DE1816778C - - Google Patents
Info
- Publication number
- DE1816778C DE1816778C DE19681816778 DE1816778A DE1816778C DE 1816778 C DE1816778 C DE 1816778C DE 19681816778 DE19681816778 DE 19681816778 DE 1816778 A DE1816778 A DE 1816778A DE 1816778 C DE1816778 C DE 1816778C
- Authority
- DE
- Germany
- Prior art keywords
- percent
- weight
- catalyst
- toluene
- aromatics
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 114
- 239000003054 catalyst Substances 0.000 claims description 37
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 20
- 229910052751 metal Inorganic materials 0.000 claims description 16
- 239000002184 metal Substances 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 15
- 229910052785 arsenic Inorganic materials 0.000 claims description 13
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 13
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 12
- 238000007323 disproportionation reaction Methods 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- -1 rare earth metal cations Chemical class 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 239000003674 animal food additive Substances 0.000 claims description 8
- 150000001768 cations Chemical class 0.000 claims description 5
- 150000002739 metals Chemical class 0.000 claims description 5
- 239000011148 porous material Substances 0.000 claims description 5
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- 230000000737 periodic effect Effects 0.000 claims description 4
- 239000002178 crystalline material Substances 0.000 claims 1
- 238000005984 hydrogenation reaction Methods 0.000 claims 1
- 230000002175 menstrual effect Effects 0.000 claims 1
- 229910052761 rare earth metal Inorganic materials 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 57
- 239000000047 product Substances 0.000 description 28
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 23
- 238000006243 chemical reaction Methods 0.000 description 16
- 125000004429 atom Chemical group 0.000 description 13
- 239000004215 Carbon black (E152) Substances 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- 229930195733 hydrocarbon Natural products 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 229910052697 platinum Inorganic materials 0.000 description 10
- 239000000463 material Substances 0.000 description 9
- 239000007788 liquid Substances 0.000 description 8
- 150000002430 hydrocarbons Chemical class 0.000 description 7
- 239000012013 faujasite Substances 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 239000000654 additive Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 230000003247 decreasing effect Effects 0.000 description 4
- 239000012530 fluid Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000020335 dealkylation Effects 0.000 description 2
- 238000006900 dealkylation reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 229910052680 mordenite Inorganic materials 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- 241001133287 Artocarpus hirsutus Species 0.000 description 1
- 101100190464 Caenorhabditis elegans pid-2 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- HKNFUVXCJNYKQH-UHFFFAOYSA-N [As].[Pt] Chemical compound [As].[Pt] HKNFUVXCJNYKQH-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019568 aromas Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000001495 arsenic compounds Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US694061A US3417157A (en) | 1967-12-28 | 1967-12-28 | Transalkylation of toluene and catalyst therefor |
| US69406167 | 1967-12-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1816778A1 DE1816778A1 (de) | 1969-07-17 |
| DE1816778C true DE1816778C (cg-RX-API-DMAC7.html) | 1973-06-07 |
Family
ID=24787243
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681817865 Pending DE1817865A1 (de) | 1967-12-28 | 1968-12-23 | Katalysator zum disproportionieren von toluol und verfahren zu seiner herstellung |
| DE19681816778 Granted DE1816778A1 (de) | 1967-12-28 | 1968-12-23 | Verfahren und Katalysator zum Transalkylieren von Toluol |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681817865 Pending DE1817865A1 (de) | 1967-12-28 | 1968-12-23 | Katalysator zum disproportionieren von toluol und verfahren zu seiner herstellung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3417157A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS4913771B1 (cg-RX-API-DMAC7.html) |
| BR (1) | BR6805180D0 (cg-RX-API-DMAC7.html) |
| DE (2) | DE1817865A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR1600557A (cg-RX-API-DMAC7.html) |
| GB (1) | GB1251388A (cg-RX-API-DMAC7.html) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3679769A (en) * | 1968-12-19 | 1972-07-25 | Ashland Oil Inc | Alkyl transfer of alkyl aromatics with group viii metals on zeolites |
| US3668265A (en) * | 1970-01-14 | 1972-06-06 | Phillips Petroleum Co | Disproportionation of alkylbenzenes |
| US3793183A (en) * | 1972-12-11 | 1974-02-19 | Standard Oil Co | Method for starting up a reforming process employing a catalyst containing a group viii metal, rhenium, and selenium |
| JPS5072568U (cg-RX-API-DMAC7.html) * | 1973-11-07 | 1975-06-26 | ||
| JPS50135473U (cg-RX-API-DMAC7.html) * | 1974-04-22 | 1975-11-07 | ||
| JPS51118556A (en) * | 1975-04-10 | 1976-10-18 | Tamura Seisakusho Co Ltd | Gas ignition device |
| US4016219A (en) * | 1975-08-22 | 1977-04-05 | Mobil Oil Corporation | Disproportionation of toluene |
| US4178267A (en) * | 1976-03-29 | 1979-12-11 | Phillips Petroleum Company | Passivating metals on cracking catalysts |
| US4141858A (en) * | 1976-03-29 | 1979-02-27 | Phillips Petroleum Company | Passivating metals on cracking catalysts |
| US4183803A (en) * | 1976-03-29 | 1980-01-15 | Phillips Petroleum Company | Passivating metals on cracking catalysts |
| US4011276A (en) * | 1976-04-28 | 1977-03-08 | Mobil Oil Corporation | Disproportionation of toluene |
| NZ183608A (en) * | 1976-03-31 | 1978-12-18 | Mobil Oil Corp | Aluminosilicate zeolite catalyst for selectine production of para-diakyl substituted benzenes |
| US4098837A (en) * | 1976-04-28 | 1978-07-04 | Mobil Oil Corporation | Disproportionation of toluene |
| JPS52152878U (cg-RX-API-DMAC7.html) * | 1976-05-14 | 1977-11-19 | ||
| JPS5321666A (en) * | 1976-08-10 | 1978-02-28 | Yanagisawa Seisakusho Kk | Igniter for gas appliance |
| US4874731A (en) * | 1987-10-13 | 1989-10-17 | Uop | Catalyst for the isomerization of aromatics |
| US4873387A (en) * | 1987-10-13 | 1989-10-10 | Uop | Process for the isomerization of aromatics |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3281483A (en) * | 1963-08-15 | 1966-10-25 | Shell Oil Co | Disproportionation of alkyl aromatic hydrocarbons in the presence of hydrogen mordenite |
| US3140253A (en) * | 1964-05-01 | 1964-07-07 | Socony Mobil Oil Co Inc | Catalytic hydrocarbon conversion with a crystalline zeolite composite catalyst |
| GB1081373A (en) * | 1965-02-19 | 1967-08-31 | British Petroleum Co | Hydrocarbon disproportionation process |
| US3293319A (en) * | 1966-02-14 | 1966-12-20 | Universal Oil Prod Co | Catalytic dehydrogenation of paraffinic hydrocarbons |
| US3310599A (en) * | 1966-02-14 | 1967-03-21 | Universal Oil Prod Co | Catalytic dehydrogenation of paraffinic hydrocarbons |
-
1967
- 1967-12-28 US US694061A patent/US3417157A/en not_active Expired - Lifetime
-
1968
- 1968-12-23 GB GB1251388D patent/GB1251388A/en not_active Expired
- 1968-12-23 DE DE19681817865 patent/DE1817865A1/de active Pending
- 1968-12-23 DE DE19681816778 patent/DE1816778A1/de active Granted
- 1968-12-27 BR BR205180/68A patent/BR6805180D0/pt unknown
- 1968-12-27 FR FR1600557D patent/FR1600557A/fr not_active Expired
- 1968-12-27 JP JP43095576A patent/JPS4913771B1/ja active Pending
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1816778C (cg-RX-API-DMAC7.html) | ||
| DE68902080T2 (de) | Verfahren zur reduktiven alkylierung. | |
| DE69930533T2 (de) | Katalysator zur disproportionierung und transalkylierung von aromatischen kohlenwasserstoffen und verfahren zu seiner herstellung | |
| DE69908886T2 (de) | Verfahren zur Herstellung eines Zeoliths des EUO-Typs mittels Vorläufern des Strukturbildners und dessen Verwendung als Isomerisierungskatalysator von Aromaten mit acht Kohlenstoffatomen | |
| DE1817865A1 (de) | Katalysator zum disproportionieren von toluol und verfahren zu seiner herstellung | |
| DE2640471A1 (de) | Verfahren zum dehydrierenden cyclisieren von aliphatischen kohlenwasserstoffen | |
| DE2419620A1 (de) | Verfahren zur herstellung von adamantanverbindungen | |
| DE1276009B (de) | Verfahren zum Wiederbeleben von kristallinen Aluminosilicat-Zeolith-Katalysatoren | |
| DE3427979A1 (de) | Verfahren zur gewinnung von 2-butenen aus 1-buten und gegebenenfalls 2-butene enthaltenden c(pfeil abwaerts)4(pfeil abwaerts)-kohlenwasserstoffgemischen | |
| DE60133237T2 (de) | Verfahren zur Herstellung eines Zeoliths des EUO-typs, so erhaltener Zeolith, und dessen Verwendung als Isomerierungskatalysator von Aromaten mit acht Kohlenstoffatomen | |
| DE2000491A1 (de) | Verfahren zur katalytischen Umlagerung von Alkylaromaten | |
| DE3837225A1 (de) | Ein mordenit und titan enthaltender isomerierungskatalysator fuer normalparaffine | |
| DE1189052B (de) | Verfahren zur Aktivierung von zur Isomerisierung von Alkylenoxyden mit 3 bis 5 Kohlenstoffatomen im Molekuel zu den entsprechenden Alkoholen dienenden Lithiumphosphatkatalysatoren | |
| EP0352505B1 (de) | Verfahren zur Herstellung von Thymol | |
| DE1816931B2 (de) | Verfahren zur reinigung eines bei der chlorierung von essigsaeure unter bildung von monochloressigsaeure anfallenden rohproduktes | |
| DE1816778B (cg-RX-API-DMAC7.html) | ||
| DE69000576T2 (de) | Verwendung von gallium enthaltendem aluminosilikat-katalysator fuer die aromatisierung von c5-c7 leichten fraktionen. | |
| DE4105223A1 (de) | Katalysator zur umwandlung technischer c(pfeil abwaerts)8(pfeil abwaerts)-aromatenfraktionen | |
| DE2162614C3 (de) | Verfahren zum Isomerisieren eines nicht im Gleichgewicht befindlichen Polymethylbenzolgemisches | |
| WO2001017932A1 (de) | Verfahren zur herstellung bzw. gewinnung von 2,6-dichlortoluol | |
| DE69012103T2 (de) | Verfahren zur herstellung von 4,4'-diisopropylbiphenyl. | |
| DE1667307C3 (cg-RX-API-DMAC7.html) | ||
| DE2806130A1 (de) | Verfahren zur vorbehandlung eines katalysators, der bei der umwandlung von aromatischen kohlenwasserstoffen in einer wasserstoffatmosphaere benutzt wird | |
| DE2127170A1 (de) | Verfahren zur Umwandlung von alkylaromatischem Kohlenwasserstoff und Katalysator zur Durchführung des Verfahrens | |
| DE1925102B2 (cg-RX-API-DMAC7.html) |