DE2112085A1 - Elektromagnetisches Relais - Google Patents
Elektromagnetisches RelaisInfo
- Publication number
- DE2112085A1 DE2112085A1 DE19712112085 DE2112085A DE2112085A1 DE 2112085 A1 DE2112085 A1 DE 2112085A1 DE 19712112085 DE19712112085 DE 19712112085 DE 2112085 A DE2112085 A DE 2112085A DE 2112085 A1 DE2112085 A1 DE 2112085A1
- Authority
- DE
- Germany
- Prior art keywords
- armature
- relay
- yoke
- actuation
- bobbin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004804 winding Methods 0.000 claims description 16
- 238000003780 insertion Methods 0.000 claims description 6
- 230000037431 insertion Effects 0.000 claims description 6
- 239000011810 insulating material Substances 0.000 claims description 6
- 238000001746 injection moulding Methods 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 230000005284 excitation Effects 0.000 claims description 3
- 230000000630 rising effect Effects 0.000 claims description 3
- 241000700647 Variola virus Species 0.000 claims description 2
- 239000000853 adhesive Substances 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 238000005755 formation reaction Methods 0.000 claims description 2
- 230000035699 permeability Effects 0.000 claims description 2
- 239000004744 fabric Substances 0.000 claims 1
- 238000011161 development Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000010276 construction Methods 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- PMVSDNDAUGGCCE-TYYBGVCCSA-L Ferrous fumarate Chemical compound [Fe+2].[O-]C(=O)\C=C\C([O-])=O PMVSDNDAUGGCCE-TYYBGVCCSA-L 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000005553 drilling Methods 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 238000012549 training Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H51/00—Electromagnetic relays
- H01H51/02—Non-polarised relays
- H01H51/20—Non-polarised relays with two or more independent armatures
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Electromagnets (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712112085 DE2112085A1 (de) | 1971-03-12 | 1971-03-12 | Elektromagnetisches Relais |
| CH206172A CH543808A (de) | 1971-03-12 | 1972-02-14 | Elektromagnetisches Relais |
| AT130872A AT322003B (de) | 1971-03-12 | 1972-02-17 | Elektromagnetisches relais |
| GB801472A GB1339872A (en) | 1971-03-12 | 1972-02-22 | Electromagnetic relays |
| NL7202945A NL7202945A (https=) | 1971-03-12 | 1972-03-06 | |
| ZA721575A ZA721575B (en) | 1971-03-12 | 1972-03-08 | Improvements in or relating to electromagnetic relays |
| US00232796A US3801940A (en) | 1971-03-12 | 1972-03-08 | Electromagnetic relay |
| BR1352/72A BR7201352D0 (pt) | 1971-03-12 | 1972-03-09 | Rele eletromagnetico |
| LU64941D LU64941A1 (https=) | 1971-03-12 | 1972-03-10 | |
| FR7208409A FR2128817B1 (https=) | 1971-03-12 | 1972-03-10 | |
| BE780524A BE780524A (fr) | 1971-03-12 | 1972-03-10 | Relais electromagnetique |
| IT21668/72A IT950059B (it) | 1971-03-12 | 1972-03-10 | Rele elettromagnetico |
| SE7203187A SE385252B (sv) | 1971-03-12 | 1972-03-13 | Elektromagnetiskt rele |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712112085 DE2112085A1 (de) | 1971-03-12 | 1971-03-12 | Elektromagnetisches Relais |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2112085A1 true DE2112085A1 (de) | 1972-09-14 |
Family
ID=5801410
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712112085 Pending DE2112085A1 (de) | 1971-03-12 | 1971-03-12 | Elektromagnetisches Relais |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3801940A (https=) |
| AT (1) | AT322003B (https=) |
| BE (1) | BE780524A (https=) |
| BR (1) | BR7201352D0 (https=) |
| CH (1) | CH543808A (https=) |
| DE (1) | DE2112085A1 (https=) |
| FR (1) | FR2128817B1 (https=) |
| GB (1) | GB1339872A (https=) |
| IT (1) | IT950059B (https=) |
| LU (1) | LU64941A1 (https=) |
| NL (1) | NL7202945A (https=) |
| SE (1) | SE385252B (https=) |
| ZA (1) | ZA721575B (https=) |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2407184A1 (de) * | 1974-02-15 | 1975-08-28 | Schaltbau Gmbh | Elektromagnetisches relais mit zwei ankern |
| DE2625203A1 (de) * | 1976-06-04 | 1977-12-08 | Sauer Hans | Polarisiertes elektromagnetisches relais |
| DE2626752A1 (de) * | 1976-06-15 | 1977-12-22 | Bbc Brown Boveri & Cie | Bistabiles, elektromagnetisches kraftschaltglied kleiner bauart |
| DE2647203A1 (de) * | 1976-10-19 | 1978-04-27 | Siemens Ag | Elektromagnetisches miniaturrelais |
| DE3414731A1 (de) * | 1984-04-18 | 1985-10-24 | Hengstler GmbH, Geschäftsbereich Haller-Relais, 7209 Wehingen | Kleinstrelais |
| DE3545356A1 (de) * | 1985-12-20 | 1987-06-25 | Siemens Ag | Sicherheits-schaltrelais |
| EP0213066A3 (de) * | 1985-08-22 | 1988-03-30 | Paul & Siedler GmbH & Co KG | Elektromagnetisches Relais |
| EP0213065A3 (de) * | 1985-08-22 | 1988-03-30 | Paul & Siedler GmbH & Co KG | Elektromagnetisches Relais |
| DE3644113A1 (de) * | 1986-12-23 | 1988-07-07 | Bbc Brown Boveri & Cie | Elektromagnetischer antrieb fuer ein schaltgeraet sowie herstellungsverfahren fuer einen anschlussbereit bestueckten spulenkoerper dieses antriebes |
| DE3644172A1 (de) * | 1986-12-23 | 1988-07-07 | Bbc Brown Boveri & Cie | Elektromagnetischer schalterantrieb fuer ein elektrisches schaltgeraet |
| DE19502322C1 (de) * | 1995-01-26 | 1996-05-09 | Kloeckner Moeller Gmbh | Klappanker-Magnetantrieb für elektrische Schaltgeräte und Verfahren zu seiner Vormontage |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2614942A1 (de) * | 1976-04-07 | 1977-10-20 | Ernst Duerr | Elektromagnetisches kleinschaltrelais |
| US4682133A (en) * | 1985-08-14 | 1987-07-21 | Siemens Aktiengesellschaft | Electro-magnetic relay having two armatures |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB302107A (en) * | 1928-04-19 | 1928-12-13 | Frank Whipp | Improvements in automatic electric cut-in and cut-out switches for battery charging systems |
| US3184563A (en) * | 1960-12-09 | 1965-05-18 | Int Standard Electric Corp | Magnetically controlled reed switching device |
| SE334420B (https=) * | 1969-05-30 | 1971-04-26 | Ericsson Telefon Ab L M |
-
1971
- 1971-03-12 DE DE19712112085 patent/DE2112085A1/de active Pending
-
1972
- 1972-02-14 CH CH206172A patent/CH543808A/de not_active IP Right Cessation
- 1972-02-17 AT AT130872A patent/AT322003B/de not_active IP Right Cessation
- 1972-02-22 GB GB801472A patent/GB1339872A/en not_active Expired
- 1972-03-06 NL NL7202945A patent/NL7202945A/xx unknown
- 1972-03-08 ZA ZA721575A patent/ZA721575B/xx unknown
- 1972-03-08 US US00232796A patent/US3801940A/en not_active Expired - Lifetime
- 1972-03-09 BR BR1352/72A patent/BR7201352D0/pt unknown
- 1972-03-10 FR FR7208409A patent/FR2128817B1/fr not_active Expired
- 1972-03-10 LU LU64941D patent/LU64941A1/xx unknown
- 1972-03-10 IT IT21668/72A patent/IT950059B/it active
- 1972-03-10 BE BE780524A patent/BE780524A/xx unknown
- 1972-03-13 SE SE7203187A patent/SE385252B/xx unknown
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2407184A1 (de) * | 1974-02-15 | 1975-08-28 | Schaltbau Gmbh | Elektromagnetisches relais mit zwei ankern |
| DE2625203A1 (de) * | 1976-06-04 | 1977-12-08 | Sauer Hans | Polarisiertes elektromagnetisches relais |
| DE2626752A1 (de) * | 1976-06-15 | 1977-12-22 | Bbc Brown Boveri & Cie | Bistabiles, elektromagnetisches kraftschaltglied kleiner bauart |
| DE2647203A1 (de) * | 1976-10-19 | 1978-04-27 | Siemens Ag | Elektromagnetisches miniaturrelais |
| DE3414731A1 (de) * | 1984-04-18 | 1985-10-24 | Hengstler GmbH, Geschäftsbereich Haller-Relais, 7209 Wehingen | Kleinstrelais |
| US4618842A (en) * | 1984-04-18 | 1986-10-21 | Wolfgang Nestlen | Miniature relay |
| EP0213066A3 (de) * | 1985-08-22 | 1988-03-30 | Paul & Siedler GmbH & Co KG | Elektromagnetisches Relais |
| EP0213065A3 (de) * | 1985-08-22 | 1988-03-30 | Paul & Siedler GmbH & Co KG | Elektromagnetisches Relais |
| DE3545356A1 (de) * | 1985-12-20 | 1987-06-25 | Siemens Ag | Sicherheits-schaltrelais |
| DE3644113A1 (de) * | 1986-12-23 | 1988-07-07 | Bbc Brown Boveri & Cie | Elektromagnetischer antrieb fuer ein schaltgeraet sowie herstellungsverfahren fuer einen anschlussbereit bestueckten spulenkoerper dieses antriebes |
| DE3644172A1 (de) * | 1986-12-23 | 1988-07-07 | Bbc Brown Boveri & Cie | Elektromagnetischer schalterantrieb fuer ein elektrisches schaltgeraet |
| DE19502322C1 (de) * | 1995-01-26 | 1996-05-09 | Kloeckner Moeller Gmbh | Klappanker-Magnetantrieb für elektrische Schaltgeräte und Verfahren zu seiner Vormontage |
Also Published As
| Publication number | Publication date |
|---|---|
| CH543808A (de) | 1973-10-31 |
| FR2128817B1 (https=) | 1978-03-03 |
| LU64941A1 (https=) | 1972-07-07 |
| FR2128817A1 (https=) | 1972-10-20 |
| BE780524A (fr) | 1972-09-11 |
| ZA721575B (en) | 1972-12-27 |
| AT322003B (de) | 1975-04-25 |
| IT950059B (it) | 1973-06-20 |
| GB1339872A (en) | 1973-12-05 |
| SE385252B (sv) | 1976-06-14 |
| US3801940A (en) | 1974-04-02 |
| BR7201352D0 (pt) | 1973-07-10 |
| NL7202945A (https=) | 1972-09-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE60025552T2 (de) | Koaxiales Relais | |
| EP0078324A1 (de) | Polarisiertes elektromagnetisches relais | |
| DE2112085A1 (de) | Elektromagnetisches Relais | |
| DE2217218C2 (de) | Kontaktfedersatz für ein elektromagnetisches Karten-Relais in Flachbauweise und Verfahren zur Herstellung desselben | |
| DE2537462A1 (de) | Elektromagnetisches schuetz | |
| DE202010008762U1 (de) | Elektrische Anschlussvorrichtung | |
| DE3220040C2 (de) | Elektromagnetisches Schaltschütz | |
| DE2165384A1 (https=) | ||
| DE3025814C2 (de) | Elektromagnetisches Relais | |
| EP0308819A2 (de) | Elektromagnetisches Relais | |
| DE3209198A1 (de) | Elektromagnetisches relais | |
| DE3002899C2 (de) | Tonabnehmersystem mit beweglicher Spule | |
| DE1564220B1 (de) | Miniaturisiertes flachrelais | |
| DE3888070T2 (de) | Elektromagnetisches Relais. | |
| DE2448111B2 (de) | Anordnung zum anschluss elektrischer leitungen an ein elektrisches geraet | |
| DE3047608A1 (de) | Elektromagnetisches relais und verfahren zur seiner herstellung | |
| DE2654111C2 (https=) | ||
| DE2625203C3 (de) | Polarisiertes elektromagnetisches Kleinrelais | |
| DE2146407C3 (de) | Flachrelais in Miniaturbauweise | |
| DE2420034A1 (de) | Elektromagnetisches schaltgeraet | |
| DE3046947C2 (https=) | ||
| DE3233254A1 (de) | Elektromagnetisches relais und verfahren zu seiner herstellung | |
| DE3328684C1 (de) | Ankerhaltefeder für DIL-Relais | |
| DE1638899B1 (de) | Als drosselspule oder transformator ausgebildetesvorschaltgeraet | |
| DE1589995A1 (de) | Elektrisches Relais |