DE2028781A1 - Hochdruck-Quecksilberdampf Jodid-Entladungslampe - Google Patents
Hochdruck-Quecksilberdampf Jodid-EntladungslampeInfo
- Publication number
- DE2028781A1 DE2028781A1 DE19702028781 DE2028781A DE2028781A1 DE 2028781 A1 DE2028781 A1 DE 2028781A1 DE 19702028781 DE19702028781 DE 19702028781 DE 2028781 A DE2028781 A DE 2028781A DE 2028781 A1 DE2028781 A1 DE 2028781A1
- Authority
- DE
- Germany
- Prior art keywords
- amount
- iodide
- lamp
- mercury
- discharge vessel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 title claims description 33
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 title claims description 8
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 40
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 claims description 23
- 229910052753 mercury Inorganic materials 0.000 claims description 22
- 239000010936 titanium Substances 0.000 claims description 19
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 16
- 229910052716 thallium Inorganic materials 0.000 claims description 16
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 14
- 229910052719 titanium Inorganic materials 0.000 claims description 14
- 235000009518 sodium iodide Nutrition 0.000 claims description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- 239000011734 sodium Substances 0.000 claims description 9
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 8
- 229910052744 lithium Inorganic materials 0.000 claims description 8
- 229910052708 sodium Inorganic materials 0.000 claims description 8
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 239000011630 iodine Substances 0.000 claims description 6
- 229910052756 noble gas Inorganic materials 0.000 claims description 6
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 claims description 3
- NLLZTRMHNHVXJJ-UHFFFAOYSA-J titanium tetraiodide Chemical compound I[Ti](I)(I)I NLLZTRMHNHVXJJ-UHFFFAOYSA-J 0.000 claims description 3
- 230000005855 radiation Effects 0.000 description 10
- 238000001228 spectrum Methods 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 150000004694 iodide salts Chemical class 0.000 description 5
- 238000009877 rendering Methods 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052754 neon Inorganic materials 0.000 description 2
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 2
- 208000034656 Contusions Diseases 0.000 description 1
- 102100021749 LIM and senescent cell antigen-like-containing domain protein 3 Human genes 0.000 description 1
- 101710104347 LIM and senescent cell antigen-like-containing domain protein 3 Proteins 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- QKEOZZYXWAIQFO-UHFFFAOYSA-M mercury(1+);iodide Chemical compound [Hg]I QKEOZZYXWAIQFO-UHFFFAOYSA-M 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- -1 rare earth iodides Chemical class 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000005341 toughened glass Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
- H01J61/22—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent vapour of an alkali metal
Landscapes
- Discharge Lamp (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6909891A NL6909891A (en:Method) | 1969-06-27 | 1969-06-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2028781A1 true DE2028781A1 (de) | 1971-01-07 |
Family
ID=19807323
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702028781 Pending DE2028781A1 (de) | 1969-06-27 | 1970-06-11 | Hochdruck-Quecksilberdampf Jodid-Entladungslampe |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3639801A (en:Method) |
| AT (1) | AT297848B (en:Method) |
| BE (1) | BE752550A (en:Method) |
| DE (1) | DE2028781A1 (en:Method) |
| FR (1) | FR2051304A5 (en:Method) |
| GB (1) | GB1272545A (en:Method) |
| NL (1) | NL6909891A (en:Method) |
| SE (1) | SE355106B (en:Method) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7203720A (en:Method) * | 1972-03-20 | 1973-09-24 | ||
| NL7303079A (en:Method) * | 1973-03-06 | 1974-09-10 | ||
| DE2456757C2 (de) * | 1974-11-30 | 1983-06-01 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Metallhalogenid-Hochdruckgasentladungslampe |
| US4757236A (en) * | 1984-11-29 | 1988-07-12 | General Electric Company | High pressure metal halide arc lamp with xenon buffer gas |
| US4605881A (en) * | 1984-11-29 | 1986-08-12 | General Electric Company | High pressure sodium iodide arc lamp with excess iodine |
| US5729090A (en) * | 1995-02-21 | 1998-03-17 | General Electric Company | Sodium halide discharge lamp |
| US6147453A (en) * | 1997-12-02 | 2000-11-14 | U.S. Philips Corporation | Metal-halide lamp with lithium and cerium iodide |
| KR20010042208A (ko) * | 1999-01-28 | 2001-05-25 | 롤페스 요하네스 게라투스 알베르투스 | 금속 할로겐화물 램프 |
| CN101529553A (zh) * | 2005-01-18 | 2009-09-09 | 马斯科公司 | 为了更好的性能而改变化学物质和去除高亮度弧光灯上的白色氧化涂层 |
| US20060178075A1 (en) * | 2005-01-18 | 2006-08-10 | Musco Corporation | Altering chemicals and removing white oxide coating on high-intensity arc lamp for better performance |
| EP1733691A1 (en) * | 2005-06-14 | 2006-12-20 | Koninklijke Philips Electronics N.V. | Apparatus for cosmetic skin rejuvenation treatment |
| WO2008048968A2 (en) * | 2006-10-16 | 2008-04-24 | Luxim Corporation | Electrodeless plasma lamp and fill |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3234421A (en) * | 1961-01-23 | 1966-02-08 | Gen Electric | Metallic halide electric discharge lamps |
| US3259777A (en) * | 1961-05-09 | 1966-07-05 | Gen Electric | Metal halide vapor discharge lamp with near molten tip electrodes |
| US3452238A (en) * | 1966-12-05 | 1969-06-24 | Westinghouse Electric Corp | Metal vapor discharge lamp |
| US3521110A (en) * | 1967-09-25 | 1970-07-21 | Gen Electric | Mercury-metallic halide vapor lamp with regenerative cycle |
-
1969
- 1969-06-27 NL NL6909891A patent/NL6909891A/xx unknown
-
1970
- 1970-06-11 DE DE19702028781 patent/DE2028781A1/de active Pending
- 1970-06-24 SE SE08757/70A patent/SE355106B/xx unknown
- 1970-06-24 AT AT567970A patent/AT297848B/de not_active IP Right Cessation
- 1970-06-24 US US49279A patent/US3639801A/en not_active Expired - Lifetime
- 1970-06-24 GB GB30682/70A patent/GB1272545A/en not_active Expired
- 1970-06-25 FR FR7023554A patent/FR2051304A5/fr not_active Expired
- 1970-06-25 BE BE752550D patent/BE752550A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT297848B (de) | 1972-04-10 |
| US3639801A (en) | 1972-02-01 |
| GB1272545A (en) | 1972-05-03 |
| FR2051304A5 (en:Method) | 1971-04-02 |
| BE752550A (fr) | 1970-12-28 |
| NL6909891A (en:Method) | 1970-12-29 |
| SE355106B (en:Method) | 1973-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE2617915A1 (de) | Lichtbogen-entladungseinrichtung | |
| EP2128888B1 (de) | Quecksilberfreie Metallhalogenid-Hochdruckentladungslampe | |
| DE2624897A1 (de) | Aluminiumoxyd-ueberzuege fuer quecksilberdampf-lampen | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2028781A1 (de) | Hochdruck-Quecksilberdampf Jodid-Entladungslampe | |
| DE69318671T2 (de) | Fluoreszente Lampen mit hoher Farbwiedergabe und Helligkeit | |
| DE68911587T2 (de) | Hochdruckmetallhalogenidentladungslampe. | |
| DE2031449C3 (de) | Hochdruck-Metalldampf lampe mit einer in ausgewählten Spektralbereichen konzentrierten Strahlung | |
| DE3110812C2 (en:Method) | ||
| DE2619674A1 (de) | Halogen-metalldampfentladungslampe | |
| DE2139078A1 (de) | Hochdruck Quecksilberdampf Entladungs lampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE905414C (de) | Entladungslampe mit langgestreckter Glashuelle und je einer Elektrode an beiden Enden dieser Huelle | |
| DE1489527A1 (de) | Quecksilberhochdrucklampe | |
| DE1089479B (de) | Elektrische Edelgas-Hochdruck-Entladungslampe | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE2525408C3 (de) | Hochdruck-Edelgas-Entladungslampe | |
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE7016628U (de) | Wandstabilisierte hochdruck-quecksilberdampf-entladungslampe mit jodid. | |
| DE1764015A1 (de) | Hochdruckentladungslampe mit grosser Leistung und ausgezeichneter Farbwiedergabe | |
| DE2059577C3 (de) | Niederdruck-Natriumdampf-Entladungslampe | |
| DE2605290C2 (de) | Hochdruck-Entladungslampe | |
| DE2307631C3 (de) | Hochdruckquecksilberdampfentladungslampe |