DE19719397A1 - Bleichaktive Metall-Komplexe - Google Patents
Bleichaktive Metall-KomplexeInfo
- Publication number
- DE19719397A1 DE19719397A1 DE19719397A DE19719397A DE19719397A1 DE 19719397 A1 DE19719397 A1 DE 19719397A1 DE 19719397 A DE19719397 A DE 19719397A DE 19719397 A DE19719397 A DE 19719397A DE 19719397 A1 DE19719397 A1 DE 19719397A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compounds
- iii
- integer
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229910052751 metal Inorganic materials 0.000 title description 18
- 239000002184 metal Substances 0.000 title description 18
- 239000011572 manganese Substances 0.000 claims abstract description 16
- 239000002253 acid Substances 0.000 claims abstract description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims abstract description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 239000003446 ligand Substances 0.000 claims abstract description 7
- 150000003839 salts Chemical group 0.000 claims abstract description 7
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 6
- 239000010941 cobalt Substances 0.000 claims abstract description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 5
- 125000000732 arylene group Chemical group 0.000 claims abstract description 3
- 150000004696 coordination complex Chemical class 0.000 claims abstract description 3
- 125000002993 cycloalkylene group Chemical group 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 32
- 238000004061 bleaching Methods 0.000 claims description 26
- 239000003599 detergent Substances 0.000 claims description 26
- 230000003647 oxidation Effects 0.000 claims description 16
- 238000007254 oxidation reaction Methods 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 15
- 229910052748 manganese Inorganic materials 0.000 claims description 15
- 239000012459 cleaning agent Substances 0.000 claims description 11
- 239000007844 bleaching agent Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 239000004753 textile Substances 0.000 claims description 9
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 5
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 229910020366 ClO 4 Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 2
- GBXQPDCOMJJCMJ-UHFFFAOYSA-M trimethyl-[6-(trimethylazaniumyl)hexyl]azanium;bromide Chemical compound [Br-].C[N+](C)(C)CCCCCC[N+](C)(C)C GBXQPDCOMJJCMJ-UHFFFAOYSA-M 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- -1 sulpho, carboxyl Chemical group 0.000 abstract description 39
- 125000003118 aryl group Chemical group 0.000 abstract description 4
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- 125000002947 alkylene group Chemical group 0.000 abstract description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 abstract description 2
- 229910018828 PO3H2 Inorganic materials 0.000 abstract 1
- 229910006069 SO3H Inorganic materials 0.000 abstract 1
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 21
- 125000006290 2-hydroxybenzyl group Chemical group [H]OC1=C(C([H])=C([H])C([H])=C1[H])C([H])([H])* 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 239000011734 sodium Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 239000000344 soap Substances 0.000 description 8
- 239000007788 liquid Substances 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 239000012190 activator Substances 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 150000002978 peroxides Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 125000000129 anionic group Chemical group 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000002736 nonionic surfactant Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical class [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 244000269722 Thea sinensis Species 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- CESXSDZNZGSWSP-UHFFFAOYSA-L manganese(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Mn+2].CC([O-])=O.CC([O-])=O CESXSDZNZGSWSP-UHFFFAOYSA-L 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- TURKNCYEUMUFNK-UHFFFAOYSA-N 2-[[2-[(2-hydroxyphenyl)methylideneamino]ethylamino]methyl]phenol Chemical compound OC1=CC=CC=C1CNCCN=CC1=CC=CC=C1O TURKNCYEUMUFNK-UHFFFAOYSA-N 0.000 description 2
- 240000004160 Capsicum annuum Species 0.000 description 2
- 235000008534 Capsicum annuum var annuum Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000001511 capsicum annuum Substances 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical class OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- ZJSCDDIGFJQVAC-UHFFFAOYSA-N 2-[(2-aminoethylamino)methyl]phenol Chemical compound NCCNCC1=CC=CC=C1O ZJSCDDIGFJQVAC-UHFFFAOYSA-N 0.000 description 1
- QYCOIDDSGOZUPC-UHFFFAOYSA-N 2-[[(2-aminocyclohexyl)amino]methyl]phenol Chemical compound NC1CCCCC1NCC1=CC=CC=C1O QYCOIDDSGOZUPC-UHFFFAOYSA-N 0.000 description 1
- CDWPADROTYJKQB-UHFFFAOYSA-N 2-[[2-[(2-hydroxyphenyl)methylideneamino]ethyl-methylamino]methyl]phenol Chemical compound CN(CCN=Cc1ccccc1O)Cc1ccccc1O CDWPADROTYJKQB-UHFFFAOYSA-N 0.000 description 1
- QBONJTWTMGVHQM-UHFFFAOYSA-N 2-[[6-[(2-hydroxyphenyl)methylideneamino]pyridin-2-yl]iminomethyl]phenol Chemical compound OC1=CC=CC=C1C=NC1=CC=CC(N=CC=2C(=CC=CC=2)O)=N1 QBONJTWTMGVHQM-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- FAGGUIDTQQXDSJ-UHFFFAOYSA-N 3-benzoylazepan-2-one Chemical compound C=1C=CC=CC=1C(=O)C1CCCCNC1=O FAGGUIDTQQXDSJ-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 1
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- SHBUUTHKGIVMJT-UHFFFAOYSA-N Hydroxystearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OO SHBUUTHKGIVMJT-UHFFFAOYSA-N 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- 239000001083 [(2R,3R,4S,5R)-1,2,4,5-tetraacetyloxy-6-oxohexan-3-yl] acetate Substances 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- UMOCTOABZLZZJS-UHFFFAOYSA-N [Fe].OC1=C(CNCCN=CC2=C(C=CC(=C2)[N+](=O)[O-])O)C=CC=C1 Chemical compound [Fe].OC1=C(CNCCN=CC2=C(C=CC(=C2)[N+](=O)[O-])O)C=CC=C1 UMOCTOABZLZZJS-UHFFFAOYSA-N 0.000 description 1
- YMHCEJMFKAQVHY-UHFFFAOYSA-N [Fe].OC1=C(CNCCN=CC2=C(C=CC=C2)O)C=CC=C1 Chemical compound [Fe].OC1=C(CNCCN=CC2=C(C=CC=C2)O)C=CC=C1 YMHCEJMFKAQVHY-UHFFFAOYSA-N 0.000 description 1
- AXYZBZFMHVUNTB-UHFFFAOYSA-N [Mn].OC1=C(CNCCN=CC2=C(C=CC(=C2)[N+](=O)[O-])O)C=CC=C1 Chemical compound [Mn].OC1=C(CNCCN=CC2=C(C=CC(=C2)[N+](=O)[O-])O)C=CC=C1 AXYZBZFMHVUNTB-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004973 alkali metal peroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229920013820 alkyl cellulose Polymers 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- ZBYYWKJVSFHYJL-UHFFFAOYSA-L cobalt(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Co+2].CC([O-])=O.CC([O-])=O ZBYYWKJVSFHYJL-UHFFFAOYSA-L 0.000 description 1
- DORPUPOUQGGSOZ-UHFFFAOYSA-N cobalt;ethanamine Chemical compound [Co].CCN DORPUPOUQGGSOZ-UHFFFAOYSA-N 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- UNWDCFHEVIWFCW-UHFFFAOYSA-N decanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCC(=O)OO UNWDCFHEVIWFCW-UHFFFAOYSA-N 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- CICFLWYXGGPEOO-UHFFFAOYSA-M dimethyl-octyl-(11-oxo-11-phenoxyundecyl)azanium;chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(C)CCCCCCCCCCC(=O)OC1=CC=CC=C1 CICFLWYXGGPEOO-UHFFFAOYSA-M 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- BRDYCNFHFWUBCZ-UHFFFAOYSA-N dodecaneperoxoic acid Chemical compound CCCCCCCCCCCC(=O)OO BRDYCNFHFWUBCZ-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 235000019990 fruit wine Nutrition 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- LNOZJRCUHSPCDZ-UHFFFAOYSA-L iron(ii) acetate Chemical compound [Fe+2].CC([O-])=O.CC([O-])=O LNOZJRCUHSPCDZ-UHFFFAOYSA-L 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- ONJSLAKTVIZUQS-UHFFFAOYSA-K manganese(3+);triacetate;dihydrate Chemical compound O.O.[Mn+3].CC([O-])=O.CC([O-])=O.CC([O-])=O ONJSLAKTVIZUQS-UHFFFAOYSA-K 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 239000003346 palm kernel oil Substances 0.000 description 1
- 235000019865 palm kernel oil Nutrition 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- HJKYXKSLRZKNSI-UHFFFAOYSA-I pentapotassium;hydrogen sulfate;oxido sulfate;sulfuric acid Chemical compound [K+].[K+].[K+].[K+].[K+].OS([O-])(=O)=O.[O-]S([O-])(=O)=O.OS(=O)(=O)O[O-].OS(=O)(=O)O[O-] HJKYXKSLRZKNSI-UHFFFAOYSA-I 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 235000020095 red wine Nutrition 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- QSKQNALVHFTOQX-UHFFFAOYSA-M sodium nonanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O QSKQNALVHFTOQX-UHFFFAOYSA-M 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- GHKCMSLSUYMTNI-UHFFFAOYSA-M sodium;3-benzoyloxy-4-methylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1OC(=O)C1=CC=CC=C1 GHKCMSLSUYMTNI-UHFFFAOYSA-M 0.000 description 1
- XVESOXRSUKAXRD-UHFFFAOYSA-M sodium;3-benzoyloxy-4-methylbenzoate Chemical compound [Na+].CC1=CC=C(C([O-])=O)C=C1OC(=O)C1=CC=CC=C1 XVESOXRSUKAXRD-UHFFFAOYSA-M 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical class OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C9/00—After-treatment of cellulose pulp, e.g. of wood pulp, or cotton linters ; Treatment of dilute or dewatered pulp or process improvement taking place after obtaining the raw cellulosic material and not provided for elsewhere
- D21C9/10—Bleaching ; Apparatus therefor
- D21C9/1026—Other features in bleaching processes
- D21C9/1042—Use of chelating agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F13/00—Compounds containing elements of Groups 7 or 17 of the Periodic Table
- C07F13/005—Compounds without a metal-carbon linkage
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3932—Inorganic compounds or complexes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Inorganic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Detergent Compositions (AREA)
- Paper (AREA)
- Catalysts (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19719397A DE19719397A1 (de) | 1997-05-07 | 1997-05-07 | Bleichaktive Metall-Komplexe |
| DE59809612T DE59809612D1 (de) | 1997-05-07 | 1998-04-24 | Bleichaktive Metall-Komplexe |
| ES98107528T ES2208997T3 (es) | 1997-05-07 | 1998-04-24 | Complejos metalicos activos sobre el blanqueo. |
| AT98107528T ATE250117T1 (de) | 1997-05-07 | 1998-04-24 | Bleichaktive metall-komplexe |
| EP98107528A EP0877078B1 (de) | 1997-05-07 | 1998-04-24 | Bleichaktive Metall-Komplexe |
| PT98107528T PT877078E (pt) | 1997-05-07 | 1998-04-24 | Complexos metalicos activos como branqueadores |
| DK98107528T DK0877078T3 (da) | 1997-05-07 | 1998-04-24 | Blegaktive metalkomplekser |
| US09/071,551 US5998645A (en) | 1997-05-07 | 1998-05-01 | Bleaching-active metal complexes |
| JP10123553A JPH1192486A (ja) | 1997-05-07 | 1998-05-06 | 漂白活性化金属錯塩 |
| BR9801594A BR9801594A (pt) | 1997-05-07 | 1998-05-06 | Complexos de metais ativos para alvejamento |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19719397A DE19719397A1 (de) | 1997-05-07 | 1997-05-07 | Bleichaktive Metall-Komplexe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE19719397A1 true DE19719397A1 (de) | 1998-11-12 |
Family
ID=7828960
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19719397A Withdrawn DE19719397A1 (de) | 1997-05-07 | 1997-05-07 | Bleichaktive Metall-Komplexe |
| DE59809612T Expired - Fee Related DE59809612D1 (de) | 1997-05-07 | 1998-04-24 | Bleichaktive Metall-Komplexe |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE59809612T Expired - Fee Related DE59809612D1 (de) | 1997-05-07 | 1998-04-24 | Bleichaktive Metall-Komplexe |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US5998645A (enExample) |
| EP (1) | EP0877078B1 (enExample) |
| JP (1) | JPH1192486A (enExample) |
| AT (1) | ATE250117T1 (enExample) |
| BR (1) | BR9801594A (enExample) |
| DE (2) | DE19719397A1 (enExample) |
| DK (1) | DK0877078T3 (enExample) |
| ES (1) | ES2208997T3 (enExample) |
| PT (1) | PT877078E (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19714122A1 (de) * | 1997-04-05 | 1998-10-08 | Clariant Gmbh | Bleichaktive Metall-Komplexe |
| BR9908887A (pt) * | 1998-05-01 | 2000-11-21 | Exxon Chemical Patents Inc | Complexos catalìticos de metal contendo ligando tridentado para polimerização de olefina |
| KR20000005710A (ko) * | 1998-06-05 | 2000-01-25 | 성재갑 | 표백활성화제 |
| DE10304131A1 (de) | 2003-02-03 | 2004-08-05 | Clariant Gmbh | Verwendung von Übergangsmetallkomplexen als Bleichkatalysatoren |
| WO2009000685A1 (en) * | 2007-06-25 | 2008-12-31 | Basf Se | Use of metal complex oxidation catalysts together with zinc compounds in laundry compositions |
| TR201905689T4 (tr) | 2008-04-09 | 2019-05-21 | Basf Se | Hidrazit bileşiklerinin oksidasyon katalizörleri olarak kullanımı. |
| MX2012015285A (es) | 2010-06-28 | 2013-02-07 | Basf Se | Composicion blanqueadora libre de metal. |
| EP2758506B8 (en) * | 2011-09-21 | 2017-05-24 | Ecolab USA Inc. | Use of iron(iii) hydroxymonocarboxylate complexes to enhance lower temperature cleaning in alkaline peroxide cleaning systems |
| CN104145012A (zh) | 2011-10-25 | 2014-11-12 | 巴斯夫欧洲公司 | 丙烯酸酯共聚物作为抗污垢再沉积剂和去污剂在洗衣过程中的用途 |
| RU2014120925A (ru) | 2011-10-25 | 2015-12-10 | Басф Се | Применение гребенчатых или блок-сополимеров в качестве средств против повторного осаждения загрязнения и грязеотталкивающих средств в процессах стирки |
| EP2880096B1 (en) | 2012-08-03 | 2018-01-03 | ExxonMobil Chemical Patents Inc. | Process for preparing polyalphaolefins using modified salan catalyst compounds and polyalphaolefins prepared therewith |
| EP2880097B1 (en) | 2012-08-03 | 2023-10-18 | ExxonMobil Chemical Patents Inc. | Process to prepare a vinyl terminated polyethylene with long chain branching |
| US9120879B2 (en) | 2012-11-02 | 2015-09-01 | Exxonmobil Chemical Patents Inc. | Supported Salan catalysts |
| US9790452B2 (en) | 2013-03-27 | 2017-10-17 | Basf Se | Block copolymers as soil release agents in laundry processes |
| CN105392776B (zh) | 2013-06-20 | 2019-02-12 | 埃克森美孚化学专利公司 | 硫代-Salalen催化剂 |
| KR20160105790A (ko) | 2013-11-27 | 2016-09-07 | 바스프 에스이 | 세탁 방법에서 오염물 방출제로서의 랜덤 공중합체 |
| US9290589B2 (en) | 2013-12-13 | 2016-03-22 | Exxonmobil Chemical Patents Inc. | Cyclopentadienyl-substituted salan catalysts |
| CN106132924B (zh) * | 2014-03-31 | 2019-03-19 | 埃克森美孚化学专利公司 | 亚苯基桥连的salalen催化剂 |
| WO2017186480A1 (en) | 2016-04-26 | 2017-11-02 | Basf Se | Metal free bleaching composition |
Family Cites Families (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2864776A (en) * | 1955-05-06 | 1958-12-16 | Asahi Chemical Ind | Process for preparing sheets of anion exchange resin |
| US2940938A (en) * | 1956-10-05 | 1960-06-14 | Procter & Gamble | Process of making a colloidal suspension of phosphates |
| US3368977A (en) * | 1965-03-23 | 1968-02-13 | Monsanto Co | Built liquid detergent compositions |
| AT291414B (de) * | 1967-01-27 | 1971-07-12 | Unilever Nv | Wasch- und Reinigungsmitell |
| LU52892A1 (enExample) * | 1967-01-27 | 1968-08-28 | ||
| DK129804A (enExample) * | 1969-01-17 | |||
| SE381672B (sv) * | 1971-07-15 | 1975-12-15 | Mo Och Domsjoe Ab | Flytande tvettmedelskomposition |
| GB1370377A (en) * | 1971-11-15 | 1974-10-16 | Procter & Gamble Ltd | Composition and method for cleaning hard surfaces |
| GB1561333A (en) * | 1975-11-03 | 1980-02-20 | Unilever Ltd | Bleaching assistants |
| US4087369A (en) * | 1976-11-08 | 1978-05-02 | The Procter & Gamble Company | Peroxybleach activated detergent composition |
| US4146495A (en) * | 1977-08-22 | 1979-03-27 | Monsanto Company | Detergent compositions comprising polyacetal carboxylates |
| US4144226A (en) * | 1977-08-22 | 1979-03-13 | Monsanto Company | Polymeric acetal carboxylates |
| NL180122C (nl) * | 1977-12-22 | 1987-01-02 | Unilever Nv | Bleekactivator in granulaatvorm. |
| ATE4818T1 (de) * | 1979-11-09 | 1983-10-15 | Unilever Nv | Nicht-waessrige, einen komplexbildner enthaltende fluessige reinigungsmittelzusammensetzung und verfahren zu deren herstellung. |
| US4399049A (en) * | 1981-04-08 | 1983-08-16 | The Procter & Gamble Company | Detergent additive compositions |
| DE3230999A1 (de) * | 1982-08-20 | 1984-02-23 | Philips Kommunikations Industrie AG, 8500 Nürnberg | Verfahren zur zugriffssteuerung bei einem nachrichtensystem |
| DE3684217D1 (de) * | 1985-09-30 | 1992-04-16 | Unilever Nv | Fluessige nichtwaessrige reinigungszusammensetzung und wasserfreies perborat. |
| US4728455A (en) * | 1986-03-07 | 1988-03-01 | Lever Brothers Company | Detergent bleach compositions, bleaching agents and bleach activators |
| GB8607387D0 (en) * | 1986-03-25 | 1986-04-30 | Unilever Plc | Activator compositions |
| GB8607388D0 (en) * | 1986-03-25 | 1986-04-30 | Unilever Plc | Activator compositions |
| ZA876157B (en) * | 1986-08-28 | 1989-04-26 | Colgate Palmolive Co | Nonaqueous liquid nonionic laundry detergent composition and method of use |
| GB8908416D0 (en) * | 1989-04-13 | 1989-06-01 | Unilever Plc | Bleach activation |
| GB8915781D0 (en) * | 1989-07-10 | 1989-08-31 | Unilever Plc | Bleach activation |
| GB9003741D0 (en) * | 1990-02-19 | 1990-04-18 | Unilever Plc | Bleach activation |
| JP3487847B2 (ja) * | 1990-03-21 | 2004-01-19 | リサーチ コーポレイション テクノロジーズ,インコーポレイテッド | キラル触媒及びそれにより触媒されたエポキシ化反応 |
| DE69125310T2 (de) * | 1990-05-21 | 1997-07-03 | Unilever Nv | Bleichmittelaktivierung |
| GB9108136D0 (en) * | 1991-04-17 | 1991-06-05 | Unilever Plc | Concentrated detergent powder compositions |
| GB9124581D0 (en) * | 1991-11-20 | 1992-01-08 | Unilever Plc | Bleach catalyst composition,manufacture and use thereof in detergent and/or bleach compositions |
| EP0544490A1 (en) * | 1991-11-26 | 1993-06-02 | Unilever Plc | Detergent bleach compositions |
| US5194416A (en) * | 1991-11-26 | 1993-03-16 | Lever Brothers Company, Division Of Conopco, Inc. | Manganese catalyst for activating hydrogen peroxide bleaching |
| CA2085642A1 (en) * | 1991-12-20 | 1993-06-21 | Ronald Hage | Bleach activation |
| GB9127060D0 (en) * | 1991-12-20 | 1992-02-19 | Unilever Plc | Bleach activation |
| DE69412188T2 (de) * | 1993-06-19 | 1999-03-11 | Ciba Specialty Chemicals Holding Inc., Basel | Inhibierung der Wiederabsorption von migrierenden Farbstoffen in der Waschlösung |
| DE4416438A1 (de) * | 1994-05-10 | 1995-11-16 | Basf Ag | Ein- oder mehrkernige Metall-Komplexe und ihre Verwendung als Bleich- und Oxidationskatalysatoren |
| WO1996015136A1 (en) * | 1994-11-14 | 1996-05-23 | Dublin Institute Of Technology | Novel mn(ii) carboxylate complexes, processes for their preparation and their use as disproportionation catalysts |
| GB9425296D0 (en) * | 1994-12-15 | 1995-02-15 | Ciba Geigy Ag | Inhibition of dye migration |
| DE19529905A1 (de) * | 1995-08-15 | 1997-02-20 | Henkel Kgaa | Aktivatorkomplexe für Persauerstoffverbindungen |
-
1997
- 1997-05-07 DE DE19719397A patent/DE19719397A1/de not_active Withdrawn
-
1998
- 1998-04-24 DK DK98107528T patent/DK0877078T3/da active
- 1998-04-24 PT PT98107528T patent/PT877078E/pt unknown
- 1998-04-24 ES ES98107528T patent/ES2208997T3/es not_active Expired - Lifetime
- 1998-04-24 AT AT98107528T patent/ATE250117T1/de not_active IP Right Cessation
- 1998-04-24 DE DE59809612T patent/DE59809612D1/de not_active Expired - Fee Related
- 1998-04-24 EP EP98107528A patent/EP0877078B1/de not_active Expired - Lifetime
- 1998-05-01 US US09/071,551 patent/US5998645A/en not_active Expired - Fee Related
- 1998-05-06 BR BR9801594A patent/BR9801594A/pt not_active Application Discontinuation
- 1998-05-06 JP JP10123553A patent/JPH1192486A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| EP0877078B1 (de) | 2003-09-17 |
| BR9801594A (pt) | 1999-06-01 |
| JPH1192486A (ja) | 1999-04-06 |
| PT877078E (pt) | 2004-02-27 |
| DK0877078T3 (da) | 2003-12-22 |
| US5998645A (en) | 1999-12-07 |
| ES2208997T3 (es) | 2004-06-16 |
| DE59809612D1 (de) | 2003-10-23 |
| EP0877078A3 (de) | 1999-03-31 |
| EP0877078A2 (de) | 1998-11-11 |
| ATE250117T1 (de) | 2003-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0869171B1 (de) | Bleichaktive Metall-Komplexe | |
| EP0877078B1 (de) | Bleichaktive Metall-Komplexe | |
| DE69125309T2 (de) | Bleichmittelaktivierung | |
| DE69222620T2 (de) | Bleichaktivierung unter Verwendung einer Mangan- verbindung und einem organischen Ligand | |
| DE69019617T2 (de) | Bleichaktivierung. | |
| DE69511410T2 (de) | Bleichaktivierung | |
| DE69014384T2 (de) | Bleichaktivierung. | |
| DE69533149T2 (de) | Bleichmittelzusammensetzung für Gewebe | |
| DE69216786T2 (de) | Mangan enthaltender Bleichkatalysator und seine Verwendung | |
| DE69906732T2 (de) | Bleichkatalysatoren und sie enthaltende formulierungen | |
| DE60025492T2 (de) | Metallkomplexe von tripodalen liganden | |
| DE69019781T2 (de) | Bleichmittelzusammensetzung. | |
| DE69825166T2 (de) | Wasch- und Bleichzusammensetzungen | |
| EP1148118B1 (de) | Wasch- und Reinigungsmittel enthaltend bleichaktive Dendrimer-Liganden und deren Metallkomplexe | |
| EP0825251A2 (de) | Sulphonylimin-Derivate als Bleichkatalysatoren | |
| EP0909810B1 (de) | Verwendung von Aminonitril-N-oxiden als Bleichaktivatoren | |
| DE19728021A1 (de) | Metall-Komplexe als Bleichaktivatoren | |
| EP1083173B1 (de) | Bleichaktive Metallkomplexe | |
| DE10037162A1 (de) | Bleich- und Oxidationsmittel und ihre Verwendung | |
| KR100647976B1 (ko) | 표백촉매로서 거대고리 망간 착화합물 및 이를 함유한표백제 및 표백세제 조성물 | |
| DE60009272T2 (de) | Wasch-und reinigungsverfahren | |
| DE19801049A1 (de) | Verwendung von Formamidinium-Salzen als Bleichaktivatoren | |
| KR100889652B1 (ko) | 거대고리 망간 착화합물의 용도와 이를 함유한 표백세제조성물 | |
| DE2843116A1 (de) | Peroxybleichen und hierfuer verwendbare zusammensetzungen | |
| DE19738274A1 (de) | Verwendung von Cyanpyridin-N-oxiden als Bleichaktivatoren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |