DE2129200B2 - Verfahren zur Herstellung von N-A rj !harnstoffen - Google Patents
Verfahren zur Herstellung von N-A rj !harnstoffenInfo
- Publication number
- DE2129200B2 DE2129200B2 DE2129200A DE2129200A DE2129200B2 DE 2129200 B2 DE2129200 B2 DE 2129200B2 DE 2129200 A DE2129200 A DE 2129200A DE 2129200 A DE2129200 A DE 2129200A DE 2129200 B2 DE2129200 B2 DE 2129200B2
- Authority
- DE
- Germany
- Prior art keywords
- formula
- reaction
- ureas
- alkyl
- prepared
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 27
- 235000013877 carbamide Nutrition 0.000 title description 9
- 238000004519 manufacturing process Methods 0.000 title description 5
- 150000003672 ureas Chemical class 0.000 title description 5
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 description 12
- 150000001412 amines Chemical class 0.000 description 10
- 239000000460 chlorine Substances 0.000 description 10
- 239000007858 starting material Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 6
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical group 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 4
- 239000005708 Sodium hypochlorite Substances 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- -1 aryl carboxamides Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 4
- YXCMBXHASVZXLT-UHFFFAOYSA-N 3-chloro-4-(trifluoromethoxy)benzamide Chemical compound NC(=O)C1=CC=C(OC(F)(F)F)C(Cl)=C1 YXCMBXHASVZXLT-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 description 2
- LYJCNWQXQAONLO-UHFFFAOYSA-N 4-(trichloromethoxy)benzoyl chloride Chemical compound ClC(=O)C1=CC=C(OC(Cl)(Cl)Cl)C=C1 LYJCNWQXQAONLO-UHFFFAOYSA-N 0.000 description 2
- IDIXWLCRJFBQJA-UHFFFAOYSA-N 4-(trifluoromethoxy)benzamide Chemical compound NC(=O)C1=CC=C(OC(F)(F)F)C=C1 IDIXWLCRJFBQJA-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- CLYZNABPUKUSDX-UHFFFAOYSA-N trichloromethoxybenzene Chemical class ClC(Cl)(Cl)OC1=CC=CC=C1 CLYZNABPUKUSDX-UHFFFAOYSA-N 0.000 description 2
- NZRLCYJRHKUVCV-UHFFFAOYSA-N 1-chloro-2-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=CC=C1Cl NZRLCYJRHKUVCV-UHFFFAOYSA-N 0.000 description 1
- LGPKFIGMLPDYEA-UHFFFAOYSA-N 1-isocyanato-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(N=C=O)C=C1 LGPKFIGMLPDYEA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- ZBWCVCKITJKQPD-UHFFFAOYSA-N 3-chloro-4-(trichloromethoxy)benzoyl chloride Chemical compound ClC(=O)C1=CC=C(OC(Cl)(Cl)Cl)C(Cl)=C1 ZBWCVCKITJKQPD-UHFFFAOYSA-N 0.000 description 1
- FEKISPQYCCOXGE-UHFFFAOYSA-N 3-chloro-4-(trifluoromethoxy)benzoyl fluoride Chemical compound FC(=O)C1=CC=C(OC(F)(F)F)C(Cl)=C1 FEKISPQYCCOXGE-UHFFFAOYSA-N 0.000 description 1
- WEJHBEDHLLBJFW-UHFFFAOYSA-N 4-(trifluoromethyl)benzamide Chemical compound NC(=O)C1=CC=C(C(F)(F)F)C=C1 WEJHBEDHLLBJFW-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- IDTKMRKZNUPFHJ-UHFFFAOYSA-N ClC1(CC=CC=C1)OC(Cl)(Cl)Cl Chemical compound ClC1(CC=CC=C1)OC(Cl)(Cl)Cl IDTKMRKZNUPFHJ-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- HAXUFHXMBCWDPM-UHFFFAOYSA-N fluoromethoxybenzene Chemical compound FCOC1=CC=CC=C1 HAXUFHXMBCWDPM-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- GQHWSLKNULCZGI-UHFFFAOYSA-N trifluoromethoxybenzene Chemical class FC(F)(F)OC1=CC=CC=C1 GQHWSLKNULCZGI-UHFFFAOYSA-N 0.000 description 1
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2129200A DE2129200B2 (de) | 1971-06-12 | 1971-06-12 | Verfahren zur Herstellung von N-A rj !harnstoffen |
| US05/258,705 US3935258A (en) | 1971-06-12 | 1972-06-01 | Process for making N-arylurea compounds and herbicidal compositions containing same |
| CS3838A CS167990B2 (enExample) | 1971-06-12 | 1972-06-02 | |
| DD163479A DD98286A5 (enExample) | 1971-06-12 | 1972-06-06 | |
| CH866572A CH580577A5 (enExample) | 1971-06-12 | 1972-06-09 | |
| IL39654A IL39654A (en) | 1971-06-12 | 1972-06-09 | The preparation of certain n-aryl-ureas and their use as herbicides |
| BR003713/72A BR7203713D0 (pt) | 1971-06-12 | 1972-06-09 | Processo para preparacao de n-aril-ureias |
| IT25534/72A IT961227B (it) | 1971-06-12 | 1972-06-10 | Procedimento per la preparazione di n aril uree |
| BE784737A BE784737A (fr) | 1971-06-12 | 1972-06-12 | Procede de preparation de n-arylurees |
| FR7221069A FR2142394A5 (enExample) | 1971-06-12 | 1972-06-12 | |
| NL7208001A NL7208001A (enExample) | 1971-06-12 | 1972-06-12 | |
| GB2726672A GB1338528A (en) | 1971-06-12 | 1972-06-12 | Process for the preparation of n-arylureas |
| AT502872A AT315192B (de) | 1971-06-12 | 1972-06-12 | Verfahren zur Herstellung von N-Arylharnstoffen |
| JP5777372A JPS5550939B1 (enExample) | 1971-06-12 | 1972-06-12 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2129200A DE2129200B2 (de) | 1971-06-12 | 1971-06-12 | Verfahren zur Herstellung von N-A rj !harnstoffen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2129200A1 DE2129200A1 (de) | 1972-12-28 |
| DE2129200B2 true DE2129200B2 (de) | 1979-09-27 |
Family
ID=5810578
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2129200A Withdrawn DE2129200B2 (de) | 1971-06-12 | 1971-06-12 | Verfahren zur Herstellung von N-A rj !harnstoffen |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3935258A (enExample) |
| JP (1) | JPS5550939B1 (enExample) |
| AT (1) | AT315192B (enExample) |
| BE (1) | BE784737A (enExample) |
| BR (1) | BR7203713D0 (enExample) |
| CH (1) | CH580577A5 (enExample) |
| CS (1) | CS167990B2 (enExample) |
| DD (1) | DD98286A5 (enExample) |
| DE (1) | DE2129200B2 (enExample) |
| FR (1) | FR2142394A5 (enExample) |
| GB (1) | GB1338528A (enExample) |
| IL (1) | IL39654A (enExample) |
| IT (1) | IT961227B (enExample) |
| NL (1) | NL7208001A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4421931A (en) | 1981-02-03 | 1983-12-20 | Basf Aktiengesellschaft | Preparation of anthranilic acid amides |
| AT397384B (de) * | 1991-08-16 | 1994-03-25 | Chemie Linz Gmbh | Verfahren zur herstellung reiner n,n'-unsymmetrisch substituierter phenylharnstoffe |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2710595C3 (de) * | 1977-03-11 | 1980-11-06 | Akzo Gmbh, 5600 Wuppertal | Verfahren zur Herstellung der Trans-Isomeren von Cyclohexan-l,4-diamin-, diurethanen, -diharnstoffen, -disulfonylharnstoffen und -diisocyanat |
| US4146645A (en) * | 1974-04-27 | 1979-03-27 | Boehringer Ingelheim Gmbh | Hypertensive phenylalkylamines and salts thereof |
| USRE32418E (en) * | 1977-05-13 | 1987-05-12 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| US4170657A (en) * | 1977-05-13 | 1979-10-09 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| US4832879A (en) * | 1980-03-04 | 1989-05-23 | Basf Aktiengesellchaft | Substituted 3-fluoroalkoxybenzoyl halides and their preparation |
| US4304935A (en) * | 1980-04-09 | 1981-12-08 | Rexolin Chemicals Ab | Production of 1-phenyl-3-cyanoureas |
| US4318866A (en) * | 1980-04-10 | 1982-03-09 | Eli Lilly And Company | Chlorination of 4-methoxybenzoyl chloride |
| US4500471A (en) * | 1980-04-16 | 1985-02-19 | Occidental Chemical Corporation | Preparation of trifluoromethyl-benzoyl halides |
| JPS58203957A (ja) * | 1982-05-25 | 1983-11-28 | Ube Ind Ltd | 尿素誘導体の製法 |
| US5047584A (en) * | 1985-12-09 | 1991-09-10 | Occidental Chemical Corp. | Process for the preparation of pentahaloethoxy benzoyl halide compounds |
| JPH0657867U (ja) * | 1992-04-08 | 1994-08-12 | 誠一 北林 | 正倒立状態で使用可能なエアゾールバルブおよび そのエアゾールバルブを内蔵したエアゾールバル ブ内蔵容器 |
| DE4234585C1 (de) * | 1992-10-14 | 1994-08-25 | Merck Patent Gmbh | Fluorierte Trifluormethoxybenzole |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1291733B (de) * | 1965-11-16 | 1969-04-03 | Lauterbach | Verfahren zur Herstellung von N-Aryl-harnstoffen |
| US3661989A (en) * | 1967-05-31 | 1972-05-09 | Aleksandra Chrobok Nawakowski | Process for preparing certain substituted bis-ureas |
-
1971
- 1971-06-12 DE DE2129200A patent/DE2129200B2/de not_active Withdrawn
-
1972
- 1972-06-01 US US05/258,705 patent/US3935258A/en not_active Expired - Lifetime
- 1972-06-02 CS CS3838A patent/CS167990B2/cs unknown
- 1972-06-06 DD DD163479A patent/DD98286A5/xx unknown
- 1972-06-09 BR BR003713/72A patent/BR7203713D0/pt unknown
- 1972-06-09 CH CH866572A patent/CH580577A5/xx not_active IP Right Cessation
- 1972-06-09 IL IL39654A patent/IL39654A/xx unknown
- 1972-06-10 IT IT25534/72A patent/IT961227B/it active
- 1972-06-12 NL NL7208001A patent/NL7208001A/xx unknown
- 1972-06-12 AT AT502872A patent/AT315192B/de not_active IP Right Cessation
- 1972-06-12 FR FR7221069A patent/FR2142394A5/fr not_active Expired
- 1972-06-12 GB GB2726672A patent/GB1338528A/en not_active Expired
- 1972-06-12 JP JP5777372A patent/JPS5550939B1/ja active Pending
- 1972-06-12 BE BE784737A patent/BE784737A/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4421931A (en) | 1981-02-03 | 1983-12-20 | Basf Aktiengesellschaft | Preparation of anthranilic acid amides |
| AT397384B (de) * | 1991-08-16 | 1994-03-25 | Chemie Linz Gmbh | Verfahren zur herstellung reiner n,n'-unsymmetrisch substituierter phenylharnstoffe |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2142394A5 (enExample) | 1973-01-26 |
| BR7203713D0 (pt) | 1973-08-09 |
| IL39654A (en) | 1974-12-31 |
| CS167990B2 (enExample) | 1976-05-28 |
| JPS5550939B1 (enExample) | 1980-12-20 |
| US3935258A (en) | 1976-01-27 |
| CH580577A5 (enExample) | 1976-10-15 |
| DD98286A5 (enExample) | 1973-06-12 |
| DE2129200A1 (de) | 1972-12-28 |
| BE784737A (fr) | 1972-12-12 |
| IL39654A0 (en) | 1972-08-30 |
| GB1338528A (en) | 1973-11-28 |
| IT961227B (it) | 1973-12-10 |
| AT315192B (de) | 1974-05-10 |
| NL7208001A (enExample) | 1972-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2129200B2 (de) | Verfahren zur Herstellung von N-A rj !harnstoffen | |
| EP0059241B1 (de) | Verfahren zur Herstellung von aromatischen Sulfohalogeniden | |
| CH628877A5 (de) | Verfahren zur herstellung von acylcyaniden. | |
| DE820897C (de) | Verfahren zur Herstellung von C-Nitrosoarylaminen | |
| EP0057889B1 (de) | Verfahren zur Herstellung von 1-Alkyl-2-chlor-5-nitro-4-benzol-sulfonsäuren | |
| DE3921035A1 (de) | Verfahren zur herstellung von jodalkinylcarbamaten | |
| EP0551632B1 (de) | Verfahren zur Herstellung von Halogenanthranilsäuren | |
| DE2648054C3 (de) | Verfahren zur Herstellung von Dichlornitroanilinen | |
| DE2328757C3 (de) | Verfahren zur Herstellung von Aminen | |
| EP0057861A2 (de) | Verfahren zur Herstellung von Nitroanilinen | |
| DE3885823T2 (de) | Verfahren zur herstellung von 3-chlor-4-fluornitrobenzol. | |
| WO1986005487A1 (fr) | Procede de production d'uree de benzoyle | |
| EP0004623A1 (de) | Verfahren zur Herstellung von aromatischen Aminen | |
| EP0315862B1 (de) | Am aromatischen Kern Fluor enthaltende Fluormethoxy- und Fluormethylthioaminobenzole und deren Herstellung | |
| EP1099686B1 (de) | Verfahren zur Herstellung von Trifluormethylanilinen | |
| DE3607298A1 (de) | Verfahren zur herstellung von benzoylharnstoffen | |
| DE2800111A1 (de) | Verfahren zur herstellung von aminophenylharnstoffen und aminocarbanylaten | |
| EP0022959B1 (de) | Verfahren zur Herstellung von Diazoniumtetrafluoroboraten in verdünnter wässriger Lösung | |
| DE1643329B2 (de) | Verfahren zur herstellung von nitroaminodiarylaethern | |
| DE3245503A1 (de) | Verfahren zur herstellung von alkyl-hydroxylaminen | |
| DE2537288A1 (de) | Herstellung von trifluormethylsubstituierten aminobenzonitrilen | |
| DE1932297A1 (de) | Verfahren zur Herstellung von Benzimidazol-2-carbaminsaeureestern | |
| DE2417669A1 (de) | Verfahren zur herstellung von n(halogenaryl)-n',n'-dialkylamidinen | |
| DE1593871C3 (de) | Verfahren zur Herstellung von Nitroaminodiaryläthern | |
| DE2416260A1 (de) | Verfahren zur herstellung von phenolderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8230 | Patent withdrawn |