DE2050901C3 - Wasserlösliche Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben und Bedrucken von Wolle, Seide, Polyamiden oder Zellulose - Google Patents
Wasserlösliche Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben und Bedrucken von Wolle, Seide, Polyamiden oder ZelluloseInfo
- Publication number
- DE2050901C3 DE2050901C3 DE19702050901 DE2050901A DE2050901C3 DE 2050901 C3 DE2050901 C3 DE 2050901C3 DE 19702050901 DE19702050901 DE 19702050901 DE 2050901 A DE2050901 A DE 2050901A DE 2050901 C3 DE2050901 C3 DE 2050901C3
- Authority
- DE
- Germany
- Prior art keywords
- hydroxy
- sulfonic acid
- pyridone
- group
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 239000000987 azo dye Substances 0.000 title claims description 14
- 230000008569 process Effects 0.000 title claims description 7
- 210000002268 wool Anatomy 0.000 title description 12
- 238000004043 dyeing Methods 0.000 title description 10
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000004952 Polyamide Substances 0.000 title description 4
- 229920002647 polyamide Polymers 0.000 title description 4
- 229920002678 cellulose Polymers 0.000 title description 3
- 239000001913 cellulose Substances 0.000 title description 3
- 239000000975 dye Substances 0.000 claims description 87
- -1 phenylsulphonyl Chemical group 0.000 claims description 56
- 230000008878 coupling Effects 0.000 claims description 40
- 238000010168 coupling process Methods 0.000 claims description 40
- 238000005859 coupling reaction Methods 0.000 claims description 40
- 239000002253 acid Substances 0.000 claims description 31
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 31
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 11
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 10
- 239000010949 copper Substances 0.000 claims description 10
- 230000007935 neutral effect Effects 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 7
- 229910052802 copper Inorganic materials 0.000 claims description 7
- 150000001989 diazonium salts Chemical class 0.000 claims description 7
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical class NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 229910017052 cobalt Inorganic materials 0.000 claims description 6
- 239000010941 cobalt Substances 0.000 claims description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- 229910052759 nickel Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical class O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 claims description 4
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 4
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical class C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 claims description 4
- VJWXIRQLLGYIDI-UHFFFAOYSA-N 4,5-dichloro-1h-pyridazin-6-one Chemical group OC1=NN=CC(Cl)=C1Cl VJWXIRQLLGYIDI-UHFFFAOYSA-N 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000001844 chromium Chemical class 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 3
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 3
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- MULACHJJELFHNJ-UHFFFAOYSA-N 3-amino-2-phenyldiazenylnaphthalene-1-sulfonic acid Chemical class NC=1C(=C(C2=CC=CC=C2C=1)S(=O)(=O)O)N=NC1=CC=CC=C1 MULACHJJELFHNJ-UHFFFAOYSA-N 0.000 claims description 2
- GSIQSSVWHLJLBR-UHFFFAOYSA-N 3-aminonaphthalene-1,2-disulfonic acid Chemical class C1=CC=C2C(S(O)(=O)=O)=C(S(O)(=O)=O)C(N)=CC2=C1 GSIQSSVWHLJLBR-UHFFFAOYSA-N 0.000 claims description 2
- WGLQHUKCXBXUDV-UHFFFAOYSA-N 3-aminophthalic acid Chemical class NC1=CC=CC(C(O)=O)=C1C(O)=O WGLQHUKCXBXUDV-UHFFFAOYSA-N 0.000 claims description 2
- AKTKBYZZTJZZPY-UHFFFAOYSA-N 4-amino-1,3-benzothiazole-2-sulfonic acid Chemical class NC1=CC=CC2=C1N=C(S(O)(=O)=O)S2 AKTKBYZZTJZZPY-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- ZAMOJKJKCBOKFV-UHFFFAOYSA-N aniline;sulfamide Chemical class NS(N)(=O)=O.NC1=CC=CC=C1 ZAMOJKJKCBOKFV-UHFFFAOYSA-N 0.000 claims description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- DELFPZLNAZAZRE-UHFFFAOYSA-N phenyl 2-aminobenzenesulfonate Chemical class NC1=CC=CC=C1S(=O)(=O)OC1=CC=CC=C1 DELFPZLNAZAZRE-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 150000003254 radicals Chemical class 0.000 description 26
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 19
- 235000011121 sodium hydroxide Nutrition 0.000 description 16
- 235000002639 sodium chloride Nutrition 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 239000000985 reactive dye Substances 0.000 description 13
- 235000019233 fast yellow AB Nutrition 0.000 description 12
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 12
- 239000011651 chromium Substances 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 11
- 229920000742 Cotton Polymers 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000007859 condensation product Substances 0.000 description 8
- 150000008049 diazo compounds Chemical class 0.000 description 8
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 7
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 235000010288 sodium nitrite Nutrition 0.000 description 6
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 5
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 5
- 229910052804 chromium Inorganic materials 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 3
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 229940072056 alginate Drugs 0.000 description 3
- 235000010443 alginic acid Nutrition 0.000 description 3
- 229920000615 alginic acid Polymers 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000000976 ink Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000001465 metallisation Methods 0.000 description 3
- 239000004627 regenerated cellulose Substances 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 230000008719 thickening Effects 0.000 description 3
- 125000003396 thiol group Chemical group [H]S* 0.000 description 3
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical group CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 206010012335 Dependence Diseases 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 2
- 229940106681 chloroacetic acid Drugs 0.000 description 2
- 229910000365 copper sulfate Inorganic materials 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- WLFXSECCHULRRO-UHFFFAOYSA-N pyridine-2,6-diol Chemical class OC1=CC=CC(O)=N1 WLFXSECCHULRRO-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 238000005185 salting out Methods 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HUAUNKAZQWMVFY-UHFFFAOYSA-M sodium;oxocalcium;hydroxide Chemical compound [OH-].[Na+].[Ca]=O HUAUNKAZQWMVFY-UHFFFAOYSA-M 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 238000010025 steaming Methods 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 1
- QLRBNEZOQPLERN-UHFFFAOYSA-N (sulfonylamino)benzene Chemical compound O=S(=O)=NC1=CC=CC=C1 QLRBNEZOQPLERN-UHFFFAOYSA-N 0.000 description 1
- DFGFMGUYKGZIEJ-UHFFFAOYSA-N 1,4-diethyl-6-hydroxypyridin-2-one Chemical compound CCC=1C=C(O)N(CC)C(=O)C=1 DFGFMGUYKGZIEJ-UHFFFAOYSA-N 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 description 1
- SGTXYQQLTUJIJD-UHFFFAOYSA-N 1-cyclohexylpyridin-2-one Chemical compound O=C1C=CC=CN1C1CCCCC1 SGTXYQQLTUJIJD-UHFFFAOYSA-N 0.000 description 1
- UCMWKAYZFDLVIT-UHFFFAOYSA-N 1-ethyl-6-hydroxy-4-phenylpyridin-2-one Chemical compound O=C1N(CC)C(O)=CC(C=2C=CC=CC=2)=C1 UCMWKAYZFDLVIT-UHFFFAOYSA-N 0.000 description 1
- DVVGIUUJYPYENY-UHFFFAOYSA-N 1-methylpyridin-2-one Chemical compound CN1C=CC=CC1=O DVVGIUUJYPYENY-UHFFFAOYSA-N 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- SPSSDDOTEZKOOV-UHFFFAOYSA-N 2,3-dichloroquinoxaline Chemical compound C1=CC=C2N=C(Cl)C(Cl)=NC2=C1 SPSSDDOTEZKOOV-UHFFFAOYSA-N 0.000 description 1
- VZLILCJJQCJIRS-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=C2N=C(Cl)C(Cl)=NC2=C1 VZLILCJJQCJIRS-UHFFFAOYSA-N 0.000 description 1
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 description 1
- AHEYFWKLKMOHCI-UHFFFAOYSA-N 2,4,6-tribromopyrimidine Chemical compound BrC1=CC(Br)=NC(Br)=N1 AHEYFWKLKMOHCI-UHFFFAOYSA-N 0.000 description 1
- QGFWFWSBFMRDNP-UHFFFAOYSA-N 2,4,6-trichloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(Cl)N=C(Cl)N=C1Cl QGFWFWSBFMRDNP-UHFFFAOYSA-N 0.000 description 1
- IAJCAZVXGKGAQK-UHFFFAOYSA-N 2,4,6-trichloropyrimidine-5-carbonitrile Chemical compound ClC1=NC(Cl)=C(C#N)C(Cl)=N1 IAJCAZVXGKGAQK-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- UEDDCBVNWFONCB-UHFFFAOYSA-N 2,4-dibromopyrimidine-5-carboxylic acid Chemical compound OC(=O)C1=CN=C(Br)N=C1Br UEDDCBVNWFONCB-UHFFFAOYSA-N 0.000 description 1
- IVIHUCXXDVVSBH-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-carboxylic acid Chemical compound OC(=O)C1=CN=C(Cl)N=C1Cl IVIHUCXXDVVSBH-UHFFFAOYSA-N 0.000 description 1
- TUQSVSYUEBNNKQ-UHFFFAOYSA-N 2,4-dichloroquinazoline Chemical compound C1=CC=CC2=NC(Cl)=NC(Cl)=C21 TUQSVSYUEBNNKQ-UHFFFAOYSA-N 0.000 description 1
- FEDCEYNFGIMQOA-UHFFFAOYSA-N 2,4-dichloroquinazoline-7-sulfonyl chloride Chemical compound C1=CC(S(Cl)(=O)=O)=CC2=NC(Cl)=NC(Cl)=C21 FEDCEYNFGIMQOA-UHFFFAOYSA-N 0.000 description 1
- DACKMKIXLGNFSM-UHFFFAOYSA-N 2,4-difluoropyrimidine-5-carboxylic acid Chemical compound OC(=O)C1=CN=C(F)N=C1F DACKMKIXLGNFSM-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- JBCUKQQIWSWEOK-UHFFFAOYSA-N 2-(benzenesulfonyl)aniline Chemical compound NC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1 JBCUKQQIWSWEOK-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- BKUNPNJNMCGJFL-UHFFFAOYSA-N 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=NC(Cl)=NC(Cl)=N1 BKUNPNJNMCGJFL-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- HMENQNSSJFLQOP-UHFFFAOYSA-N 2-bromoprop-2-enoic acid Chemical compound OC(=O)C(Br)=C HMENQNSSJFLQOP-UHFFFAOYSA-N 0.000 description 1
- SZTBMYHIYNGYIA-UHFFFAOYSA-N 2-chloroacrylic acid Chemical compound OC(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-N 0.000 description 1
- NNUQEZBWGDSLCX-UHFFFAOYSA-N 2-hydrazinylbenzenesulfonic acid Chemical compound NNC1=CC=CC=C1S(O)(=O)=O NNUQEZBWGDSLCX-UHFFFAOYSA-N 0.000 description 1
- BFHKYHMCIAMQIN-UHFFFAOYSA-N 2-hydroxy-6-oxo-1h-pyridine-3-carbonitrile Chemical class OC=1NC(=O)C=CC=1C#N BFHKYHMCIAMQIN-UHFFFAOYSA-N 0.000 description 1
- YHKUFWFVZIIVDL-UHFFFAOYSA-N 3,5,6-trichloro-1,2,4-triazine Chemical compound ClC1=NN=C(Cl)C(Cl)=N1 YHKUFWFVZIIVDL-UHFFFAOYSA-N 0.000 description 1
- FRCXPDWDMAYSCE-UHFFFAOYSA-N 3,6-dichloropyridazine-4-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=NN=C1Cl FRCXPDWDMAYSCE-UHFFFAOYSA-N 0.000 description 1
- KYJFVIRRHALAEZ-UHFFFAOYSA-N 3-(2-chloroethylsulfonyl)aniline Chemical compound NC1=CC=CC(S(=O)(=O)CCCl)=C1 KYJFVIRRHALAEZ-UHFFFAOYSA-N 0.000 description 1
- WGTYYNCSWCKXAI-UHFFFAOYSA-N 3-(benzenesulfonyl)propanoic acid Chemical compound OC(=O)CCS(=O)(=O)C1=CC=CC=C1 WGTYYNCSWCKXAI-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 1
- MCLXKFUCPVGZEN-UHFFFAOYSA-N 4,6-dichloro-1,3,5-triazin-2-amine Chemical compound NC1=NC(Cl)=NC(Cl)=N1 MCLXKFUCPVGZEN-UHFFFAOYSA-N 0.000 description 1
- DROUVIKCNOHKBA-UHFFFAOYSA-N 4,6-dichloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=CC(Cl)=N1 DROUVIKCNOHKBA-UHFFFAOYSA-N 0.000 description 1
- CHIJEKAVDZLCJA-UHFFFAOYSA-N 4-[2-(4-nitrophenyl)ethenyl]aniline Chemical compound C1=CC(N)=CC=C1C=CC1=CC=C([N+]([O-])=O)C=C1 CHIJEKAVDZLCJA-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- BTCCOOALVRZZGD-UHFFFAOYSA-N 4-bromo-9,10-dioxoanthracene-2-sulfonic acid Chemical compound C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC(Br)=C3C(=O)C2=C1 BTCCOOALVRZZGD-UHFFFAOYSA-N 0.000 description 1
- MIJGJJKVYCRQNI-UHFFFAOYSA-N 4-ethenylsulfonylaniline Chemical compound NC1=CC=C(S(=O)(=O)C=C)C=C1 MIJGJJKVYCRQNI-UHFFFAOYSA-N 0.000 description 1
- URCVIZREQULREA-UHFFFAOYSA-N 4-ethenylsulfonylbutanoic acid Chemical compound OC(=O)CCCS(=O)(=O)C=C URCVIZREQULREA-UHFFFAOYSA-N 0.000 description 1
- RYZNAKCFMXPUMR-UHFFFAOYSA-N 4-ethenylsulfonylcyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCC(S(=O)(=O)C=C)CC1 RYZNAKCFMXPUMR-UHFFFAOYSA-N 0.000 description 1
- WJPHPOIVNDQZFI-UHFFFAOYSA-N 6-hydroxy-1,4-dimethylpyridin-2-one Chemical compound CC=1C=C(O)N(C)C(=O)C=1 WJPHPOIVNDQZFI-UHFFFAOYSA-N 0.000 description 1
- YJCZDRUBCGWBTL-UHFFFAOYSA-N 6-hydroxy-1-methyl-4-phenylpyridin-2-one Chemical compound O=C1N(C)C(O)=CC(C=2C=CC=CC=2)=C1 YJCZDRUBCGWBTL-UHFFFAOYSA-N 0.000 description 1
- JJHVYGVVMBYCMQ-UHFFFAOYSA-N 6-hydroxy-4-methyl-1h-pyridin-2-one Chemical compound CC=1C=C(O)NC(=O)C=1 JJHVYGVVMBYCMQ-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- ONMOULMPIIOVTQ-UHFFFAOYSA-N 98-47-5 Chemical compound OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 ONMOULMPIIOVTQ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DGXAKRVNQDBVMB-UHFFFAOYSA-N COC=1C(=NN=NC1Cl)Cl Chemical compound COC=1C(=NN=NC1Cl)Cl DGXAKRVNQDBVMB-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910004013 NO 2 Inorganic materials 0.000 description 1
- CSZJQOFFCJHDIK-UHFFFAOYSA-N O=C(C(C(CC1)(C1(F)F)F)=CCl)Cl Chemical compound O=C(C(C(CC1)(C1(F)F)F)=CCl)Cl CSZJQOFFCJHDIK-UHFFFAOYSA-N 0.000 description 1
- AYFWVPBCVOZDMA-UHFFFAOYSA-N OC1=CC(=CC(N1C)=O)CCC Chemical compound OC1=CC(=CC(N1C)=O)CCC AYFWVPBCVOZDMA-UHFFFAOYSA-N 0.000 description 1
- NQHMSMRGRSWPHL-UHFFFAOYSA-N OC1=CC(=CC(N1C)=O)CCCC Chemical compound OC1=CC(=CC(N1C)=O)CCCC NQHMSMRGRSWPHL-UHFFFAOYSA-N 0.000 description 1
- SJEYSFABYSGQBG-UHFFFAOYSA-M Patent blue Chemical compound [Na+].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 SJEYSFABYSGQBG-UHFFFAOYSA-M 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000000980 acid dye Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- BEHLMOQXOSLGHN-UHFFFAOYSA-N benzenamine sulfate Chemical compound OS(=O)(=O)NC1=CC=CC=C1 BEHLMOQXOSLGHN-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229960001506 brilliant green Drugs 0.000 description 1
- HXCILVUBKWANLN-UHFFFAOYSA-N brilliant green cation Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](CC)CC)C=C1 HXCILVUBKWANLN-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- KYRMFSOATGQQBV-UHFFFAOYSA-N chromium;2-hydroxybenzoic acid Chemical compound [Cr].OC(=O)C1=CC=CC=C1O KYRMFSOATGQQBV-UHFFFAOYSA-N 0.000 description 1
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 1
- 229940044175 cobalt sulfate Drugs 0.000 description 1
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000001335 demethylating effect Effects 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- FPVGTPBMTFTMRT-UHFFFAOYSA-L disodium;2-amino-5-[(4-sulfonatophenyl)diazenyl]benzenesulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(N)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 FPVGTPBMTFTMRT-UHFFFAOYSA-L 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 210000000744 eyelid Anatomy 0.000 description 1
- FPVGTPBMTFTMRT-NSKUCRDLSA-L fast yellow Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(N)=CC=C1\N=N\C1=CC=C(S([O-])(=O)=O)C=C1 FPVGTPBMTFTMRT-NSKUCRDLSA-L 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 229960002449 glycine Drugs 0.000 description 1
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 1
- 239000001046 green dye Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Substances CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- SQYUJKVKVFILNB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorophenyl)carbamoyl]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1C(=O)NC1=CC(Cl)=CC=C1Cl SQYUJKVKVFILNB-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- OUEDIKSSMUCCGK-UHFFFAOYSA-N n-(3-aminophenyl)-2-chloroacetamide Chemical compound NC1=CC=CC(NC(=O)CCl)=C1 OUEDIKSSMUCCGK-UHFFFAOYSA-N 0.000 description 1
- IQVSWLPEOQMCQD-UHFFFAOYSA-N n-phenylethanesulfonamide Chemical compound CCS(=O)(=O)NC1=CC=CC=C1 IQVSWLPEOQMCQD-UHFFFAOYSA-N 0.000 description 1
- 125000005184 naphthylamino group Chemical group C1(=CC=CC2=CC=CC=C12)N* 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- MKJZRZRIEWBTMN-UHFFFAOYSA-N prop-2-ynoyl chloride Chemical compound ClC(=O)C#C MKJZRZRIEWBTMN-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical compound OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
- C09B62/0067—Azodyes with heterocyclic compound as coupling component
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
- C09B29/3621—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring
- C09B29/3626—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O)
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702050901 DE2050901C3 (de) | 1970-10-16 | 1970-10-16 | Wasserlösliche Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben und Bedrucken von Wolle, Seide, Polyamiden oder Zellulose |
| NL7113459A NL7113459A (enExample) | 1970-10-16 | 1971-09-30 | |
| JP8023371A JPS5544781B1 (enExample) | 1970-10-16 | 1971-10-13 | |
| CA125,119A CA982559A (en) | 1970-10-16 | 1971-10-14 | Water-soluble azo dyes and processes for their manufacture |
| ES396041A ES396041A1 (es) | 1970-10-16 | 1971-10-15 | Procedimiento para la obtencion de colorantes azoicos. |
| BE774028A BE774028A (fr) | 1970-10-16 | 1971-10-15 | Colorants azoiques hydrosolubles et leur preparation |
| GB4811771A GB1372527A (en) | 1970-10-16 | 1971-10-15 | Water-soluble azo dyes and processes for their manufacture |
| CH1504671A CH582214A5 (enExample) | 1970-10-16 | 1971-10-15 | |
| FR7137144A FR2111668B1 (enExample) | 1970-10-16 | 1971-10-15 | |
| AT894271A AT306884B (de) | 1970-10-16 | 1971-10-15 | Verfahren zur Herstellung von neuen, gegebenenfalls metallhaltigen, wasserlöslichen Azofarbstoffen |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702050901 DE2050901C3 (de) | 1970-10-16 | 1970-10-16 | Wasserlösliche Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben und Bedrucken von Wolle, Seide, Polyamiden oder Zellulose |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2050901A1 DE2050901A1 (de) | 1972-04-20 |
| DE2050901B2 DE2050901B2 (de) | 1980-02-07 |
| DE2050901C3 true DE2050901C3 (de) | 1980-10-02 |
Family
ID=5785349
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702050901 Expired DE2050901C3 (de) | 1970-10-16 | 1970-10-16 | Wasserlösliche Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben und Bedrucken von Wolle, Seide, Polyamiden oder Zellulose |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS5544781B1 (enExample) |
| AT (1) | AT306884B (enExample) |
| BE (1) | BE774028A (enExample) |
| CA (1) | CA982559A (enExample) |
| CH (1) | CH582214A5 (enExample) |
| DE (1) | DE2050901C3 (enExample) |
| ES (1) | ES396041A1 (enExample) |
| FR (1) | FR2111668B1 (enExample) |
| GB (1) | GB1372527A (enExample) |
| NL (1) | NL7113459A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2757681C2 (de) * | 1977-12-23 | 1982-08-19 | Hoechst Ag, 6000 Frankfurt | Phenylazopyridon-Verbindung, Verfahren zu deren Herstellung, ihre Verwendung zum Färben oder Bedrucken von Fasermaterial aus natürlicher oder regenerierter Cellulose oder aus natürlichen, regenerierten oder synthetischen Polyamiden |
| DE3316887A1 (de) * | 1983-05-07 | 1984-11-08 | Agfa-Gevaert Ag, 5090 Leverkusen | Photographisches aufzeichnungsmaterial und neue azofarbstoffe |
| DE3427188A1 (de) * | 1984-07-24 | 1986-01-30 | Hoechst Ag, 6230 Frankfurt | Wasserloesliche pyridon-monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| GB2200364B (en) * | 1987-01-31 | 1990-12-19 | Sandoz Ltd | Fibre reactive phthalocyamine-monoazodyes |
| EP0775731B1 (de) * | 1995-11-23 | 1999-12-29 | Ciba SC Holding AG | Reaktivfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung |
| EP0775730B1 (de) * | 1995-11-23 | 2000-05-03 | Ciba SC Holding AG | Reaktivfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung |
| EP1247842B1 (de) * | 1995-11-23 | 2008-05-21 | Huntsman Advanced Materials (Switzerland) GmbH | Faserreaktive Anthrachinonfarbstoffe, deren Herstellung und deren Verwendung |
-
1970
- 1970-10-16 DE DE19702050901 patent/DE2050901C3/de not_active Expired
-
1971
- 1971-09-30 NL NL7113459A patent/NL7113459A/xx not_active Application Discontinuation
- 1971-10-13 JP JP8023371A patent/JPS5544781B1/ja active Pending
- 1971-10-14 CA CA125,119A patent/CA982559A/en not_active Expired
- 1971-10-15 BE BE774028A patent/BE774028A/xx unknown
- 1971-10-15 CH CH1504671A patent/CH582214A5/xx not_active IP Right Cessation
- 1971-10-15 AT AT894271A patent/AT306884B/de active
- 1971-10-15 GB GB4811771A patent/GB1372527A/en not_active Expired
- 1971-10-15 FR FR7137144A patent/FR2111668B1/fr not_active Expired
- 1971-10-15 ES ES396041A patent/ES396041A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT306884B (de) | 1973-04-25 |
| CH582214A5 (enExample) | 1976-11-30 |
| CA982559A (en) | 1976-01-27 |
| BE774028A (fr) | 1972-04-17 |
| ES396041A1 (es) | 1974-04-01 |
| NL7113459A (enExample) | 1972-04-18 |
| DE2050901A1 (de) | 1972-04-20 |
| DE2050901B2 (de) | 1980-02-07 |
| FR2111668A1 (enExample) | 1972-06-09 |
| JPS5544781B1 (enExample) | 1980-11-14 |
| FR2111668B1 (enExample) | 1976-04-02 |
| GB1372527A (en) | 1974-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644208C3 (de) | Reaktivfarbstoffe | |
| DE2614550B2 (de) | Neue Reaktivfarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von Cellulose sowie natürlichen und synthetischen Polyamidsubstraten | |
| DE2650555C2 (enExample) | ||
| DE1644204B2 (de) | Reaktivfarbstoffe und deren verwendung | |
| DE1644203C3 (enExample) | ||
| EP0159292B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE2748966C3 (de) | Wasserlösliche Farbstoffe, Verfahren zu deren Herstellung, ihre Verwendung als faserreaktive Farbstoffe zum Färben und Bedrucken von Cellulose- und Polyamid-Fasermaterialien | |
| DE1102317B (de) | Verfahren zur Herstellung metallhaltiger Monoazofarbstoffe | |
| EP0013765A1 (de) | Reaktivazofarbstoffe sowie deren Herstellung und Verwendung zum Färben von OH- und N-haltigen Materialien | |
| CH514658A (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| EP0497174A1 (de) | Vinylsulfon/Pyrimidingruppenhaltige bifunktionelle Reaktivfarbstoffe | |
| DE2050901C3 (de) | Wasserlösliche Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben und Bedrucken von Wolle, Seide, Polyamiden oder Zellulose | |
| DE1223971B (de) | Verfahren zur Herstellung kupferhaltiger, faserreaktiver Monoazofarbstoffe | |
| DE2902486A1 (de) | Azofarbstoffe, deren herstellung und verwendung | |
| EP0281898B1 (de) | Reaktivfarbstoffe | |
| DE3819752A1 (de) | Reaktivfarbstoffe | |
| EP0395951A1 (de) | Polyfunktionelle faserreaktive Farbstoffe | |
| DE1794222C3 (de) | Wasserlösliche Diazofarbstoffe und deren Metallkomplexverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CH635859A5 (de) | Azofarbstoffe sowie deren herstellung. | |
| EP0125650B1 (de) | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Substraten | |
| DE1904113B2 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2515137A1 (de) | Azofarbstoffe, deren herstellung und verwendung | |
| DE2064104C3 (de) | Wasserlösliche faserreaktive Azofarbstoffe, deren Metallkomplexverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Seide, WoUe, Leder, synthetischen Polyamid- und Polyurethanfasern, regenerierten Proteinfasern, nativen oder regenerierten Cellulosefasern oder modifizierten Acrylnitrilfasermaterialien | |
| DE1419840C (de) | Verfahren zur Herstellung von reaktiven Färb stoffen | |
| DE1544561A1 (de) | Reaktivfarbstoffe und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| C3 | Grant after two publication steps (3rd publication) |