DE1944719B2 - Verfahren zur Herstellung von organischen Isocyanaten durch thermische Spaltung von Urethanen - Google Patents
Verfahren zur Herstellung von organischen Isocyanaten durch thermische Spaltung von UrethanenInfo
- Publication number
- DE1944719B2 DE1944719B2 DE1944719A DE1944719A DE1944719B2 DE 1944719 B2 DE1944719 B2 DE 1944719B2 DE 1944719 A DE1944719 A DE 1944719A DE 1944719 A DE1944719 A DE 1944719A DE 1944719 B2 DE1944719 B2 DE 1944719B2
- Authority
- DE
- Germany
- Prior art keywords
- urethanes
- isocyanate
- carbamate
- urethane
- production
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000012948 isocyanate Substances 0.000 title claims description 35
- 150000002513 isocyanates Chemical class 0.000 title claims description 35
- 238000000034 method Methods 0.000 title claims description 30
- 238000004519 manufacturing process Methods 0.000 title claims description 13
- 150000003673 urethanes Chemical class 0.000 title claims description 12
- 238000003776 cleavage reaction Methods 0.000 title claims description 5
- 230000007017 scission Effects 0.000 title claims description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000002841 Lewis acid Substances 0.000 claims description 12
- 239000003054 catalyst Substances 0.000 claims description 12
- 150000007517 lewis acids Chemical class 0.000 claims description 12
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 8
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 7
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical group Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 claims 2
- OVNKYQIIJBKPOU-UHFFFAOYSA-N Cc1cccc(OC(N)=O)c1OC(N)=O Chemical compound Cc1cccc(OC(N)=O)c1OC(N)=O OVNKYQIIJBKPOU-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- -1 amino compound Chemical class 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- 238000002474 experimental method Methods 0.000 description 8
- 238000000197 pyrolysis Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- PHYURWGMBQTCSY-UHFFFAOYSA-N ethyl n-[3-(ethoxycarbonylamino)-4-methylphenyl]carbamate Chemical compound CCOC(=O)NC1=CC=C(C)C(NC(=O)OCC)=C1 PHYURWGMBQTCSY-UHFFFAOYSA-N 0.000 description 4
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000007233 catalytic pyrolysis Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- JQAOGTOHCZCZGI-UHFFFAOYSA-N ethyl n-isocyanato-n-(2-methylphenyl)carbamate Chemical compound CCOC(=O)N(N=C=O)C1=CC=CC=C1C JQAOGTOHCZCZGI-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000001119 stannous chloride Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- LEGIHXSSKUKHSK-UHFFFAOYSA-N (2-pentylphenyl) carbamate Chemical compound CCCCCC1=CC=CC=C1OC(N)=O LEGIHXSSKUKHSK-UHFFFAOYSA-N 0.000 description 1
- OHWZQGOJLRVRIW-UHFFFAOYSA-N (3-carbamoyloxy-4-methylphenyl) carbamate Chemical compound CC1=CC=C(OC(N)=O)C=C1OC(N)=O OHWZQGOJLRVRIW-UHFFFAOYSA-N 0.000 description 1
- SHXGGYLLZCCNAX-UHFFFAOYSA-N (3-chlorophenyl) carbamate Chemical compound NC(=O)OC1=CC=CC(Cl)=C1 SHXGGYLLZCCNAX-UHFFFAOYSA-N 0.000 description 1
- OAXSVEFCBLZGCA-UHFFFAOYSA-N 1-chloro-4-(isocyanatomethyl)benzene Chemical compound ClC1=CC=C(CN=C=O)C=C1 OAXSVEFCBLZGCA-UHFFFAOYSA-N 0.000 description 1
- IQOIAHPAAZJVOX-UHFFFAOYSA-N 1-isocyanato-3-methoxypropane Chemical compound COCCCN=C=O IQOIAHPAAZJVOX-UHFFFAOYSA-N 0.000 description 1
- BKJABLMNBSVKCV-UHFFFAOYSA-N 1-isocyanato-3-methylsulfanylbenzene Chemical compound CSC1=CC=CC(N=C=O)=C1 BKJABLMNBSVKCV-UHFFFAOYSA-N 0.000 description 1
- WXIOQJUEBPUFHH-UHFFFAOYSA-N 1-isocyanato-4-(2-isocyanatopropan-2-yl)-1-methylcyclohexane Chemical compound O=C=NC(C)(C)C1CCC(C)(N=C=O)CC1 WXIOQJUEBPUFHH-UHFFFAOYSA-N 0.000 description 1
- 239000007848 Bronsted acid Substances 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- ZTIMKJROOYMUMU-UHFFFAOYSA-N butyl n-phenylcarbamate Chemical compound CCCCOC(=O)NC1=CC=CC=C1 ZTIMKJROOYMUMU-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- CGDXDLOPNKYPBU-UHFFFAOYSA-N ethyl n-(1-ethylcyclohexyl)carbamate Chemical compound CCOC(=O)NC1(CC)CCCCC1 CGDXDLOPNKYPBU-UHFFFAOYSA-N 0.000 description 1
- BHIJTTOVTIAITI-UHFFFAOYSA-N ethyl n-[4-(ethoxycarbonylamino)butyl]carbamate Chemical compound CCOC(=O)NCCCCNC(=O)OCC BHIJTTOVTIAITI-UHFFFAOYSA-N 0.000 description 1
- ARNSTSIXMKZQBC-UHFFFAOYSA-N ethyl n-naphthalen-1-ylcarbamate Chemical compound C1=CC=C2C(NC(=O)OCC)=CC=CC2=C1 ARNSTSIXMKZQBC-UHFFFAOYSA-N 0.000 description 1
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 1
- 229960002089 ferrous chloride Drugs 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- UPWPDUACHOATKO-UHFFFAOYSA-K gallium trichloride Chemical compound Cl[Ga](Cl)Cl UPWPDUACHOATKO-UHFFFAOYSA-K 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- HNEGSWZZYCZACE-UHFFFAOYSA-N hexyl n-phenylcarbamate Chemical compound CCCCCCOC(=O)NC1=CC=CC=C1 HNEGSWZZYCZACE-UHFFFAOYSA-N 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- 235000014413 iron hydroxide Nutrition 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 235000013980 iron oxide Nutrition 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical class [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 1
- 239000011968 lewis acid catalyst Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- OKBJVCWRESLMMD-UHFFFAOYSA-N methyl n-(4-methylphenyl)carbamate Chemical compound COC(=O)NC1=CC=C(C)C=C1 OKBJVCWRESLMMD-UHFFFAOYSA-N 0.000 description 1
- OZXBLDXVIIDKNA-UHFFFAOYSA-N methyl n-butan-2-ylcarbamate Chemical compound CCC(C)NC(=O)OC OZXBLDXVIIDKNA-UHFFFAOYSA-N 0.000 description 1
- PWFYXEJZPCACLT-UHFFFAOYSA-N methyl n-propan-2-ylcarbamate Chemical compound COC(=O)NC(C)C PWFYXEJZPCACLT-UHFFFAOYSA-N 0.000 description 1
- HBCAQUUDOCPMTB-UHFFFAOYSA-N methyl n-tert-butylcarbamate Chemical compound COC(=O)NC(C)(C)C HBCAQUUDOCPMTB-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 description 1
- BXBUGIFDTNEDNS-UHFFFAOYSA-N propan-2-yl n-[3-(trifluoromethyl)phenyl]carbamate Chemical compound CC(C)OC(=O)NC1=CC=CC(C(F)(F)F)=C1 BXBUGIFDTNEDNS-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 230000006798 recombination Effects 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
- C07C319/20—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides by reactions not involving the formation of sulfide groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75813868A | 1968-09-06 | 1968-09-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1944719A1 DE1944719A1 (de) | 1970-03-12 |
| DE1944719B2 true DE1944719B2 (de) | 1979-08-30 |
Family
ID=25050654
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1944719A Ceased DE1944719B2 (de) | 1968-09-06 | 1969-09-03 | Verfahren zur Herstellung von organischen Isocyanaten durch thermische Spaltung von Urethanen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3734941A (enExample) |
| DE (1) | DE1944719B2 (enExample) |
| FR (1) | FR2017496A1 (enExample) |
| GB (1) | GB1247451A (enExample) |
| NL (1) | NL162632C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0042059A1 (de) * | 1980-06-06 | 1981-12-23 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Isocyanaten |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3870739A (en) * | 1973-03-05 | 1975-03-11 | Air Prod & Chem | Isocyanates from urethanes |
| US3919279A (en) * | 1974-06-26 | 1975-11-11 | Atlantic Richfield Co | Catalytic production of isocyanates from esters of carbamic acids |
| DE2512514C2 (de) * | 1975-03-21 | 1982-12-30 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von aliphatischen Isocyanaten |
| JPS5219624A (en) * | 1975-08-07 | 1977-02-15 | Mitsui Toatsu Chem Inc | Process for preparation of isocyanates |
| US3992430A (en) * | 1975-09-11 | 1976-11-16 | Chevron Research Company | Process for preparing aromatic isocyanates |
| DE2729990A1 (de) * | 1977-07-02 | 1979-01-18 | Bayer Ag | Verfahren zur herstellung von isocyanatgruppen aufweisenden allophanaten |
| US4255453A (en) * | 1977-08-16 | 1981-03-10 | Jordan Robert K | Production of isocyanic acid and isocyanates |
| US4123450A (en) * | 1977-09-22 | 1978-10-31 | Fmc Corporation | Process for preparing alkyl isocyanates |
| DE2756928A1 (de) * | 1977-12-21 | 1979-07-05 | Bayer Ag | Verfahren zur kontinuierlichen herstellung von monoisocyanaten |
| DE2917569A1 (de) * | 1979-04-30 | 1980-11-13 | Basf Ag | Verfahren zur herstellung von aromatischen di- und polyurethanen |
| DE2917493A1 (de) * | 1979-04-30 | 1980-11-13 | Basf Ag | Verfahren zur herstellung von aliphatischen und cycloaliphatischen di- und polyurethanen |
| US4851565A (en) * | 1979-04-30 | 1989-07-25 | Basf Aktiengesellschaft | Catalyzed process for the preparation of an aliphatic, cycloaliphatic, arylaliphatic or aliphatic-cycloaliphatic di- or polyurethane |
| US4288382A (en) * | 1979-10-10 | 1981-09-08 | Vertac, Inc. | Reversible adducts of isocyanates with boron compounds |
| JPS5679657A (en) | 1979-12-04 | 1981-06-30 | Mitsui Toatsu Chem Inc | Novel preparation of polyisocyanate |
| DE3035146A1 (de) * | 1980-09-18 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von n- und o-substituierten mono- oder bis-urethanen, sowie deren verwendung als ausgangsmaterial zur herstellung von aliphatischen isocyanaten |
| DE3035354A1 (de) * | 1980-09-19 | 1982-04-29 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von n,o-disubstituierten urethanen und ihre verwendung als ausgangsmaterial zur herstellung von organischen isocyanaten |
| DE3047898A1 (de) * | 1980-12-19 | 1982-07-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur kontinuierlichen thermischen spaltung von carbamidsaeureestern und die verwendung von hierbei anfallenden isocyanate und carbamidsaeureester aufweisenden gemischen zur herstellung von isocyanaten |
| DE3108990A1 (de) * | 1981-03-10 | 1982-09-23 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyisocyanaten |
| US4487713A (en) * | 1981-06-26 | 1984-12-11 | Exxon Research & Engineering Co. | Production of isocyanates from esters of aromatic carbamic acids (urethanes) |
| DE3215591A1 (de) * | 1982-04-27 | 1983-10-27 | Bayer Ag, 5090 Leverkusen | Verfahren zur kontinuierlichen thermischen spaltung von carbamidsaeureestern |
| DE3362121D1 (en) * | 1982-07-24 | 1986-03-27 | Basf Ag | Process for the preparation of hexamethylene diisocyanate-1,6 and/or of the isomeric diisocyanates with 6 carbon atoms in the alkyl group |
| US4587056A (en) * | 1984-04-26 | 1986-05-06 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for producing an aliphatic isocyanate |
| DE4124671A1 (de) * | 1991-07-25 | 1993-01-28 | Basf Ag | Reaktor und verfahren zur thermischen spaltung von carbamidsaeureestern |
| EP0795543B1 (de) * | 1996-03-15 | 2001-10-31 | Bayer Ag | Verwendung von hochsiedenden Lösemitteln bzw. -gemischen als Wärmetauschmedium für die thermische Spaltung von Carbamidsäureestern |
| GB0017968D0 (en) * | 2000-07-22 | 2000-09-13 | Epichem Ltd | An improved process and apparatus for the isolation of pure,or substantially pure,organometallic compounds |
| DE10209095A1 (de) * | 2002-03-01 | 2003-09-11 | Basf Ag | Verfahren zur Herstellung von Isocyanaten |
| BRPI0718144B1 (pt) * | 2006-11-17 | 2017-04-04 | Asahi Kasei Chemicals Corp | processo para produzir um isocianato, e, policarbamato de arila |
| TW200844080A (en) | 2007-01-11 | 2008-11-16 | Asahi Kasei Chemicals Corp | Process for producing isocyanate |
| JP4958971B2 (ja) | 2007-03-30 | 2012-06-20 | 旭化成ケミカルズ株式会社 | カルバミン酸エステルおよび芳香族ヒドロキシ化合物を含む組成物を用いるイソシアネートの製造方法、ならびにカルバミン酸エステル移送用および貯蔵用組成物 |
| CA2705874C (en) * | 2007-11-19 | 2013-10-29 | Masaaki Shinohata | Process for producing isocyanates and aromatic hydroxy compounds from aromatic polycarbonate resins |
| US9233918B2 (en) * | 2008-05-15 | 2016-01-12 | Asahi Kasei Chemicals Corporation | Isocyanate production process |
| US8895774B2 (en) * | 2008-05-15 | 2014-11-25 | Asahi Kasei Chemicals Corporation | Process for producing isocyanates using diaryl carbonate |
| RU2528423C2 (ru) | 2009-08-21 | 2014-09-20 | Асахи Касеи Кемикалз Корпорейшн | Способ получения сложного эфира n-замещенной карбаминовой кислоты и способ получения изоцианата с использованием сложного эфира n-замещенной карбаминовой кислоты |
| CN101857556A (zh) * | 2010-05-18 | 2010-10-13 | 中国科学院过程工程研究所 | 一种气相热解制备异氰酸酯的系统及其方法 |
| KR20130089233A (ko) * | 2010-06-22 | 2013-08-09 | 바스프 에스이 | 고체 루이스 산 위의 이소시아네이트의 합성을 위한 불균일하게 촉매화된 카바메이트 해리 |
| KR101507251B1 (ko) | 2011-02-21 | 2015-03-30 | 아사히 가세이 케미칼즈 가부시키가이샤 | 카르보닐 화합물의 제조 방법 |
-
1968
- 1968-09-06 US US00758138A patent/US3734941A/en not_active Expired - Lifetime
-
1969
- 1969-08-05 GB GB39231/69A patent/GB1247451A/en not_active Expired
- 1969-08-29 NL NL6913239.A patent/NL162632C/xx active
- 1969-09-03 DE DE1944719A patent/DE1944719B2/de not_active Ceased
- 1969-09-03 FR FR6930076A patent/FR2017496A1/fr not_active Withdrawn
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0042059A1 (de) * | 1980-06-06 | 1981-12-23 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Isocyanaten |
Also Published As
| Publication number | Publication date |
|---|---|
| US3734941A (en) | 1973-05-22 |
| NL162632B (nl) | 1980-01-15 |
| NL6913239A (enExample) | 1970-03-10 |
| FR2017496A1 (enExample) | 1970-05-22 |
| GB1247451A (en) | 1971-09-22 |
| DE1944719A1 (de) | 1970-03-12 |
| NL162632C (nl) | 1980-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1944719B2 (de) | Verfahren zur Herstellung von organischen Isocyanaten durch thermische Spaltung von Urethanen | |
| EP0054817B1 (de) | Verfahren zur kontinuierlichen thermischen Spaltung von Carbamidsäureestern und die Verwendung von hierbei anfallenden Isocyanate und Carbamidsäureester aufweisenden Gemischen zur Herstellung von Isocyanaten | |
| EP0018586B1 (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Di- und Polyurethanen | |
| DE1215365B (de) | Verfahren zur Herstellung von hoehermolekularen Polyisocyanaten mit Biuret-Struktur | |
| EP0126299A1 (de) | Mehrstufenverfahren zur Herstellung von Hexamethylen-diisocyanat-1,6 und/oder isomeren aliphatischen Diisocyanaten mit 6 Kohlenstoffatomen im Alkylenrest | |
| EP0018588A1 (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Di- und Polyurethanen | |
| DE3850647T2 (de) | Verfahren zur herstellung von isocyanat-verbindungen. | |
| EP0019109B1 (de) | Verfahren zur Herstellung von aromatischen Di- und Polyurethanen | |
| DE69114867T2 (de) | Verfahren zur Herstellung aromatischer Urethane. | |
| DE2512514C2 (de) | Verfahren zur Herstellung von aliphatischen Isocyanaten | |
| EP0018583B1 (de) | Verfahren zur Herstellung von Aryl-mono-,-di- und/oder-polyurethanen | |
| DE1286025B (de) | Verfahren zum Herabsetzen des Gehaltes organischer Isocyanate an hydrolysierbarem Chlor | |
| DE2212604B2 (de) | Verfahren zur herstellung von 2- halogenaethylphosphonsaeuren | |
| EP0598338A1 (de) | Verfahren zur Herstellung von 1,3-Difluorbenzol | |
| DE60115403T2 (de) | Kontinuierliches verfahren zur herstellung von aromatischen urethanen | |
| DE69006475T2 (de) | Verfahren zur Herstellung von Isocyanatverbindung. | |
| EP0030269B1 (de) | Verfahren zur Rückführung des Edelmetallkatalysators bei der Herstellung aromatischer Urethane | |
| DE1924429C3 (de) | Verfahren zur Herstellung von Bisurethanen | |
| DE2339840A1 (de) | Dehydrierungs- bzw. dehydrocyclisierungskatalysatoren und deren verwendung | |
| DE2917568A1 (de) | Verfahren zur herstellung von aromatischen di- und polyurethanen | |
| DE2942510A1 (de) | Verfahren zur herstellung von aryl-mono- und -polyurethanen | |
| DE2249459A1 (de) | Verfahren zur herstellung von isocyanaten | |
| EP0158928A1 (de) | Verfahren zur Herstellung von reinem 2,6-Dichlorbenzonitril | |
| DE3200783C2 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten cis,cis-1,3-Cyclooctadienen durch Isomerisierung von gegebenenfalls substituierten 1,4- oder 1,5-Cyclooctadienen | |
| DE2719996C2 (de) | Verfahren zum Abtrennen von 4,4'-Diaminodiphenylmethan in praktisch reiner Form aus Mischungen desselben mit dem entsprechenden 2,4'-Isomeren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BHV | Refusal |