DE2013509C3 - - Google Patents
Info
- Publication number
- DE2013509C3 DE2013509C3 DE19702013509 DE2013509A DE2013509C3 DE 2013509 C3 DE2013509 C3 DE 2013509C3 DE 19702013509 DE19702013509 DE 19702013509 DE 2013509 A DE2013509 A DE 2013509A DE 2013509 C3 DE2013509 C3 DE 2013509C3
- Authority
- DE
- Germany
- Prior art keywords
- dinitro
- phenylenediamine
- trifluoromethyl
- diethyl
- grass
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000004215 Carbon black (E152) Substances 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 claims 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 2
- JNYLMODTPLSLIF-UHFFFAOYSA-N 6-(trifluoromethyl)pyridine-3-carboxylic acid Chemical group OC(=O)C1=CC=C(C(F)(F)F)N=C1 JNYLMODTPLSLIF-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- 241000196324 Embryophyta Species 0.000 description 25
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 19
- 239000000047 product Substances 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 150000001412 amines Chemical class 0.000 description 12
- -1 3-chloropropyl Chemical group 0.000 description 11
- 230000006378 damage Effects 0.000 description 11
- 238000009835 boiling Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical class NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 7
- 240000001592 Amaranthus caudatus Species 0.000 description 7
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 7
- 240000003176 Digitaria ciliaris Species 0.000 description 7
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 7
- 235000005476 Digitaria cruciata Nutrition 0.000 description 7
- 235000006830 Digitaria didactyla Nutrition 0.000 description 7
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 7
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 7
- 235000014716 Eleusine indica Nutrition 0.000 description 7
- 235000015225 Panicum colonum Nutrition 0.000 description 7
- 240000002439 Sorghum halepense Species 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 239000004576 sand Substances 0.000 description 7
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 6
- 241000219312 Chenopodium Species 0.000 description 6
- 244000234609 Portulaca oleracea Species 0.000 description 6
- 235000001855 Portulaca oleracea Nutrition 0.000 description 6
- 240000000321 Abutilon grandifolium Species 0.000 description 5
- 240000005528 Arctium lappa Species 0.000 description 5
- 235000003130 Arctium lappa Nutrition 0.000 description 5
- 235000008078 Arctium minus Nutrition 0.000 description 5
- 240000006122 Chenopodium album Species 0.000 description 5
- 235000009344 Chenopodium album Nutrition 0.000 description 5
- 235000003403 Limnocharis flava Nutrition 0.000 description 5
- 244000290719 Paspalidium geminatum Species 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- ZCTYGKMXWWDBCB-UHFFFAOYSA-N 4-(trifluoromethyl)benzene-1,3-diamine Chemical compound NC1=CC=C(C(F)(F)F)C(N)=C1 ZCTYGKMXWWDBCB-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 244000038559 crop plants Species 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 244000038012 Fimbristylis barbata Species 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 2
- GETTZEONDQJALK-UHFFFAOYSA-N (trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1 GETTZEONDQJALK-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VYDLOVROCXEUQP-UHFFFAOYSA-N 1-(1-methoxypropan-2-yl)-2,6-dinitro-4-(trifluoromethyl)cyclohexa-3,5-diene-1,3-diamine Chemical compound CC(COC)C1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N VYDLOVROCXEUQP-UHFFFAOYSA-N 0.000 description 1
- VATYJTRBQKJAAT-UHFFFAOYSA-N 1-(2,2-dimethoxyethyl)-2,6-dinitro-4-(trifluoromethyl)cyclohexa-3,5-diene-1,3-diamine Chemical compound COC(CC1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N)OC VATYJTRBQKJAAT-UHFFFAOYSA-N 0.000 description 1
- UTCUWAIJXJWNTQ-UHFFFAOYSA-N 1-cyclohexyl-2,6-dinitro-4-(trifluoromethyl)cyclohexa-3,5-diene-1,3-diamine Chemical compound C1(CCCCC1)C1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N UTCUWAIJXJWNTQ-UHFFFAOYSA-N 0.000 description 1
- PREJOWIFBWZKIN-UHFFFAOYSA-N 1-methyl-2,6-dinitro-4-(trifluoromethyl)cyclohexa-3,5-diene-1,3-diamine Chemical compound CC1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N PREJOWIFBWZKIN-UHFFFAOYSA-N 0.000 description 1
- DPQYRXNRGNLPFC-UHFFFAOYSA-N 2,4-dichloro-1,3-dinitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=C(Cl)C([N+]([O-])=O)=C1Cl DPQYRXNRGNLPFC-UHFFFAOYSA-N 0.000 description 1
- KALSHRGEFLVFHE-UHFFFAOYSA-N 2,4-dichloro-1-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(Cl)C=C1Cl KALSHRGEFLVFHE-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- OTMGRWAAWZZGNV-UHFFFAOYSA-N 3-chloro-n,n-dimethyl-2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound CN(C)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C(Cl)=C1[N+]([O-])=O OTMGRWAAWZZGNV-UHFFFAOYSA-N 0.000 description 1
- OJPSFJLSZZTSDF-UHFFFAOYSA-N 3-ethoxyprop-1-ene Chemical group CCOCC=C OJPSFJLSZZTSDF-UHFFFAOYSA-N 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- QREPUIHPDHUEQM-UHFFFAOYSA-N BrCCC1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N Chemical compound BrCCC1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N QREPUIHPDHUEQM-UHFFFAOYSA-N 0.000 description 1
- KLBLMAWYKQYAKR-UHFFFAOYSA-N C(C)(CC)C1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N Chemical compound C(C)(CC)C1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N KLBLMAWYKQYAKR-UHFFFAOYSA-N 0.000 description 1
- NPLYTCKXHBHHEP-UHFFFAOYSA-N CCC(CC)C1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N Chemical compound CCC(CC)C1(C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)N)[N+](=O)[O-])N NPLYTCKXHBHHEP-UHFFFAOYSA-N 0.000 description 1
- GRDOFXVYPXIRBE-UHFFFAOYSA-N COCCCNC(C([N+]([O-])=O)=C(C(C(F)(F)F)=C1)N)=C1[N+]([O-])=O Chemical compound COCCCNC(C([N+]([O-])=O)=C(C(C(F)(F)F)=C1)N)=C1[N+]([O-])=O GRDOFXVYPXIRBE-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 235000010716 Vigna mungo Nutrition 0.000 description 1
- 240000001417 Vigna umbellata Species 0.000 description 1
- 235000011453 Vigna umbellata Nutrition 0.000 description 1
- MKKVKFWHNPAATH-UHFFFAOYSA-N [C].N Chemical compound [C].N MKKVKFWHNPAATH-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- DKOQGJHPHLTOJR-WHRDSVKCSA-N cefpirome Chemical compound N([C@@H]1C(N2C(=C(C[N+]=3C=4CCCC=4C=CC=3)CS[C@@H]21)C([O-])=O)=O)C(=O)\C(=N/OC)C1=CSC(N)=N1 DKOQGJHPHLTOJR-WHRDSVKCSA-N 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000001609 comparable effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000004042 decolorization Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 235000008216 herbs Nutrition 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000002035 hexane extract Substances 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000000116 mitigating effect Effects 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- GAZIBGHLWYHBDT-UHFFFAOYSA-N n-propylpropan-1-amine;hydrochloride Chemical compound Cl.CCCNCCC GAZIBGHLWYHBDT-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 239000012178 vegetable wax Substances 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81230769A | 1969-04-01 | 1969-04-01 | |
| US81230769 | 1969-04-01 | ||
| US87550869A | 1969-11-10 | 1969-11-10 | |
| US87550869 | 1969-11-10 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2013509A1 DE2013509A1 (de) | 1970-10-08 |
| DE2013509B2 DE2013509B2 (de) | 1976-10-07 |
| DE2013509C3 true DE2013509C3 (enrdf_load_stackoverflow) | 1977-05-12 |
Family
ID=27123590
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702013509 Granted DE2013509B2 (de) | 1969-04-01 | 1970-03-20 | Neue 6-trifluormethyl-2,4-dinitro-1,3- phenylendiamine |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3617252A (enrdf_load_stackoverflow) |
| DE (1) | DE2013509B2 (enrdf_load_stackoverflow) |
| ES (1) | ES378033A1 (enrdf_load_stackoverflow) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3933467A (en) * | 1970-07-28 | 1976-01-20 | Basf Aktiengesellschaft | Substituted nitroanilines and substituted 1, 3, 5-triazines as herbicidal mixtures |
| US3910783A (en) * | 1970-11-02 | 1975-10-07 | United States Borax Chem | Dinitro-1,3-p |
| CA1106390A (en) * | 1974-12-04 | 1981-08-04 | Don L. Hunter | Nitrophenylhydrazine compounds |
| US4201724A (en) * | 1975-02-20 | 1980-05-06 | United States Borax & Chemical Corp. | N3 -(Cycloalkyl)alkyl-2,4-dinitro-6-trifluoromethyl-1,3-phenylenediamine compounds |
| US4054441A (en) * | 1975-10-02 | 1977-10-18 | Eli Lilly And Company | Substituted (α,α,α-trifluoro-2,6-dinitro-p-tolyl)hydrazines |
| US3979453A (en) * | 1975-06-23 | 1976-09-07 | Eli Lilly And Company | 3-Cyanamino-2,6-dinitroanilines |
| US4078000A (en) * | 1976-11-22 | 1978-03-07 | Olin Corporation | Method of isolating and recovering 2,4-dinitro-N-substituted-1,3-phenylenediamine compounds |
| US4133672A (en) * | 1977-02-07 | 1979-01-09 | United States Borax & Chemical Corporation | (Aminophenyl)morpholines and use thereof |
| EP0434613B1 (de) | 1989-12-13 | 1995-05-03 | Ciba-Geigy Ag | Synergistisch wirkendes Mittel und Verfahren zur Regulierung des Pflanzenwuchses |
| EP2052612A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037629A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN101723839B (zh) * | 2009-11-16 | 2011-09-14 | 浙江省诸暨合力化学对外贸易有限公司 | 一种氨基丙氟灵的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3442639A (en) * | 1965-12-22 | 1969-05-06 | Lilly Co Eli | Process of selectively eliminating weeds |
| US3466329A (en) * | 1967-03-03 | 1969-09-09 | Lilly Co Eli | N2,n2-dialkyl-3-nitro-5-trifluoromethyl-0-phenylenediamines |
-
1969
- 1969-11-10 US US875508A patent/US3617252A/en not_active Expired - Lifetime
-
1970
- 1970-03-20 DE DE19702013509 patent/DE2013509B2/de active Granted
- 1970-03-30 ES ES378033A patent/ES378033A1/es not_active Expired
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2218097C2 (enrdf_load_stackoverflow) | ||
| DE2013509C3 (enrdf_load_stackoverflow) | ||
| DE2603877C2 (de) | Oxadiazolinonverbindungen, ihre Herstellung und sie enthaltendes Mittel | |
| DE2013509B2 (de) | Neue 6-trifluormethyl-2,4-dinitro-1,3- phenylendiamine | |
| EP0028829B1 (de) | Harnstoffe mit cyclischen Substituenten, ihre Herstellung und Verwendung als Herbizide | |
| DE2422807A1 (de) | Salze von phosphonsaeuren | |
| DE1618644B2 (de) | N-(Cyclohexen-l-yl)- a -chloracetamide, Verfahren zu ihrer Herstellung und sie enthaltende Herbicide | |
| DE2013508C3 (de) | 6-Halo-2,4-dinitro-,3-phenylendiamine | |
| DD153845A5 (de) | Verfahren zur herstellung unsymmetrischer thiophosphonatverbindungen | |
| DE2813281C2 (de) | N-substituierte Bis-Carbamoyloximinodisulfidverbindungen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Pestizide | |
| DE1116469B (de) | Selektive herbicide Mittel | |
| DE1542972C3 (de) | Herbicide Mittel | |
| DE2013510C3 (de) | Verwendung von 6-Trifluormethyl-2,4- dinitro-1,3-phenylendiaminen als Herbizide | |
| DE2055399C3 (de) | 3-Chlor-oder 3-Brom-2,6-dinitro-4trifluormethylaniline | |
| DE2655212A1 (de) | Aminothiocarbamate, verfahren zu ihrer herstellung und diese enthaltende pestizide | |
| DE2136616A1 (de) | 2,4 Dinitro 1,3 phenylendiamine und ihre Verwendung | |
| DD139788A5 (de) | Pflanzenwuchsregulierende mittel | |
| DE2451899A1 (de) | Triazindionverbindungen | |
| DE2601447B2 (de) | Cyclohexenon-derivate, verfahren zu deren herstellung und diese enthaltende herbizide mittel | |
| DE2457599A1 (de) | Pyran-derivate und ihre verwendung als herbicide | |
| DE1542956B2 (de) | N-carbyloxymethyl-substituierte 2-alkyl-6-tert.-butyl-anilide und herbicide zubereitungen | |
| DE2363602A1 (de) | Nitrobenzolderivate | |
| DE2548898A1 (de) | Benzothiazolderivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE2146756A1 (de) | Triazine, Verfahren zu deren Herstellung und deren Verwendung | |
| DE3038083A1 (de) | 5-(2'-chlor-4'-trifluormethylphenoxy)-2-nitrostyrolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende herbizide mittel |