DE1905580A1 - Photoelektrostatische Kopiervorrichtung - Google Patents
Photoelektrostatische KopiervorrichtungInfo
- Publication number
- DE1905580A1 DE1905580A1 DE19691905580 DE1905580A DE1905580A1 DE 1905580 A1 DE1905580 A1 DE 1905580A1 DE 19691905580 DE19691905580 DE 19691905580 DE 1905580 A DE1905580 A DE 1905580A DE 1905580 A1 DE1905580 A1 DE 1905580A1
- Authority
- DE
- Germany
- Prior art keywords
- conductive
- conductive layer
- layer
- tape
- photoconductive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 claims description 15
- 239000011248 coating agent Substances 0.000 claims description 8
- 238000000576 coating method Methods 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 239000000843 powder Substances 0.000 claims description 6
- 229920000728 polyester Polymers 0.000 claims description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 claims description 3
- 229910001507 metal halide Inorganic materials 0.000 claims description 2
- 150000005309 metal halides Chemical class 0.000 claims description 2
- 238000010276 construction Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 6
- 239000011230 binding agent Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 4
- 229920006267 polyester film Polymers 0.000 description 4
- -1 polyethylene, ethylene vinyl acetate Polymers 0.000 description 4
- 239000004065 semiconductor Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 229920002799 BoPET Polymers 0.000 description 2
- 239000005041 Mylar™ Substances 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- DQEFEBPAPFSJLV-UHFFFAOYSA-N Cellulose propionate Chemical compound CCC(=O)OCC1OC(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C1OC1C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(COC(=O)CC)O1 DQEFEBPAPFSJLV-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920006328 Styrofoam Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 229920006218 cellulose propionate Polymers 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000002508 contact lithography Methods 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229920002382 photo conductive polymer Polymers 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920003225 polyurethane elastomer Polymers 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000008261 styrofoam Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G15/00—Apparatus for electrographic processes using a charge pattern
- G03G15/75—Details relating to xerographic drum, band or plate, e.g. replacing, testing
- G03G15/754—Details relating to xerographic drum, band or plate, e.g. replacing, testing relating to band, e.g. tensioning
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/10—Bases for charge-receiving or other layers
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Discharging, Photosensitive Material Shape In Electrophotography (AREA)
- Photoreceptors In Electrophotography (AREA)
- Electrostatic Charge, Transfer And Separation In Electrography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US70291768A | 1968-02-05 | 1968-02-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1905580A1 true DE1905580A1 (de) | 1969-08-28 |
Family
ID=24823148
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691905580 Pending DE1905580A1 (de) | 1968-02-05 | 1969-02-05 | Photoelektrostatische Kopiervorrichtung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3533692A (OSRAM) |
| BE (1) | BE727973A (OSRAM) |
| DE (1) | DE1905580A1 (OSRAM) |
| FR (1) | FR2005210A1 (OSRAM) |
| GB (1) | GB1249734A (OSRAM) |
| NL (1) | NL6901792A (OSRAM) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3542400A1 (de) * | 1985-11-30 | 1987-06-04 | Braun Ag | Anordnung zur funkentstoerung von elektrisch betriebenen antriebsmotoren, insbesondere in haushaltsgeraeten |
| DE3913613A1 (de) * | 1988-04-25 | 1989-11-09 | Fuji Electric Co Ltd | Verfahren zum regenerieren eines fotorezeptors fuer die elektrofotographie |
| DE10049817A1 (de) * | 2000-10-09 | 2002-04-25 | Siemens Ag | Induktionsvorrichtung mit Dämpfungseinrichtung |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3620614A (en) * | 1970-04-06 | 1971-11-16 | Addressograph Multigraph | Photoelectrostatic copying machine with corona means establishing a reference potential |
| US3749927A (en) * | 1970-07-03 | 1973-07-31 | Fuji Photo Film Co Ltd | Electrostatic charging process for electrophotographic photosensitive material |
| US3796488A (en) * | 1970-09-28 | 1974-03-12 | Minolta Camera Kk | Electrophotographic duplicator |
| NL171934C (nl) * | 1972-02-07 | 1983-06-01 | Hoechst Ag | Stelsel met een bandvormige elektrofotografische beelddrager en een glijcontact. |
| US3910475A (en) * | 1973-03-15 | 1975-10-07 | Xerox Corp | System for electrically grounding or biasing a member |
| US3941280A (en) * | 1974-02-13 | 1976-03-02 | Xerox Corporation | Apparatus for controlling developer efficiency |
| JPS5426027Y2 (OSRAM) * | 1977-07-29 | 1979-08-29 | ||
| DE2832775A1 (de) * | 1978-07-26 | 1980-02-07 | Hoechst Ag | Auflageplatte fuer ein fotoleitfaehiges bandfoermiges aufzeichnungsmaterial |
| US4192603A (en) * | 1978-09-27 | 1980-03-11 | Xerox Corporation | Replenishable photoconductor system |
| US4198155A (en) * | 1978-10-30 | 1980-04-15 | Xerox Corporation | Photoconductive belt assembly |
| JPS5573075A (en) * | 1978-11-28 | 1980-06-02 | Ricoh Co Ltd | Electrophotographic copying apparatus |
| JPS587392Y2 (ja) * | 1980-09-12 | 1983-02-09 | ヘキスト・アクチエンゲゼルシヤフト | 接点装置 |
| US4344698A (en) * | 1980-10-01 | 1982-08-17 | Eastman Kodak Company | Electrophotographic apparatus having improved grounding means |
| JPS5868050A (ja) * | 1981-10-19 | 1983-04-22 | Fuji Photo Film Co Ltd | 電子写真による多種情報記録方法 |
| GB2121694A (en) * | 1982-06-11 | 1984-01-04 | Tornado Model Products Limited | Toy vehicles |
| US4823942A (en) * | 1983-01-13 | 1989-04-25 | The Goodyear Tire & Rubber Company | Electrically conductive document transport belt |
| US4512653A (en) * | 1983-06-15 | 1985-04-23 | Eastman Kodak Company | Method and apparatus for thermally-assisted grounding of an electrographic imaging member |
| US4540271A (en) * | 1983-06-29 | 1985-09-10 | Eastman Kodak Company | Electrophotographic apparatus having improved, fixed-contact grounding structure |
| DE3689486T2 (de) * | 1985-08-01 | 1994-07-21 | Raytheon Co | Brennwertkessel. |
| ATE118956T1 (de) * | 1990-12-26 | 1995-03-15 | Eastman Kodak Co | System und verfahren zum elektrostatischen entladen eines bandes. |
| US5303013A (en) * | 1991-03-18 | 1994-04-12 | Fujitsu Limited | Color picture image formation device for developing latent image formed on a photosensitive body |
| US5519230A (en) * | 1994-08-25 | 1996-05-21 | Xerox Corporation | Belt edge steering sensor |
| US5537189A (en) * | 1995-07-03 | 1996-07-16 | Xerox Corporation | Printing apparatus which grounds photoreceptor independently of CRU |
| US5683840A (en) * | 1996-04-11 | 1997-11-04 | Xerox Corporation | Method and apparatus for grounding migration imaging members |
| KR100346702B1 (ko) * | 1999-07-01 | 2002-08-01 | 삼성전자 주식회사 | 전자사진방식 인쇄기의 감광벨트 접지 구조체 |
| US10185259B2 (en) * | 2016-03-18 | 2019-01-22 | Ricoh Company, Ltd. | Endless belt, fixing device, image forming apparatus, and method of manufacturing endless belt |
| JP6870333B2 (ja) * | 2016-03-18 | 2021-05-12 | 株式会社リコー | 無端ベルト、定着装置、画像形成装置、及び、無端ベルトの製造方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3045644A (en) * | 1957-06-06 | 1962-07-24 | Xerox Corp | Two-color electrostatic printing apparatus |
| US3152012A (en) * | 1960-12-19 | 1964-10-06 | Ibm | Apparatus for the development of electrostatic images |
| US3288602A (en) * | 1962-04-04 | 1966-11-29 | Xerox Corp | Xerographic plate and method |
| US3337339A (en) * | 1962-10-01 | 1967-08-22 | Xerox Corp | Screen xerography |
| US3185051A (en) * | 1962-10-16 | 1965-05-25 | Xerox Corp | Xerographic method |
| US3190199A (en) * | 1963-01-02 | 1965-06-22 | Xerox Corp | Xerographic copying apparatus |
-
1968
- 1968-02-05 US US702917A patent/US3533692A/en not_active Expired - Lifetime
-
1969
- 1969-02-03 GB GB5716/69A patent/GB1249734A/en not_active Expired
- 1969-02-04 FR FR6902406A patent/FR2005210A1/fr not_active Withdrawn
- 1969-02-05 DE DE19691905580 patent/DE1905580A1/de active Pending
- 1969-02-05 BE BE727973D patent/BE727973A/xx unknown
- 1969-02-05 NL NL6901792A patent/NL6901792A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3542400A1 (de) * | 1985-11-30 | 1987-06-04 | Braun Ag | Anordnung zur funkentstoerung von elektrisch betriebenen antriebsmotoren, insbesondere in haushaltsgeraeten |
| DE3913613A1 (de) * | 1988-04-25 | 1989-11-09 | Fuji Electric Co Ltd | Verfahren zum regenerieren eines fotorezeptors fuer die elektrofotographie |
| DE10049817A1 (de) * | 2000-10-09 | 2002-04-25 | Siemens Ag | Induktionsvorrichtung mit Dämpfungseinrichtung |
Also Published As
| Publication number | Publication date |
|---|---|
| BE727973A (OSRAM) | 1969-07-16 |
| GB1249734A (en) | 1971-10-13 |
| US3533692A (en) | 1970-10-13 |
| FR2005210A1 (OSRAM) | 1969-12-12 |
| NL6901792A (OSRAM) | 1969-08-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1905580A1 (de) | Photoelektrostatische Kopiervorrichtung | |
| DE2210337C3 (de) | Vorrichtung zur Entwicklung von elektrostatischen Ladungsbildern | |
| DE69213903T2 (de) | Apparatur zur Tonerleilchenübertragung auf ein Substrat | |
| DE2951460C2 (de) | Elektrographisches Verfahren und Vorrichtung zur Durchführung eines elektrographischen Verfahrens | |
| DE2059805A1 (de) | Vorrichtung zur UEbertragung elektrostatisch geladener Tonerteilchen | |
| DE2400716A1 (de) | Verfahren und vorrichtung zum entwickeln einer latente elektrostatische bilder tragenden flaeche mit toner | |
| DE1497070B2 (de) | Vorrichtung zum entwickeln elektrostatischer ladungsbilder | |
| DE2954323C2 (de) | Magnetbürsten-Entwicklervorrichtung zum Entwickeln eines elektrostatischen Ladungsbildes | |
| DE2058481A1 (de) | Verfahren und Vorrichtung zur UEbertragung eines elektrophotographischen Tonerbildes | |
| DE2263903A1 (de) | Verfahren und vorrichtung zur elektrofotografie | |
| DE1900804C3 (de) | Elektrostatische Kopiereinrichtung zum Herstellen mehrerer Tonerbilder von einem einzigen Ladungsbild | |
| DE2162086A1 (de) | Verfahren zur Entwicklung elektrostatischer latenter Bilder | |
| DE2820805C2 (de) | Verfahren und Vorrichtung zur Erzeugung eines latenten elektrostatischen Bildes | |
| DE69819413T2 (de) | Entwicklung eines latenten elektrostatischen Bildes | |
| DE2339458A1 (de) | Elektrophotographisches system | |
| DE69323133T2 (de) | Drahtlose, berührungslose hybride Entwicklung | |
| DE1414991A1 (de) | Vorrichtung zur Induktion von Ladungen | |
| DE2832175A1 (de) | Elektrophotographisches verfahren | |
| DE2165359C3 (de) | Elektrophotographisches Kopierverfahren | |
| DE2111158C3 (de) | Verfahren und Vorrichtung zur Einstellung eines bestimmten elektrischen Potentials an einem wählbaren ersten Ort der elektrisch leitenden Schicht eines bandförmigen photoleitfähigen Aufzeichnungsmaterials | |
| DE2200449A1 (de) | Verfahren zur Entwicklung eines latenten elektrostatischen Bildes | |
| DE2361418A1 (de) | Verfahren und vorrichtung zum entwickeln eines elektrostatischen latenten bilds | |
| DE2163608C3 (de) | Verfahren zur Erzeugung eines Tonerbildes auf den beiden Seiten eines blattförmigen Bildempfangsmaterials und Vorrichtung zur Durchführung dieses Verfahrens | |
| DE2526415A1 (de) | Elektronenradiografisches verfahren und vorrichtung zur durchfuehrung des verfahrens | |
| DE2303819A1 (de) | Photoelektrostatische bilduebertragungsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |