DE2063199C3 - Einrichtung zur Ausführung logischer Funktionen - Google Patents
Einrichtung zur Ausführung logischer FunktionenInfo
- Publication number
- DE2063199C3 DE2063199C3 DE2063199A DE2063199A DE2063199C3 DE 2063199 C3 DE2063199 C3 DE 2063199C3 DE 2063199 A DE2063199 A DE 2063199A DE 2063199 A DE2063199 A DE 2063199A DE 2063199 C3 DE2063199 C3 DE 2063199C3
- Authority
- DE
- Germany
- Prior art keywords
- variables
- matrix
- function
- functions
- logic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000006870 function Effects 0.000 title claims description 97
- 239000011159 matrix material Substances 0.000 claims description 58
- 230000014509 gene expression Effects 0.000 description 14
- 230000009467 reduction Effects 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 2
- LFVLUOAHQIVABZ-UHFFFAOYSA-N Iodofenphos Chemical compound COP(=S)(OC)OC1=CC(Cl)=C(I)C=C1Cl LFVLUOAHQIVABZ-UHFFFAOYSA-N 0.000 description 1
- 102100028787 Tumor necrosis factor receptor superfamily member 11A Human genes 0.000 description 1
- 101710178436 Tumor necrosis factor receptor superfamily member 11A Proteins 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/177—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form
Landscapes
- Physics & Mathematics (AREA)
- Mathematical Physics (AREA)
- Engineering & Computer Science (AREA)
- Computer Hardware Design (AREA)
- Computing Systems (AREA)
- General Engineering & Computer Science (AREA)
- Logic Circuits (AREA)
- Complex Calculations (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US88902469A | 1969-12-30 | 1969-12-30 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2063199A1 DE2063199A1 (de) | 1971-07-08 |
| DE2063199B2 DE2063199B2 (de) | 1974-02-28 |
| DE2063199C3 true DE2063199C3 (de) | 1974-09-26 |
Family
ID=25394372
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2063199A Expired DE2063199C3 (de) | 1969-12-30 | 1970-12-22 | Einrichtung zur Ausführung logischer Funktionen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3593317A (enExample) |
| JP (1) | JPS5040903B1 (enExample) |
| CA (1) | CA935928A (enExample) |
| CH (1) | CH512110A (enExample) |
| DE (1) | DE2063199C3 (enExample) |
| FR (1) | FR2072117B1 (enExample) |
| NL (1) | NL171401C (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3761902A (en) * | 1971-12-30 | 1973-09-25 | Ibm | Functional memory using multi-state associative cells |
| US3760368A (en) * | 1972-04-21 | 1973-09-18 | Ibm | Vector information shifting array |
| US3790959A (en) * | 1972-06-26 | 1974-02-05 | Burroughs Corp | Capacitive read only memory |
| DE2321200C3 (de) * | 1973-04-26 | 1984-01-26 | Siemens AG, 1000 Berlin und 8000 München | Schaltungsanordnung zur Durchführung logischer, durch Boolesche Gleichungen dargestellter Verknüpfungen |
| DE2401645C2 (de) * | 1974-01-15 | 1982-09-09 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Vorrichtung zur Abgabe von Steuersignalen an eine Schaltungsanordnung |
| US3924243A (en) * | 1974-08-06 | 1975-12-02 | Ibm | Cross-field-partitioning in array logic modules |
| US4063080A (en) * | 1976-06-30 | 1977-12-13 | International Business Machines Corporation | Method of propagation delay testing a level sensitive array logic system |
| US4123669A (en) * | 1977-09-08 | 1978-10-31 | International Business Machines Corporation | Logical OR circuit for programmed logic arrays |
| US4438427A (en) | 1978-07-20 | 1984-03-20 | Fujitsu Limited | Decoder and method utilizing partial and redundant decoding |
| DE2846686C2 (de) * | 1978-10-26 | 1984-07-19 | Siemens AG, 1000 Berlin und 8000 München | Programmierbares Schaltwerk |
| US4506341A (en) * | 1982-06-10 | 1985-03-19 | International Business Machines Corporation | Interlaced programmable logic array having shared elements |
| US4600846A (en) * | 1983-10-06 | 1986-07-15 | Sanders Associates, Inc. | Universal logic circuit modules |
| EP0365733B1 (en) * | 1988-10-28 | 1994-01-05 | International Business Machines Corporation | Reprogrammable logic fuse based on a 6-device SRAM cell for logic arrays |
| US4942319A (en) * | 1989-01-19 | 1990-07-17 | National Semiconductor Corp. | Multiple page programmable logic architecture |
| US5021689A (en) * | 1989-01-19 | 1991-06-04 | National Semiconductor Corp. | Multiple page programmable logic architecture |
| US5081375A (en) * | 1989-01-19 | 1992-01-14 | National Semiconductor Corp. | Method for operating a multiple page programmable logic device |
| US5055712A (en) * | 1990-04-05 | 1991-10-08 | National Semiconductor Corp. | Register file with programmable control, decode and/or data manipulation |
| JP5203594B2 (ja) * | 2006-11-07 | 2013-06-05 | 株式会社東芝 | 暗号処理回路及び暗号処理方法 |
| JP4851947B2 (ja) * | 2007-01-29 | 2012-01-11 | 株式会社東芝 | 論理回路 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3212064A (en) * | 1961-11-27 | 1965-10-12 | Sperry Rand Corp | Matrix having thin magnetic film logical gates for transferring signals from plural input means to plural output means |
| US3210737A (en) * | 1962-01-29 | 1965-10-05 | Sylvania Electric Prod | Electronic data processing |
| US3274556A (en) * | 1962-07-10 | 1966-09-20 | Ibm | Large scale shifter |
| US3311896A (en) * | 1964-04-03 | 1967-03-28 | Ibm | Data shifting apparatus |
| US3383661A (en) * | 1964-09-30 | 1968-05-14 | Bell Telephone Labor Inc | Arrangement for generating permutations |
| GB1101851A (en) * | 1965-01-20 | 1968-01-31 | Ncr Co | Generalized logic circuitry |
| US3371320A (en) * | 1965-03-12 | 1968-02-27 | Sperry Rand Corp | Multipurpose matrix |
-
1969
- 1969-12-30 US US889024A patent/US3593317A/en not_active Expired - Lifetime
-
1970
- 1970-11-19 FR FR707044226A patent/FR2072117B1/fr not_active Expired
- 1970-12-08 CA CA100064A patent/CA935928A/en not_active Expired
- 1970-12-14 NL NLAANVRAGE7018172,A patent/NL171401C/xx not_active IP Right Cessation
- 1970-12-15 JP JP45111370A patent/JPS5040903B1/ja active Pending
- 1970-12-22 DE DE2063199A patent/DE2063199C3/de not_active Expired
- 1970-12-28 CH CH1918470A patent/CH512110A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2072117B1 (enExample) | 1973-02-02 |
| FR2072117A1 (enExample) | 1971-09-24 |
| US3593317A (en) | 1971-07-13 |
| NL171401C (nl) | 1983-03-16 |
| NL171401B (nl) | 1982-10-18 |
| DE2063199B2 (de) | 1974-02-28 |
| NL7018172A (enExample) | 1971-07-02 |
| CH512110A (de) | 1971-08-31 |
| CA935928A (en) | 1973-10-23 |
| DE2063199A1 (de) | 1971-07-08 |
| JPS5040903B1 (enExample) | 1975-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2063199C3 (de) | Einrichtung zur Ausführung logischer Funktionen | |
| DE2912287C3 (de) | Datenverarbeitungsanlage | |
| DE1901343C3 (de) | Datenverarbeitungsanlage zur Ausführung von Mateirenrechnungen | |
| DE2354521A1 (de) | Verfahren und einrichtung zum gleichzeitigen zugriff zu verschiedenen speichermoduln | |
| DE1269393B (de) | Mikroprogramm-Steuerwerk | |
| DE1193996B (de) | Schiebespeicher mit Steuervorrichtung | |
| DE3788617T2 (de) | Vektordatenverarbeitungssystem mit einer E/A-Steuerung für jeden Vektordatenprozessor und einer anderen E/A-Steuerung für mindestens einen anderen Vektordatenprozessor. | |
| DE3507584C2 (enExample) | ||
| DE2926048A1 (de) | Verschiebe-rechenwerk | |
| EP0178424A2 (de) | Zellenstrukturierter digitaler Multiplizierer mit semisystolischem Aufbau | |
| DE1271433B (de) | Adressiereinrichtung fuer einen Tabellenwertspeicher | |
| DE69603618T2 (de) | System zur rekonfiguration der länge eines xyram-speicher | |
| DE2245284A1 (de) | Datenverarbeitungsanlage | |
| DE2451235A1 (de) | Schaltungsanordnung fuer ein digitales filter | |
| DE3878666T2 (de) | Integrierte schaltung fuer digitale rechenvorgaenge zur faltung oder aehnlichen rechenverfahren. | |
| DE1774571A1 (de) | Divisionseinrichtung | |
| DE2233164B2 (de) | Schaltungsanordnung zur uebertragung von aufeinanderfolgenden bitstellen zwischen zwei registern | |
| EP0333884B1 (de) | CMOS-Parallel-Serien-Multiplizierschaltung sowie deren Multiplizier- und Addierstufen | |
| DE69325786T2 (de) | Prozessor für gleichförmige Operationen auf Datenreihenfolgen in entsprechenden parallelen Datenströmen | |
| DE69128661T2 (de) | Verfahren und Anordnung zur Vektorverarbeitung | |
| DE1094020B (de) | Periodisch arbeitende numerische Rechenmaschine | |
| EP0433315A1 (de) | Schaltungsanordnung zur addition oder subtraktion von im bcd-code oder dual-code codierten operanden | |
| DE68923355T2 (de) | Künstliche neuronale integrierte Schaltung mit Lernmitteln. | |
| DE2952689A1 (de) | Programmierbarer lesespeicher-addierer | |
| DE2508141A1 (de) | Verfahren zur transformation von reellen zahlen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |