DE2052971A1 - - Google Patents
Info
- Publication number
- DE2052971A1 DE2052971A1 DE19702052971 DE2052971A DE2052971A1 DE 2052971 A1 DE2052971 A1 DE 2052971A1 DE 19702052971 DE19702052971 DE 19702052971 DE 2052971 A DE2052971 A DE 2052971A DE 2052971 A1 DE2052971 A1 DE 2052971A1
- Authority
- DE
- Germany
- Prior art keywords
- insert
- opening
- projection
- teat cup
- projections
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000037431 insertion Effects 0.000 claims 2
- 238000003780 insertion Methods 0.000 claims 2
- 210000002445 nipple Anatomy 0.000 description 20
- 239000008267 milk Substances 0.000 description 11
- 210000004080 milk Anatomy 0.000 description 11
- 235000013336 milk Nutrition 0.000 description 11
- 210000000078 claw Anatomy 0.000 description 4
- KRQUFUKTQHISJB-YYADALCUSA-N 2-[(E)-N-[2-(4-chlorophenoxy)propoxy]-C-propylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one Chemical compound CCC\C(=N/OCC(C)OC1=CC=C(Cl)C=C1)C1=C(O)CC(CC1=O)C1CCCSC1 KRQUFUKTQHISJB-YYADALCUSA-N 0.000 description 1
- 101100327917 Caenorhabditis elegans chup-1 gene Proteins 0.000 description 1
- 101100421569 Leptosphaeria maculans sirZ gene Proteins 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01J—MANUFACTURE OF DAIRY PRODUCTS
- A01J5/00—Milking machines or devices
- A01J5/04—Milking machines or devices with pneumatic manipulation of teats
- A01J5/08—Teat-cups with two chambers
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Animal Husbandry (AREA)
- Environmental Sciences (AREA)
- External Artificial Organs (AREA)
- Self-Closing Valves And Venting Or Aerating Valves (AREA)
- Dairy Products (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US87536069A | 1969-11-10 | 1969-11-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2052971A1 true DE2052971A1 (enExample) | 1971-07-22 |
Family
ID=25365667
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702052971 Pending DE2052971A1 (enExample) | 1969-11-10 | 1970-10-28 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3611993A (enExample) |
| CA (1) | CA922259A (enExample) |
| DE (1) | DE2052971A1 (enExample) |
| DK (1) | DK128801B (enExample) |
| FR (1) | FR2069236A5 (enExample) |
| GB (1) | GB1265633A (enExample) |
| NL (1) | NL7016140A (enExample) |
| SE (1) | SE361401B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2241233A1 (de) * | 1972-08-22 | 1974-03-07 | Syd Ernest Bodmin | Pulsator fuer melkmaschinen |
| DE3022555A1 (de) * | 1980-06-16 | 1982-01-07 | Happel, Fritz, 8951 Baisweil | Vorrichtung zur periodischen einsteuerung von luft in den innenraum eines melkbechers und damit ausgeruesteter melkbecher |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE428411B (sv) * | 1975-05-27 | 1983-07-04 | Kunzler & Co | Spenkopp |
| SE404286B (sv) * | 1977-02-22 | 1978-10-02 | Alfa Laval Ab | Stotdempare for spengummi |
| US4303038A (en) * | 1980-02-21 | 1981-12-01 | Babson Bros. Co. | Teat cup with air inlet |
| EP0052637B1 (de) * | 1980-05-28 | 1986-04-16 | HAPPEL, Fritz | Zweiraummelkbecher |
| US4756275A (en) * | 1985-10-31 | 1988-07-12 | Larson Leigh R | Milking inflation |
| GB8611471D0 (en) * | 1986-05-10 | 1986-06-18 | Ambic Equip Ltd | Automatic milking apparatus |
| US4936254A (en) * | 1986-05-10 | 1990-06-26 | Ambic Equipment Limited | Automatic milking apparatus |
| US4745881A (en) * | 1986-09-08 | 1988-05-24 | Larson Reed A | Milking inflation |
| US4869205A (en) * | 1988-06-03 | 1989-09-26 | Hi-Life Rubber Inc. | Milking machine inflation |
| GB2244417B (en) * | 1990-06-01 | 1994-01-26 | Nat Res Dev | Automatic milking apparatus |
| US5080041A (en) * | 1990-08-30 | 1992-01-14 | Dec International, Inc. | Pre-curved milk tube |
| US5178095A (en) * | 1991-06-13 | 1993-01-12 | Dec International, Inc. | Milking system with positive pressure on thin liner |
| US5482004A (en) * | 1994-05-16 | 1996-01-09 | Alfa Laval Agri, Inc. | Collapsible teat liner with reinforced barrel |
| US5493995A (en) * | 1994-05-16 | 1996-02-27 | Alfa Laval Agri, Inc. | Collapsing teat cup liner with tapering barrel wall |
| CA2570327C (en) * | 2004-06-29 | 2013-11-26 | Lauren Agrisystems, Ltd. | Milking liner |
| RU2284100C1 (ru) * | 2005-03-09 | 2006-09-27 | ФГОУ ВПО "Белгородская государственная сельскохозяйственная академия" | Доильный аппарат |
| DE102007014535B4 (de) * | 2006-09-13 | 2010-12-09 | Gea Westfaliasurge Gmbh | Zitzengummi sowie Melkbecher mit einer Belüftungsdüse |
| BRPI0818347A2 (pt) * | 2007-10-08 | 2014-09-23 | Delaval Holding Ab | Elemento tubular e método para fabricação do mesmo |
| US20110107971A1 (en) * | 2008-07-16 | 2011-05-12 | Delaval Holding Ab | Milking system, a teat cup and a teat cup liner |
| US8302561B2 (en) * | 2009-08-11 | 2012-11-06 | Lauren Agrisystems, Ltd. | Teat cup shell |
| US8056505B2 (en) * | 2009-12-08 | 2011-11-15 | Lauren Agrisystems, Ltd. | Vent for milking liner |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US807372A (en) * | 1905-06-26 | 1905-12-12 | Alexander Gillies | Pneumatic teat-cup. |
| US1393781A (en) * | 1919-06-03 | 1921-10-18 | Palmer B Hewlett | Milking-machine |
| US1839765A (en) * | 1928-12-07 | 1932-01-05 | George Harry Gascoigne | Teat cup of milking machines |
| US3255732A (en) * | 1964-09-28 | 1966-06-14 | John W Raht | Method and apparatus for teat cup inflation control in machine milking |
| DE1299165B (de) * | 1966-06-06 | 1969-07-10 | Maier Jakob | Melkbecher fuer Melkmaschinen |
-
1969
- 1969-11-10 US US875360A patent/US3611993A/en not_active Expired - Lifetime
-
1970
- 1970-10-16 SE SE13967/70A patent/SE361401B/xx unknown
- 1970-10-28 DE DE19702052971 patent/DE2052971A1/de active Pending
- 1970-11-02 CA CA097163A patent/CA922259A/en not_active Expired
- 1970-11-04 NL NL7016140A patent/NL7016140A/xx unknown
- 1970-11-09 DK DK567870AA patent/DK128801B/da unknown
- 1970-11-10 GB GB1265633D patent/GB1265633A/en not_active Expired
- 1970-11-10 FR FR7040403A patent/FR2069236A5/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2241233A1 (de) * | 1972-08-22 | 1974-03-07 | Syd Ernest Bodmin | Pulsator fuer melkmaschinen |
| DE3022555A1 (de) * | 1980-06-16 | 1982-01-07 | Happel, Fritz, 8951 Baisweil | Vorrichtung zur periodischen einsteuerung von luft in den innenraum eines melkbechers und damit ausgeruesteter melkbecher |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2069236A5 (enExample) | 1971-09-03 |
| NL7016140A (enExample) | 1971-05-12 |
| SE361401B (enExample) | 1973-11-05 |
| CA922259A (en) | 1973-03-06 |
| GB1265633A (enExample) | 1972-03-01 |
| US3611993A (en) | 1971-10-12 |
| DK128801B (da) | 1974-07-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2052971A1 (enExample) | ||
| DE69006460T2 (de) | Melkbecher für eine hydraulische Melkmaschine. | |
| DE69609593T2 (de) | Schnellverbindung mit entkupplung in zwei stufen | |
| DE3023583A1 (de) | Tauchrohr und ventil mit schnelltrennkupplung fuer einen zusammenlegbaren behaelter | |
| DE20016859U1 (de) | Nasenspritze | |
| EP1222853A2 (de) | Verfahren und Vorrichtung zum Melken | |
| DE69304713T2 (de) | Automatische melkanlagen | |
| DE3587629T2 (de) | Automatische Melkanlage. | |
| EP0064949A1 (de) | Behälterverschluss für aufsetzbare Abzapfvorrichtungen | |
| WO1991017386A1 (de) | Reinigbare molchstation | |
| DE69207061T2 (de) | Milchbecher und Milchzeuge mit einem oder mehreren solcher Milchbecher und automatische Milchmaschine | |
| DE2251263A1 (de) | Zapfanordnung fuer bierfaesser und dergl | |
| DE1650212A1 (de) | Schnellanschlussvorrichtung fuer Rohrleitungen und aehnliche Anwendungen | |
| DE3152153A1 (en) | Improvement in self-closing closures | |
| DE2524397A1 (de) | Vorrichtung zum reduzieren des unterdrucks in einer melkmaschine | |
| DE29923420U1 (de) | Backofen mit Vorratsbehälter für eine Flüssigkeit | |
| DE2838705C3 (de) | Sammelstück | |
| DE4312799B4 (de) | Verfahren zur Ermittlung der optimalen Grösse von Vakuumventilen sowie Vorrichtung zur Herstellung von Gußteilen | |
| DE69202645T2 (de) | Vorrichtung aufsetzbar auf einen Behälter, insbesondere für chemische Reaktionen, Reaktor mit einer solchen Vorrichtung und Anwendung dieses Reaktors. | |
| DE3022555C2 (de) | Zweiraum-Melkbecher | |
| DE102016215633B4 (de) | Melkbecherhülse und modulares Melkbecherhülsensystem | |
| DE69000599T2 (de) | Fluessigkeitsspeicher. | |
| DE19507640C1 (de) | Aufsteckbarer Wasserhahnadapter | |
| DE1125222B (de) | Melkbecherhuelse | |
| DE811296C (de) | Deckel fuer haengende Melkmaschinen |