DE1932500C3 - Beharrungsgesteuerter Wickelmechanismus für einen Sicherheitsgurt - Google Patents
Beharrungsgesteuerter Wickelmechanismus für einen SicherheitsgurtInfo
- Publication number
- DE1932500C3 DE1932500C3 DE1932500A DE1932500A DE1932500C3 DE 1932500 C3 DE1932500 C3 DE 1932500C3 DE 1932500 A DE1932500 A DE 1932500A DE 1932500 A DE1932500 A DE 1932500A DE 1932500 C3 DE1932500 C3 DE 1932500C3
- Authority
- DE
- Germany
- Prior art keywords
- pawl
- ratchet wheel
- winding mechanism
- housing
- shaft
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000007246 mechanism Effects 0.000 title claims description 25
- 238000004804 winding Methods 0.000 title claims description 25
- 230000002688 persistence Effects 0.000 title claims description 7
- 230000001133 acceleration Effects 0.000 claims description 9
- 230000005540 biological transmission Effects 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 208000010201 Exanthema Diseases 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical class C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R22/00—Safety belts or body harnesses in vehicles
- B60R22/34—Belt retractors, e.g. reels
- B60R22/36—Belt retractors, e.g. reels self-locking in an emergency
- B60R22/40—Belt retractors, e.g. reels self-locking in an emergency responsive only to vehicle movement
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R22/00—Safety belts or body harnesses in vehicles
- B60R22/34—Belt retractors, e.g. reels
- B60R22/36—Belt retractors, e.g. reels self-locking in an emergency
- B60R22/40—Belt retractors, e.g. reels self-locking in an emergency responsive only to vehicle movement
- B60R2022/401—Belt retractors, e.g. reels self-locking in an emergency responsive only to vehicle movement with adjustable sensor
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Automotive Seat Belt Assembly (AREA)
- Storing, Repeated Paying-Out, And Re-Storing Of Elongated Articles (AREA)
- Emergency Lowering Means (AREA)
- Transmission Devices (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB30816/68A GB1221846A (en) | 1968-06-27 | 1968-06-27 | Improvements in or relating to inertia reel mechanisms |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1932500A1 DE1932500A1 (de) | 1970-08-27 |
| DE1932500B2 DE1932500B2 (enExample) | 1979-09-27 |
| DE1932500C3 true DE1932500C3 (de) | 1980-05-29 |
Family
ID=10313594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1932500A Expired DE1932500C3 (de) | 1968-06-27 | 1969-06-26 | Beharrungsgesteuerter Wickelmechanismus für einen Sicherheitsgurt |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3578260A (enExample) |
| JP (1) | JPS4924604B1 (enExample) |
| BE (1) | BE735068A (enExample) |
| CH (1) | CH497301A (enExample) |
| DE (1) | DE1932500C3 (enExample) |
| DK (1) | DK124172B (enExample) |
| ES (1) | ES368674A1 (enExample) |
| FR (1) | FR2014310A1 (enExample) |
| GB (1) | GB1221846A (enExample) |
| IL (1) | IL32465A (enExample) |
| NL (1) | NL6909357A (enExample) |
| NO (1) | NO131332C (enExample) |
| SE (1) | SE356685B (enExample) |
Families Citing this family (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3770224A (en) * | 1970-10-07 | 1973-11-06 | Tokai Rika Co Ltd | Automatic lock-up device for safety belt |
| CA940507A (en) * | 1970-11-06 | 1974-01-22 | John Kell | Inertia reels for vehicle safety belts |
| US3923269A (en) * | 1970-11-06 | 1975-12-02 | Kangol Magnet Ltd | Inertia reels for vehicle safety belts |
| DE2163732C2 (de) * | 1971-12-22 | 1985-05-30 | Artur 7060 Schorndorf Föhl | Aufwickelvorrichtung für einen Sicherheitsgurt |
| US3693596A (en) * | 1971-06-01 | 1972-09-26 | Joseph Croce | Dog leash retriever |
| CA1004203A (en) * | 1971-11-09 | 1977-01-25 | Robert B. Heath | Take-up spool latch |
| USRE29095E (en) * | 1971-11-09 | 1977-01-04 | Rainsfords Metal Products Proprietary Ltd. | Take-up spool latch |
| AU471215B2 (en) * | 1972-02-22 | 1976-04-15 | Seat belt retractor | |
| US3917189A (en) * | 1972-05-26 | 1975-11-04 | Gateway Industries | Inertia locking retractor |
| US4018399A (en) * | 1972-08-09 | 1977-04-19 | Autoindustri Ab | Automatic locking device for a vehicle safety belt |
| US4058272A (en) * | 1972-09-01 | 1977-11-15 | Takata Kojyo Co., Ltd. | Inertia locked safety belt take-up reel |
| US3838831A (en) * | 1972-12-06 | 1974-10-01 | Technar Inc | Vehicle sensitive retractor |
| DE2261890A1 (de) * | 1972-12-18 | 1974-06-20 | Repa Feinstanzwerk Gmbh | Selbstsperrender gurtaufroller |
| US3915401A (en) * | 1973-01-19 | 1975-10-28 | Takata Kojyo Co | Inertia-responsive automatic braking safety belt retractor |
| JPS5326369B2 (enExample) * | 1973-02-12 | 1978-08-02 | ||
| US3937416A (en) * | 1973-04-20 | 1976-02-10 | American Safety Equipment Corporation | Reel for storing belts or the like |
| GB1436764A (en) * | 1973-05-04 | 1976-05-26 | Britax London Ltd | Seat belt storage reel with electrically operated locking device |
| US3841581A (en) * | 1973-05-21 | 1974-10-15 | Gen Motors Corp | Locking mechanism for a vehicle body restraint belt retractor |
| GB1448870A (en) * | 1973-05-25 | 1976-09-08 | Ml Aviation Co Ltd | Device for restraining objects on inclined decks |
| US3944164A (en) * | 1974-01-23 | 1976-03-16 | Hans Kolb Kg | Storage device for a safety belt |
| US3885753A (en) * | 1974-03-14 | 1975-05-27 | Ford Motor Co | Seat belt retractor mechanism |
| US3889898A (en) * | 1974-04-10 | 1975-06-17 | American Safety Equip | Piggyback dual lock bar |
| US3945587A (en) * | 1974-11-12 | 1976-03-23 | The Firestone Tire & Rubber Company | Saddle pawl and pendulum support for vehicle sensitive inertial retractors |
| US4083511A (en) * | 1975-04-03 | 1978-04-11 | Nsk-Warner K. K. | Seat belt retractor |
| US4046332A (en) * | 1975-05-02 | 1977-09-06 | Allied Chemical Corporation | Support for safety belt retractor inertia mechanism |
| JPS51131025A (en) * | 1975-05-07 | 1976-11-15 | Takata Kk | Retractor responsive to acceleration |
| JPS51135016A (en) * | 1975-05-17 | 1976-11-22 | Takata Kk | Acceleration-responsive retractor |
| JPS5261019A (en) * | 1975-11-14 | 1977-05-20 | Fuji Kiko Kk | Belt retractor |
| US4059242A (en) * | 1976-05-20 | 1977-11-22 | American Safety Equipment Corporation | Safety belt retractor |
| FR2364668A1 (fr) * | 1976-09-17 | 1978-04-14 | Kangol Magnet Ltd | Mecanisme sensible a l'acceleration |
| DE2661110C3 (de) * | 1976-10-13 | 1996-02-08 | Trw Repa Gmbh | Gurtaufroller für Fahrzeugsicherheitsgurte |
| US4127240A (en) * | 1976-11-08 | 1978-11-28 | Kangol Magnet Limited | Acceleration-sensing mechanism |
| US4101093A (en) * | 1976-11-11 | 1978-07-18 | Allied Chemical Corporation | Friction dampened pendulum sensor |
| JPS5720216Y2 (enExample) * | 1977-11-29 | 1982-04-30 | ||
| JPS5326757Y2 (enExample) * | 1977-03-12 | 1978-07-07 | ||
| JPS53142728A (en) * | 1977-05-17 | 1978-12-12 | Takata Kojyo Co | Winder device of accelerate speed induction |
| SE7711468L (sv) * | 1977-10-12 | 1979-04-13 | Autoliv Ab | Pendelanordning vid rullningsmekanismer for bilbelten |
| SE421107B (sv) * | 1977-10-17 | 1981-11-30 | Syncron I Halmstad Ab | Automatlada for sekerhetsbelten |
| JPS5646768Y2 (enExample) * | 1977-11-02 | 1981-11-02 | ||
| DE2823487C2 (de) * | 1978-05-30 | 1981-11-26 | Repa Feinstanzwerk Gmbh, 7071 Alfdorf | Sicherheitsgurtaufrollautomat |
| DE2827409A1 (de) * | 1978-06-22 | 1980-01-10 | Klippan Nv | Auf fahrzeugbeschleunigung ansprechende, justierbare sensorvorrichtung |
| DE3008177A1 (de) * | 1980-03-04 | 1981-09-17 | Naamloze Vennootschap Klippan S.A., 3044 Leeuwen | Verriegelungsvorrichtung fuer einen gurtaufroller bei sicherheitsgurten |
| JPS57163644A (en) * | 1981-01-28 | 1982-10-07 | Bigelow Sanford Inc | Pallet for carrying and package formed from said pallet |
| SE8103237L (sv) * | 1981-05-22 | 1982-11-23 | Igloo Elements Ab | Sperranordning till sekerhetsbelten |
| US4492349A (en) * | 1981-09-08 | 1985-01-08 | American Safety Equipment Corporation | Programmed pawl control means |
| DE3205515A1 (de) * | 1981-11-30 | 1983-06-09 | Repa Feinstanzwerk Gmbh, 7071 Alfdorf | Vorrichtung zum blockieren einer aufrolleinrichtung fuer sicherheitsgurte |
| US4437623A (en) * | 1982-09-21 | 1984-03-20 | American Safety Equipment Corporation | Integrated weblocker with program pawl retractor |
| US4475697A (en) * | 1983-03-11 | 1984-10-09 | American Safety Equipment Corporation | Inertia reel using modular locking mechanism |
| US4573646A (en) * | 1984-04-23 | 1986-03-04 | Trw Automotive Products Inc. | Mode selection retractor |
| US4765559A (en) * | 1987-07-07 | 1988-08-23 | American Safety Equipment Corporation | Synchronized safety belt retractor with structural control locking means |
| US6405683B1 (en) | 1999-08-24 | 2002-06-18 | Eleven, Llc | Retractable leash assembly |
| DE20008014U1 (de) * | 2000-05-05 | 2000-08-03 | Müller, Roland, 66453 Gersheim | Wickelleine für Tiere |
| US6792893B1 (en) | 2003-01-28 | 2004-09-21 | Diane Ellen Quintero | Retractable two-pet leash |
| US20120085135A1 (en) * | 2010-10-07 | 2012-04-12 | Billie Louden | Expandable handcuffs |
| US8973857B2 (en) | 2012-01-02 | 2015-03-10 | Intitate Launch LLC | Innovative ratcheting system |
| EP2862755B1 (en) | 2013-10-21 | 2016-06-08 | Advanced Digital Broadcast S.A. | Vehicle bonnet safety assembly |
| EP2862786A1 (en) | 2013-10-21 | 2015-04-22 | Advanced Digital Broadcast S.A. | Vehicle bonnet safety assembly |
| DE102017126987A1 (de) * | 2017-11-16 | 2019-05-16 | Trw Automotive Gmbh | Sensor zur Aktivierung eines fahrzeugsensitiven Sperrmechanismus eines Gurtaufrollers |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL299254A (enExample) * | 1962-10-15 | |||
| US3343765A (en) * | 1965-11-19 | 1967-09-26 | Gen Motors Corp | Seat belt retractor |
| GB1119437A (en) * | 1966-05-04 | 1968-07-10 | Britax London Ltd | Automatic locking mechanism for a safety belt or harness |
| GB1195028A (en) * | 1967-02-17 | 1970-06-17 | Teleflex Prod Ltd | Improvements in or relating to Harness Reels. |
| US3489367A (en) * | 1967-11-17 | 1970-01-13 | Firestone Tire & Rubber Co | Emergency locking retractor |
-
1968
- 1968-06-27 GB GB30816/68A patent/GB1221846A/en not_active Expired
-
1969
- 1969-06-19 NL NL6909357A patent/NL6909357A/xx unknown
- 1969-06-21 ES ES368674A patent/ES368674A1/es not_active Expired
- 1969-06-23 IL IL32465A patent/IL32465A/en unknown
- 1969-06-24 BE BE735068D patent/BE735068A/xx unknown
- 1969-06-25 US US836502A patent/US3578260A/en not_active Expired - Lifetime
- 1969-06-26 SE SE09106/69*A patent/SE356685B/xx unknown
- 1969-06-26 DE DE1932500A patent/DE1932500C3/de not_active Expired
- 1969-06-26 NO NO2676/69A patent/NO131332C/no unknown
- 1969-06-26 DK DK346769AA patent/DK124172B/da not_active IP Right Cessation
- 1969-06-26 FR FR6921547A patent/FR2014310A1/fr not_active Withdrawn
- 1969-06-27 CH CH992869A patent/CH497301A/de not_active IP Right Cessation
- 1969-06-27 JP JP44050946A patent/JPS4924604B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE1932500A1 (de) | 1970-08-27 |
| NO131332B (enExample) | 1975-02-03 |
| NL6909357A (enExample) | 1969-12-30 |
| JPS4924604B1 (enExample) | 1974-06-24 |
| BE735068A (enExample) | 1969-12-01 |
| NO131332C (enExample) | 1975-05-14 |
| CH497301A (de) | 1970-10-15 |
| IL32465A (en) | 1972-03-28 |
| SE356685B (enExample) | 1973-06-04 |
| US3578260A (en) | 1971-05-11 |
| IL32465A0 (en) | 1969-08-27 |
| DE1932500B2 (enExample) | 1979-09-27 |
| FR2014310A1 (enExample) | 1970-04-17 |
| GB1221846A (en) | 1971-02-10 |
| DK124172B (da) | 1972-09-25 |
| ES368674A1 (es) | 1971-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1932500C3 (de) | Beharrungsgesteuerter Wickelmechanismus für einen Sicherheitsgurt | |
| DE2429368C2 (de) | Vorrichtung zum selbsttätigen Verriegeln eines Fahrzeug-Sicherheitgurtes | |
| DE2251982C3 (de) | Abnehmabre Kassette für das Farbband einer Rechenmaschine | |
| DE1506621B2 (de) | Doppeltwirkende automatische Sperrvorrichtung für einen Sicherheitsgurt | |
| DE8803659U1 (de) | Im Notfall blockierende Rückholvorrichtung für einen Sitzgurt | |
| DE2523675B2 (de) | Rueckholvorrichtung fuer sicherheitsgurte, insbesondere fuer kraftfahrzeuge | |
| DE2722487A1 (de) | Einziehvorrichtung fuer sicherheitsgurte | |
| DE2264509C3 (de) | Gelenkbeschlag für Kraftfahrzeugsitze | |
| DE102013004211B4 (de) | Gurtaufroller | |
| DE1257591B (de) | Auf Beschleunigungen ansprechende Sperrvorrichtung fuer die Aufwickelrolle eines Anschnallgurtes | |
| DE2537453A1 (de) | Sperrvorrichtung fuer die gurtaufwikkelrolle von fahrzeugsicherheitsgurten | |
| DE4137029C2 (de) | Fahrzeugsitzgurt-Rückholvorrichtung | |
| DE3248426C2 (enExample) | ||
| DE2733121C3 (de) | Fahrzeugsensitive Blockiervorrichtung fur Sicherheitsgurte | |
| DE2515085C3 (de) | Selbstsperrende Aufwickelrolle für Sicherheitsgurte | |
| DE1207138B (de) | Angelwinde mit Laengsachse | |
| DE2530006A1 (de) | Sperrvorrichtung fuer einen aufwickel- sicherheitsgurt fuer fahrzeuge | |
| DE2621059C2 (de) | Spannungsfrei anlegbarer Automatikgurt | |
| DE2557460B2 (de) | Sicherheitsgurt-Aufrollvorrichtung | |
| DE1430599C2 (de) | Durch die Trägheit einer Masse betätigte Verriegelungseinrichtung für einen Sicherheitsgurt, insbesondere für Kraftfahrzeuge | |
| DE2733122A1 (de) | Fahrzeugsensitive blockiervorrichtung fuer sicherheitsgurte | |
| DE611138C (de) | Vorrichtung zum Verhindern des Ruecklaufs von Kraftfahrzeugen | |
| DE952721C (de) | Formular-Blattfernschreibempfaenger mit einer Einrichtung zum Abfuehlen der mit mindestens einem Steuerloch je Formular versehenen Papierbahn | |
| DE1556807C (de) | Beharrungsgesteuerter Wickelmechams mus fur einen Sicherheitsgurt | |
| DE1506128A1 (de) | Aufrollvorrichtung fuer Sicherheitsgurte an Fahrzeugsitzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8325 | Change of the main classification |
Ipc: B60R 22/40 |
|
| 8327 | Change in the person/name/address of the patent owner |
Owner name: ASE (UK) LTD., CARLISLE, CUMBRIA, GB |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: HANSMANN, A., DIPL.-WIRTSCH.-ING., PAT.-ANW., 8000 MUENCHEN |