DE2020890C3 - Verfahren zur Herstellung von Propionaldehyd - Google Patents
Verfahren zur Herstellung von PropionaldehydInfo
- Publication number
- DE2020890C3 DE2020890C3 DE2020890A DE2020890A DE2020890C3 DE 2020890 C3 DE2020890 C3 DE 2020890C3 DE 2020890 A DE2020890 A DE 2020890A DE 2020890 A DE2020890 A DE 2020890A DE 2020890 C3 DE2020890 C3 DE 2020890C3
- Authority
- DE
- Germany
- Prior art keywords
- propionaldehyde
- allyl
- catalysts
- acid
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 title claims description 48
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 title claims description 24
- 238000000034 method Methods 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 239000003054 catalyst Substances 0.000 claims description 20
- -1 carboxylic acid allyl ester Chemical class 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000007519 polyprotic acids Polymers 0.000 claims description 3
- 150000003460 sulfonic acids Chemical class 0.000 claims description 3
- 125000005599 alkyl carboxylate group Chemical group 0.000 claims 1
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 230000008707 rearrangement Effects 0.000 description 5
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 4
- 235000011007 phosphoric acid Nutrition 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- LYJHVEDILOKZCG-UHFFFAOYSA-N Allyl benzoate Chemical compound C=CCOC(=O)C1=CC=CC=C1 LYJHVEDILOKZCG-UHFFFAOYSA-N 0.000 description 3
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000006317 isomerization reaction Methods 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- JSDZSLGMRRSAHD-UHFFFAOYSA-N 3-methylbutan-2-ylcyclopropane Chemical compound CC(C)C(C)C1CC1 JSDZSLGMRRSAHD-UHFFFAOYSA-N 0.000 description 2
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910002090 carbon oxide Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000008246 gaseous mixture Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- DHRLEVQXOMLTIM-UHFFFAOYSA-N phosphoric acid;trioxomolybdenum Chemical compound O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.OP(O)(O)=O DHRLEVQXOMLTIM-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- RMZIOVJHUJAAEY-UHFFFAOYSA-N Allyl butyrate Chemical compound CCCC(=O)OCC=C RMZIOVJHUJAAEY-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- OHAVYOCBYILSBZ-UHFFFAOYSA-M dihydroxyboron;hydroxy(dioxo)tungsten Chemical compound O[B]O.O[W](=O)=O OHAVYOCBYILSBZ-UHFFFAOYSA-M 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910003439 heavy metal oxide Inorganic materials 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000003863 metallic catalyst Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- IYDGMDWEHDFVQI-UHFFFAOYSA-N phosphoric acid;trioxotungsten Chemical compound O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.OP(O)(O)=O IYDGMDWEHDFVQI-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- QNBDJTKBKITRJI-UHFFFAOYSA-N prop-2-enyl 2-methylpropanoate Chemical compound CC(C)C(=O)OCC=C QNBDJTKBKITRJI-UHFFFAOYSA-N 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- CGFYHILWFSGVJS-UHFFFAOYSA-N silicic acid;trioxotungsten Chemical compound O[Si](O)(O)O.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 CGFYHILWFSGVJS-UHFFFAOYSA-N 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/51—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition
- C07C45/54—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition of compounds containing doubly bound oxygen atoms, e.g. esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2020890A DE2020890C3 (de) | 1970-04-29 | 1970-04-29 | Verfahren zur Herstellung von Propionaldehyd |
| CA109784A CA936177A (en) | 1970-04-29 | 1971-04-06 | Process for the preparation of propionaldehyde |
| ZA712516A ZA712516B (en) | 1970-04-29 | 1971-04-20 | Process for the preparation of propionaldehyde |
| GB1295588D GB1295588A (enExample) | 1970-04-29 | 1971-04-23 | |
| NL7105543A NL7105543A (enExample) | 1970-04-29 | 1971-04-23 | |
| CH608571A CH551354A (de) | 1970-04-29 | 1971-04-26 | Verfahren zur herstellung von propionaldehyd. |
| AT360171A AT305964B (de) | 1970-04-29 | 1971-04-27 | Verfahren zur Herstellung von Propionaldehyd |
| BE766360A BE766360A (fr) | 1970-04-29 | 1971-04-27 | Procede de preparation d'aldehyde propionique |
| US137944A US3899539A (en) | 1970-04-29 | 1971-04-27 | Process for the preparation of propionaldehyde |
| FR7115173A FR2090871A5 (enExample) | 1970-04-29 | 1971-04-28 | |
| SE7105503A SE370229B (enExample) | 1970-04-29 | 1971-04-28 | |
| BR2519/71A BR7102519D0 (pt) | 1970-04-29 | 1971-04-28 | Processo para a fabricacao de propiomaldeido |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2020890A DE2020890C3 (de) | 1970-04-29 | 1970-04-29 | Verfahren zur Herstellung von Propionaldehyd |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2020890A1 DE2020890A1 (de) | 1971-11-18 |
| DE2020890B2 DE2020890B2 (de) | 1979-01-11 |
| DE2020890C3 true DE2020890C3 (de) | 1979-09-13 |
Family
ID=5769715
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2020890A Expired DE2020890C3 (de) | 1970-04-29 | 1970-04-29 | Verfahren zur Herstellung von Propionaldehyd |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3899539A (enExample) |
| AT (1) | AT305964B (enExample) |
| BE (1) | BE766360A (enExample) |
| BR (1) | BR7102519D0 (enExample) |
| CA (1) | CA936177A (enExample) |
| CH (1) | CH551354A (enExample) |
| DE (1) | DE2020890C3 (enExample) |
| FR (1) | FR2090871A5 (enExample) |
| GB (1) | GB1295588A (enExample) |
| NL (1) | NL7105543A (enExample) |
| SE (1) | SE370229B (enExample) |
| ZA (1) | ZA712516B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2815539A1 (de) * | 1978-04-11 | 1979-10-25 | Basf Ag | Verfahren zur herstellung von crotonaldehyden |
| US4320229A (en) * | 1980-11-04 | 1982-03-16 | Union Carbide Corporation | Preparation of aliphatic aldehydes from esters |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1714783A (en) * | 1927-04-04 | 1929-05-28 | Consortium Elektrochem Ind | Process for the manufacture of acetaldehyde |
| US2106347A (en) * | 1934-07-13 | 1938-01-25 | Shell Dev | Production of carbonylic compounds |
| US2441540A (en) * | 1943-06-19 | 1948-05-11 | Wyandotte Chemicals Corp | Production of allyl alcohol |
| US3190912A (en) * | 1962-05-02 | 1965-06-22 | Nat Distillers Chem Corp | Process for preparing esters |
-
1970
- 1970-04-29 DE DE2020890A patent/DE2020890C3/de not_active Expired
-
1971
- 1971-04-06 CA CA109784A patent/CA936177A/en not_active Expired
- 1971-04-20 ZA ZA712516A patent/ZA712516B/xx unknown
- 1971-04-23 NL NL7105543A patent/NL7105543A/xx unknown
- 1971-04-23 GB GB1295588D patent/GB1295588A/en not_active Expired
- 1971-04-26 CH CH608571A patent/CH551354A/xx not_active IP Right Cessation
- 1971-04-27 AT AT360171A patent/AT305964B/de not_active IP Right Cessation
- 1971-04-27 US US137944A patent/US3899539A/en not_active Expired - Lifetime
- 1971-04-27 BE BE766360A patent/BE766360A/xx unknown
- 1971-04-28 BR BR2519/71A patent/BR7102519D0/pt unknown
- 1971-04-28 SE SE7105503A patent/SE370229B/xx unknown
- 1971-04-28 FR FR7115173A patent/FR2090871A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2020890B2 (de) | 1979-01-11 |
| NL7105543A (enExample) | 1971-11-02 |
| ZA712516B (en) | 1972-01-26 |
| BR7102519D0 (pt) | 1973-05-03 |
| GB1295588A (enExample) | 1972-11-08 |
| AT305964B (de) | 1973-03-26 |
| BE766360A (fr) | 1971-10-27 |
| US3899539A (en) | 1975-08-12 |
| CH551354A (de) | 1974-07-15 |
| FR2090871A5 (enExample) | 1972-01-14 |
| DE2020890A1 (de) | 1971-11-18 |
| CA936177A (en) | 1973-10-30 |
| SE370229B (enExample) | 1974-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0046840B1 (de) | Verfahren zur oxydativen Dehydrierung von Isobuttersäure zu Methacrylsäure | |
| DE1125901B (de) | Verfahren zur Herstellung von Acrolein | |
| DE2038749B2 (de) | Verfahren zur herstellung von (meth) acrolein durch oxydation von propylen oder isobuten | |
| DE3854973T2 (de) | Verfahren zur Herstellung von Alkoholen durch Niederdruck- hydrierung von Carbonylhaltigen Zusammensetzungen mittels Palladium auf Zinkoxid enthaltenden Katalysatoren. | |
| DE3106945C2 (de) | Verfahren zur Herstellung von Estern der Acrylsäure oder Methacrylsäure | |
| WO2014067600A1 (de) | Verfahren zur herstellung von neopentylglykol | |
| EP0002027A1 (de) | Verfahren zur Herstellung von 2-Buten-1-ol-Verbindungen durch Isomerisierung der entsprechenden 3-Buten-1-ol-Verbindungen | |
| EP0000054B1 (de) | Verfahren zur Herstellung von olefinisch ungesättigten aliphatischen oder cycloaliphatischen Kohlenwasserstoffen | |
| CH511790A (de) | Verfahren zur Herstellung ungesättigter Ester von Carbonsäuren | |
| DE2020890C3 (de) | Verfahren zur Herstellung von Propionaldehyd | |
| US3253018A (en) | Decobalting aldehydic acid ester oxo reaction mixtures using oxalic acid at reflux temperatures and atmospheric pressure | |
| US5550302A (en) | Method for producing an alcohol and catalyst precursor useful for the method | |
| DE2429095C3 (de) | Molybdän, Phosphor, Antimon, Kupfer sowie gegebenenfalls Chrom enthaltender Oxydationskatalysator und dessen Verwendung zur Herstellung von Methacrylsäure | |
| DE69204818T2 (de) | Verfahren zur Herstellung von Isobuten. | |
| DE2103686B2 (de) | Verfahren zur Herstellung von a -Hydroxy- γ -lactonen | |
| DE1618591C3 (de) | Verfahren zur Herstellung ungesättigter Ester von Carbonsäuren | |
| JP3036938B2 (ja) | 飽和炭化水素の酸化方法 | |
| DE2143846C3 (de) | Verfahren zur Herstellung von Indol aus o-Äthylanilin | |
| DE2552652C3 (de) | Verfahren zum Herstellen von Dibenzofuran | |
| EP0012800A1 (de) | Verfahren zur Herstellung von Butan-2,3-dion und Aceton aus Isobutanal | |
| EP0013373B1 (de) | Verfahren zur Herstellung von Tetrahydrofuran | |
| DE2756461C2 (de) | Verfahren zur Herstellung von Mono-o-alkylphenolen | |
| US4742035A (en) | Mixed metal phosphorus oxide catalysts for the oxidative dehydrogenation of carboxylic acids | |
| DE2056034C3 (de) | Verfahren zur Herstellung von Butadien | |
| EP0398099B1 (de) | Verfahren zur Herstellung von Cyclopentanonen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| EHJ | Ceased/non-payment of the annual fee |