DE2026997A1 - - Google Patents
Info
- Publication number
- DE2026997A1 DE2026997A1 DE19702026997 DE2026997A DE2026997A1 DE 2026997 A1 DE2026997 A1 DE 2026997A1 DE 19702026997 DE19702026997 DE 19702026997 DE 2026997 A DE2026997 A DE 2026997A DE 2026997 A1 DE2026997 A1 DE 2026997A1
- Authority
- DE
- Germany
- Prior art keywords
- diamino
- acid addition
- pyrimidine
- addition salts
- benzyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003839 salts Chemical class 0.000 claims description 41
- 239000002253 acid Substances 0.000 claims description 39
- 150000001204 N-oxides Chemical class 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 22
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 16
- 150000002367 halogens Chemical class 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 13
- -1 methylenedioxy Chemical group 0.000 claims description 12
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 11
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 7
- FQLKASDBWGNDRZ-UHFFFAOYSA-N 5-[(2,4,5-trichlorophenyl)methyl]pyrimidine-2,4-diamine Chemical compound NC1=NC(N)=NC=C1CC1=CC(Cl)=C(Cl)C=C1Cl FQLKASDBWGNDRZ-UHFFFAOYSA-N 0.000 claims description 6
- 238000007254 oxidation reaction Methods 0.000 claims description 6
- 229940124530 sulfonamide Drugs 0.000 claims description 5
- 150000003456 sulfonamides Chemical class 0.000 claims description 5
- KEEYRKYKLYARHO-UHFFFAOYSA-N 5-[(4,5-dimethoxy-2-methylphenyl)methyl]pyrimidine-2,4-diamine Chemical compound C1=C(OC)C(OC)=CC(C)=C1CC1=CN=C(N)N=C1N KEEYRKYKLYARHO-UHFFFAOYSA-N 0.000 claims description 4
- 230000000844 anti-bacterial effect Effects 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 230000003389 potentiating effect Effects 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- IEDVJHCEMCRBQM-UHFFFAOYSA-N trimethoprim Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(=NC(N)=NC=2)N)=C1 IEDVJHCEMCRBQM-UHFFFAOYSA-N 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 9
- 238000002360 preparation method Methods 0.000 claims 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 3
- 125000005807 2,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C([H])C(=C1OC([H])([H])[H])C([H])([H])* 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 2
- 239000000969 carrier Substances 0.000 claims 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- LDBTVAXGKYIFHO-UHFFFAOYSA-N diaveridine Chemical compound C1=C(OC)C(OC)=CC=C1CC1=CN=C(N)N=C1N LDBTVAXGKYIFHO-UHFFFAOYSA-N 0.000 claims 2
- 231100000252 nontoxic Toxicity 0.000 claims 2
- 230000003000 nontoxic effect Effects 0.000 claims 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims 2
- 230000001225 therapeutic effect Effects 0.000 claims 2
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims 1
- IEAAAQXTROJCRL-UHFFFAOYSA-N 5-[(2,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine Chemical compound COC1=CC(OC)=C(OC)C=C1CC1=CN=C(N)N=C1N IEAAAQXTROJCRL-UHFFFAOYSA-N 0.000 claims 1
- KGFRBZVECBIIHN-UHFFFAOYSA-N 5-[(3,4-dimethoxy-5-phenylmethoxyphenyl)methyl]pyrimidine-2,4-diamine Chemical compound C=1C(OCC=2C=CC=CC=2)=C(OC)C(OC)=CC=1CC1=CN=C(N)N=C1N KGFRBZVECBIIHN-UHFFFAOYSA-N 0.000 claims 1
- GOFOTPLMUJKBON-UHFFFAOYSA-N 5-[(6-bromo-1,3-benzodioxol-5-yl)methyl]pyrimidine-2,4-diamine Chemical compound NC1=NC(N)=NC=C1CC(C(=C1)Br)=CC2=C1OCO2 GOFOTPLMUJKBON-UHFFFAOYSA-N 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 229910052714 tellurium Inorganic materials 0.000 claims 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 20
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 239000000155 melt Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 10
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 8
- 229910021529 ammonia Inorganic materials 0.000 description 8
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 229960005404 sulfamethoxazole Drugs 0.000 description 4
- JLKIGFTWXXRPMT-UHFFFAOYSA-N sulphamethoxazole Chemical compound O1C(C)=CC(NS(=O)(=O)C=2C=CC(N)=CC=2)=N1 JLKIGFTWXXRPMT-UHFFFAOYSA-N 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- OOLOAWZLPBDRJQ-UHFFFAOYSA-N 2-benzylpyrimidine Chemical class N=1C=CC=NC=1CC1=CC=CC=C1 OOLOAWZLPBDRJQ-UHFFFAOYSA-N 0.000 description 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- AZVRQGHQVPBIHL-UHFFFAOYSA-N 2-amino-n-(4,5-dimethylpyrimidin-2-yl)benzenesulfonamide Chemical compound N1=C(C)C(C)=CN=C1NS(=O)(=O)C1=CC=CC=C1N AZVRQGHQVPBIHL-UHFFFAOYSA-N 0.000 description 1
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- NHUHCSRWZMLRLA-UHFFFAOYSA-N Sulfisoxazole Chemical compound CC1=NOC(NS(=O)(=O)C=2C=CC(N)=CC=2)=C1C NHUHCSRWZMLRLA-UHFFFAOYSA-N 0.000 description 1
- PJSFRIWCGOHTNF-UHFFFAOYSA-N Sulphormetoxin Chemical compound COC1=NC=NC(NS(=O)(=O)C=2C=CC(N)=CC=2)=C1OC PJSFRIWCGOHTNF-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- FJWLWIRHZOHPIY-UHFFFAOYSA-N potassium;hydroiodide Chemical compound [K].I FJWLWIRHZOHPIY-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- ZZORFUFYDOWNEF-UHFFFAOYSA-N sulfadimethoxine Chemical compound COC1=NC(OC)=CC(NS(=O)(=O)C=2C=CC(N)=CC=2)=N1 ZZORFUFYDOWNEF-UHFFFAOYSA-N 0.000 description 1
- 229960000973 sulfadimethoxine Drugs 0.000 description 1
- 229960000654 sulfafurazole Drugs 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
- C07D239/49—Two nitrogen atoms with an aralkyl radical, or substituted aralkyl radical, attached in position 5, e.g. trimethoprim
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH897069A CH513181A (de) | 1969-06-12 | 1969-06-12 | Verfahren zur Herstellung von N-Oxyden von Benzylpyrimidinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2026997A1 true DE2026997A1 (enExample) | 1970-12-23 |
Family
ID=4346865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702026997 Pending DE2026997A1 (enExample) | 1969-06-12 | 1970-06-02 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3715357A (enExample) |
| AT (1) | AT294843B (enExample) |
| BE (1) | BE751790A (enExample) |
| BR (1) | BR6915095D0 (enExample) |
| CA (1) | CA955944A (enExample) |
| CH (1) | CH513181A (enExample) |
| DE (1) | DE2026997A1 (enExample) |
| DK (1) | DK124682B (enExample) |
| ES (1) | ES380642A1 (enExample) |
| FR (1) | FR2052954B1 (enExample) |
| GB (1) | GB1256849A (enExample) |
| IE (1) | IE34683B1 (enExample) |
| IL (1) | IL34632A (enExample) |
| NL (1) | NL7008610A (enExample) |
| NO (1) | NO127237B (enExample) |
| SE (1) | SE367412B (enExample) |
| YU (1) | YU33390B (enExample) |
| ZA (1) | ZA703569B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3993761A (en) * | 1971-12-01 | 1976-11-23 | Hoffmann-La Roche Inc. | Antibacterial compositions |
| BE792096A (fr) * | 1971-12-01 | 1973-05-30 | Hoffmann La Roche | Nouvelles benzylpyrimidines |
| AR204082A1 (es) * | 1972-06-26 | 1975-11-20 | Hoffmann La Roche | Procedimiento para preparar derivados de n-oxidos de 2,4-diamino-5-(3-metoxi-4,5-metilendioxibencil)pirimidina |
| US4515948A (en) * | 1973-09-12 | 1985-05-07 | Hoffmann-La Roche Inc. | 2,4-Diamino-5-(4-amino and 4-dimethylamino-3,5-dimethoxy benzyl)pyrimidines |
| CH591457A5 (enExample) * | 1973-11-08 | 1977-09-15 | Hoffmann La Roche | |
| US4076810A (en) * | 1973-11-08 | 1978-02-28 | Hoffmann-La Roche Inc. | Benzylpyrimidine antibacterial composition |
| WO2003043979A2 (en) * | 2001-11-20 | 2003-05-30 | Dana Farber Cancer Institute | Pharmaceutically active compounds and methods of use thereof |
| HRP20120901T1 (hr) * | 2004-03-05 | 2012-12-31 | F. Hoffmann - La Roche Ag | Diaminopirimidini kao p2x3 i p2x2/3 |
| JP4850912B2 (ja) * | 2005-09-01 | 2012-01-11 | エフ.ホフマン−ラ ロシュ アーゲー | P2x3およびp3x2/3モジュレーターとしてのジアミノピリミジン |
| WO2007025901A1 (en) * | 2005-09-01 | 2007-03-08 | F. Hoffmann-La Roche Ag | Diaminopyrimidines as p2x3 and p2x2/3 modulators |
| CA2619919C (en) * | 2005-09-01 | 2014-04-01 | F. Hoffmann-La Roche Ag | Diaminopyrimidines as p2x3 and p2x2/3 modulators |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2518130A (en) * | 1945-04-26 | 1950-08-08 | Evans | N-oxides of tertiary amines and process of preparing same |
| US2500131A (en) * | 1945-06-27 | 1950-03-07 | Ralph L Evans | Di-nu-oxides of amino-substituted acridines and quinolines |
| US3159628A (en) * | 1962-05-28 | 1964-12-01 | Smith Kline French Lab | Pteridine-5-oxide derivatives |
| FR1453056A (fr) * | 1964-11-12 | 1966-04-15 | Hoffmann La Roche | Procédé pour la préparation de dérivés de pyrimidine |
| US3485840A (en) * | 1964-11-12 | 1969-12-23 | Hoffmann La Roche | 2,4-diamino - 5 - (2',4',5'-substituted benzyl) pyrimidines,intermediates and processes |
| US3461461A (en) * | 1965-11-01 | 1969-08-12 | Upjohn Co | 6-amino-4-(substituted amino)-1,2-dihydro-1-hydroxy-2-iminopyrimidines |
| US3464987A (en) * | 1966-02-21 | 1969-09-02 | Upjohn Co | 1,2-dihydro-1-hydroxy-2-imino-6-(lower alkyl)pyrimidines |
-
1969
- 1969-06-12 CH CH897069A patent/CH513181A/de not_active IP Right Cessation
- 1969-12-15 BR BR215095/69A patent/BR6915095D0/pt unknown
-
1970
- 1970-05-25 YU YU01328/70A patent/YU33390B/xx unknown
- 1970-05-26 ZA ZA703569A patent/ZA703569B/xx unknown
- 1970-06-01 IL IL34632A patent/IL34632A/xx unknown
- 1970-06-02 SE SE07642/70A patent/SE367412B/xx unknown
- 1970-06-02 DE DE19702026997 patent/DE2026997A1/de active Pending
- 1970-06-04 US US00043607A patent/US3715357A/en not_active Expired - Lifetime
- 1970-06-08 GB GB1256849D patent/GB1256849A/en not_active Expired
- 1970-06-09 IE IE745/70A patent/IE34683B1/xx unknown
- 1970-06-11 AT AT526070A patent/AT294843B/de not_active IP Right Cessation
- 1970-06-11 ES ES380642A patent/ES380642A1/es not_active Expired
- 1970-06-11 CA CA085,216A patent/CA955944A/en not_active Expired
- 1970-06-11 NO NO02284/70A patent/NO127237B/no unknown
- 1970-06-11 FR FR707021418A patent/FR2052954B1/fr not_active Expired
- 1970-06-11 DK DK303870AA patent/DK124682B/da unknown
- 1970-06-11 BE BE751790D patent/BE751790A/xx unknown
- 1970-06-12 NL NL7008610A patent/NL7008610A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES380642A1 (es) | 1972-10-16 |
| DK124682B (da) | 1972-11-13 |
| NO127237B (enExample) | 1973-05-28 |
| IL34632A0 (en) | 1970-08-19 |
| GB1256849A (enExample) | 1971-12-15 |
| IL34632A (en) | 1973-08-29 |
| IE34683B1 (en) | 1975-07-23 |
| FR2052954B1 (enExample) | 1973-08-10 |
| AT294843B (de) | 1971-12-10 |
| NL7008610A (enExample) | 1970-12-15 |
| BR6915095D0 (pt) | 1973-03-08 |
| IE34683L (en) | 1970-12-12 |
| BE751790A (fr) | 1970-12-11 |
| CH513181A (de) | 1971-09-30 |
| YU33390B (en) | 1976-12-31 |
| CA955944A (en) | 1974-10-08 |
| FR2052954A1 (enExample) | 1971-04-16 |
| YU132870A (en) | 1976-06-30 |
| SE367412B (enExample) | 1974-05-27 |
| US3715357A (en) | 1973-02-06 |
| ZA703569B (en) | 1971-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0042593A1 (de) | Aryloxypropanolamine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3132613A1 (de) | Imidazolderivate | |
| DE3603577A1 (de) | Neue substituierte 2,4-diamino-5-benzylpyrimidine, deren herstellung und deren verwendung als arzneimittel mit antibakterieller wirksamkeit | |
| DE2026997A1 (enExample) | ||
| WO1982000824A1 (en) | 1h and 2h indazol derivatives and medicaments containing them | |
| DE2523103A1 (de) | Neue propargyl-2-phenylamino-imidazoline-(2), deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE2639135A1 (de) | 1-carbamoyl-5-fluorouracilderivate und ihre verwendung zur tumortherapie | |
| DE19816857A1 (de) | Neue unsymmetrisch substituierte Xanthin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DE2509471A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| Heymann et al. | Derivatives of p, p'-Diaminodiphenyl Sulfone1a | |
| DE2804518A1 (de) | Oxadiazolopyrimidin-derivate | |
| DE1149010B (de) | Verfahren zur Herstellung von 1-[2-Alkyl-4-aminopyrimidyl-(5)-methyl]-alkylpyridiniumsalzen | |
| DE1250828B (de) | Verfahren zur Herstellung des spasmolytisch wirksamen 6,7,3',4' - Tetraäthoxy -l-benzyliden-1,2,3,4tetrahydroisochinolins und seiner Salze | |
| DE2166270C3 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| DE2322350A1 (de) | 1,8-naphthyridin-2(1h)-on-derivate und verfahren zu ihrer herstellung | |
| DE2122070A1 (de) | 1 Veratryl 4 methyl 5 athyl 7,8 dimethoxy 2,3 diazabicyclo eckige Klam mer auf 5,4,0 eckige Klammer zu undeca pentaen (1,3,6,8,10) und seine Verwendung | |
| DE3529872A1 (de) | Neue tetraoxoverbindungen | |
| EP0113911B1 (de) | Pyrido-triazolochinazoline, ihre Herstellung und Verwendung | |
| DE2259471A1 (de) | Neue 6-aza-3h-1,4-benzodiazepine | |
| DE2103134C3 (de) | 2-Aminoindazolo [1,2-b] phthalazin- 6-(11H), 13-dion, Verfahren zu dessen Herstellung sowie dieses enthaltende Arzneimittel | |
| DE2306001C3 (de) | Pyrimidinderivate, Verfahren zu deren Herstellung und diese enthaltende Geflügelfutterzusammensetzungen | |
| DE2038922A1 (de) | Organische Thiazolopyrimidine | |
| DE2147103A1 (de) | Neue Imidazo eckige Klammer auf 4,5 b eckige Klammer zu pyridinderivate, ihre Herstellung und die Zusammensetzun gen, die sie enthalten | |
| EP0040685A2 (de) | Lysergsäurederivate und deren pharmazeutische Zubereitungen | |
| DE1233406B (de) | Verfahren zur Herstellung von 4, 6, 7-Triaminopteridinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |