DE2037265A1 - Herbizid - Google Patents
HerbizidInfo
- Publication number
- DE2037265A1 DE2037265A1 DE19702037265 DE2037265A DE2037265A1 DE 2037265 A1 DE2037265 A1 DE 2037265A1 DE 19702037265 DE19702037265 DE 19702037265 DE 2037265 A DE2037265 A DE 2037265A DE 2037265 A1 DE2037265 A1 DE 2037265A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- alkyl
- dinitro
- alkoxy
- optionally substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000002363 herbicidal effect Effects 0.000 title description 11
- 239000004009 herbicide Substances 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 claims description 26
- -1 dialkenylamino Chemical group 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 125000003545 alkoxy group Chemical group 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 16
- 150000002367 halogens Chemical group 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 11
- 150000002148 esters Chemical class 0.000 claims description 10
- 125000004001 thioalkyl group Chemical group 0.000 claims description 8
- 125000001188 haloalkyl group Chemical group 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 229920006395 saturated elastomer Polymers 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 3
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000006319 alkynyl amino group Chemical group 0.000 claims description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical group C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 2
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- DSWNRHCOGVRDOE-UHFFFAOYSA-N n,n-dimethylmethanimidamide Chemical compound CN(C)C=N DSWNRHCOGVRDOE-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000005415 substituted alkoxy group Chemical group 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 125000002339 acetoacetyl group Chemical group O=C([*])C([H])([H])C(=O)C([H])([H])[H] 0.000 claims 1
- 125000006323 alkenyl amino group Chemical group 0.000 claims 1
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 56
- 239000000203 mixture Substances 0.000 description 32
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 22
- 239000002253 acid Substances 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000004202 carbamide Substances 0.000 description 13
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 11
- 241001148727 Bromus tectorum Species 0.000 description 10
- 244000234609 Portulaca oleracea Species 0.000 description 10
- 235000001855 Portulaca oleracea Nutrition 0.000 description 10
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 10
- 235000010469 Glycine max Nutrition 0.000 description 9
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 8
- 244000299507 Gossypium hirsutum Species 0.000 description 8
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 8
- 244000237956 Amaranthus retroflexus Species 0.000 description 7
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 7
- 241000335053 Beta vulgaris Species 0.000 description 7
- 244000214240 Galinsoga parviflora Species 0.000 description 7
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 244000038559 crop plants Species 0.000 description 6
- 241000219318 Amaranthus Species 0.000 description 5
- 241000209764 Avena fatua Species 0.000 description 5
- 235000007320 Avena fatua Nutrition 0.000 description 5
- 235000021533 Beta vulgaris Nutrition 0.000 description 5
- 235000008427 Brassica arvensis Nutrition 0.000 description 5
- 244000024671 Brassica kaber Species 0.000 description 5
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 5
- 244000152970 Digitaria sanguinalis Species 0.000 description 5
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 5
- 241000192043 Echinochloa Species 0.000 description 5
- 230000002349 favourable effect Effects 0.000 description 5
- DOOFIWHGCPBLOA-UHFFFAOYSA-N n-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound CCNC1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O DOOFIWHGCPBLOA-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 235000017896 Digitaria Nutrition 0.000 description 4
- 241001303487 Digitaria <clam> Species 0.000 description 4
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 4
- 244000110797 Polygonum persicaria Species 0.000 description 4
- 235000004442 Polygonum persicaria Nutrition 0.000 description 4
- 241001355178 Setaria faberi Species 0.000 description 4
- NAGJZTKCGNOGPW-UHFFFAOYSA-N dithiophosphoric acid Chemical compound OP(O)(S)=S NAGJZTKCGNOGPW-UHFFFAOYSA-N 0.000 description 4
- VACNDKUQVLNNLD-UHFFFAOYSA-N 2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound NC1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O VACNDKUQVLNNLD-UHFFFAOYSA-N 0.000 description 3
- 244000285774 Cyperus esculentus Species 0.000 description 3
- 235000005853 Cyperus esculentus Nutrition 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 235000009438 Gossypium Nutrition 0.000 description 3
- 241000219146 Gossypium Species 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 244000088461 Panicum crus-galli Species 0.000 description 3
- 235000011999 Panicum crusgalli Nutrition 0.000 description 3
- 240000003461 Setaria viridis Species 0.000 description 3
- 235000002248 Setaria viridis Nutrition 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- SMDHCQAYESWHAE-UHFFFAOYSA-N benfluralin Chemical compound CCCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O SMDHCQAYESWHAE-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- SOWBFZRMHSNYGE-UHFFFAOYSA-N oxamic acid Chemical compound NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 2
- MDLKWDQMIZRIBY-UHFFFAOYSA-N 1-(dimethylamino)ethanol Chemical class CC(O)N(C)C MDLKWDQMIZRIBY-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 101001053401 Arabidopsis thaliana Acid beta-fructofuranosidase 3, vacuolar Proteins 0.000 description 2
- 240000002791 Brassica napus Species 0.000 description 2
- 235000011293 Brassica napus Nutrition 0.000 description 2
- 241000209200 Bromus Species 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- 240000006122 Chenopodium album Species 0.000 description 2
- 235000009344 Chenopodium album Nutrition 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 235000005775 Setaria Nutrition 0.000 description 2
- 241000232088 Setaria <nematode> Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical compound OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000007244 Zea mays Nutrition 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- QVVJZHVEBUNKBZ-UHFFFAOYSA-N (4-fluorophenyl)carbamic acid Chemical compound OC(=O)NC1=CC=C(F)C=C1 QVVJZHVEBUNKBZ-UHFFFAOYSA-N 0.000 description 1
- NCQVQQNVWXQOAD-UHFFFAOYSA-N 1-(3-chlorophenyl)-1-(cyclohexen-1-yl)-3-methylurea Chemical compound C=1C=CC(Cl)=CC=1N(C(=O)NC)C1=CCCCC1 NCQVQQNVWXQOAD-UHFFFAOYSA-N 0.000 description 1
- HYCUUTWFLXHTQB-UHFFFAOYSA-N 1-(cyclohexen-1-yl)-3-methyl-1-phenylurea Chemical compound C=1C=CC=CC=1N(C(=O)NC)C1=CCCCC1 HYCUUTWFLXHTQB-UHFFFAOYSA-N 0.000 description 1
- OBGFMRSXJROQDT-UHFFFAOYSA-N 1-methoxy-1-methylurea Chemical compound CON(C)C(N)=O OBGFMRSXJROQDT-UHFFFAOYSA-N 0.000 description 1
- PLJGSBURZABSJT-UHFFFAOYSA-N 4-bromo-2-phenyl-1,5-dihydropyridazin-6-one Chemical compound C1(=CC=CC=C1)N1NC(CC(=C1)Br)=O PLJGSBURZABSJT-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- NLYNUTMZTCLNOO-UHFFFAOYSA-N Chlorbromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C(Cl)=C1 NLYNUTMZTCLNOO-UHFFFAOYSA-N 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001087269 Hispa Species 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- 241000209094 Oryza Species 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 241000881225 Persicaria Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- AKGGOMZLAADIQD-UHFFFAOYSA-N [3-(methoxycarbonylamino)phenyl]-(3-methylphenyl)carbamic acid Chemical compound COC(=O)NC1=CC=CC(N(C(O)=O)C=2C=C(C)C=CC=2)=C1 AKGGOMZLAADIQD-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- PXWUKZGIHQRDHL-UHFFFAOYSA-N atraton Chemical compound CCNC1=NC(NC(C)C)=NC(OC)=N1 PXWUKZGIHQRDHL-UHFFFAOYSA-N 0.000 description 1
- 229960003369 butacaine Drugs 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- YJVOECXUWYQORY-UHFFFAOYSA-N dihydroxy-methylsulfanyl-sulfanylidene-$l^{5}-phosphane Chemical compound CSP(O)(O)=S YJVOECXUWYQORY-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000004992 haloalkylamino group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SLFVYFOEHHLHDW-UHFFFAOYSA-N n-(trifluoromethyl)aniline Chemical compound FC(F)(F)NC1=CC=CC=C1 SLFVYFOEHHLHDW-UHFFFAOYSA-N 0.000 description 1
- UMRMRBSCLRWNTL-UHFFFAOYSA-N n-butyl-n-ethyl-4-methylsulfonyl-2,6-dinitroaniline Chemical compound CCCCN(CC)C1=C([N+]([O-])=O)C=C(S(C)(=O)=O)C=C1[N+]([O-])=O UMRMRBSCLRWNTL-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
- C07D295/073—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals with the ring nitrogen atoms and the substituents separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/16—Esters of thiophosphoric acids or thiophosphorous acids
- C07F9/165—Esters of thiophosphoric acids
- C07F9/1651—Esters of thiophosphoric acids with hydroxyalkyl compounds with further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (28)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702037265 DE2037265A1 (de) | 1970-07-28 | 1970-07-28 | Herbizid |
| US00162317A US3849107A (en) | 1970-07-28 | 1971-07-13 | Herbicide |
| IL37313A IL37313A (en) | 1970-07-28 | 1971-07-14 | Selective herbicidal compositions comprising an aromatic amine together with another active ingredient |
| CA118,250A CA970181A (en) | 1970-07-28 | 1971-07-14 | Herbicidal compositions containing dinitroaniline derivatives |
| AU31319/71A AU461725B2 (en) | 1970-07-28 | 1971-07-16 | Herbicide |
| CS5381A CS171657B2 (enEXAMPLES) | 1970-07-28 | 1971-07-21 | |
| BE770395A BE770395A (fr) | 1970-07-28 | 1971-07-23 | Melanges a activite herbicide |
| ZA714937A ZA714937B (en) | 1970-07-28 | 1971-07-23 | Herbicide |
| AR23700971A AR195268A1 (es) | 1957-01-01 | 1971-07-26 | Composicion herbicida a base de dialcohildinitroanilinas y arilmetoxiureas |
| SU1683959A SU404189A1 (ru) | 1971-07-26 | Гербицидный состав | |
| SE7109578A SE381160B (sv) | 1970-07-28 | 1971-07-26 | Herbicid innehallande en blandning av vissa dinitroanilinderivat och vissa pyridazoner |
| SU1790688A SU460604A3 (ru) | 1970-07-28 | 1971-07-26 | Гербицидное средство |
| SU1789831A SU511830A3 (ru) | 1970-07-28 | 1971-07-26 | Гербицидна смесь |
| PL1971149676A PL77753B1 (enEXAMPLES) | 1970-07-28 | 1971-07-27 | |
| AT462072A AT309886B (de) | 1970-07-28 | 1971-07-27 | Herbizid |
| DK367871AA DK129074B (da) | 1970-07-28 | 1971-07-27 | Herbicid. |
| AT462372A AT309888B (de) | 1970-07-28 | 1971-07-27 | Herbizid |
| AT653671A AT308465B (de) | 1970-07-28 | 1971-07-27 | Herbizid |
| AT462272A AT309887B (de) | 1970-07-28 | 1971-07-27 | Herbizid |
| GB3518671A GB1348428A (en) | 1970-07-28 | 1971-07-27 | Herbicidal compositions |
| NL7110345A NL7110345A (enEXAMPLES) | 1970-07-28 | 1971-07-27 | |
| BR4766/71A BR7104766D0 (pt) | 1970-07-28 | 1971-07-28 | Composicoes herbicidas |
| FR7127692A FR2099642B1 (enEXAMPLES) | 1970-07-28 | 1971-07-28 | |
| HUBA2817A HU165877B (enEXAMPLES) | 1970-07-28 | 1971-07-28 | |
| DK579572A DK133843C (da) | 1970-07-28 | 1972-11-21 | Herbicid |
| DK579672A DK131754C (da) | 1970-07-28 | 1972-11-21 | Herbicid |
| US05/468,372 US3989508A (en) | 1970-01-28 | 1974-05-09 | Substituted nitroanilines and ureas as herbicidal mixtures |
| US05/472,646 US3933467A (en) | 1970-07-28 | 1974-05-23 | Substituted nitroanilines and substituted 1, 3, 5-triazines as herbicidal mixtures |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702037265 DE2037265A1 (de) | 1970-07-28 | 1970-07-28 | Herbizid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2037265A1 true DE2037265A1 (de) | 1972-02-03 |
Family
ID=5778058
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702037265 Pending DE2037265A1 (de) | 1957-01-01 | 1970-07-28 | Herbizid |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3849107A (enEXAMPLES) |
| AT (4) | AT309887B (enEXAMPLES) |
| AU (1) | AU461725B2 (enEXAMPLES) |
| BE (1) | BE770395A (enEXAMPLES) |
| BR (1) | BR7104766D0 (enEXAMPLES) |
| CA (1) | CA970181A (enEXAMPLES) |
| CS (1) | CS171657B2 (enEXAMPLES) |
| DE (1) | DE2037265A1 (enEXAMPLES) |
| DK (1) | DK129074B (enEXAMPLES) |
| FR (1) | FR2099642B1 (enEXAMPLES) |
| GB (1) | GB1348428A (enEXAMPLES) |
| HU (1) | HU165877B (enEXAMPLES) |
| IL (1) | IL37313A (enEXAMPLES) |
| NL (1) | NL7110345A (enEXAMPLES) |
| PL (1) | PL77753B1 (enEXAMPLES) |
| SE (1) | SE381160B (enEXAMPLES) |
| SU (2) | SU511830A3 (enEXAMPLES) |
| ZA (1) | ZA714937B (enEXAMPLES) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2435747A1 (de) * | 1973-08-10 | 1975-02-13 | Lilly Industries Ltd | Stabile fluessige zubereitung mit herbicider wirkung und verfahren zu ihrer herstellung |
| DE2604224A1 (de) * | 1976-02-04 | 1977-08-11 | Hoechst Ag | Herbizide mittel |
| JPS5528901A (en) * | 1977-02-17 | 1980-02-29 | Consortium Elektrochem Ind | Pyridazinee33one*its manufacture and herbicide containing it |
| US4541860A (en) * | 1980-06-06 | 1985-09-17 | Montedison S.P.A. | Stable compositions of N-(3,4-dichlorophenyl)-N'-methoxy-N'-methylurea (linuron) and 2,6-dinitro-N,N-dipropyl-4-trifluoro-methylaniline (trifluralin) in emulsion |
| EP0336118A1 (de) * | 1988-03-10 | 1989-10-11 | BASF Aktiengesellschaft | 2-Phenylpyridazin-3-on-Verbindungen, Verfahren zur ihrer Herstellung und ihre Verwendung als Herbizide |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4042628A (en) * | 1967-12-21 | 1977-08-16 | Badische Anilin- & Soda-Fabrik Aktiengesellschaft | 2,6-Dinitro-4-trifluoromethylanilines |
| US3989508A (en) * | 1970-01-28 | 1976-11-02 | Basf Aktiengesellschaft | Substituted nitroanilines and ureas as herbicidal mixtures |
| DE2334787A1 (de) * | 1973-07-09 | 1975-02-06 | Basf Ag | Herbizid |
| DE2352537A1 (de) * | 1973-10-19 | 1975-04-30 | Basf Ag | Herbizid |
| US3979453A (en) * | 1975-06-23 | 1976-09-07 | Eli Lilly And Company | 3-Cyanamino-2,6-dinitroanilines |
| DE2534042A1 (de) * | 1975-07-30 | 1977-02-17 | Shell Int Research | Herbicide mittel |
| US4124639A (en) * | 1975-12-22 | 1978-11-07 | America Cyanamid Company | N-alkoxyalkyl-2,6-dinitroaniline herbicides |
| DE2617736C2 (de) * | 1976-04-23 | 1982-12-09 | Hoechst Ag, 6000 Frankfurt | Schädlingsbekämpfungsmittel |
| US4087460A (en) * | 1977-06-27 | 1978-05-02 | Eli Lilly And Company | Substituted N-alkoxy-N-substituted-2,6-dinitroanilines and intermediates for the preparation thereof |
| US4453965A (en) * | 1977-07-13 | 1984-06-12 | Patel Natu R | N-Isopropylcarbanilylmethyl dithiophosphates as pre-emergent herbicides |
| EP0006681A1 (en) * | 1978-06-17 | 1980-01-09 | FISONS plc | Herbicidal composition and method |
| DE2842142A1 (de) * | 1978-09-28 | 1980-04-10 | Hoechst Ag | Herbizide mittel |
| DE3129374A1 (de) * | 1981-07-25 | 1983-02-10 | Norddeutsche Affinerie AG, 2000 Hamburg | Mittel zur selktiven unkrautbekaempfung und seine anwendung |
| KR100891599B1 (ko) | 2003-08-29 | 2009-04-08 | 미쓰이 가가쿠 가부시키가이샤 | 농업용 또는 원예용 살충제 및 그의 이용 방법 |
| US7390395B2 (en) * | 2005-06-23 | 2008-06-24 | Saleh Elomari | Hydrocarbon conversion using molecular sieve SSZ-56 |
| AU2011213621A1 (en) * | 2010-02-08 | 2012-08-30 | Allergan, Inc. | Pyridazine derivatives useful as cannabinoid - 2 agonists |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3257190A (en) * | 1962-12-10 | 1966-06-21 | Lilly Co Eli | Method of eliminating weed grasses and broadleaf weeds |
| FR1486323A (fr) * | 1965-07-12 | 1967-06-23 | Daikin Ind Ltd | Compositions herbicides, procédés pour les obtenir et applications de ces compositions |
| US3442639A (en) * | 1965-12-22 | 1969-05-06 | Lilly Co Eli | Process of selectively eliminating weeds |
| US3449111A (en) * | 1966-12-08 | 1969-06-10 | Lilly Co Eli | Method of eliminating weeds |
| DE1670315B1 (de) * | 1968-02-10 | 1972-05-31 | Basf Ag | 1-(m-Trifluormethylphenyl)-4-methoxy-5-halogen-pyridazon-(6)-derivate |
-
1970
- 1970-07-28 DE DE19702037265 patent/DE2037265A1/de active Pending
-
1971
- 1971-07-13 US US00162317A patent/US3849107A/en not_active Expired - Lifetime
- 1971-07-14 IL IL37313A patent/IL37313A/xx unknown
- 1971-07-14 CA CA118,250A patent/CA970181A/en not_active Expired
- 1971-07-16 AU AU31319/71A patent/AU461725B2/en not_active Expired
- 1971-07-21 CS CS5381A patent/CS171657B2/cs unknown
- 1971-07-23 BE BE770395A patent/BE770395A/xx unknown
- 1971-07-23 ZA ZA714937A patent/ZA714937B/xx unknown
- 1971-07-26 SU SU1789831A patent/SU511830A3/ru active
- 1971-07-26 SE SE7109578A patent/SE381160B/xx unknown
- 1971-07-26 SU SU1790688A patent/SU460604A3/ru active
- 1971-07-27 AT AT462272A patent/AT309887B/de not_active IP Right Cessation
- 1971-07-27 AT AT653671A patent/AT308465B/de not_active IP Right Cessation
- 1971-07-27 AT AT462072A patent/AT309886B/de active
- 1971-07-27 AT AT462372A patent/AT309888B/de not_active IP Right Cessation
- 1971-07-27 NL NL7110345A patent/NL7110345A/xx unknown
- 1971-07-27 DK DK367871AA patent/DK129074B/da unknown
- 1971-07-27 PL PL1971149676A patent/PL77753B1/pl unknown
- 1971-07-27 GB GB3518671A patent/GB1348428A/en not_active Expired
- 1971-07-28 HU HUBA2817A patent/HU165877B/hu unknown
- 1971-07-28 FR FR7127692A patent/FR2099642B1/fr not_active Expired
- 1971-07-28 BR BR4766/71A patent/BR7104766D0/pt unknown
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2435747A1 (de) * | 1973-08-10 | 1975-02-13 | Lilly Industries Ltd | Stabile fluessige zubereitung mit herbicider wirkung und verfahren zu ihrer herstellung |
| DE2604224A1 (de) * | 1976-02-04 | 1977-08-11 | Hoechst Ag | Herbizide mittel |
| JPS5528901A (en) * | 1977-02-17 | 1980-02-29 | Consortium Elektrochem Ind | Pyridazinee33one*its manufacture and herbicide containing it |
| US4541860A (en) * | 1980-06-06 | 1985-09-17 | Montedison S.P.A. | Stable compositions of N-(3,4-dichlorophenyl)-N'-methoxy-N'-methylurea (linuron) and 2,6-dinitro-N,N-dipropyl-4-trifluoro-methylaniline (trifluralin) in emulsion |
| EP0336118A1 (de) * | 1988-03-10 | 1989-10-11 | BASF Aktiengesellschaft | 2-Phenylpyridazin-3-on-Verbindungen, Verfahren zur ihrer Herstellung und ihre Verwendung als Herbizide |
Also Published As
| Publication number | Publication date |
|---|---|
| IL37313A0 (en) | 1971-11-29 |
| GB1348428A (en) | 1974-03-20 |
| FR2099642A1 (enEXAMPLES) | 1972-03-17 |
| BR7104766D0 (pt) | 1973-04-17 |
| HU165877B (enEXAMPLES) | 1974-12-28 |
| SE381160B (sv) | 1975-12-01 |
| AT309886B (de) | 1973-09-10 |
| AT309888B (de) | 1973-09-10 |
| IL37313A (en) | 1974-06-30 |
| CA970181A (en) | 1975-07-01 |
| PL77753B1 (enEXAMPLES) | 1975-04-30 |
| AU3131971A (en) | 1973-01-18 |
| AT308465B (de) | 1973-07-10 |
| AU461725B2 (en) | 1975-06-05 |
| FR2099642B1 (enEXAMPLES) | 1976-03-26 |
| CS171657B2 (enEXAMPLES) | 1976-10-29 |
| ZA714937B (en) | 1972-05-31 |
| DK129074B (da) | 1974-08-19 |
| US3849107A (en) | 1974-11-19 |
| AT309887B (de) | 1973-09-10 |
| BE770395A (fr) | 1972-01-24 |
| SU511830A3 (ru) | 1976-04-25 |
| NL7110345A (enEXAMPLES) | 1972-02-01 |
| SU404189A3 (enEXAMPLES) | 1973-10-26 |
| SU460604A3 (ru) | 1975-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2037265A1 (de) | Herbizid | |
| EP0131258B1 (de) | Neue N-Alkoxy- N-Alkylsulfonylaminosulfonylharnstoffe, und neue (Pyrimido) Triazino-thiatriazinoxide als Vorprodukte | |
| EP0007482A1 (de) | 2-Chlor-6-nitroaniline, Verfahren zu ihrer Herstellung, ihre Verwendung, herbizide Mittel | |
| DE2726684A1 (de) | Insektizide mittel | |
| DE69126836T2 (de) | Herbizide | |
| DE2254200A1 (de) | Tetrahydro-1.3.5-triazin-2.6-dione, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| EP0264865A2 (de) | Alpha-Iminocarbonsäureanilide enthaltende herbizide Mittel sowie neue Alpha-Iminocarbonsäureanilide und Verfahren zu ihrer Herstellung | |
| DE1901501C3 (de) | m- Trifluormethylphenylharnstoffe und diese enthaltende herbizide Mittel | |
| DD222769A5 (de) | Verwendung von in 2-stellung mit (substituierten) aminogruppen substituierten 4-dl-alkylester- -alaninyl-6-chlor-s-triazinen als herbizide, insbesondere gegen flughafer | |
| DE19728568B4 (de) | Herbizide Mittel auf Basis von (5-Trifluormethyl-1,3,4-thiadiazol-2-yl-oxy)-essigsäure-N-isopropyl-N-(4fluorphenyl)-amid | |
| DE2131745A1 (de) | Zyklische Schwefelverbindungen und deren Verwendung | |
| DD261084A5 (de) | 1,2-disubstituierte piperidine, verfahren zu ihrer herstellung sowie ihre verwendung im pflanzenschutz | |
| DE2242420C3 (de) | Halogenacetanilide, Verfahren zu ihrer Herstellung und Selektivherbizide mit den Halogenacetaniliden als Wirkstoff | |
| DE2824126C2 (de) | Tetrahydro-1,3,5-thiadiazin-4-on-Verbindungen | |
| DE2155391A1 (de) | l-Hydrocarbyldithio-3-arylharnstoffe und dieselben enthaltende Herbizide | |
| DE2210540C2 (de) | Cyanphenylcarbonate, Verfahren zu deren Herstellung sowie diese enthaltende herbizide Mittel | |
| DE2344134A1 (de) | Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DD220217A5 (de) | Herbizide und wachstumregulierende mittel | |
| DE2044735A1 (de) | Schädlingsbekämpfungsmittel | |
| DE3037300A1 (de) | Substituierte 6-halogen-tert.-butyl-1,2,4-triazin-5-one, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE69123761T2 (de) | Sulfamidosulfonamidderivate und herbizide | |
| DE2302029C2 (de) | N,N-disubstituierte &alpha;-Aminothiopropionsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DD228160A5 (de) | Herbizide und wachstumsregulierende mittel | |
| DD201969A5 (de) | Fungizide mittel | |
| DE2633159C2 (de) | Phosphorhaltige Verbindungen, Verfahren zu ihrer Herstellung, sowie diese Verbindungen enthaltende herbizide Mittel |