DE2036421C - - Google Patents
Info
- Publication number
- DE2036421C DE2036421C DE19702036421 DE2036421A DE2036421C DE 2036421 C DE2036421 C DE 2036421C DE 19702036421 DE19702036421 DE 19702036421 DE 2036421 A DE2036421 A DE 2036421A DE 2036421 C DE2036421 C DE 2036421C
- Authority
- DE
- Germany
- Prior art keywords
- acid
- hours
- general formula
- mixture
- reflux
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 10
- 150000001728 carbonyl compounds Chemical class 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 16
- HVYWMOMLDIMFJA-DPAQBDIFSA-N (3β)-Cholest-5-en-3-ol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 15
- 239000011780 sodium chloride Substances 0.000 description 13
- 239000002253 acid Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- 238000010992 reflux Methods 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- -1 Cyclohexenyl- Chemical group 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 229940107161 Cholesterol Drugs 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- QIIPQYDSKRYMFG-UHFFFAOYSA-N phenyl hydrogen carbonate Chemical class OC(=O)OC1=CC=CC=C1 QIIPQYDSKRYMFG-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 125000004494 ethyl ester group Chemical group 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 210000004369 Blood Anatomy 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 235000012000 cholesterol Nutrition 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 230000000875 corresponding Effects 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- BZKBCQXYZZXSCO-UHFFFAOYSA-N sodium hydride Chemical compound [H-].[Na+] BZKBCQXYZZXSCO-UHFFFAOYSA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- ILPUOPPYSQEBNJ-UHFFFAOYSA-N 2-methyl-2-phenoxypropanoic acid Chemical compound OC(=O)C(C)(C)OC1=CC=CC=C1 ILPUOPPYSQEBNJ-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butanoic acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 229920000089 Cyclic olefin copolymer Polymers 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N Cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- OBNCKNCVKJNDBV-UHFFFAOYSA-N Ethyl butyrate Chemical compound CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- FPKOPBFLPLFWAD-UHFFFAOYSA-N Trinitrotoluene Chemical compound CC1=CC=C([N+]([O-])=O)C([N+]([O-])=O)=C1[N+]([O-])=O FPKOPBFLPLFWAD-UHFFFAOYSA-N 0.000 description 2
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating Effects 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- FHEPZBIUHGLJMP-UHFFFAOYSA-N cyclohexene Chemical group [CH]1CCCC=C1 FHEPZBIUHGLJMP-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 229940079593 drugs Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000008079 hexane Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PLKNGVGPMMDDHG-UHFFFAOYSA-N 2-(cyclohexen-1-yl)phenol Chemical compound OC1=CC=CC=C1C1=CCCCC1 PLKNGVGPMMDDHG-UHFFFAOYSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- TXCGAZHTZHNUAI-UHFFFAOYSA-N Clofibric acid Chemical compound OC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 TXCGAZHTZHNUAI-UHFFFAOYSA-N 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N Sulfuryl chloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N al2o3 Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 201000001320 atherosclerosis Diseases 0.000 description 1
- 125000004429 atoms Chemical group 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L cacl2 Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 230000003247 decreasing Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N iodine atom Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 230000003000 nontoxic Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6116469 | 1969-08-01 | ||
| JP6116469 | 1969-08-01 | ||
| JP6187169 | 1969-08-04 | ||
| JP6187169 | 1969-08-04 | ||
| JP7651769 | 1969-09-24 | ||
| JP7651669 | 1969-09-24 | ||
| JP7651769A JPS5010306B1 (fi) | 1969-09-24 | 1969-09-24 | |
| JP7651669 | 1969-09-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2036421A1 DE2036421A1 (de) | 1972-01-27 |
| DE2036421C true DE2036421C (fi) | 1973-05-03 |
Family
ID=27464003
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702036421 Granted DE2036421A1 (de) | 1969-08-01 | 1970-07-22 | Phenoxycarbonsaure Derivate, Verfah ren zu ihrer Herstellung und ihre Verwen dung |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3658829A (fi) |
| BE (1) | BE754245A (fi) |
| CH (1) | CH548969A (fi) |
| DE (1) | DE2036421A1 (fi) |
| DK (1) | DK133870B (fi) |
| FR (1) | FR2060072B1 (fi) |
| GB (1) | GB1280752A (fi) |
| NL (1) | NL150096B (fi) |
| NO (1) | NO130395B (fi) |
| SE (1) | SE371638B (fi) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4058552A (en) * | 1969-01-31 | 1977-11-15 | Orchimed Sa | Esters of p-carbonylphenoxy-isobutyric acids |
| US3970691A (en) * | 1972-08-03 | 1976-07-20 | International Telephone And Telegraph Corporation | Etherification of bark extracts |
| AR206596A1 (es) * | 1972-08-29 | 1976-08-06 | Sterling Drug Inc | Procedimiento para preparar compuestos de acidos p-(dihalociclopropil)-fenoxialcanoicos |
| DE2342118C2 (de) * | 1973-08-21 | 1982-09-23 | Merck Patent Gmbh, 6100 Darmstadt | Phenoxypropionsäurederivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Zubereitungen |
| DK432074A (fi) * | 1973-09-18 | 1975-05-20 | Ciba Geigy Ag | |
| DE2907089A1 (de) * | 1979-02-23 | 1980-09-04 | Hoechst Ag | Herbizide mittel |
| US4337261A (en) * | 1980-07-28 | 1982-06-29 | Hoechst-Roussel Pharmaceuticals Inc. | (1,2-Benzisoxazol)phenoxyacetic acids as diuretics |
| JPS5846079A (ja) * | 1981-09-12 | 1983-03-17 | Santen Pharmaceut Co Ltd | ベンゾチアゾリン環を有するエ−テル類 |
| DK305884A (da) * | 1983-06-24 | 1984-12-25 | Yamanouchi Pharma Co Ltd | Phenoxyderivat, fremgangsmaade til fremstilling deraf og farmaceutisk praeparat indeholdende et saadant derivat |
| EP0320501A3 (en) * | 1983-06-24 | 1989-12-06 | Yamanouchi Pharmaceutical Co., Ltd. | Phenoxy derivatives, their preparation, and pharmaceutical compositions containing them |
| NZ535603A (en) | 2002-03-20 | 2007-10-26 | Metabolex Inc | Substituted phenylacetic acids |
| US7199259B2 (en) * | 2003-06-20 | 2007-04-03 | Metabolex, Inc. | Resolution of α-(phenoxy)phenylacetic acid derivatives |
| EP1749000A4 (en) * | 2004-05-25 | 2009-12-30 | Metabolex Inc | BICYCLIC SUBSTITUTED TRIAZOLE AS PPAR MODULATORS AND METHOD FOR THE PRODUCTION THEREOF |
| RU2006145872A (ru) * | 2004-05-25 | 2008-06-27 | Метаболекс, Инк. (Us) | Замещенные триазолы в качестве модуляторов ppar и способы их получения |
| US7714131B2 (en) * | 2005-09-23 | 2010-05-11 | Metabolex, Inc. | Process for the stereoselective preparation of (−)-halofenate and derivatives thereof |
| KR101395146B1 (ko) * | 2011-02-09 | 2014-05-16 | 부산대학교 산학협력단 | 피부미백, 항산화 및 ｐｐａｒ 활성을 갖는 신규 화합물 및 이의 의학적 용도 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1121722A (en) * | 1966-03-31 | 1968-07-31 | Ici Ltd | New carboxylic acid derivatives |
-
0
- BE BE754245D patent/BE754245A/xx unknown
-
1970
- 1970-07-22 DE DE19702036421 patent/DE2036421A1/de active Granted
- 1970-07-27 DK DK388470AA patent/DK133870B/da unknown
- 1970-07-27 US US58743A patent/US3658829A/en not_active Expired - Lifetime
- 1970-07-30 FR FR707028177A patent/FR2060072B1/fr not_active Expired
- 1970-07-30 GB GB36946/70A patent/GB1280752A/en not_active Expired
- 1970-07-31 SE SE70105889*3A patent/SE371638B/xx unknown
- 1970-07-31 NL NL707011358A patent/NL150096B/xx unknown
- 1970-07-31 NO NO02968/70A patent/NO130395B/no unknown
- 1970-07-31 CH CH1160270A patent/CH548969A/xx not_active IP Right Cessation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2036421C (fi) | ||
| DE2015573C3 (de) | a-Aminomethyl-3-(hydroxy-, acyloxy- oder acyloxymethyl)-4-acyloxybenzylalkohole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2351412C2 (de) | 2,2-Disubstituierte 1-Oxo-5-indanyloxy-carbonsäuren, Verfahren zu deren Herstellung und Spaltung racemischer Gemische, sowie diese enthaltende Arzneimittel | |
| DE2003430C3 (de) | p-Benzoylphenoxyisobuttersäureester, ihre Herstellung und diese enthaltende Arzneimittel | |
| DE2036421A1 (de) | Phenoxycarbonsaure Derivate, Verfah ren zu ihrer Herstellung und ihre Verwen dung | |
| EP0006114B1 (de) | 7-Methoxy-5-oxo-5H-thiazolo(2,3-b)chinazolin-2-carbonsäure und deren pharmazeutisch verwendbare Salze. Verfahren zu deren Herstellung und sie enthaltende Arzneimittel | |
| DE3225528C2 (de) | 7-Acyl-ursodesoxycholsäuren und diese Verbindungen enthaltende Arzneimittel | |
| DE2448438A1 (de) | 2-substituierte und 2,2-disubstituierte eckige klammer auf 1,3-dioxoindanyloxy(oder -thio) eckige klammer zu -alkancarbonsaeuren und verfahren zur herstellung derselben | |
| DE2313338C3 (de) | N-Hexamethylenimino-derivate, deren Salze, Verfahren zu deren Herstellng sowie diese enthaltende pharmazeutische Zubereitung | |
| EP0027268A2 (de) | Chinazolin-Derivate, Verfahren und Zwischenprodukte zu deren Herstellung, Arzneimittel enthaltend solche Chinazolin-Derivate und deren pharmazeutische Verwendung | |
| DE2431561A1 (de) | Cycloalkylphenoxycarbonsaeuren, verfahren zu ihrer herstellung und arzneimittel | |
| DE2038628C3 (de) | N,N'-Di(carboxyalkyI)-p-phenylendiamine, deren Salze und Diäthylester, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2736268A1 (de) | Neue 5-thiazolalkylamin-derivate, verfahren zu deren herstellung und diese enthaltende pharmazeutische zusammensetzungen | |
| DE2357250A1 (de) | 7 alpha-cyano-17-hydroxy-3-oxo-17 alpha-pregn-4-en-21-carbonsaeure-gamma lacton und verwandte verbindungen, verfahren zu deren herstellung und diese verbindungen enthaltende mittel | |
| DE2024049B2 (de) | Alpha-(3,4-dihydroxyphenyl)-alpha(2-piperidinyl)-methanol | |
| DE1966948C2 (de) | Derivate der 5-Thiazolcarbonsäure enthaltende pharmazeutische Zusammensetzungen | |
| DE2164988C3 (de) | 2,2-Diphenylcyclopropancarbonsäureesterderivate, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE1593113C3 (de) | 4-(2-Nitro-l-aIkenyl)-phenoxyessigsäuren, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2157694C3 (de) | Phenylessigsäurederivate, Verfahren zu ihrer Herstellung und Phenylessigsäurederivate enthaltende pharmazeutische Zubereitungen | |
| DE2036421B (fi) | ||
| DE2017331C3 (de) | 23.12.69 Japan 104194-69 Phenoxycarbonsäuren, deren Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2139541C3 (fi) | ||
| DE2639600A1 (de) | Neue 2,2-dimethylsteroide, verfahren zu ihrer herstellung und pharmazeutische zusammensetzungen | |
| DE1543744C3 (de) | 3-Alkylflavanone und Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| DE1420955C (de) | alpha (o Benzylphenoxy)-beta piperidino propan, dessen Saureadditionssalze sowie Verfahren zur Herstellung dieser Verbm düngen |