DE2114634A1 - Dispersionsfarbstoffe der Thioxanthenreihe - Google Patents
Dispersionsfarbstoffe der ThioxanthenreiheInfo
- Publication number
- DE2114634A1 DE2114634A1 DE19712114634 DE2114634A DE2114634A1 DE 2114634 A1 DE2114634 A1 DE 2114634A1 DE 19712114634 DE19712114634 DE 19712114634 DE 2114634 A DE2114634 A DE 2114634A DE 2114634 A1 DE2114634 A1 DE 2114634A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- water
- solution
- formula
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000986 disperse dye Substances 0.000 title claims description 3
- 150000005075 thioxanthenes Chemical class 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 15
- 239000000975 dye Substances 0.000 claims description 9
- 239000004033 plastic Substances 0.000 claims description 4
- 229920003023 plastic Polymers 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 238000004043 dyeing Methods 0.000 claims description 2
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 229920000728 polyester Polymers 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- -1 heterocyclic radical Chemical class 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 239000000155 melt Substances 0.000 description 11
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- 238000009835 boiling Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 235000010288 sodium nitrite Nutrition 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- XJHABGPPCLHLLV-UHFFFAOYSA-N benzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(=O)NC2=O)=C3C2=CC=CC3=C1 XJHABGPPCLHLLV-UHFFFAOYSA-N 0.000 description 4
- 229910000365 copper sulfate Inorganic materials 0.000 description 4
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical compound NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 125000005521 carbonamide group Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000002950 monocyclic group Chemical class 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 125000006183 2,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])*)C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000764238 Isis Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000006226 butoxyethyl group Chemical group 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004663 dialkyl amino group Chemical class 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000006505 p-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C#N)C([H])([H])* 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical group 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/14—Benzoxanthene dyes; Benzothioxanthene dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712114634 DE2114634A1 (de) | 1971-03-26 | 1971-03-26 | Dispersionsfarbstoffe der Thioxanthenreihe |
| DD161494A DD96247A5 (enExample) | 1971-03-26 | 1972-03-13 | |
| BE780778A BE780778A (fr) | 1971-03-26 | 1972-03-16 | Colorants disperses de la serie du thioxanthene |
| IT49113/72A IT952301B (it) | 1971-03-26 | 1972-03-20 | Coloranti da dispersione della serie tioxantenica |
| US00236211A US3808215A (en) | 1971-03-26 | 1972-03-20 | N alkoxyl naphthalimides |
| FR7210413A FR2130667B1 (enExample) | 1971-03-26 | 1972-03-24 | |
| GB1382872A GB1375117A (enExample) | 1971-03-26 | 1972-03-24 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712114634 DE2114634A1 (de) | 1971-03-26 | 1971-03-26 | Dispersionsfarbstoffe der Thioxanthenreihe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2114634A1 true DE2114634A1 (de) | 1972-10-05 |
Family
ID=5802806
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712114634 Pending DE2114634A1 (de) | 1971-03-26 | 1971-03-26 | Dispersionsfarbstoffe der Thioxanthenreihe |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3808215A (enExample) |
| BE (1) | BE780778A (enExample) |
| DD (1) | DD96247A5 (enExample) |
| DE (1) | DE2114634A1 (enExample) |
| FR (1) | FR2130667B1 (enExample) |
| GB (1) | GB1375117A (enExample) |
| IT (1) | IT952301B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998019648A3 (en) * | 1996-11-01 | 1999-03-04 | Warner Lambert Co | N-oxy-naphthalimides as antibacterial agents |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102005037115A1 (de) * | 2005-08-03 | 2007-02-08 | Basf Ag | Mehrfachchromophore |
| WO2016151068A1 (en) | 2015-03-26 | 2016-09-29 | Basf Se | Cyanated benzoxanthene and benzothioxanthene compounds |
-
1971
- 1971-03-26 DE DE19712114634 patent/DE2114634A1/de active Pending
-
1972
- 1972-03-13 DD DD161494A patent/DD96247A5/xx unknown
- 1972-03-16 BE BE780778A patent/BE780778A/xx unknown
- 1972-03-20 US US00236211A patent/US3808215A/en not_active Expired - Lifetime
- 1972-03-20 IT IT49113/72A patent/IT952301B/it active
- 1972-03-24 FR FR7210413A patent/FR2130667B1/fr not_active Expired
- 1972-03-24 GB GB1382872A patent/GB1375117A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998019648A3 (en) * | 1996-11-01 | 1999-03-04 | Warner Lambert Co | N-oxy-naphthalimides as antibacterial agents |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1375117A (enExample) | 1974-11-27 |
| DD96247A5 (enExample) | 1973-03-12 |
| US3808215A (en) | 1974-04-30 |
| IT952301B (it) | 1973-07-20 |
| FR2130667B1 (enExample) | 1976-08-06 |
| FR2130667A1 (enExample) | 1972-11-03 |
| BE780778A (fr) | 1972-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1098125B (de) | Verfahren zur Herstellung von fluoreszierenden Verbindungen | |
| DE1924770A1 (de) | Basische Azoverbindungen,ihre Herstellung und Verwendung | |
| DE2054697C3 (de) | Sulfonsäuregruppenfreie basische Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1644328C3 (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH629238A5 (de) | Verfahren zur herstellung von farbstoffen der cumarinreihe. | |
| DE1469691A1 (de) | Verwendung von Methinfarbstoffen zum Faerben von hydrophoben Faeden und Fasern sowie hieraus hergestellten Textilien | |
| DE1644069C3 (de) | Wasserunlösliche Monoazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE2114634A1 (de) | Dispersionsfarbstoffe der Thioxanthenreihe | |
| DE1644325A1 (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE2340571A1 (de) | Verfahren zur herstellung von heterocyclischen verbindungen | |
| DE1901422C3 (de) | Trisazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung in photographischen Materialien | |
| DE2406333A1 (de) | Neue azo-zimtsaeurefarbstoffe | |
| DE2842186A1 (de) | Azofarbstoffe | |
| DE2129565A1 (de) | Fluoreszierende Farbstoffe | |
| DE2008491C3 (de) | Benzoxanthenfarbstoffe und Verfahren zu ihrer Herstellung | |
| DE2529434B2 (de) | Farbstoffe der cumarinreihe und ihre verwendung | |
| DE1519468A1 (de) | 3-Pyrazolyl-7-aryltriazolyl-cumarinverbindungen | |
| CH626391A5 (en) | Process for preparing concentrated solutions of basic dyes | |
| DE1670999A1 (de) | Triazolyl-cumarine | |
| DE2824710A1 (de) | Wasserunloesliche monoazofarbstoffe | |
| EP0198206A1 (de) | Azofarbstoffe | |
| EP0185620A2 (de) | Monoazoverbindungen | |
| CH523955A (de) | Verfahren zur Herstellung sulfonsäuregruppenfreier Azoverbindungen | |
| AT226855B (de) | Verfahren zur Herstellung neuer basischer Hydrazonfarbstoffe | |
| DE1644115A1 (de) | Neue Monoazofarbstoffpigmente und Verfahren zu deren Herstellung |