 5-Fluoruracile - Google Patents
5-FluoruracileInfo
- Publication number
- DE2149504A1 DE2149504A1 DE19712149504 DE2149504A DE2149504A1 DE 2149504 A1 DE2149504 A1 DE 2149504A1 DE 19712149504 DE19712149504 DE 19712149504 DE 2149504 A DE2149504 A DE 2149504A DE 2149504 A1 DE2149504 A1 DE 2149504A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- fluorine
- nucleophilic agent
- fluorination
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- -1 alkoxy ion Chemical class 0.000 claims description 19
- 229910052731 fluorine Inorganic materials 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 239000011737 fluorine Substances 0.000 claims description 11
- 230000000269 nucleophilic effect Effects 0.000 claims description 10
- VMUWIFNDNXXSQA-UHFFFAOYSA-N hypofluorite Chemical compound F[O-] VMUWIFNDNXXSQA-UHFFFAOYSA-N 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 238000003682 fluorination reaction Methods 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 239000012025 fluorinating agent Substances 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 239000011261 inert gas Substances 0.000 claims description 4
- 125000006575 electron-withdrawing group Chemical group 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 230000008030 elimination Effects 0.000 claims description 2
- 238000003379 elimination reaction Methods 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical group [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000003153 chemical reaction reagent Substances 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 229940035893 uracil Drugs 0.000 description 9
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 8
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 8
- 229960002949 fluorouracil Drugs 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 150000003230 pyrimidines Chemical class 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- WCFAPJDPAPDDAQ-UHFFFAOYSA-N 1,2-dihydropyrimidine Chemical compound C1NC=CC=N1 WCFAPJDPAPDDAQ-UHFFFAOYSA-N 0.000 description 1
- 125000000189 2-deoxyribosyl group Chemical group C1(C[C@H](O)[C@H](O1)CO)* 0.000 description 1
- 150000005718 5-chloropyrimidines Chemical class 0.000 description 1
- KSPDSMOWMQFPBL-UHFFFAOYSA-N 5-fluoropyrimidine Chemical compound FC1=CN=CN=C1 KSPDSMOWMQFPBL-UHFFFAOYSA-N 0.000 description 1
- 150000005727 5-fluoropyrimidines Chemical class 0.000 description 1
- FHIDNBAQOFJWCA-UAKXSSHOSA-N 5-fluorouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(F)=C1 FHIDNBAQOFJWCA-UAKXSSHOSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- GMLJCMXFMUEABC-UHFFFAOYSA-N [difluoro(fluorooxy)methyl] hypofluorite Chemical compound FOC(F)(F)OF GMLJCMXFMUEABC-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- IYRWEQXVUNLMAY-UHFFFAOYSA-N carbonyl fluoride Chemical compound FC(F)=O IYRWEQXVUNLMAY-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- AFYPFACVUDMOHA-UHFFFAOYSA-N chlorotrifluoromethane Chemical compound FC(F)(F)Cl AFYPFACVUDMOHA-UHFFFAOYSA-N 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 230000001472 cytotoxic effect Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WPQVKKFPOFIUFF-UHFFFAOYSA-M fluorolead Chemical compound [Pb]F WPQVKKFPOFIUFF-UHFFFAOYSA-M 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- VBZWSGALLODQNC-UHFFFAOYSA-N hexafluoroacetone Chemical compound FC(F)(F)C(=O)C(F)(F)F VBZWSGALLODQNC-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000012476 oxidizable substance Substances 0.000 description 1
- XHFXMNZYIKFCPN-UHFFFAOYSA-N perchloryl fluoride Chemical compound FCl(=O)(=O)=O XHFXMNZYIKFCPN-UHFFFAOYSA-N 0.000 description 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 1
- 125000005009 perfluoropropyl group Chemical group FC(C(C(F)(F)F)(F)F)(F)* 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Inorganic materials [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000006257 total synthesis reaction Methods 0.000 description 1
- SMBZJSVIKJMSFP-UHFFFAOYSA-N trifluoromethyl hypofluorite Chemical group FOC(F)(F)F SMBZJSVIKJMSFP-UHFFFAOYSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/20—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D239/22—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/553—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with halogen atoms or nitro radicals directly attached to ring carbon atoms, e.g. fluorouracil
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7823570A | 1970-10-05 | 1970-10-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2149504A1 true DE2149504A1 (de) | 1972-07-06 |
Family
ID=22142782
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712149504 Ceased DE2149504A1 (de) | 1970-10-05 | 1971-10-04 | 5-Fluoruracile |
Country Status (16)
| Country | Link |
|---|---|
| JP (4) | JPS5432790B1 (enExample) |
| AR (1) | AR199762A1 (enExample) |
| AU (1) | AU454408B2 (enExample) |
| BE (1) | BE773446A (enExample) |
| CA (1) | CA1009657A (enExample) |
| CH (1) | CH567002A5 (enExample) |
| DE (1) | DE2149504A1 (enExample) |
| DK (1) | DK128496B (enExample) |
| FR (1) | FR2110952A5 (enExample) |
| GB (1) | GB1362839A (enExample) |
| HK (1) | HK15678A (enExample) |
| IL (1) | IL37855A (enExample) |
| NL (1) | NL7113583A (enExample) |
| NO (1) | NO135985C (enExample) |
| SE (1) | SE408418B (enExample) |
| ZA (1) | ZA716637B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2401619A1 (de) * | 1974-01-14 | 1975-07-24 | Robugen Gmbh | Fungistatisch wirksame uracilderivate und verfahren zu ihrer herstellung |
| DE2719245A1 (de) * | 1976-04-29 | 1977-11-10 | Daikin Ind Ltd | Verfahren zur fluorierung von uracil |
| DE3508355A1 (de) * | 1984-03-09 | 1985-09-12 | Onoda Cement Co., Ltd., Onoda, Yamaguchi | Verfahren zur herstellung von 5-fluoruracil |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5640813A (en) * | 1979-09-10 | 1981-04-17 | Minolta Camera Co Ltd | Electric power unit for flash emitting device |
| JPS58140098A (ja) * | 1982-01-27 | 1983-08-19 | Daikin Ind Ltd | ウリジン誘導体の製法およびウリジン誘導体 |
| JPH055677Y2 (enExample) * | 1985-05-22 | 1993-02-15 |
-
1971
- 1971-10-04 ZA ZA716637A patent/ZA716637B/xx unknown
- 1971-10-04 JP JP7720771A patent/JPS5432790B1/ja active Pending
- 1971-10-04 FR FR7135619A patent/FR2110952A5/fr not_active Expired
- 1971-10-04 DE DE19712149504 patent/DE2149504A1/de not_active Ceased
- 1971-10-04 AR AR238287A patent/AR199762A1/es active
- 1971-10-04 BE BE773446A patent/BE773446A/xx unknown
- 1971-10-04 CH CH1442371A patent/CH567002A5/xx not_active IP Right Cessation
- 1971-10-04 CA CA124,296A patent/CA1009657A/en not_active Expired
- 1971-10-04 GB GB4610071A patent/GB1362839A/en not_active Expired
- 1971-10-04 NO NO3634/71A patent/NO135985C/no unknown
- 1971-10-04 SE SE7112537A patent/SE408418B/xx unknown
- 1971-10-04 NL NL7113583A patent/NL7113583A/xx active Search and Examination
- 1971-10-04 DK DK481171AA patent/DK128496B/da unknown
- 1971-10-05 AU AU34181/71A patent/AU454408B2/en not_active Expired
- 1971-10-06 IL IL37855A patent/IL37855A/xx unknown
-
1978
- 1978-02-16 JP JP53017099A patent/JPS58421B2/ja not_active Expired
- 1978-02-16 JP JP1710078A patent/JPS53147081A/ja active Pending
- 1978-02-16 JP JP1710178A patent/JPS53147082A/ja active Granted
- 1978-03-23 HK HK156/78A patent/HK15678A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2401619A1 (de) * | 1974-01-14 | 1975-07-24 | Robugen Gmbh | Fungistatisch wirksame uracilderivate und verfahren zu ihrer herstellung |
| DE2719245A1 (de) * | 1976-04-29 | 1977-11-10 | Daikin Ind Ltd | Verfahren zur fluorierung von uracil |
| DE3508355A1 (de) * | 1984-03-09 | 1985-09-12 | Onoda Cement Co., Ltd., Onoda, Yamaguchi | Verfahren zur herstellung von 5-fluoruracil |
Also Published As
| Publication number | Publication date |
|---|---|
| CH567002A5 (enExample) | 1975-09-30 |
| JPS53147081A (en) | 1978-12-21 |
| CA1009657A (en) | 1977-05-03 |
| JPS53147080A (en) | 1978-12-21 |
| FR2110952A5 (enExample) | 1972-06-02 |
| JPS58421B2 (ja) | 1983-01-06 |
| NL7113583A (enExample) | 1972-04-07 |
| BE773446A (fr) | 1972-04-04 |
| IL37855A (en) | 1974-12-31 |
| DK128496B (da) | 1974-05-13 |
| JPS53147082A (en) | 1978-12-21 |
| JPS5432790B1 (enExample) | 1979-10-16 |
| JPS5516583B2 (enExample) | 1980-05-02 |
| HK15678A (en) | 1978-03-31 |
| IL37855A0 (en) | 1971-12-29 |
| GB1362839A (en) | 1974-08-07 |
| SE408418B (sv) | 1979-06-11 |
| AU3418171A (en) | 1973-04-12 |
| NO135985C (enExample) | 1977-07-06 |
| AR199762A1 (es) | 1974-09-30 |
| AU454408B2 (en) | 1974-10-31 |
| NO135985B (enExample) | 1977-03-28 |
| ZA716637B (en) | 1972-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3789702T2 (de) | Verfahren zur Herstellung von Perfluoräthern durch Fluorierung mit elementarem Fluor. | |
| DE69118649T2 (de) | Synthese fluorierter Ether | |
| DE3878463T2 (de) | Verfahren zur 9-alpha-dehalogenierung von 9-alpha-steroiden. | |
| DE2030402C3 (enExample) | ||
| DE2149504A1 (de) | 5-Fluoruracile | |
| DE3032471A1 (de) | Verfahren zur herstellung von fluorierten carbonylverbindungen | |
| DE2916889C2 (de) | Verfahren und Zwischenprodukte zur Herstellung von 6α-Halogen-3-Keto-Δ↑1↑↑,↑↑4↑-pregnadienderivaten | |
| DE3045375A1 (de) | Neue substituierte pyrimidin-nukleoside mit antiviraler wirkung, verfahren zu deren herstellung und daraus zubereitete arzneiformen | |
| DE69111972T2 (de) | Verfahren zur Herstellung von Salzen fluorierter Alkohole. | |
| DE2726258A1 (de) | Verfahren zur herstellung von 5-fluoruracil | |
| EP0708080B1 (de) | Verfahren zur Herstellung von N,N'-Disubstituierten p-Chinondiiminen und deren Verwendung | |
| EP2464636A1 (de) | Verfahren zum herstellen von 2,4-dioxotetrahydrofuran-3-carboxylaten | |
| EP0492386B1 (de) | Verfahren zur Herstellung von Fluor enthaltenden Ethanderivaten | |
| DE1793500C2 (de) | Verfahren zur Herstellung fluorier ter Allyl oder Vinyl ather | |
| EP1355915B1 (de) | Markierungsfähige verbindungen zur einfachen synthese von 3'-[18f]fluor-3'-deoxythymidin und verfahren zu deren herstellung | |
| DE69309090T2 (de) | Ein verbessertes Verfahren zur Herstellung von N-Fluorsulfonimiden. | |
| DE4123993A1 (de) | Verbessertes verfahren zur herstellung des mononatriumsalzes von riboflavin-5'-phosphat | |
| DE2645844A1 (de) | Verfahren zur herstellung von oxalsaeureestern | |
| EP2556039A1 (de) | Fluorierungsreagenzien mit (perfluoralkyl)fluorophosphat-anion | |
| DE69302783T2 (de) | Verfahren zur Herstellung von Perfluor-2-Methyl-4-Methoxypentan | |
| EP0445644B1 (de) | Trifluor- bzw. Chlordifluormethoxypyrimidine und Verfahren zu ihrer Herstellung | |
| DE2148631B2 (de) | Verfahren zur herstellung von in der 9(11)- und/oder 16-stellung ungesaettigten steroiden | |
| DE2246203A1 (de) | Verfahren zur herstellung von steroid-21-alkoholen | |
| DE69013332T2 (de) | N-(3',4'-dimethoxyzimtsäure)anthranilsäure. | |
| DE102006015704B4 (de) | Neue 1,2-Bis-(azol-1-yl)-ethan-1,2-diole als Zwischenprodukte zur Synthese von Agrochemikalien und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8131 | Rejection |