DE2123989A1 - Verfahren zur Herstellung von C tief 1bis C tief 10-Alkylestern der Chrysanthemsäure - Google Patents
Verfahren zur Herstellung von C tief 1bis C tief 10-Alkylestern der ChrysanthemsäureInfo
- Publication number
- DE2123989A1 DE2123989A1 DE19712123989 DE2123989A DE2123989A1 DE 2123989 A1 DE2123989 A1 DE 2123989A1 DE 19712123989 DE19712123989 DE 19712123989 DE 2123989 A DE2123989 A DE 2123989A DE 2123989 A1 DE2123989 A1 DE 2123989A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- alkyl
- diazoacetate
- glycine
- ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 37
- 238000002360 preparation method Methods 0.000 title claims description 5
- XLOPRKKSAJMMEW-SFYZADRCSA-N Chrysanthemic acid Natural products CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 title description 5
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical compound CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 title description 5
- 125000005907 alkyl ester group Chemical group 0.000 title description 2
- 238000006243 chemical reaction Methods 0.000 claims description 29
- -1 alkyl diazoacetate Chemical compound 0.000 claims description 26
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 25
- 239000004471 Glycine Substances 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 13
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 11
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 claims description 11
- 235000007516 Chrysanthemum Nutrition 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 239000007795 chemical reaction product Substances 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 239000012431 aqueous reaction media Substances 0.000 claims description 3
- VIMXTGUGWLAOFZ-UHFFFAOYSA-N ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CCOC(=O)C1C(C=C(C)C)C1(C)C VIMXTGUGWLAOFZ-UHFFFAOYSA-N 0.000 claims description 3
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 claims description 3
- 239000004317 sodium nitrate Substances 0.000 claims description 3
- 235000010344 sodium nitrate Nutrition 0.000 claims description 3
- 238000003756 stirring Methods 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000006227 byproduct Substances 0.000 claims description 2
- 239000000839 emulsion Substances 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 150000008043 acidic salts Chemical class 0.000 claims 5
- 150000001875 compounds Chemical class 0.000 claims 2
- 244000189548 Chrysanthemum x morifolium Species 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- BHZOKUMUHVTPBX-UHFFFAOYSA-M sodium acetic acid acetate Chemical compound [Na+].CC(O)=O.CC([O-])=O BHZOKUMUHVTPBX-UHFFFAOYSA-M 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 23
- 239000000243 solution Substances 0.000 description 19
- 235000010288 sodium nitrite Nutrition 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 11
- 241000723353 Chrysanthemum Species 0.000 description 9
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 239000001632 sodium acetate Substances 0.000 description 9
- 235000017281 sodium acetate Nutrition 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- ZXLUFQJSMQSMTR-AATRIKPKSA-N (4e)-2-methylhepta-2,4-diene Chemical compound CC\C=C\C=C(C)C ZXLUFQJSMQSMTR-AATRIKPKSA-N 0.000 description 8
- 239000012044 organic layer Substances 0.000 description 7
- 238000004821 distillation Methods 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 238000010923 batch production Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000003377 acid catalyst Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000010924 continuous production Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000002917 insecticide Substances 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000000711 cancerogenic effect Effects 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000001030 gas--liquid chromatography Methods 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- ZCVAOQKBXKSDMS-AQYZNVCMSA-N (+)-trans-allethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(CC=C)C(=O)C1 ZCVAOQKBXKSDMS-AQYZNVCMSA-N 0.000 description 1
- TXTWXQXDMWILOF-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl)azanium;chloride Chemical compound [Cl-].CCOC(=O)C[NH3+] TXTWXQXDMWILOF-UHFFFAOYSA-N 0.000 description 1
- YJXNJQHBVKTWCC-UHFFFAOYSA-N (3-cyclopent-2-en-1-yl-2-methyl-4-oxocyclopent-2-en-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OC1C(C)=C(C2C=CCC2)C(=O)C1 YJXNJQHBVKTWCC-UHFFFAOYSA-N 0.000 description 1
- FMTFEIJHMMQUJI-NJAFHUGGSA-N 102130-98-3 Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]1[C@@H](C=C(C)C)C1(C)C FMTFEIJHMMQUJI-NJAFHUGGSA-N 0.000 description 1
- DZPCYXCBXGQBRN-UHFFFAOYSA-N 2,5-Dimethyl-2,4-hexadiene Chemical compound CC(C)=CC=C(C)C DZPCYXCBXGQBRN-UHFFFAOYSA-N 0.000 description 1
- HEFYHDKCEOTPPW-UHFFFAOYSA-N 2-(octylamino)acetic acid Chemical class CCCCCCCCNCC(O)=O HEFYHDKCEOTPPW-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 1
- 206010040880 Skin irritation Diseases 0.000 description 1
- GVVWEQQBBATYME-UHFFFAOYSA-L [Na+].[Na+].[O-]N=O.[O-]N=O Chemical compound [Na+].[Na+].[O-]N=O.[O-]N=O GVVWEQQBBATYME-UHFFFAOYSA-L 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229940024113 allethrin Drugs 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000001944 continuous distillation Methods 0.000 description 1
- 238000011437 continuous method Methods 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- ROVGZAWFACYCSP-VUMXUWRFSA-N pyrethrin I Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-VUMXUWRFSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000036556 skin irritation Effects 0.000 description 1
- 231100000475 skin irritation Toxicity 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C245/00—Compounds containing chains of at least two nitrogen atoms with at least one nitrogen-to-nitrogen multiple bond
- C07C245/12—Diazo compounds, i.e. compounds having the free valencies of >N2 groups attached to the same carbon atom
- C07C245/14—Diazo compounds, i.e. compounds having the free valencies of >N2 groups attached to the same carbon atom having diazo groups bound to acyclic carbon atoms of a carbon skeleton
- C07C245/18—Diazo compounds, i.e. compounds having the free valencies of >N2 groups attached to the same carbon atom having diazo groups bound to acyclic carbon atoms of a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US039202A US3897478A (en) | 1970-05-21 | 1970-05-21 | Continuous process for the manufacture of alkyl chrysanthemate esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2123989A1 true DE2123989A1 (de) | 1971-12-02 |
Family
ID=21904214
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712123989 Withdrawn DE2123989A1 (de) | 1970-05-21 | 1971-05-14 | Verfahren zur Herstellung von C tief 1bis C tief 10-Alkylestern der Chrysanthemsäure |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3897478A (enExample) |
| BE (1) | BE767471A (enExample) |
| CA (1) | CA935176A (enExample) |
| CH (1) | CH553148A (enExample) |
| DE (1) | DE2123989A1 (enExample) |
| FR (1) | FR2091751A5 (enExample) |
| GB (1) | GB1306191A (enExample) |
| NL (1) | NL7106994A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2554380A1 (de) * | 1974-12-03 | 1976-06-10 | Ici Ltd | Verfahren zur herstellung eines esters von 3-(2,2-dichlorovinyl)-2,2- dimethylcyclopropan-carbonsaeure |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN102216243B (zh) * | 2008-11-14 | 2014-09-03 | Dsm精细化学奥地利Nfg两合公司 | 制备环丙烷衍生物的方法 |
| WO2012128985A1 (en) * | 2011-03-18 | 2012-09-27 | Sigma-Aldrich Co. Llc | Continuous flow process for the production of diazo esters |
| CN109776351B (zh) * | 2017-11-15 | 2021-11-09 | 江苏优士化学有限公司 | 一种重氮乙酸酯连续化合成方法 |
| CN112142597B (zh) * | 2020-09-25 | 2022-11-15 | 湖北中灏科技有限公司 | 一种菊酸乙酯制备方法 |
| CN111978181B (zh) * | 2020-09-25 | 2022-11-15 | 湖北中灏科技有限公司 | 一种高收率的菊酸乙酯制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2691650A (en) * | 1951-12-14 | 1954-10-12 | Nat Distillers Prod Corp | Diazotizing of glycine esters |
| GB740014A (en) * | 1953-04-23 | 1955-11-09 | Ici Ltd | Manufacture of ethyl chrysanthemate |
| US3808260A (en) * | 1971-05-14 | 1974-04-30 | Sumitomo Chemical Co | Process for producing alkyl chrysanthemates |
-
1970
- 1970-05-21 US US039202A patent/US3897478A/en not_active Expired - Lifetime
-
1971
- 1971-04-20 CA CA110827A patent/CA935176A/en not_active Expired
- 1971-04-30 GB GB1234771A patent/GB1306191A/en not_active Expired
- 1971-05-14 DE DE19712123989 patent/DE2123989A1/de not_active Withdrawn
- 1971-05-18 FR FR7117999A patent/FR2091751A5/fr not_active Expired
- 1971-05-18 CH CH729471A patent/CH553148A/xx not_active IP Right Cessation
- 1971-05-21 NL NL7106994A patent/NL7106994A/xx not_active Application Discontinuation
- 1971-05-21 BE BE767471A patent/BE767471A/xx not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2554380A1 (de) * | 1974-12-03 | 1976-06-10 | Ici Ltd | Verfahren zur herstellung eines esters von 3-(2,2-dichlorovinyl)-2,2- dimethylcyclopropan-carbonsaeure |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1306191A (enExample) | 1973-02-07 |
| CH553148A (de) | 1974-08-30 |
| BE767471A (fr) | 1971-11-22 |
| CA935176A (en) | 1973-10-09 |
| FR2091751A5 (enExample) | 1972-01-14 |
| US3897478A (en) | 1975-07-29 |
| NL7106994A (enExample) | 1971-11-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2123989A1 (de) | Verfahren zur Herstellung von C tief 1bis C tief 10-Alkylestern der Chrysanthemsäure | |
| DE2542496A1 (de) | Verfahren zur herstellung von perfluoralkyljodidtelomeren | |
| DE1493022C3 (de) | Verfahren zur Herstellung von alpha-Monochlor-tyN-dialkylacetylacetamid | |
| DE69009394T2 (de) | Verfahren zur Herstellung von 3-Cyano-3,5,5-trimethyl-1-cyclohexanon. | |
| DE1693027B2 (de) | Verfahren zur Herstellung von e-Caprolacton oder von Methyli-caprolactonen | |
| DE2651531C2 (de) | Fluorierte Acylfluoride mit einer Estergruppe und Verfahren zu deren Herstellung | |
| DE888696C (de) | Verfahren zur Herstellung von Alkylbleiverbindungen | |
| DE2831777A1 (de) | Verfahren zur herstellung von aromatischen saeurechloriden | |
| EP0045425B1 (de) | Verfahren zur Halogenierung von gegebenenfalls substituierten 4-tert.-Butyltoluolen sowie die daraus erhaltenen Gemische aus gegebenenfalls substituierten 4-tert.-Butylbenzalhalogeniden, 4-tert.-Butylbenzylhalogeniden und 4-tert.-Butylbenzotrihalogeniden | |
| DE2721265C2 (de) | Verfahren zur Herstellung von Di- n-propylacetonitril | |
| EP0302331B1 (de) | Ester von Arylbisperfluoralkylcarbinolen, Verfahren zur Herstellung dieser Verbindungen und der zugrundeliegenden Arylbisperfluoralkylcarbinole | |
| DE3326436C2 (enExample) | ||
| DE1593405C (enExample) | ||
| DE870853C (de) | Verfahren zur Herstellung von Diisopropylbenzolhydroperoxyden | |
| DE3811095C2 (enExample) | ||
| DE2019250A1 (de) | Herstellung aromatischer Sulfonate | |
| DE2601824C2 (de) | Verfahren zur Herstellung von beta-Chlorpropionsäurechlorid | |
| DE895597C (de) | Verfahren zur Herstellung von Vinylestern | |
| DE2824558B2 (de) | Verfahren zur Herstellung von Quadratsäure | |
| DE2814450A1 (de) | Verfahren zur herstellung von fluorierten s-triazinen | |
| DE2151565C3 (de) | Verfahren zur gleichzeitigen Herstellung von aliphatischen Bromcarbonsäuren und Alkylbromlden | |
| EP0375920A1 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten Alkyl- oder Alkenylchloriden | |
| DE863937C (de) | Verfahren zur Herstellung von 1, 4-Dichlor- oder 1, 4-Dibrombutan | |
| DE2032136C3 (de) | Verfahren zur Herstellung von 2-Halogenäthylphosphonyldihalogeniden | |
| DE809555C (de) | Verfahren zur Herstellung von Aryloxyphosphoryldichloriden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |