DE1904540A1 - Verfahren zum Polymerisieren von Oxazolinen - Google Patents
Verfahren zum Polymerisieren von OxazolinenInfo
- Publication number
- DE1904540A1 DE1904540A1 DE19691904540 DE1904540A DE1904540A1 DE 1904540 A1 DE1904540 A1 DE 1904540A1 DE 19691904540 DE19691904540 DE 19691904540 DE 1904540 A DE1904540 A DE 1904540A DE 1904540 A1 DE1904540 A1 DE 1904540A1
- Authority
- DE
- Germany
- Prior art keywords
- reactor
- monomer
- mixture
- daa
- oxazolines
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 21
- 230000008569 process Effects 0.000 title claims description 12
- 230000000379 polymerizing effect Effects 0.000 title claims description 4
- 150000002918 oxazolines Chemical class 0.000 title description 8
- 239000000178 monomer Substances 0.000 claims description 23
- 239000003054 catalyst Substances 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 18
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 description 19
- -1 2-substituted -oxazolines Chemical class 0.000 description 12
- 238000006116 polymerization reaction Methods 0.000 description 9
- 239000002253 acid Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- 241000209202 Bromus secalinus Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000012662 bulk polymerization Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011951 cationic catalyst Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- GIGOAOBKJCQHSF-UHFFFAOYSA-N 2-heptadecyl-4,5-dihydro-1,3-oxazole Chemical compound CCCCCCCCCCCCCCCCCC1=NCCO1 GIGOAOBKJCQHSF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 241000353097 Molva molva Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- AVSOCXWJUCUDHB-UHFFFAOYSA-N diethyl sulfate;dimethyl sulfate Chemical compound COS(=O)(=O)OC.CCOS(=O)(=O)OCC AVSOCXWJUCUDHB-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005485 electric heating Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 125000004401 m-toluyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C(*)=O 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- YXJYBPXSEKMEEJ-UHFFFAOYSA-N phosphoric acid;sulfuric acid Chemical compound OP(O)(O)=O.OS(O)(=O)=O YXJYBPXSEKMEEJ-UHFFFAOYSA-N 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/02—Polyamines
- C08G73/0233—Polyamines derived from (poly)oxazolines, (poly)oxazines or having pendant acyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US70239968A | 1968-02-01 | 1968-02-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1904540A1 true DE1904540A1 (de) | 1970-01-08 |
Family
ID=24821069
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691904540 Pending DE1904540A1 (de) | 1968-02-01 | 1969-01-30 | Verfahren zum Polymerisieren von Oxazolinen |
Country Status (3)
| Country | Link |
|---|---|
| CH (1) | CH515292A (enExample) |
| DE (1) | DE1904540A1 (enExample) |
| GB (1) | GB1238004A (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0140291A3 (en) * | 1983-10-21 | 1986-07-30 | Takeda Chemical Industries, Ltd. | Process for producing cross-linked polyesteramides |
| EP0141345A3 (en) * | 1983-10-21 | 1986-07-30 | Takeda Chemical Industries, Ltd. | Process for producing cross-linked resins |
| EP0148457A3 (en) * | 1983-12-26 | 1987-03-25 | Takeda Chemical Industries, Ltd. | Process for producing cross-linked resins |
| WO1995021894A1 (de) * | 1994-02-08 | 1995-08-17 | Henkel Kommanditgesellschaft Auf Aktien | Verlaufsmittel für pulverlacke |
| US5512614A (en) * | 1992-08-13 | 1996-04-30 | Henkel Kommanditgesellschaft Auf Aktien | Binder mixtures for stoving lacquers |
| DE102005039154A1 (de) * | 2005-08-17 | 2007-03-01 | GÖPFERICH, Achim, Prof. Dr. | Bioabbaubare Polymere für den Transport von Nukleinsäuren in Zellen |
| EP2970588A4 (en) * | 2013-03-15 | 2016-11-02 | Basf Se | CYCLE OPENING OF OXAZOLINES AT HIGH TEMPERATURE IN A CONTINUOUS PROCESS |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN104684632A (zh) * | 2012-09-14 | 2015-06-03 | 伊沃夸水处理技术有限责任公司 | 用于膜的聚合物共混物 |
| US20160090447A1 (en) * | 2013-05-29 | 2016-03-31 | Basf Se | Continuous Process For The Preparation Of Polyoxazolines |
| CN107847869B (zh) | 2015-07-14 | 2021-09-10 | 罗门哈斯电子材料新加坡私人有限公司 | 用于过滤系统的通气装置 |
| WO2017182610A1 (en) * | 2016-04-22 | 2017-10-26 | Universiteit Gent | Methods for the preparation of cyclic imino ether polymers |
-
1969
- 1969-01-30 DE DE19691904540 patent/DE1904540A1/de active Pending
- 1969-01-30 CH CH142369A patent/CH515292A/de not_active IP Right Cessation
- 1969-01-31 GB GB1238004D patent/GB1238004A/en not_active Expired
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0140291A3 (en) * | 1983-10-21 | 1986-07-30 | Takeda Chemical Industries, Ltd. | Process for producing cross-linked polyesteramides |
| EP0141345A3 (en) * | 1983-10-21 | 1986-07-30 | Takeda Chemical Industries, Ltd. | Process for producing cross-linked resins |
| EP0148457A3 (en) * | 1983-12-26 | 1987-03-25 | Takeda Chemical Industries, Ltd. | Process for producing cross-linked resins |
| US5512614A (en) * | 1992-08-13 | 1996-04-30 | Henkel Kommanditgesellschaft Auf Aktien | Binder mixtures for stoving lacquers |
| WO1995021894A1 (de) * | 1994-02-08 | 1995-08-17 | Henkel Kommanditgesellschaft Auf Aktien | Verlaufsmittel für pulverlacke |
| US5786308A (en) * | 1994-02-08 | 1998-07-28 | Henkel Kommanditgesellschaft Auf Aktien | Flow controllers for powder lacquers |
| DE102005039154A1 (de) * | 2005-08-17 | 2007-03-01 | GÖPFERICH, Achim, Prof. Dr. | Bioabbaubare Polymere für den Transport von Nukleinsäuren in Zellen |
| EP2970588A4 (en) * | 2013-03-15 | 2016-11-02 | Basf Se | CYCLE OPENING OF OXAZOLINES AT HIGH TEMPERATURE IN A CONTINUOUS PROCESS |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1238004A (enExample) | 1971-07-07 |
| CH515292A (de) | 1971-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2343871A1 (de) | Verfahren zur herstellung von einheitlichen polymerisaten. | |
| DE1520500B1 (de) | Verfahren zur Herstellung von Tetrafluoraethylen-Hexafluorpropylen-Mischpolymerisaten | |
| DE3115898A1 (de) | "verfahren zur herstellung von styrolpolymeren" | |
| DE1904540A1 (de) | Verfahren zum Polymerisieren von Oxazolinen | |
| DE1745233B2 (de) | Verfahren zur herstellung eines sirups von methacrylsaeuremethylesterpolymerisat | |
| DE2341318B2 (de) | Verfahren zur Herstellung von formbaren Methylmethacrylat-Polymerisaten | |
| EP0134995A2 (de) | Wasserlösliche Ester von Polymerisaten der Acrylsäure | |
| DE2133606A1 (de) | Verfahren zur Herstellung von Pfropfpolymeren des Vinylchlonds | |
| DE1595343C3 (de) | Verfahren zum Herstellen scMagfester Styrol-Acrylnitrilmischpolymerisate | |
| DE3213735C2 (de) | Verfahren und Vorrichtung zum kontinuierlichen Herstellen von hochschlagfestem Polystyrol | |
| DE69603529T2 (de) | Verbessertes Verfahren zur kontinuierlichen Herstellung von Poly-Epsilon-Caprolactonen | |
| DE2724166C2 (de) | Verfahren zur Herstellung eines Polymers durch Additionspolymerisation in Gegenwart eines Starters | |
| DE1620962A1 (de) | Verfahren zur Polymerisation und Mischpolymerisation von Vinylfluorid und verwandten Produkten | |
| DE2415983A1 (de) | Verfahren zum substanzhomo- oder -copolymerisieren von vinylchlorid | |
| DE1570631A1 (de) | Verfahren zur Herstellung hoch schlagfester,loesungsmittelbestaendiger,formbarer Polymerer | |
| DE1495804C3 (de) | Verfahren zur Herstellung von Polyäthylen-Selbstglanzdispersionen | |
| DE1074264B (enExample) | ||
| DE1519415C3 (de) | Verfahren zur Herstellung wäßriger Emulsionen | |
| DE69310943T2 (de) | Verfahren zur kontinuierlichen Herstellung von Blockcopolymeren aus Vinylaromat | |
| EP0137138B1 (de) | Verfahren zur Herstellung von Suspensions-Polyvinylchlorid, welches zur Spritzgiessverarbeitung geeignet ist | |
| DE2240294A1 (de) | Kontinuierliches verfahren zur polymerisation in masse | |
| DE1109900B (de) | Verfahren zur Herstellung trocknender polymerer Kohlenwasserstoffoele | |
| DE2062976C3 (de) | Kontinuierliches Verfahren zur Herstellung von Methylmethacrylatpolymeren | |
| DE2909706C2 (de) | Verfahren zur Herstellung von Epoxydharz | |
| DE1520500C (de) | Verfahren zur Herstellung von Tetrafluoräthylen-Hexafluorpropylen-Mischpolymerisaten |