DE1935106U - Spinnduesenplatte. - Google Patents
Spinnduesenplatte.Info
- Publication number
- DE1935106U DE1935106U DEP26550U DEP0026550U DE1935106U DE 1935106 U DE1935106 U DE 1935106U DE P26550 U DEP26550 U DE P26550U DE P0026550 U DEP0026550 U DE P0026550U DE 1935106 U DE1935106 U DE 1935106U
- Authority
- DE
- Germany
- Prior art keywords
- opening
- nozzle plate
- section
- angle
- nozzle
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 239000004071 soot Substances 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 8
- 239000000463 material Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000001788 irregular Effects 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- 238000005553 drilling Methods 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- 102100033070 Histone acetyltransferase KAT6B Human genes 0.000 description 1
- 101100019690 Homo sapiens KAT6B gene Proteins 0.000 description 1
- 241001233242 Lontra Species 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229910001651 emery Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01D—MECHANICAL METHODS OR APPARATUS IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS
- D01D5/00—Formation of filaments, threads, or the like
- D01D5/253—Formation of filaments, threads, or the like with a non-circular cross section; Spinnerette packs therefor
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Spinning Methods And Devices For Manufacturing Artificial Fibers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US425219A US3303530A (en) | 1965-01-13 | 1965-01-13 | Spinnerette |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1935106U true DE1935106U (de) | 1966-03-24 |
Family
ID=23685662
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP26550U Expired DE1935106U (de) | 1965-01-13 | 1966-01-13 | Spinnduesenplatte. |
| DE1660567A Pending DE1660567B2 (de) | 1965-01-13 | 1966-01-13 | Spinndüsenplatte |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1660567A Pending DE1660567B2 (de) | 1965-01-13 | 1966-01-13 | Spinndüsenplatte |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3303530A (enExample) |
| BE (1) | BE675022A (enExample) |
| CH (1) | CH446602A (enExample) |
| DE (2) | DE1935106U (enExample) |
| FR (1) | FR1463541A (enExample) |
| GB (1) | GB1096093A (enExample) |
| LU (1) | LU50253A1 (enExample) |
| NL (1) | NL148658B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3438087A (en) * | 1965-06-15 | 1969-04-15 | Ici Ltd | Spinnerets |
| GB1155691A (en) * | 1966-01-03 | 1969-06-18 | Ici Ltd | Improvements in or relating to Processes and Apparartus for the Spinning of Synthetic Fibre-Forming Polymers |
| US3405424A (en) * | 1966-10-27 | 1968-10-15 | Inventa Ag | Device and process for the manufacture of hollow synthetic fibers |
| US3419936A (en) * | 1967-01-31 | 1969-01-07 | Monsanto Co | Spinneret for melt spinning filaments |
| US3456292A (en) * | 1967-03-30 | 1969-07-22 | Du Pont | Spinneret |
| US3621087A (en) * | 1967-07-31 | 1971-11-16 | Toyo Rayon Co Ltd | Process for the preparation of acrylic fibers with odd-shaped sections |
| US3478389A (en) * | 1967-10-19 | 1969-11-18 | Monsanto Co | Spinneret |
| US3774266A (en) * | 1971-06-25 | 1973-11-27 | Speedco Inc | Mixing gland for stuffing meat dough |
| US4008035A (en) * | 1973-10-01 | 1977-02-15 | Matcon, Inc. | Extrusion die |
| US3868870A (en) * | 1974-01-02 | 1975-03-04 | Du Pont | Spinneret fabrication process |
| US3973428A (en) * | 1975-04-07 | 1976-08-10 | Westinghouse Electric Corporation | Uniform land length die |
| US5154908A (en) * | 1985-09-12 | 1992-10-13 | Clemson University | Carbon fibers and method for producing same |
| US5208107A (en) * | 1991-05-31 | 1993-05-04 | Basf Corporation | Hollow trilobal cross-section filament |
| JP2668849B2 (ja) * | 1993-12-02 | 1997-10-27 | 惠一 村上 | 紡糸用口金の製造方法 |
| WO2017212465A1 (en) * | 2016-06-09 | 2017-12-14 | Intellisiv Ltd. | Method and system for the preparation of polymer fibers |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE25424C (de) * | A. GRASER in Stuttgart, i Christophstrafse 2D | Neuerung an Nähnadeln mit ge-I schlitztem Oehr | ||
| US1245898A (en) * | 1916-07-25 | 1917-11-06 | Revere Rubber Co | Die for tire-tubing machines. |
| GB530379A (en) * | 1938-07-09 | 1940-12-11 | Kolnische Gummifadenfabrik Vor | Improved process and apparatus for making sharp-edged threads, cords, ribbons or bands, profiled strips and so forth from plastic masses, artificial and natural dispersions and emulsions |
| BE514770A (enExample) * | 1951-11-08 | |||
| BE564637A (enExample) * | 1957-03-02 | |||
| US3017686A (en) * | 1957-08-01 | 1962-01-23 | Du Pont | Two component convoluted filaments |
| US3001230A (en) * | 1959-01-29 | 1961-09-26 | Eltherma A G | Spinnerette nozzles |
| US3210451A (en) * | 1960-12-01 | 1965-10-05 | Celanese Corp | Spinnerettes |
| US3095607A (en) * | 1962-07-10 | 1963-07-02 | Du Pont | Spinneret assembly |
-
1965
- 1965-01-13 US US425219A patent/US3303530A/en not_active Expired - Lifetime
-
1966
- 1966-01-04 NL NL666600028A patent/NL148658B/xx unknown
- 1966-01-11 CH CH31266A patent/CH446602A/de unknown
- 1966-01-12 BE BE675022D patent/BE675022A/xx unknown
- 1966-01-13 GB GB1665/66A patent/GB1096093A/en not_active Expired
- 1966-01-13 FR FR45764A patent/FR1463541A/fr not_active Expired
- 1966-01-13 LU LU50253A patent/LU50253A1/xx unknown
- 1966-01-13 DE DEP26550U patent/DE1935106U/de not_active Expired
- 1966-01-13 DE DE1660567A patent/DE1660567B2/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE1660567B2 (de) | 1975-08-14 |
| CH446602A (de) | 1967-11-15 |
| GB1096093A (en) | 1967-12-20 |
| LU50253A1 (enExample) | 1966-03-14 |
| DE1660567A1 (de) | 1971-05-13 |
| NL6600028A (enExample) | 1966-07-14 |
| BE675022A (enExample) | 1966-05-03 |
| FR1463541A (fr) | 1966-06-03 |
| NL148658B (nl) | 1976-02-16 |
| US3303530A (en) | 1967-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1935106U (de) | Spinnduesenplatte. | |
| DE1561650A1 (de) | Verfahren und Vorrichtung zur Zufuehrung von Aufschlaemmungen,insbesondere Papierstoff zu einer Papiermaschine | |
| DE2430487A1 (de) | Vorrichtung zum mischen von mindestens zwei gasfoermigen oder fluessigen oder koernigen medien | |
| DE1941424A1 (de) | Stoffauflauf fuer eine Papiermaschine od.dgl. | |
| DE2649500A1 (de) | Vorrichtung zum anreichern einer fluessigkeit mit gas, insbesondere luft | |
| DE2346119C3 (de) | Stoffauflauf für Papiermaschinen | |
| DE4426159A1 (de) | Flotationseinrichtung | |
| DE3431083A1 (de) | Verfahren zum entgasen einer fluessigkeit | |
| DE2827495A1 (de) | Bahnfoerdervorrichtung | |
| DE3529638A1 (de) | Begasungsvorrichtung fuer eine flotationseinrichtung und deren verwendung in papierstoffanlagen, insbesondere zum deinken von altpapier | |
| DE60032811T2 (de) | Verfahren und vorrichtung zur mischung von faserstoffkomponenten für die herstellung von papier | |
| CH404073A (de) | Verfahren und Vorrichtung zum Schmelzspinnen synthetischen linearen Polymers | |
| DE1660660A1 (de) | Spinnduese fuer die Herstellung von eigenartig geformten und hohlen Faeden | |
| DE1844593U (de) | Brausekopf. | |
| DE1760174A1 (de) | Strangpressmundstueck fuer die Herstellung von duennen Faeden oder Fadenscharen | |
| DE2000307A1 (de) | Extrudierkopf zur Herstellung eines Widerstands-Elementes,eines Bandes,Antriebsriemens od.dgl. | |
| DE4125513A1 (de) | Verfahren zum vermischen von suspendiertem faserstoff sowie vorrichtungen zu dessen ausfuehrung | |
| DE1411911B1 (de) | Stoffauflauf fuer Papiermaschinen | |
| DE3040662A1 (de) | Fadenspleissvorrichtung | |
| DE2701053A1 (de) | Luftduesenvorrichtung zur herstellung von verdrilltem garn sowie verfahren zum verdrillen der faeden von aus mehreren faeden gebildetem garn | |
| DE2658844A1 (de) | Stoffauflaufvorrichtung fuer eine papiermaschine | |
| DE3309742A1 (de) | Brausekopf mit einem brauseeinsatz | |
| DE1930795A1 (de) | Stoffauflauf fuer eine Papier-,Pappen- oder aehnliche Faserbahnherstellungsmaschine | |
| DE3631223C2 (enExample) | ||
| DE395873C (de) | Gewindeschneider |