DE1959308A1 - Farbstoffsalze der Phthaloxyaninreihe - Google Patents
Farbstoffsalze der PhthaloxyaninreiheInfo
- Publication number
- DE1959308A1 DE1959308A1 DE19691959308 DE1959308A DE1959308A1 DE 1959308 A1 DE1959308 A1 DE 1959308A1 DE 19691959308 DE19691959308 DE 19691959308 DE 1959308 A DE1959308 A DE 1959308A DE 1959308 A1 DE1959308 A1 DE 1959308A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- dye
- carbon atoms
- rhodamine
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003839 salts Chemical class 0.000 title claims description 19
- 239000000975 dye Substances 0.000 claims description 36
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical class [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 claims description 20
- -1 hydrocarbon radicals Chemical class 0.000 claims description 19
- 229940043267 rhodamine b Drugs 0.000 claims description 15
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical group [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 239000000981 basic dye Substances 0.000 claims description 10
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000001033 ether group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 239000000976 ink Substances 0.000 claims description 6
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- 125000000565 sulfonamide group Chemical group 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002966 varnish Substances 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000000203 mixture Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 3
- 244000172533 Viola sororia Species 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 239000001045 blue dye Substances 0.000 description 3
- MPMSMUBQXQALQI-UHFFFAOYSA-N cobalt phthalocyanine Chemical compound [Co+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 MPMSMUBQXQALQI-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 235000005811 Viola adunca Nutrition 0.000 description 2
- 240000009038 Viola odorata Species 0.000 description 2
- 235000013487 Viola odorata Nutrition 0.000 description 2
- 235000002254 Viola papilionacea Nutrition 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- NNBFNNNWANBMTI-UHFFFAOYSA-M brilliant green Chemical compound OS([O-])(=O)=O.C1=CC(N(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](CC)CC)C=C1 NNBFNNNWANBMTI-UHFFFAOYSA-M 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 2
- 229940107698 malachite green Drugs 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 239000001022 rhodamine dye Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 239000001018 xanthene dye Substances 0.000 description 2
- MIJDSYMOBYNHOT-UHFFFAOYSA-N 2-(ethylamino)ethanol Chemical compound CCNCCO MIJDSYMOBYNHOT-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 1
- PLYTVAFAKDFFKM-UHFFFAOYSA-N 3,4-dimethylmorpholine Chemical compound CC1COCCN1C PLYTVAFAKDFFKM-UHFFFAOYSA-N 0.000 description 1
- CUFBDUDYFHCIOH-UHFFFAOYSA-N 3-(11-methyldodecoxy)propan-1-amine Chemical compound CC(C)CCCCCCCCCCOCCCN CUFBDUDYFHCIOH-UHFFFAOYSA-N 0.000 description 1
- DVFGEIYOLIFSRX-UHFFFAOYSA-N 3-(2-ethylhexoxy)propan-1-amine Chemical compound CCCCC(CC)COCCCN DVFGEIYOLIFSRX-UHFFFAOYSA-N 0.000 description 1
- NZMUWHNIWFMBNW-UHFFFAOYSA-N 3-(3-methylbutoxy)propan-1-amine Chemical compound CC(C)CCOCCCN NZMUWHNIWFMBNW-UHFFFAOYSA-N 0.000 description 1
- WNESQTLZVOTCIL-UHFFFAOYSA-N 3-(6-methylheptoxy)propan-1-amine Chemical compound CC(C)CCCCCOCCCN WNESQTLZVOTCIL-UHFFFAOYSA-N 0.000 description 1
- HYEOYFUOERFWIX-UHFFFAOYSA-N 3-(7-methyloctoxy)propan-1-amine Chemical compound CC(C)CCCCCCOCCCN HYEOYFUOERFWIX-UHFFFAOYSA-N 0.000 description 1
- TWXCJZHSMRBNGO-UHFFFAOYSA-N 3-decoxypropan-1-amine Chemical compound CCCCCCCCCCOCCCN TWXCJZHSMRBNGO-UHFFFAOYSA-N 0.000 description 1
- ZRJOUVOXPWNFOF-UHFFFAOYSA-N 3-dodecoxypropan-1-amine Chemical compound CCCCCCCCCCCCOCCCN ZRJOUVOXPWNFOF-UHFFFAOYSA-N 0.000 description 1
- NWGJTXNNXLHFSE-UHFFFAOYSA-N 3-hexoxypropan-1-amine Chemical compound CCCCCCOCCCN NWGJTXNNXLHFSE-UHFFFAOYSA-N 0.000 description 1
- AXDJCCTWPBKUKL-UHFFFAOYSA-N 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydron;chloride Chemical compound Cl.C1=CC(=N)C(C)=CC1=C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 AXDJCCTWPBKUKL-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- ZXJXZNDDNMQXFV-UHFFFAOYSA-M crystal violet Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 ZXJXZNDDNMQXFV-UHFFFAOYSA-M 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000003947 ethylamines Chemical class 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000006308 propyl amino group Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical group ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000001003 triarylmethane dye Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B69/00—Dyes not provided for by a single group of this subclass
- C09B69/02—Dyestuff salts, e.g. salts of acid dyes with basic dyes
- C09B69/04—Dyestuff salts, e.g. salts of acid dyes with basic dyes of anionic dyes with nitrogen containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Coloring (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE759422D BE759422A (fr) | 1969-11-26 | Sels de colorants de la serie de la phtalocyanine | |
| DE19691959308 DE1959308A1 (de) | 1969-11-26 | 1969-11-26 | Farbstoffsalze der Phthaloxyaninreihe |
| CH1705470A CH550234A (de) | 1969-11-26 | 1970-11-17 | Verfahren zur herstellung von farbstoffsalzen der phthalocyaninreihe. |
| NL7017110A NL7017110A (enrdf_load_stackoverflow) | 1969-11-26 | 1970-11-23 | |
| FR7042332A FR2068658B1 (enrdf_load_stackoverflow) | 1969-11-26 | 1970-11-25 | |
| GB5604270A GB1322045A (en) | 1969-11-26 | 1970-11-25 | Dye salts of the phthalocyanine series |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691959308 DE1959308A1 (de) | 1969-11-26 | 1969-11-26 | Farbstoffsalze der Phthaloxyaninreihe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1959308A1 true DE1959308A1 (de) | 1971-06-03 |
Family
ID=5752111
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691959308 Pending DE1959308A1 (de) | 1969-11-26 | 1969-11-26 | Farbstoffsalze der Phthaloxyaninreihe |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE759422A (enrdf_load_stackoverflow) |
| CH (1) | CH550234A (enrdf_load_stackoverflow) |
| DE (1) | DE1959308A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2068658B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1322045A (enrdf_load_stackoverflow) |
| NL (1) | NL7017110A (enrdf_load_stackoverflow) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE29607434U1 (de) * | 1996-04-24 | 1996-06-20 | Schlüter-Systems GmbH, 58640 Iserlohn | Vorrichtung zum Sichtabschluß des Mörtelbettes unterhalb von Plattenbelägen auf Terrassen, Balkonen o.dgl. |
| DE29606490U1 (de) * | 1996-04-10 | 1996-07-04 | Schlüter-Systems GmbH, 58640 Iserlohn | Abschlußprofil zur Begrenzung von Balkon- oder Terrassenbelägen |
| DE19510748A1 (de) * | 1995-03-24 | 1996-10-02 | Rudolf Muenkel | Traufen- und Verblendprofilelement für Balkon- und Terrassengrundplatten |
| DE19535187A1 (de) * | 1995-09-22 | 1997-03-27 | Schlueter Systems Gmbh | Trägerprofil zum Anbringen an einer Wand |
| US5960591A (en) * | 1995-09-22 | 1999-10-05 | Schluter-Systems Gmbh | System for securing guttering to the ends of balconies or terraces |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2636427C3 (de) | 1976-08-13 | 1980-07-31 | Basf Ag, 6700 Ludwigshafen | Farbstoffzubereitungen für Cellulose oder cellulosehaltiges Fasermaterial |
| TW200704721A (en) * | 2005-05-10 | 2007-02-01 | Clariant Int Ltd | Anionic phthalocyanine based dyes for use as bca dye in an optical recording layer for blue laser recording |
| US20210309913A1 (en) * | 2018-08-27 | 2021-10-07 | Nitto Denko Corporation | Composition for correcting color blindness |
-
0
- BE BE759422D patent/BE759422A/xx unknown
-
1969
- 1969-11-26 DE DE19691959308 patent/DE1959308A1/de active Pending
-
1970
- 1970-11-17 CH CH1705470A patent/CH550234A/xx not_active IP Right Cessation
- 1970-11-23 NL NL7017110A patent/NL7017110A/xx unknown
- 1970-11-25 FR FR7042332A patent/FR2068658B1/fr not_active Expired
- 1970-11-25 GB GB5604270A patent/GB1322045A/en not_active Expired
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19510748A1 (de) * | 1995-03-24 | 1996-10-02 | Rudolf Muenkel | Traufen- und Verblendprofilelement für Balkon- und Terrassengrundplatten |
| DE19510748C2 (de) * | 1995-03-24 | 1999-04-15 | Rudolf Muenkel | Traufen- und Verblendprofilelement |
| DE19535187A1 (de) * | 1995-09-22 | 1997-03-27 | Schlueter Systems Gmbh | Trägerprofil zum Anbringen an einer Wand |
| DE19535187C2 (de) * | 1995-09-22 | 1998-01-29 | Schlueter Systems Gmbh | Befestigungssystem zum Anbringen von Rinnen an Balkon- oder Terrassenabschlüssen |
| US5960591A (en) * | 1995-09-22 | 1999-10-05 | Schluter-Systems Gmbh | System for securing guttering to the ends of balconies or terraces |
| DE29606490U1 (de) * | 1996-04-10 | 1996-07-04 | Schlüter-Systems GmbH, 58640 Iserlohn | Abschlußprofil zur Begrenzung von Balkon- oder Terrassenbelägen |
| DE29607434U1 (de) * | 1996-04-24 | 1996-06-20 | Schlüter-Systems GmbH, 58640 Iserlohn | Vorrichtung zum Sichtabschluß des Mörtelbettes unterhalb von Plattenbelägen auf Terrassen, Balkonen o.dgl. |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1322045A (en) | 1973-07-04 |
| NL7017110A (enrdf_load_stackoverflow) | 1971-05-28 |
| FR2068658A1 (enrdf_load_stackoverflow) | 1971-08-27 |
| CH550234A (de) | 1974-06-14 |
| BE759422A (fr) | 1971-05-25 |
| FR2068658B1 (enrdf_load_stackoverflow) | 1973-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1959308A1 (de) | Farbstoffsalze der Phthaloxyaninreihe | |
| DE2263235A1 (de) | Heterocyclische metallkomplexverbindungen, ihre herstellung und verwendung | |
| DE2855944C3 (de) | Verfahren zur Herstellung von Pigmentzusammensetzungen | |
| DE3418672A1 (de) | Basische azofarbstoffe | |
| CH630945A5 (de) | Waessrige farbstoffzubereitungen fuer cellulose oder cellulosehaltiges fasermaterial. | |
| DE2018168B2 (de) | Pigmentpraparationen und Ver fahren zu deren Herstellung | |
| DE3413022A1 (de) | Basische azofarbstoffe | |
| DE2404069C2 (enrdf_load_stackoverflow) | ||
| DE2403736A1 (de) | Sulfonsaeuregruppenfreie basische azoverbindungen, ihre herstellung und verwendung | |
| DE1079251B (de) | Verfahren zur Herstellung von Dioxazinpigmentfarbstoffen | |
| EP0189836B1 (de) | Basische Azofarbstoffe | |
| DE2018169C3 (enrdf_load_stackoverflow) | ||
| DE1669083C3 (de) | Farbstoffzubereitungen für Schreibund Druckzwecke | |
| DE1644244A1 (de) | Verfahren zur Herstellung eines Monoazopigments | |
| EP0075202A2 (de) | Farbstoffe für Druckfarben | |
| DE1278042B (de) | Verfahren zur Herstellung von kationischen Farbstoffen | |
| DE2316845A1 (de) | Neue anthrachinonazofarbstoffe | |
| DE1644440C (de) | Verfahren zur Herstellung von Umsetzungsprodukten basischer Farbstoffe | |
| DE494531C (de) | Verfahren zur Darstellung von Oxynitrosofarbstoffen und deren Metallacken | |
| DE694442C (de) | Verfahren zur Herstellung, wasserunloeslicher Disazofarbstoffe | |
| DE1959306C3 (de) | Salze sulfonsäuregruppenhaltiger 1 zu 2-Metallkomplexfarbstoffe und deren Verwendung | |
| DE1794127A1 (de) | Neue Pigmentfarbstoffe | |
| US2255385A (en) | Dyestuffs of the para-rosaniline series | |
| DE1569727C (de) | Verfahren zur Herstellung von Phthalocyaninfarbstoffen | |
| DE1644244C (de) | Monoazopigmentfarbstoff, Verfahren zu dessen Herstellung und dessen Verwendung |