DE2047613C3 - - Google Patents
Info
- Publication number
- DE2047613C3 DE2047613C3 DE19702047613 DE2047613A DE2047613C3 DE 2047613 C3 DE2047613 C3 DE 2047613C3 DE 19702047613 DE19702047613 DE 19702047613 DE 2047613 A DE2047613 A DE 2047613A DE 2047613 C3 DE2047613 C3 DE 2047613C3
- Authority
- DE
- Germany
- Prior art keywords
- weight
- styrene
- terpolymer
- ethylene
- polyphenylene oxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 37
- 229920006380 polyphenylene oxide Polymers 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 23
- 229920000642 polymer Polymers 0.000 claims description 16
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 51
- 229920001897 terpolymer Polymers 0.000 description 43
- -1 styrene compound Chemical class 0.000 description 35
- 229920000578 graft copolymer Polymers 0.000 description 21
- 150000003440 styrenes Chemical class 0.000 description 14
- 229910052739 hydrogen Inorganic materials 0.000 description 13
- 239000001257 hydrogen Substances 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000004793 Polystyrene Substances 0.000 description 10
- 150000002431 hydrogen Chemical class 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 229920001519 homopolymer Polymers 0.000 description 9
- 229920001577 copolymer Polymers 0.000 description 8
- 229920001971 elastomer Polymers 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- 229910052736 halogen Inorganic materials 0.000 description 7
- 150000002367 halogens Chemical class 0.000 description 7
- 239000005060 rubber Substances 0.000 description 7
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- 229920002223 polystyrene Polymers 0.000 description 6
- 229920000265 Polyparaphenylene Polymers 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 229920000930 2, 6-dimethyl-1, 4-phenylene oxide Polymers 0.000 description 4
- GVLZQVREHWQBJN-UHFFFAOYSA-N 3,5-dimethyl-7-oxabicyclo[2.2.1]hepta-1,3,5-triene Chemical compound CC1=C(O2)C(C)=CC2=C1 GVLZQVREHWQBJN-UHFFFAOYSA-N 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 4
- 239000005977 Ethylene Substances 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 238000005191 phase separation Methods 0.000 description 3
- 150000004291 polyenes Chemical class 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- 125000000547 substituted alkyl group Chemical group 0.000 description 3
- 125000003107 substituted aryl group Chemical group 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N 1-Heptene Chemical compound CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- UAJRSHJHFRVGMG-UHFFFAOYSA-N 1-ethenyl-4-methoxybenzene Chemical compound COC1=CC=C(C=C)C=C1 UAJRSHJHFRVGMG-UHFFFAOYSA-N 0.000 description 2
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- JESXATFQYMPTNL-UHFFFAOYSA-N 2-ethenylphenol Chemical compound OC1=CC=CC=C1C=C JESXATFQYMPTNL-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- UFERIGCCDYCZLN-UHFFFAOYSA-N 3a,4,7,7a-tetrahydro-1h-indene Chemical compound C1C=CCC2CC=CC21 UFERIGCCDYCZLN-UHFFFAOYSA-N 0.000 description 2
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- UAHWPYUMFXYFJY-UHFFFAOYSA-N beta-myrcene Chemical compound CC(C)=CCCC(=C)C=C UAHWPYUMFXYFJY-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010559 graft polymerization reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- HGXJDMCMYLEZMJ-UHFFFAOYSA-N (2-methylpropan-2-yl)oxy 2,2-dimethylpropaneperoxoate Chemical compound CC(C)(C)OOOC(=O)C(C)(C)C HGXJDMCMYLEZMJ-UHFFFAOYSA-N 0.000 description 1
- JAMNSIXSLVPNLC-UHFFFAOYSA-N (4-ethenylphenyl) acetate Chemical compound CC(=O)OC1=CC=C(C=C)C=C1 JAMNSIXSLVPNLC-UHFFFAOYSA-N 0.000 description 1
- PRBHEGAFLDMLAL-GQCTYLIASA-N (4e)-hexa-1,4-diene Chemical compound C\C=C\CC=C PRBHEGAFLDMLAL-GQCTYLIASA-N 0.000 description 1
- OJOWICOBYCXEKR-KRXBUXKQSA-N (5e)-5-ethylidenebicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(=C/C)/CC1C=C2 OJOWICOBYCXEKR-KRXBUXKQSA-N 0.000 description 1
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- QTYUSOHYEPOHLV-FNORWQNLSA-N 1,3-Octadiene Chemical compound CCCC\C=C\C=C QTYUSOHYEPOHLV-FNORWQNLSA-N 0.000 description 1
- WEERVPDNCOGWJF-UHFFFAOYSA-N 1,4-bis(ethenyl)benzene Chemical compound C=CC1=CC=C(C=C)C=C1 WEERVPDNCOGWJF-UHFFFAOYSA-N 0.000 description 1
- FFILSRMIWBBSQO-UHFFFAOYSA-N 1-(chloromethoxy)-4-ethenylbenzene Chemical compound ClCOC1=CC=C(C=C)C=C1 FFILSRMIWBBSQO-UHFFFAOYSA-N 0.000 description 1
- NVZWEEGUWXZOKI-UHFFFAOYSA-N 1-ethenyl-2-methylbenzene Chemical compound CC1=CC=CC=C1C=C NVZWEEGUWXZOKI-UHFFFAOYSA-N 0.000 description 1
- JZHGRUMIRATHIU-UHFFFAOYSA-N 1-ethenyl-3-methylbenzene Chemical compound CC1=CC=CC(C=C)=C1 JZHGRUMIRATHIU-UHFFFAOYSA-N 0.000 description 1
- YFZHODLXYNDBSM-UHFFFAOYSA-N 1-ethenyl-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(C=C)C=C1 YFZHODLXYNDBSM-UHFFFAOYSA-N 0.000 description 1
- ZMYIIHDQURVDRB-UHFFFAOYSA-N 1-phenylethenylbenzene Chemical group C=1C=CC=CC=1C(=C)C1=CC=CC=C1 ZMYIIHDQURVDRB-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- OMNYXCUDBQKCMU-UHFFFAOYSA-N 2,4-dichloro-1-ethenylbenzene Chemical compound ClC1=CC=C(C=C)C(Cl)=C1 OMNYXCUDBQKCMU-UHFFFAOYSA-N 0.000 description 1
- MWTWAEXAFOVSLO-UHFFFAOYSA-N 3-bromoprop-2-enylbenzene Chemical compound BrC=CCC1=CC=CC=C1 MWTWAEXAFOVSLO-UHFFFAOYSA-N 0.000 description 1
- FDIHXBYYQCPWDX-UHFFFAOYSA-N 3-ethenylbenzonitrile Chemical compound C=CC1=CC=CC(C#N)=C1 FDIHXBYYQCPWDX-UHFFFAOYSA-N 0.000 description 1
- LBSXSAXOLABXMF-UHFFFAOYSA-N 4-Vinylaniline Chemical compound NC1=CC=C(C=C)C=C1 LBSXSAXOLABXMF-UHFFFAOYSA-N 0.000 description 1
- FUGYGGDSWSUORM-UHFFFAOYSA-N 4-hydroxystyrene Chemical compound OC1=CC=C(C=C)C=C1 FUGYGGDSWSUORM-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 1
- 229920002943 EPDM rubber Polymers 0.000 description 1
- 229920000181 Ethylene propylene rubber Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- YFTIRLAWDTWKKG-UHFFFAOYSA-K [Na+].[Cl-].[Mn+2].[Cl-].[Cl-] Chemical compound [Na+].[Cl-].[Mn+2].[Cl-].[Cl-] YFTIRLAWDTWKKG-UHFFFAOYSA-K 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- VYBREYKSZAROCT-UHFFFAOYSA-N alpha-myrcene Natural products CC(=C)CCCC(=C)C=C VYBREYKSZAROCT-UHFFFAOYSA-N 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 description 1
- CHVJITGCYZJHLR-UHFFFAOYSA-N cyclohepta-1,3,5-triene Chemical compound C1C=CC=CC=C1 CHVJITGCYZJHLR-UHFFFAOYSA-N 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- LDLDYFCCDKENPD-UHFFFAOYSA-N ethenylcyclohexane Chemical compound C=CC1CCCCC1 LDLDYFCCDKENPD-UHFFFAOYSA-N 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- BLNWTAHYTCHDJH-UHFFFAOYSA-O hydroxy(oxo)azanium Chemical compound O[NH+]=O BLNWTAHYTCHDJH-UHFFFAOYSA-O 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 230000000051 modifying effect Effects 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 238000005691 oxidative coupling reaction Methods 0.000 description 1
- HDBWAWNLGGMZRQ-UHFFFAOYSA-N p-Vinylbiphenyl Chemical compound C1=CC(C=C)=CC=C1C1=CC=CC=C1 HDBWAWNLGGMZRQ-UHFFFAOYSA-N 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 229920000314 poly p-methyl styrene Polymers 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- WQDUMFSSJAZKTM-UHFFFAOYSA-N sodium methoxide Substances [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- PFBLRDXPNUJYJM-UHFFFAOYSA-N tert-butyl 2-methylpropaneperoxoate Chemical compound CC(C)C(=O)OOC(C)(C)C PFBLRDXPNUJYJM-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7886369A JPS4743174B1 (OSRAM) | 1969-10-01 | 1969-10-01 | |
| JP7886369 | 1969-10-01 | ||
| JP9806269 | 1969-12-06 | ||
| JP9806269 | 1969-12-06 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2047613A1 DE2047613A1 (de) | 1971-04-08 |
| DE2047613B2 DE2047613B2 (de) | 1975-06-05 |
| DE2047613C3 true DE2047613C3 (OSRAM) | 1976-01-15 |
Family
ID=26419925
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2047613A Granted DE2047613B2 (de) | 1969-10-01 | 1970-09-28 | Polyphenylenoxydmasse |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3658945A (OSRAM) |
| BE (1) | BE756894A (OSRAM) |
| DE (1) | DE2047613B2 (OSRAM) |
| FR (1) | FR2062837A5 (OSRAM) |
| GB (1) | GB1312465A (OSRAM) |
| NL (1) | NL143608B (OSRAM) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3943191A (en) * | 1973-10-01 | 1976-03-09 | General Electric Company | Blends of a polyphenylene ether resin and alkenyl aromatic resins modified with EPDM rubber |
| US3974235A (en) * | 1973-10-01 | 1976-08-10 | General Electric Company | Blends of a polyphenylene ether resin, alkenyl aromatic resins modified with EPDM rubber and flame retardant |
| US3959211A (en) * | 1973-10-01 | 1976-05-25 | General Electric Company | Blends of a polyphenylene ether resin and alkenyl aromatic resins modified with EPDM rubber |
| US4153644A (en) * | 1974-12-26 | 1979-05-08 | Mitsubishi Gas Chemical Company, Inc. | Resin composition containing polyphenylene oxide |
| US4179532A (en) * | 1976-04-09 | 1979-12-18 | Polygram Gmbh | Process for producing a disc-shaped information carrier which has information in the form of a beam-reflecting structure |
| US4152316A (en) * | 1977-04-13 | 1979-05-01 | General Electric Company | Compositions of a polyphenylene ether resin and alkenyl aromatic resins modified with epdm rubber |
| US4101503A (en) * | 1977-04-13 | 1978-07-18 | General Electric Company | Compositions of a polyphenylene ether resin and high molecular weight alkenyl aromatic resins modified with EPDM rubber |
| US4101505A (en) * | 1977-04-13 | 1978-07-18 | General Electric Company | Compositions of a polyphenylene ether resin and EPDM rubber-modified alkenyl aromatic resins having specified gel content |
| US4101504A (en) * | 1977-04-13 | 1978-07-18 | General Electric Company | High impact compositions of a polyphenylene ether resin and alkenyl aromatic resins modified with EPDM rubber |
| US4102850A (en) * | 1977-04-13 | 1978-07-25 | General Electric Company | High impact polyphenylene ether resin compositions containing mineral oil |
| US4127558A (en) * | 1977-04-13 | 1978-11-28 | General Electric Company | Compositions of a polyphenylene ether resin and alkenyl aromatic resins modified with EPDM rubber containing propylene |
| US4144218A (en) * | 1977-07-08 | 1979-03-13 | Hercules Incorporated | Thermosetting compositions containing a poly (arylacetylene) and a poly (phenylene oxide) |
| US4166812A (en) * | 1977-09-30 | 1979-09-04 | General Electric Company | Filled compositions of a polyphenylene ether resin and rubber-modified alkenyl aromatic resins |
| US4172929A (en) * | 1977-11-28 | 1979-10-30 | General Electric Company | Plated polyphenylene ether resin compositions containing EPDM rubber-modified alkenyl aromatic resins and hydrogenated elastomeric block copolymers |
| US4172826A (en) * | 1977-11-28 | 1979-10-30 | General Electric Company | Polyphenylene ether resin compositions containing EPDM rubber-modified alkenyl aromatic resins and hydrogenated elastomeric block copolymers |
| US4196116A (en) * | 1977-11-28 | 1980-04-01 | General Electric Company | Impact resistant polyphenylene ether compositions containing EPDM rubber-modified alkenyl aromatic resins and hydrogenated diblock copolymers |
| US4139574A (en) * | 1977-11-28 | 1979-02-13 | General Electric Company | Impact resistant polyphenylene ether resin compositions containing EPDM rubber-modified alkenyl aromatic resins and hydrogenated radial teleblock copolymers |
| US4284733A (en) * | 1980-02-08 | 1981-08-18 | Mobil Oil Corporation | Thermoplastic composition containing a poly(methyl ethenyl benzene) resin and a poly(phenylene oxide) resin |
| GB2076830B (en) * | 1980-05-30 | 1984-03-07 | Gen Electric | Compositions of a polyphenylene ether resin and a rubber modified copolymer of styrene and bromostyrene |
| US4311633A (en) * | 1980-08-04 | 1982-01-19 | General Electric Company | Modified polyphenylene ether compositions |
| US4760114A (en) * | 1981-02-26 | 1988-07-26 | General Electric Company | Polyphenylene ether compositions and process |
| US4341882A (en) * | 1981-08-27 | 1982-07-27 | General Electric Company | Low resistivity thermoplastic compositions |
| EP0083049A3 (en) * | 1981-12-28 | 1984-02-22 | General Electric Company | Composition of ppe and ps-grafted epdm and plasticizer |
| WO1983003833A1 (en) * | 1982-05-04 | 1983-11-10 | General Electric Company | Process for the polymerization of phenols at low oxygen flow rates |
| DE3334068A1 (de) * | 1983-09-21 | 1985-04-11 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur brommethylierung von polyphenylenethern |
| US4849486A (en) * | 1985-07-10 | 1989-07-18 | Nippon Oil Co., Ltd. | Polyphenylene ether resin composition |
| IL97430A0 (en) * | 1990-03-26 | 1992-06-21 | Himont Inc | Heat resistant propylene polymer compositions |
| JP3028561B2 (ja) * | 1990-07-10 | 2000-04-04 | 宇部サイコン株式会社 | ポリフェニレンエーテル組成物 |
| US5290856A (en) * | 1992-04-16 | 1994-03-01 | Himont Incorporated | Engineering resin-propylene polymer graft composition |
| JP3298266B2 (ja) * | 1993-10-27 | 2002-07-02 | 住友化学工業株式会社 | ポリフェニレンエーテル系熱可塑性樹脂組成物 |
-
0
- BE BE756894A patent/BE756894A/xx not_active IP Right Cessation
-
1970
- 1970-09-25 US US75669A patent/US3658945A/en not_active Expired - Lifetime
- 1970-09-28 DE DE2047613A patent/DE2047613B2/de active Granted
- 1970-09-30 GB GB4661670A patent/GB1312465A/en not_active Expired
- 1970-09-30 FR FR7035419A patent/FR2062837A5/fr not_active Expired
- 1970-10-01 NL NL707014465A patent/NL143608B/xx not_active IP Right Cessation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2047613C3 (OSRAM) | ||
| DE2047613B2 (de) | Polyphenylenoxydmasse | |
| DE3787275T2 (de) | Schlagzähe Polyamidharz-Zusammensetzung und Verfahren zu deren Herstellung. | |
| DE69406300T2 (de) | Verbessertes kautschukmodifiziertes polystyrol | |
| DE2000118C3 (de) | Thermoplastische Masse und Verfahren zu ihrer Herstellung | |
| DE69028251T2 (de) | Poly(alkenylsubstituierte aromatische) und elastomerhaltige Polymerezusammensetzungen und Verfahren zu deren Herstellung | |
| DE2546621C3 (de) | Thermoplastische Formmasse | |
| DE2705656C3 (de) | Pfropfcopolymerisate und Verfahren zu ihrer Herstellung | |
| DE1964641C3 (de) | Formmassen auf der Grundlage von Polyphenylenoxiden | |
| EP0054144B1 (de) | Verfahren zur kontinuierlichen Herstellung von mit Kautschuk modifizierten Polymerisaten von Vinylaromaten | |
| DE3027104A1 (de) | Kunstharzmasse und verfahren zu ihrer herstellung | |
| DE2258896A1 (de) | Polyphenylenaether-zusammensetzungen | |
| DE1745945B2 (de) | Pfropfmischpolymerisat | |
| DE2119301A1 (de) | Thermoplastische Massen von hoher Schlagzähigkeit | |
| DE1694749A1 (de) | Verfahren zur Herstellung von Polystyrolmassen | |
| DE2037510B2 (de) | Flammwidrige Polymergemische | |
| DE3129767T1 (de) | Polyphenylene ether molding compositions that include an alkenyl aromatic resin and an epdm rubber | |
| DE2705657C2 (de) | Pfropfcopolymerisatmassen und Verfahren zu ihrer Herstellung | |
| DE2802664A1 (de) | Gummimodifizierter polyphenylenaether und verfahren zu seiner herstellung | |
| DE3346304A1 (de) | Thermoplastische formmassen | |
| DE3206637C2 (OSRAM) | ||
| DE2253221C3 (de) | Zusammensetzung aus einem Polyphenylenäther und einem Acrylharzmodifizierten Polyisopren | |
| DE3035637A1 (de) | Thermoplastische formmasse, verwendung der formmasse, sowie formteile aus dieser | |
| EP0292714B1 (de) | Thermoplastische Formmassen auf Basis von Polyphenylenether | |
| EP0068172A2 (de) | Thermoplastische Formmassen |