DE1814638C3 - - Google Patents
Info
- Publication number
- DE1814638C3 DE1814638C3 DE19681814638 DE1814638A DE1814638C3 DE 1814638 C3 DE1814638 C3 DE 1814638C3 DE 19681814638 DE19681814638 DE 19681814638 DE 1814638 A DE1814638 A DE 1814638A DE 1814638 C3 DE1814638 C3 DE 1814638C3
- Authority
- DE
- Germany
- Prior art keywords
- propylene
- titanium trichloride
- amorphous polymer
- component
- phosphate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 claims description 22
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 14
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 14
- 229920000642 polymer Polymers 0.000 claims description 13
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 claims description 11
- -1 alkyl aluminum compound Chemical class 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 10
- 238000006116 polymerization reaction Methods 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 9
- 229910019142 PO4 Inorganic materials 0.000 claims description 7
- 229920006125 amorphous polymer Polymers 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 229920001155 polypropylene Polymers 0.000 claims description 7
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 5
- 239000005977 Ethylene Substances 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 5
- 239000010452 phosphate Substances 0.000 claims description 5
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- 229920001577 copolymer Polymers 0.000 claims 2
- 239000000835 fiber Substances 0.000 claims 2
- 150000001875 compounds Chemical class 0.000 claims 1
- 239000011888 foil Substances 0.000 claims 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 claims 1
- 229910052698 phosphorus Inorganic materials 0.000 claims 1
- 239000011574 phosphorus Substances 0.000 claims 1
- 229920002959 polymer blend Polymers 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 238000009835 boiling Methods 0.000 description 8
- 239000004743 Polypropylene Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- KYLIZBIRMBGUOP-UHFFFAOYSA-N Anetholtrithion Chemical group C1=CC(OC)=CC=C1C1=CC(=S)SS1 KYLIZBIRMBGUOP-UHFFFAOYSA-N 0.000 description 1
- 241001317416 Lius Species 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- IZMHKHHRLNWLMK-UHFFFAOYSA-M chloridoaluminium Chemical compound Cl[Al] IZMHKHHRLNWLMK-UHFFFAOYSA-M 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000037048 polymerization activity Effects 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 1
- SWZWLTMDMPCGFH-UHFFFAOYSA-N tris(benzylsulfanyl)phosphane Chemical compound C=1C=CC=CC=1CSP(SCC=1C=CC=CC=1)SCC1=CC=CC=C1 SWZWLTMDMPCGFH-UHFFFAOYSA-N 0.000 description 1
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US782423A US3644320A (en) | 1968-12-09 | 1968-12-09 | Process for producing highly crystalline polyolefins |
| GB59020/68A GB1195660A (en) | 1968-12-09 | 1968-12-11 | Process for Producing Highly Crystalline Polyolefins |
| DE1814638A DE1814638B2 (de) | 1968-12-09 | 1968-12-13 | Verfahren zur Herstellung von Propylenpolymerisaten |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US78242368A | 1968-12-09 | 1968-12-09 | |
| GB59020/68A GB1195660A (en) | 1968-12-09 | 1968-12-11 | Process for Producing Highly Crystalline Polyolefins |
| DE1814638A DE1814638B2 (de) | 1968-12-09 | 1968-12-13 | Verfahren zur Herstellung von Propylenpolymerisaten |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1814638A1 DE1814638A1 (de) | 1970-07-02 |
| DE1814638B2 DE1814638B2 (de) | 1975-06-05 |
| DE1814638C3 true DE1814638C3 (cg-RX-API-DMAC7.html) | 1976-01-22 |
Family
ID=27181665
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1814638A Granted DE1814638B2 (de) | 1968-12-09 | 1968-12-13 | Verfahren zur Herstellung von Propylenpolymerisaten |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3644320A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1814638B2 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1195660A (cg-RX-API-DMAC7.html) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3972866A (en) * | 1972-06-09 | 1976-08-03 | Imperial Chemical Industries Limited | Polymerization process |
| US4051307A (en) * | 1972-06-09 | 1977-09-27 | Imperial Chemical Industries Limited | Polymerization process |
| US4142991A (en) * | 1975-12-22 | 1979-03-06 | Stauffer Chemical Company | Substantially agglomeration-free catalyst component |
| US4095016A (en) * | 1976-12-15 | 1978-06-13 | Dart Industries, Inc. | Process for the polymerization of α-olefins |
| US4376064A (en) * | 1981-05-26 | 1983-03-08 | Standard Oil Co. (Indiana) | Catalyst and process for production of polyolefins of improved morphology |
-
1968
- 1968-12-09 US US782423A patent/US3644320A/en not_active Expired - Lifetime
- 1968-12-11 GB GB59020/68A patent/GB1195660A/en not_active Expired
- 1968-12-13 DE DE1814638A patent/DE1814638B2/de active Granted
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69209102T2 (de) | Verfahren zur Herstellung von Ethylenpolymere | |
| DE1094985B (de) | Verfahren zur Polymerisation von Olefinen zu linearen, im wesentlichen unverzweigten hochmolekularen Polymerisaten | |
| DE1570949B2 (de) | Verfahren zur Herstellung von modifizierten Propylenpolymerisaten | |
| DE1814638C3 (cg-RX-API-DMAC7.html) | ||
| DE1520693A1 (de) | Verfahren zur Polymerisation von alpha-Olefinen | |
| DE1931421B2 (de) | Zaehfluessige massen und verfahren zu deren herstellung | |
| DE2346471C3 (de) | Verfahren zur Homopolymerisation von Äthylen oder Propylen und zur Mischpolymerisation von Äthylen mit einem α-Olefin und/oder Diolefin und Katalysatorzusammensetzung hierfür | |
| DE1814638B2 (de) | Verfahren zur Herstellung von Propylenpolymerisaten | |
| DE1964706A1 (de) | Verfahren zur Herstellung alternierender Copolymerer von Butadien und alpha-Olefinen,sowie dadurch hergestellte Copolymere hohen Molekulargewichtes | |
| DE1294653B (de) | Verfahren zur Polymerisation von ª‡-Olefinen | |
| DE2426795A1 (de) | Verfahren zur polymerisation von alpha-olefinen | |
| EP0068255B1 (de) | Verfahren zur Herstellung eines Polyolefins und Katalysator hierfür | |
| DE1645250C3 (de) | Verfahren zur Herstellung von isotaktischen Polyolefinen | |
| DE2947935A1 (de) | Verfahren zur polymerisation von buten-1 | |
| DE2323126A1 (de) | Verfahren zu der herstellung von polybutylen- | |
| DE2709857C2 (cg-RX-API-DMAC7.html) | ||
| DE1442528C3 (de) | Katalysator zum Polymerisieren von alpha-Olefinen und Verfahren zu seiner Herstellung | |
| DE2832440C2 (cg-RX-API-DMAC7.html) | ||
| DE2046063C3 (de) | Verfahren zur Herstellung von Polyisopren | |
| DE1520925C3 (de) | Verfahren zur Herstellung von Polyäthylen-Paraffinen mit bestimmten Eigenschaften | |
| EP0258788B1 (de) | Verfahren zum Herstellen von Homo- und Copolymerisaten des Propylens mittels eines Ziegler-Natta-Katalysatorsystems | |
| AT206178B (de) | Verfahren zur Herstellung von linearen, hochkristallinen α - Olefinpolymeren | |
| DE1495303C (de) | Verfahren zum Polymerisieren von Olefinen oder Diolefinen mit Hilfe von Ziegler Katalysatoren | |
| AT232723B (de) | Verfahren zur Polymerisation von α-Olefinen | |
| DE1814643C3 (de) | Verfahren zur Herstellung von festen kristallinen Polyolefinen |