DE1944719B2 - Verfahren zur Herstellung von organischen Isocyanaten durch thermische Spaltung von Urethanen - Google Patents
Verfahren zur Herstellung von organischen Isocyanaten durch thermische Spaltung von UrethanenInfo
- Publication number
- DE1944719B2 DE1944719B2 DE1944719A DE1944719A DE1944719B2 DE 1944719 B2 DE1944719 B2 DE 1944719B2 DE 1944719 A DE1944719 A DE 1944719A DE 1944719 A DE1944719 A DE 1944719A DE 1944719 B2 DE1944719 B2 DE 1944719B2
- Authority
- DE
- Germany
- Prior art keywords
- urethanes
- isocyanate
- carbamate
- urethane
- production
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000012948 isocyanate Substances 0.000 title claims description 35
- 150000002513 isocyanates Chemical class 0.000 title claims description 35
- 238000000034 method Methods 0.000 title claims description 30
- 238000004519 manufacturing process Methods 0.000 title claims description 13
- 150000003673 urethanes Chemical class 0.000 title claims description 12
- 238000003776 cleavage reaction Methods 0.000 title claims description 5
- 230000007017 scission Effects 0.000 title claims description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000002841 Lewis acid Substances 0.000 claims description 12
- 239000003054 catalyst Substances 0.000 claims description 12
- 150000007517 lewis acids Chemical class 0.000 claims description 12
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 8
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 7
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical group Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 claims 2
- OVNKYQIIJBKPOU-UHFFFAOYSA-N Cc1cccc(OC(N)=O)c1OC(N)=O Chemical compound Cc1cccc(OC(N)=O)c1OC(N)=O OVNKYQIIJBKPOU-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- -1 amino compound Chemical class 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- 238000002474 experimental method Methods 0.000 description 8
- 238000000197 pyrolysis Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- PHYURWGMBQTCSY-UHFFFAOYSA-N ethyl n-[3-(ethoxycarbonylamino)-4-methylphenyl]carbamate Chemical compound CCOC(=O)NC1=CC=C(C)C(NC(=O)OCC)=C1 PHYURWGMBQTCSY-UHFFFAOYSA-N 0.000 description 4
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000007233 catalytic pyrolysis Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- JQAOGTOHCZCZGI-UHFFFAOYSA-N ethyl n-isocyanato-n-(2-methylphenyl)carbamate Chemical compound CCOC(=O)N(N=C=O)C1=CC=CC=C1C JQAOGTOHCZCZGI-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000001119 stannous chloride Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- LEGIHXSSKUKHSK-UHFFFAOYSA-N (2-pentylphenyl) carbamate Chemical compound CCCCCC1=CC=CC=C1OC(N)=O LEGIHXSSKUKHSK-UHFFFAOYSA-N 0.000 description 1
- OHWZQGOJLRVRIW-UHFFFAOYSA-N (3-carbamoyloxy-4-methylphenyl) carbamate Chemical compound CC1=CC=C(OC(N)=O)C=C1OC(N)=O OHWZQGOJLRVRIW-UHFFFAOYSA-N 0.000 description 1
- SHXGGYLLZCCNAX-UHFFFAOYSA-N (3-chlorophenyl) carbamate Chemical compound NC(=O)OC1=CC=CC(Cl)=C1 SHXGGYLLZCCNAX-UHFFFAOYSA-N 0.000 description 1
- OAXSVEFCBLZGCA-UHFFFAOYSA-N 1-chloro-4-(isocyanatomethyl)benzene Chemical compound ClC1=CC=C(CN=C=O)C=C1 OAXSVEFCBLZGCA-UHFFFAOYSA-N 0.000 description 1
- IQOIAHPAAZJVOX-UHFFFAOYSA-N 1-isocyanato-3-methoxypropane Chemical compound COCCCN=C=O IQOIAHPAAZJVOX-UHFFFAOYSA-N 0.000 description 1
- BKJABLMNBSVKCV-UHFFFAOYSA-N 1-isocyanato-3-methylsulfanylbenzene Chemical compound CSC1=CC=CC(N=C=O)=C1 BKJABLMNBSVKCV-UHFFFAOYSA-N 0.000 description 1
- WXIOQJUEBPUFHH-UHFFFAOYSA-N 1-isocyanato-4-(2-isocyanatopropan-2-yl)-1-methylcyclohexane Chemical compound O=C=NC(C)(C)C1CCC(C)(N=C=O)CC1 WXIOQJUEBPUFHH-UHFFFAOYSA-N 0.000 description 1
- 239000007848 Bronsted acid Substances 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- ZTIMKJROOYMUMU-UHFFFAOYSA-N butyl n-phenylcarbamate Chemical compound CCCCOC(=O)NC1=CC=CC=C1 ZTIMKJROOYMUMU-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- CGDXDLOPNKYPBU-UHFFFAOYSA-N ethyl n-(1-ethylcyclohexyl)carbamate Chemical compound CCOC(=O)NC1(CC)CCCCC1 CGDXDLOPNKYPBU-UHFFFAOYSA-N 0.000 description 1
- BHIJTTOVTIAITI-UHFFFAOYSA-N ethyl n-[4-(ethoxycarbonylamino)butyl]carbamate Chemical compound CCOC(=O)NCCCCNC(=O)OCC BHIJTTOVTIAITI-UHFFFAOYSA-N 0.000 description 1
- ARNSTSIXMKZQBC-UHFFFAOYSA-N ethyl n-naphthalen-1-ylcarbamate Chemical compound C1=CC=C2C(NC(=O)OCC)=CC=CC2=C1 ARNSTSIXMKZQBC-UHFFFAOYSA-N 0.000 description 1
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 1
- 229960002089 ferrous chloride Drugs 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- UPWPDUACHOATKO-UHFFFAOYSA-K gallium trichloride Chemical compound Cl[Ga](Cl)Cl UPWPDUACHOATKO-UHFFFAOYSA-K 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- HNEGSWZZYCZACE-UHFFFAOYSA-N hexyl n-phenylcarbamate Chemical compound CCCCCCOC(=O)NC1=CC=CC=C1 HNEGSWZZYCZACE-UHFFFAOYSA-N 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- 235000014413 iron hydroxide Nutrition 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 235000013980 iron oxide Nutrition 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical class [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 1
- 239000011968 lewis acid catalyst Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- OKBJVCWRESLMMD-UHFFFAOYSA-N methyl n-(4-methylphenyl)carbamate Chemical compound COC(=O)NC1=CC=C(C)C=C1 OKBJVCWRESLMMD-UHFFFAOYSA-N 0.000 description 1
- OZXBLDXVIIDKNA-UHFFFAOYSA-N methyl n-butan-2-ylcarbamate Chemical compound CCC(C)NC(=O)OC OZXBLDXVIIDKNA-UHFFFAOYSA-N 0.000 description 1
- PWFYXEJZPCACLT-UHFFFAOYSA-N methyl n-propan-2-ylcarbamate Chemical compound COC(=O)NC(C)C PWFYXEJZPCACLT-UHFFFAOYSA-N 0.000 description 1
- HBCAQUUDOCPMTB-UHFFFAOYSA-N methyl n-tert-butylcarbamate Chemical compound COC(=O)NC(C)(C)C HBCAQUUDOCPMTB-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 description 1
- BXBUGIFDTNEDNS-UHFFFAOYSA-N propan-2-yl n-[3-(trifluoromethyl)phenyl]carbamate Chemical compound CC(C)OC(=O)NC1=CC=CC(C(F)(F)F)=C1 BXBUGIFDTNEDNS-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 230000006798 recombination Effects 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
- C07C319/20—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides by reactions not involving the formation of sulfide groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75813868A | 1968-09-06 | 1968-09-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1944719A1 DE1944719A1 (de) | 1970-03-12 |
| DE1944719B2 true DE1944719B2 (de) | 1979-08-30 |
Family
ID=25050654
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1944719A Ceased DE1944719B2 (de) | 1968-09-06 | 1969-09-03 | Verfahren zur Herstellung von organischen Isocyanaten durch thermische Spaltung von Urethanen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3734941A (enExample) |
| DE (1) | DE1944719B2 (enExample) |
| FR (1) | FR2017496A1 (enExample) |
| GB (1) | GB1247451A (enExample) |
| NL (1) | NL162632C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0042059A1 (de) * | 1980-06-06 | 1981-12-23 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Isocyanaten |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3870739A (en) * | 1973-03-05 | 1975-03-11 | Air Prod & Chem | Isocyanates from urethanes |
| US3919279A (en) * | 1974-06-26 | 1975-11-11 | Atlantic Richfield Co | Catalytic production of isocyanates from esters of carbamic acids |
| DE2512514C2 (de) * | 1975-03-21 | 1982-12-30 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von aliphatischen Isocyanaten |
| JPS5219624A (en) * | 1975-08-07 | 1977-02-15 | Mitsui Toatsu Chem Inc | Process for preparation of isocyanates |
| US3992430A (en) * | 1975-09-11 | 1976-11-16 | Chevron Research Company | Process for preparing aromatic isocyanates |
| DE2729990A1 (de) * | 1977-07-02 | 1979-01-18 | Bayer Ag | Verfahren zur herstellung von isocyanatgruppen aufweisenden allophanaten |
| US4255453A (en) * | 1977-08-16 | 1981-03-10 | Jordan Robert K | Production of isocyanic acid and isocyanates |
| US4123450A (en) * | 1977-09-22 | 1978-10-31 | Fmc Corporation | Process for preparing alkyl isocyanates |
| DE2756928A1 (de) * | 1977-12-21 | 1979-07-05 | Bayer Ag | Verfahren zur kontinuierlichen herstellung von monoisocyanaten |
| DE2917493A1 (de) * | 1979-04-30 | 1980-11-13 | Basf Ag | Verfahren zur herstellung von aliphatischen und cycloaliphatischen di- und polyurethanen |
| DE2917569A1 (de) * | 1979-04-30 | 1980-11-13 | Basf Ag | Verfahren zur herstellung von aromatischen di- und polyurethanen |
| US4851565A (en) * | 1979-04-30 | 1989-07-25 | Basf Aktiengesellschaft | Catalyzed process for the preparation of an aliphatic, cycloaliphatic, arylaliphatic or aliphatic-cycloaliphatic di- or polyurethane |
| US4288382A (en) * | 1979-10-10 | 1981-09-08 | Vertac, Inc. | Reversible adducts of isocyanates with boron compounds |
| JPS5679657A (en) | 1979-12-04 | 1981-06-30 | Mitsui Toatsu Chem Inc | Novel preparation of polyisocyanate |
| DE3035146A1 (de) * | 1980-09-18 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von n- und o-substituierten mono- oder bis-urethanen, sowie deren verwendung als ausgangsmaterial zur herstellung von aliphatischen isocyanaten |
| DE3035354A1 (de) * | 1980-09-19 | 1982-04-29 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von n,o-disubstituierten urethanen und ihre verwendung als ausgangsmaterial zur herstellung von organischen isocyanaten |
| DE3047898A1 (de) * | 1980-12-19 | 1982-07-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur kontinuierlichen thermischen spaltung von carbamidsaeureestern und die verwendung von hierbei anfallenden isocyanate und carbamidsaeureester aufweisenden gemischen zur herstellung von isocyanaten |
| DE3108990A1 (de) * | 1981-03-10 | 1982-09-23 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyisocyanaten |
| US4487713A (en) * | 1981-06-26 | 1984-12-11 | Exxon Research & Engineering Co. | Production of isocyanates from esters of aromatic carbamic acids (urethanes) |
| DE3215591A1 (de) * | 1982-04-27 | 1983-10-27 | Bayer Ag, 5090 Leverkusen | Verfahren zur kontinuierlichen thermischen spaltung von carbamidsaeureestern |
| EP0100047B1 (de) * | 1982-07-24 | 1986-02-12 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Hexamethylen-diisocyanat-1,6 und/oder isomeren Diisocyanaten mit 6 Kohlenstoffatomen im Alkylenrest |
| US4587056A (en) * | 1984-04-26 | 1986-05-06 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for producing an aliphatic isocyanate |
| DE4124671A1 (de) * | 1991-07-25 | 1993-01-28 | Basf Ag | Reaktor und verfahren zur thermischen spaltung von carbamidsaeureestern |
| EP0795543B1 (de) * | 1996-03-15 | 2001-10-31 | Bayer Ag | Verwendung von hochsiedenden Lösemitteln bzw. -gemischen als Wärmetauschmedium für die thermische Spaltung von Carbamidsäureestern |
| GB0017968D0 (en) * | 2000-07-22 | 2000-09-13 | Epichem Ltd | An improved process and apparatus for the isolation of pure,or substantially pure,organometallic compounds |
| DE10209095A1 (de) * | 2002-03-01 | 2003-09-11 | Basf Ag | Verfahren zur Herstellung von Isocyanaten |
| WO2008059953A1 (en) * | 2006-11-17 | 2008-05-22 | Asahi Kasei Chemicals Corporation | Method for producing isocyanate |
| TW200844080A (en) | 2007-01-11 | 2008-11-16 | Asahi Kasei Chemicals Corp | Process for producing isocyanate |
| US9056819B2 (en) * | 2007-03-30 | 2015-06-16 | Asahi Kasei Chemicals Corporation | Isocyanate production process using composition containing carbamic acid ester and aromatic hydroxy compound, and composition for transfer and storage of carbamic acid ester |
| US7977504B2 (en) | 2007-11-19 | 2011-07-12 | Asahi Kasei Chemicals Corporation | Process for producing isocyanates and aromatic hydroxy compounds |
| BRPI0822694B1 (pt) * | 2008-05-15 | 2018-11-27 | Asahi Kasei Chemicals Corp | processo para produzir um isocianato |
| KR20130127553A (ko) | 2008-05-15 | 2013-11-22 | 아사히 가세이 케미칼즈 가부시키가이샤 | 탄산디아릴을 이용하는 이소시아네이트의 제조 방법 |
| EA022171B1 (ru) | 2009-08-21 | 2015-11-30 | Асахи Касеи Кемикалз Корпорейшн | Способ получения сложного эфира n-замещенной карбаминовой кислоты, способ получения изоцианата с применением такого сложного эфира n-замещенной карбаминовой кислоты и композиция для транспортировки и хранения сложного эфира n-замещенной карбаминовой кислоты, содержащая сложный эфир n-замещенной карбаминовой кислоты и ароматическое гидроксисоединение |
| CN101857556A (zh) * | 2010-05-18 | 2010-10-13 | 中国科学院过程工程研究所 | 一种气相热解制备异氰酸酯的系统及其方法 |
| KR20130089233A (ko) * | 2010-06-22 | 2013-08-09 | 바스프 에스이 | 고체 루이스 산 위의 이소시아네이트의 합성을 위한 불균일하게 촉매화된 카바메이트 해리 |
| JP5760077B2 (ja) | 2011-02-21 | 2015-08-05 | 旭化成ケミカルズ株式会社 | カルボニル化合物の製造方法 |
-
1968
- 1968-09-06 US US00758138A patent/US3734941A/en not_active Expired - Lifetime
-
1969
- 1969-08-05 GB GB39231/69A patent/GB1247451A/en not_active Expired
- 1969-08-29 NL NL6913239.A patent/NL162632C/xx active
- 1969-09-03 DE DE1944719A patent/DE1944719B2/de not_active Ceased
- 1969-09-03 FR FR6930076A patent/FR2017496A1/fr not_active Withdrawn
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0042059A1 (de) * | 1980-06-06 | 1981-12-23 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Isocyanaten |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2017496A1 (enExample) | 1970-05-22 |
| GB1247451A (en) | 1971-09-22 |
| NL6913239A (enExample) | 1970-03-10 |
| NL162632C (nl) | 1980-06-16 |
| NL162632B (nl) | 1980-01-15 |
| US3734941A (en) | 1973-05-22 |
| DE1944719A1 (de) | 1970-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1944719B2 (de) | Verfahren zur Herstellung von organischen Isocyanaten durch thermische Spaltung von Urethanen | |
| EP0054817B1 (de) | Verfahren zur kontinuierlichen thermischen Spaltung von Carbamidsäureestern und die Verwendung von hierbei anfallenden Isocyanate und Carbamidsäureester aufweisenden Gemischen zur Herstellung von Isocyanaten | |
| EP0126299B1 (de) | Mehrstufenverfahren zur Herstellung von Hexamethylen-diisocyanat-1,6 und/oder isomeren aliphatischen Diisocyanaten mit 6 Kohlenstoffatomen im Alkylenrest | |
| DE1215365B (de) | Verfahren zur Herstellung von hoehermolekularen Polyisocyanaten mit Biuret-Struktur | |
| EP0018586A1 (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Di- und Polyurethanen | |
| EP0317744A2 (de) | Verfahren zur Herstellung (cyclo)-aliphatischer Uretdione | |
| EP0018588A1 (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Di- und Polyurethanen | |
| DE3850647T2 (de) | Verfahren zur herstellung von isocyanat-verbindungen. | |
| EP0019109B1 (de) | Verfahren zur Herstellung von aromatischen Di- und Polyurethanen | |
| DE69114867T2 (de) | Verfahren zur Herstellung aromatischer Urethane. | |
| DE1286025B (de) | Verfahren zum Herabsetzen des Gehaltes organischer Isocyanate an hydrolysierbarem Chlor | |
| DE2212604B2 (de) | Verfahren zur herstellung von 2- halogenaethylphosphonsaeuren | |
| EP0018583A1 (de) | Verfahren zur Herstellung von Aryl-mono-,-di- und/oder-polyurethanen | |
| DE889898C (de) | Verfahren zur Herstellung von Phosphorverbindungen | |
| EP0598338A1 (de) | Verfahren zur Herstellung von 1,3-Difluorbenzol | |
| DE60115403T2 (de) | Kontinuierliches verfahren zur herstellung von aromatischen urethanen | |
| DE1964619A1 (de) | Adiabatisches Verfahren zur Herstellung von 2,4-Dichlor-6-amino-s-triazinen | |
| EP0158928B1 (de) | Verfahren zur Herstellung von reinem 2,6-Dichlorbenzonitril | |
| DE69006475T2 (de) | Verfahren zur Herstellung von Isocyanatverbindung. | |
| EP0030269B1 (de) | Verfahren zur Rückführung des Edelmetallkatalysators bei der Herstellung aromatischer Urethane | |
| DE1924429C3 (de) | Verfahren zur Herstellung von Bisurethanen | |
| DE2339840A1 (de) | Dehydrierungs- bzw. dehydrocyclisierungskatalysatoren und deren verwendung | |
| DE2917568A1 (de) | Verfahren zur herstellung von aromatischen di- und polyurethanen | |
| DE2249459A1 (de) | Verfahren zur herstellung von isocyanaten | |
| DE2557162C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BHV | Refusal |