DE1940532C - - Google Patents
Info
- Publication number
- DE1940532C DE1940532C DE19691940532 DE1940532A DE1940532C DE 1940532 C DE1940532 C DE 1940532C DE 19691940532 DE19691940532 DE 19691940532 DE 1940532 A DE1940532 A DE 1940532A DE 1940532 C DE1940532 C DE 1940532C
- Authority
- DE
- Germany
- Prior art keywords
- printing
- sublimation
- weight
- printing ink
- layers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000007639 printing Methods 0.000 claims description 104
- 239000000976 ink Substances 0.000 claims description 64
- 239000000975 dye Substances 0.000 claims description 35
- 238000000859 sublimation Methods 0.000 claims description 33
- 239000011230 binding agent Substances 0.000 claims description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- 239000000945 filler Substances 0.000 claims description 21
- 239000000126 substance Substances 0.000 claims description 20
- 239000004925 Acrylic resin Substances 0.000 claims description 12
- 229920000178 Acrylic resin Polymers 0.000 claims description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 12
- 239000000463 material Substances 0.000 claims description 9
- 239000000969 carrier Substances 0.000 claims description 7
- 239000000377 silicon dioxide Substances 0.000 claims description 6
- 239000003086 colorant Substances 0.000 claims description 5
- 238000004140 cleaning Methods 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 238000004040 coloring Methods 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 claims 3
- 229920002451 polyvinyl alcohol Polymers 0.000 claims 3
- 239000003973 paint Substances 0.000 claims 2
- QOSTVEDABRQTSU-UHFFFAOYSA-N 1,4-bis(methylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(NC)=CC=C2NC QOSTVEDABRQTSU-UHFFFAOYSA-N 0.000 claims 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-Nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 claims 1
- RZVHIXYEVGDQDX-UHFFFAOYSA-N Anthraquinone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 claims 1
- SGHZXLIDFTYFHQ-UHFFFAOYSA-L Brilliant Blue FCF Chemical compound [Na+].[Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C(=CC=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 SGHZXLIDFTYFHQ-UHFFFAOYSA-L 0.000 claims 1
- CHMBIJAOCISYEW-UHFFFAOYSA-N N-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 claims 1
- 239000004927 clay Substances 0.000 claims 1
- 229910052570 clay Inorganic materials 0.000 claims 1
- 239000002657 fibrous material Substances 0.000 claims 1
- 238000005259 measurement Methods 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 229920003023 plastic Polymers 0.000 claims 1
- 239000004033 plastic Substances 0.000 claims 1
- 239000007789 gas Substances 0.000 description 8
- 239000004088 foaming agent Substances 0.000 description 7
- 239000004744 fabric Substances 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- XOZUGNYVDXMRKW-AATRIKPKSA-N Azodicarbonamide Chemical compound NC(=O)\N=N\C(N)=O XOZUGNYVDXMRKW-AATRIKPKSA-N 0.000 description 4
- 239000004156 Azodicarbonamide Substances 0.000 description 4
- 235000019399 azodicarbonamide Nutrition 0.000 description 4
- -1 calcium nitrosoterephthalic acid Chemical compound 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000010979 ruby Substances 0.000 description 3
- 229910001750 ruby Inorganic materials 0.000 description 3
- TZCXTZWJZNENPQ-UHFFFAOYSA-L Barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L Calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- MWRWFPQBGSZWNV-UHFFFAOYSA-N Dinitrosopentamethylenetetramine Chemical compound C1N2CN(N=O)CN1CN(N=O)C2 MWRWFPQBGSZWNV-UHFFFAOYSA-N 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N N-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M NaHCO3 Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminum Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000007646 gravure printing Methods 0.000 description 2
- 150000002484 inorganic compounds Chemical class 0.000 description 2
- 229910010272 inorganic material Inorganic materials 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000001044 red dye Substances 0.000 description 2
- 230000033458 reproduction Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- XJKJWTWGDGIQRH-BFIDDRIFSA-N Alginic acid Chemical compound O1[C@@H](C(O)=O)[C@@H](OC)[C@H](O)[C@H](O)[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](C)[C@@H](O)[C@H]1O XJKJWTWGDGIQRH-BFIDDRIFSA-N 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- PRKQVKDSMLBJBJ-UHFFFAOYSA-N Ammonium carbonate Chemical compound N.N.OC(O)=O PRKQVKDSMLBJBJ-UHFFFAOYSA-N 0.000 description 1
- CAMXVZOXBADHNJ-UHFFFAOYSA-N Ammonium nitrite Chemical compound [NH4+].[O-]N=O CAMXVZOXBADHNJ-UHFFFAOYSA-N 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N Butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 229940042795 Hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 101710028361 MARVELD2 Proteins 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L Magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 241001676573 Minium Species 0.000 description 1
- LIVNPJMFVYWSIS-UHFFFAOYSA-N Silicon monoxide Chemical class [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 1
- FKHIFSZMMVMEQY-UHFFFAOYSA-N Talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium(0) Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- VJRITMATACIYAF-UHFFFAOYSA-N benzenesulfonohydrazide Chemical compound NNS(=O)(=O)C1=CC=CC=C1 VJRITMATACIYAF-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atoms Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000004049 embossing Methods 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N fumaric acid Chemical compound OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 239000011776 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 239000005445 natural product Substances 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- 238000007645 offset printing Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000002441 reversible Effects 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000001187 sodium carbonate Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 238000007651 thermal printing Methods 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N tin hydride Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 150000003643 triphenylenes Chemical class 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8438768 | 1968-11-18 | ||
| JP8438768 | 1968-11-18 | ||
| JP2739769 | 1969-04-09 | ||
| JP2739869 | 1969-04-09 | ||
| JP2739869 | 1969-04-09 | ||
| JP2739769 | 1969-04-09 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1940532A1 DE1940532A1 (de) | 1970-04-23 |
| DE1940532B2 DE1940532B2 (de) | 1971-07-01 |
| DE1940532C true DE1940532C (ja) | 1973-03-15 |
Family
ID=27285778
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691940532 Granted DE1940532B2 (de) | 1968-11-18 | 1969-08-08 | Sublimationsdruckform zur herstellung mehrfarbiger drucke in einem arbeitsgang |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3647503A (ja) |
| DE (1) | DE1940532B2 (ja) |
| FR (1) | FR2023496A1 (ja) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1414096A (en) * | 1972-05-19 | 1975-11-19 | Dainippon Printing Co Ltd | Heat transfer printing sheet and heat transfer printing method using the same |
| JPS5029550B2 (ja) * | 1972-06-03 | 1975-09-23 | ||
| JPS5029549B2 (ja) * | 1972-06-03 | 1975-09-23 | ||
| US3952131A (en) * | 1973-07-10 | 1976-04-20 | Sideman Carl E | Heat transfer print sheet and printed product |
| US3924049A (en) * | 1973-07-30 | 1975-12-02 | Texas Instruments Inc | Multicolor thermosensitive paper |
| CH759874A4 (ja) * | 1973-10-18 | 1975-04-15 | ||
| US4021591A (en) * | 1974-12-04 | 1977-05-03 | Roy F. DeVries | Sublimation transfer and method |
| US3966396A (en) | 1974-12-18 | 1976-06-29 | F P Licensing Co Inc | Textile printing process and transfer medium |
| CH586786B5 (ja) * | 1975-01-16 | 1977-04-15 | Sublistatic Holding Sa | |
| US4131695A (en) * | 1975-02-27 | 1978-12-26 | Ciba-Geigy Corporation | Azo color former containing heat-sensitive recording material |
| US4123580A (en) * | 1977-06-23 | 1978-10-31 | Minnesota Mining And Manufacturing Company | Color source sheet with rubber binder |
| DE2814801C3 (de) * | 1977-09-09 | 1982-12-23 | Schweizerische Aluminium AG, 3965 Chippis | Hilfsträger für den Thermotransferdruck |
| US4177299A (en) * | 1978-01-27 | 1979-12-04 | Swiss Aluminium Ltd. | Aluminum or aluminum alloy article and process |
| US4189429A (en) * | 1978-05-08 | 1980-02-19 | Minnesota Mining And Manufacturing Company | Hydrolyzable silyl-substituted dyestuffs for transfer printing |
| JPS56148981A (en) * | 1980-03-25 | 1981-11-18 | Donkurofuto Karaazu Ando Chem | Sublimable dyestuff transfer printing method and composition |
| DE3365843D1 (en) * | 1982-06-04 | 1986-10-09 | Ciba Geigy Ag | Aqueous inks for transfer printing |
| US4491494A (en) * | 1983-05-31 | 1985-01-01 | Hallmark Cards, Inc. | Decorating methods |
| JPH0696308B2 (ja) * | 1983-06-30 | 1994-11-30 | ソニーケミカル株式会社 | 昇華性インクリボン |
| FR2592338B1 (fr) * | 1985-12-27 | 1988-03-11 | Doublet Festitub Sa | Procede d'impression d'un materiau |
| US4880768A (en) * | 1987-09-07 | 1989-11-14 | Ricoh Company, Ltd. | Sublimation type thermosensitive image transfer recording medium |
| CA1335329C (en) * | 1988-09-06 | 1995-04-25 | Donald C. Berghauser | Color sublimation dye transfer from color video prints to ceramic mugs and the like |
| DE69128505T2 (de) * | 1990-09-07 | 1998-08-20 | Dainippon Printing Co Ltd | Bildempfangsmaterial für thermische Farbstoffübertragung und dessen Herstellungsverfahren |
| DE4134704A1 (de) * | 1991-10-21 | 1993-05-19 | Manfred Keppeler Verlag | Verfahren zur uebertragung von folien, auf denen sich farben, pigmente oder toner befinden, auf permanente traeger, poroese oder anloesbare folien zur durchfuehrung des verfahrens, und herstellung poroeser folien |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3413184A (en) * | 1962-02-05 | 1968-11-26 | Ibm | Transfer medium and method for making same |
| US3458335A (en) * | 1967-02-14 | 1969-07-29 | Columbia Ribbon Carbon Mfg | Heat sensitive transfer sheet having screen layer and method of making |
-
1969
- 1969-08-08 US US3647503D patent/US3647503A/en not_active Expired - Lifetime
- 1969-08-08 DE DE19691940532 patent/DE1940532B2/de active Granted
- 1969-09-16 FR FR6931424A patent/FR2023496A1/fr not_active Withdrawn
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1940532C (ja) | ||
| DE1940532A1 (de) | Sublimationsdruckform fuer die Druckfarbenuebertragung unter Waermeeinwirkung | |
| US3363557A (en) | Heat transfer of indicia containing sublimable coloring agent | |
| DE1208749B (de) | Verfahren zur Herstellung einer Zurichtung fuer den Hochdruck und Zurichtebogen hierfuer | |
| DE1671501B2 (de) | Einheit und verfahren zur gleichzeitigen herstellung von hoch- und tiefdruckformen auf thermographischem wege | |
| DE2821423A1 (de) | Verfahren zur herstellung von umdruck-originalen und mittel zur durchfuehrung des verfahrens | |
| DE1197478B (de) | UEbertragungsblatt fuer thermographische Vervielfaeltigungen | |
| US3628979A (en) | Transfer elements and method of making same | |
| DE2124084B2 (de) | Druckempfindliche Aufzeichnungsmaterialien | |
| DE1133740B (de) | Verfahren zur Herstellung vervielfaeltigungsfaehiger Druckformen | |
| DE1220447B (de) | Thermoplastisches Aufzeichnungsverfahren | |
| USRE27892E (en) | Heat transfer of indicia containing sublimable coloring agent | |
| JPS5833113B2 (ja) | テンシヤインサツホウ | |
| DE2360928A1 (de) | Verfahren zum drucken einer hektographier-bildmasse und mittel zur durchfuehrung des verfahrens | |
| AT225206B (de) | Glasartiges Abziehbild und Verfahren zu seiner Herstellung | |
| EP0505362B1 (de) | Thermotransferfarbband | |
| US1759868A (en) | Transfer for multicolored designs and markings | |
| DE2700249C2 (de) | Verfahren zur Herstellung einer vorbedruckten Vervielfältigungsmatrize | |
| DE848830C (de) | Vervielfaeltigungsverfahren mittels Schablonen | |
| AT218546B (de) | Verfahren zur Herstellung von nach der Aufbringung lesbaren Aufdrucken | |
| DE2224568C3 (de) | Hektographisches Vervielfältigungsverfahren | |
| DE494894C (de) | Verfahren zur Herstellung von Imitationen von Gemaelden, Bildern, Landkarten, Tapeten u. dgl. | |
| DE2437696C3 (de) | Matrize für die Herstellung von Mehrfachkopien | |
| DE1282031B (de) | Hektographische Druckform und damit durchgefuehrtes Trockenvervielfaeltigungsverfahren | |
| DE1206918B (de) | Verfahren zur Beschriftung von bei thermographischen Vervielfaeltigungsverfahren zu verwendenden Originalboegen |