DE1811063C - - Google Patents
Info
- Publication number
- DE1811063C DE1811063C DE19681811063 DE1811063A DE1811063C DE 1811063 C DE1811063 C DE 1811063C DE 19681811063 DE19681811063 DE 19681811063 DE 1811063 A DE1811063 A DE 1811063A DE 1811063 C DE1811063 C DE 1811063C
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- weight
- oxygen
- percent
- propylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 claims description 159
- 238000006243 chemical reaction Methods 0.000 claims description 77
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 62
- 239000000203 mixture Substances 0.000 claims description 50
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 34
- 239000001301 oxygen Substances 0.000 claims description 34
- 229910052760 oxygen Inorganic materials 0.000 claims description 34
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 33
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 33
- 150000001336 alkenes Chemical class 0.000 claims description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 29
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 28
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 26
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 24
- 239000007789 gas Substances 0.000 claims description 24
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 23
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims description 20
- 230000000694 effects Effects 0.000 claims description 20
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 20
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims description 19
- 238000007254 oxidation reaction Methods 0.000 claims description 19
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 claims description 17
- 230000003647 oxidation Effects 0.000 claims description 17
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 16
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 13
- 238000005839 oxidative dehydrogenation reaction Methods 0.000 claims description 13
- 229910052698 phosphorus Inorganic materials 0.000 claims description 13
- 239000011574 phosphorus Substances 0.000 claims description 13
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 12
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 claims description 12
- 229910052796 boron Chemical group 0.000 claims description 12
- 229910021529 ammonia Inorganic materials 0.000 claims description 11
- 238000004519 manufacturing process Methods 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 229910052750 molybdenum Inorganic materials 0.000 claims description 9
- 239000011733 molybdenum Substances 0.000 claims description 9
- 229910052720 vanadium Inorganic materials 0.000 claims description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 8
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 8
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical group [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 8
- 229910052721 tungsten Inorganic materials 0.000 claims description 7
- 239000010937 tungsten Substances 0.000 claims description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 6
- 230000003197 catalytic effect Effects 0.000 claims description 6
- MHNNAWXXUZQSNM-UHFFFAOYSA-N methylethylethylene Natural products CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 claims description 6
- DJGPQOFRRRXVHB-UHFFFAOYSA-N [Sb+]=O.[O-2].[Fe+2] Chemical compound [Sb+]=O.[O-2].[Fe+2] DJGPQOFRRRXVHB-UHFFFAOYSA-N 0.000 claims description 5
- 229910000410 antimony oxide Inorganic materials 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 150000001299 aldehydes Chemical class 0.000 claims description 4
- 239000001569 carbon dioxide Substances 0.000 claims description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 4
- 230000008859 change Effects 0.000 claims description 4
- 150000001993 dienes Chemical class 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 230000004913 activation Effects 0.000 claims 3
- 229910052751 metal Inorganic materials 0.000 claims 3
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 claims 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims 1
- 230000003213 activating effect Effects 0.000 claims 1
- 229910002091 carbon monoxide Inorganic materials 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 238000009776 industrial production Methods 0.000 claims 1
- 238000011835 investigation Methods 0.000 claims 1
- 230000000052 comparative effect Effects 0.000 description 55
- 229910004298 SiO 2 Inorganic materials 0.000 description 34
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 21
- 229910052714 tellurium Inorganic materials 0.000 description 18
- 238000001354 calcination Methods 0.000 description 17
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 13
- 229910017604 nitric acid Inorganic materials 0.000 description 13
- 239000000047 product Substances 0.000 description 12
- 229910052787 antimony Inorganic materials 0.000 description 11
- 239000000843 powder Substances 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 229910052742 iron Inorganic materials 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 8
- -1 antimony halides Chemical class 0.000 description 8
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- FXADMRZICBQPQY-UHFFFAOYSA-N orthotelluric acid Chemical compound O[Te](O)(O)(O)(O)O FXADMRZICBQPQY-UHFFFAOYSA-N 0.000 description 7
- 239000008188 pellet Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- UNTBPXHCXVWYOI-UHFFFAOYSA-O azanium;oxido(dioxo)vanadium Chemical compound [NH4+].[O-][V](=O)=O UNTBPXHCXVWYOI-UHFFFAOYSA-O 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 4
- 239000004327 boric acid Substances 0.000 description 4
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- 239000011259 mixed solution Substances 0.000 description 4
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 4
- 239000004323 potassium nitrate Substances 0.000 description 4
- 235000010333 potassium nitrate Nutrition 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 235000012239 silicon dioxide Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000000383 tetramethylene group Chemical class [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 238000005470 impregnation Methods 0.000 description 3
- 235000014413 iron hydroxide Nutrition 0.000 description 3
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical compound [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 239000011949 solid catalyst Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 2
- 229940010552 ammonium molybdate Drugs 0.000 description 2
- 235000018660 ammonium molybdate Nutrition 0.000 description 2
- 239000011609 ammonium molybdate Substances 0.000 description 2
- LJCFOYOSGPHIOO-UHFFFAOYSA-N antimony pentoxide Chemical compound O=[Sb](=O)O[Sb](=O)=O LJCFOYOSGPHIOO-UHFFFAOYSA-N 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- DAMJCWMGELCIMI-UHFFFAOYSA-N benzyl n-(2-oxopyrrolidin-3-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC1CCNC1=O DAMJCWMGELCIMI-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 159000000014 iron salts Chemical class 0.000 description 2
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 2
- JKQOBWVOAYFWKG-UHFFFAOYSA-N molybdenum trioxide Chemical compound O=[Mo](=O)=O JKQOBWVOAYFWKG-UHFFFAOYSA-N 0.000 description 2
- LIYKJALVRPGQTR-UHFFFAOYSA-M oxostibanylium;chloride Chemical compound [Cl-].[Sb+]=O LIYKJALVRPGQTR-UHFFFAOYSA-M 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000012495 reaction gas Substances 0.000 description 2
- 230000003014 reinforcing effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- LAJZODKXOMJMPK-UHFFFAOYSA-N tellurium dioxide Chemical compound O=[Te]=O LAJZODKXOMJMPK-UHFFFAOYSA-N 0.000 description 2
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical compound C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 2
- AHBGXHAWSHTPOM-UHFFFAOYSA-N 1,3,2$l^{4},4$l^{4}-dioxadistibetane 2,4-dioxide Chemical compound O=[Sb]O[Sb](=O)=O AHBGXHAWSHTPOM-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- JKUMLNOQXADSAD-UHFFFAOYSA-N [Bi].[P] Chemical compound [Bi].[P] JKUMLNOQXADSAD-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001462 antimony Chemical class 0.000 description 1
- 229910000411 antimony tetroxide Inorganic materials 0.000 description 1
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- IAQRGUVFOMOMEM-ARJAWSKDSA-N cis-but-2-ene Chemical compound C\C=C/C IAQRGUVFOMOMEM-ARJAWSKDSA-N 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 239000010431 corundum Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- VEPSWGHMGZQCIN-UHFFFAOYSA-H ferric oxalate Chemical compound [Fe+3].[Fe+3].[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O VEPSWGHMGZQCIN-UHFFFAOYSA-H 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052909 inorganic silicate Inorganic materials 0.000 description 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 1
- MVFCKEFYUDZOCX-UHFFFAOYSA-N iron(2+);dinitrate Chemical compound [Fe+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MVFCKEFYUDZOCX-UHFFFAOYSA-N 0.000 description 1
- CDVDBGXLSOHXOF-UHFFFAOYSA-N iron(2+);iron(3+);oxygen(2-) Chemical compound [O-2].[Fe+2].[Fe+3] CDVDBGXLSOHXOF-UHFFFAOYSA-N 0.000 description 1
- PVFSDGKDKFSOTB-UHFFFAOYSA-K iron(3+);triacetate Chemical compound [Fe+3].CC([O-])=O.CC([O-])=O.CC([O-])=O PVFSDGKDKFSOTB-UHFFFAOYSA-K 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 1
- 239000005078 molybdenum compound Substances 0.000 description 1
- 150000002752 molybdenum compounds Chemical class 0.000 description 1
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000036284 oxygen consumption Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000004886 process control Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000004153 renaturation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000001932 seasonal effect Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000004227 thermal cracking Methods 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 150000003682 vanadium compounds Chemical class 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7589067 | 1967-11-28 | ||
| JP7589067 | 1967-11-28 | ||
| JP6757868 | 1968-09-20 | ||
| JP6757968 | 1968-09-20 | ||
| JP43067580A JPS492085B1 (show.php) | 1968-09-20 | 1968-09-20 | |
| JP6757968 | 1968-09-20 | ||
| JP6758068 | 1968-09-20 | ||
| JP6757868 | 1968-09-20 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1811063A1 DE1811063A1 (de) | 1969-08-14 |
| DE1811063B2 DE1811063B2 (de) | 1973-01-18 |
| DE1811063C true DE1811063C (show.php) | 1973-08-09 |
Family
ID=27464874
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681811063 Granted DE1811063B2 (de) | 1967-11-28 | 1968-11-26 | Verwendung eines aktivierten katalysators auf der basis von eisenoxid-antimonoxid bei der oxydation bzw. oxydativen dehydrierung von olefinen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3668147A (show.php) |
| BE (1) | BE730696A (show.php) |
| DE (1) | DE1811063B2 (show.php) |
| FR (1) | FR1593484A (show.php) |
| GB (1) | GB1208690A (show.php) |
| IT (1) | IT859097A (show.php) |
| NL (1) | NL140163B (show.php) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE627213A (show.php) * | 1962-01-18 | |||
| US3716496A (en) * | 1969-09-06 | 1973-02-13 | Nitto Chemical Industry Co Ltd | Catalyst composition for the oxidation and the oxidative dehydrogenation of olefins |
| AU465139B2 (en) * | 1971-09-02 | 1975-09-18 | SNAMPROGETTI Sp. A | Improved catalysts forthe oxidation of olefines |
| US4151117A (en) * | 1971-09-07 | 1979-04-24 | Rohm And Haas Company | Novel oxidation catalyst and production of unsaturated aldehydes, acids and nitriles therewith |
| US3875078A (en) * | 1972-02-15 | 1975-04-01 | Celanese Corp | Catalyst for oxidation of olefins |
| DE2212964C3 (de) * | 1972-03-17 | 1980-01-31 | Basf Ag, 6700 Ludwigshafen | Vanadinpentoxid, Titandioxid und gegebenenfalls Zirkondioxid, Phosphor sowie weitere Metalloxide enthaltender Trägerkatalysator |
| DE2235993C2 (de) * | 1972-07-21 | 1984-09-06 | Nitto Chemical Industry Co., Ltd., Tokio / Tokyo | Verfahren zur gleichzeitigen Herstellung von Methacrylnitril und Butadien |
| GB1417787A (en) * | 1972-11-13 | 1975-12-17 | Mitsubishi Rayon Co | Catalyst composition for oxidation of butenes |
| FR2208399A5 (show.php) * | 1972-11-27 | 1974-06-21 | Ugine Kuhlmann | |
| US4093558A (en) * | 1972-12-08 | 1978-06-06 | The Standard Oil Company | Molybdate catalysts |
| US3886096A (en) * | 1973-01-02 | 1975-05-27 | Monsanto Co | Oxidation and ammoxidation catalyst |
| JPS5318014B2 (show.php) * | 1974-02-09 | 1978-06-13 | ||
| US4083804A (en) * | 1974-02-09 | 1978-04-11 | Nitto Chemical Industry Co., Ltd. | Catalyst for use in and process for preparing acrylonitrile |
| US4000088A (en) * | 1974-06-03 | 1976-12-28 | Nippon Kayaku Co., Ltd. | Oxidation catalyst for the manufacture of methacrylic acid |
| JPS5242552B2 (show.php) * | 1974-08-01 | 1977-10-25 | ||
| JPS52125124A (en) * | 1976-04-10 | 1977-10-20 | Nitto Chem Ind Co Ltd | Manufacture of acrylonitrile |
| JPS5462193A (en) * | 1977-10-26 | 1979-05-18 | Nitto Chem Ind Co Ltd | Regenerating method for iron antimony type oxide catalyst |
| JPS5924662B2 (ja) * | 1977-11-12 | 1984-06-11 | 日東化学工業株式会社 | アンチモン含有酸化物触媒の再生法 |
| JPS56126448A (en) * | 1980-03-12 | 1981-10-03 | Nitto Chem Ind Co Ltd | Production of antimony-containing oxide catalyst |
| DE3274975D1 (en) * | 1981-10-07 | 1987-02-12 | Nitto Chemical Industry Co Ltd | Process for ammoxidation of organic compounds |
| US4590011A (en) * | 1983-11-23 | 1986-05-20 | Monsanto Company | Ammoxidation process |
| US4746641A (en) * | 1984-08-22 | 1988-05-24 | Standard Oil Company | Ammoxidation of paraffins and catalysts therefor |
| US4783545A (en) * | 1985-12-20 | 1988-11-08 | The Standard Oil Company | Method for ammoxidation of paraffins and catalyst system therefor |
| US4788173A (en) * | 1985-12-20 | 1988-11-29 | The Standard Oil Company | Catalytic mixtures for ammoxidation of paraffins |
| US4837233A (en) * | 1986-07-21 | 1989-06-06 | The Standard Oil Company | Catalyst system for ammoxidation of paraffins |
| US5079379A (en) * | 1988-12-29 | 1992-01-07 | Monsanto Company | Fluid bed process |
| US5877377A (en) * | 1993-08-14 | 1999-03-02 | Johnson Matthey Public Limited Company | Metal oxide catalyst and use thereof in chemical reactions |
| GB9316955D0 (en) | 1993-08-14 | 1993-09-29 | Johnson Matthey Plc | Improvements in catalysts |
| US7323809B2 (en) * | 2002-07-23 | 2008-01-29 | Koninklijke Philips Electronics, N.V. | Lamp emitting visible and IR light |
| JP5011176B2 (ja) * | 2008-03-14 | 2012-08-29 | ダイヤニトリックス株式会社 | アクリロニトリル合成用触媒およびアクリロニトリルの製造方法 |
| US8293960B2 (en) * | 2009-08-17 | 2012-10-23 | Lummus Technology Inc. | Process for the production of butadiene |
| US20160263560A1 (en) * | 2015-03-10 | 2016-09-15 | Ph Matter, Llc | Chromium-free water-gas shift catalyst and process for making the same |
| CN112469499B (zh) | 2018-06-28 | 2023-08-01 | 奥升德功能材料运营有限公司 | 在流化床反应器中使用二氧化硅粒子的方法和系统 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT605134A (show.php) * | 1959-02-24 | |||
| IT701822A (show.php) * | 1961-11-30 | |||
| NL293857A (show.php) * | 1962-06-11 | |||
| US3200141A (en) * | 1963-05-27 | 1965-08-10 | Standard Oil Co | Process for the manufacture of acrylonitrile |
| CA774587A (en) * | 1965-08-30 | 1967-12-26 | The B. F. Goodrich Company | Process for preparing unsaturated nitriles |
| US3338952A (en) * | 1965-11-15 | 1967-08-29 | Standard Oil Co | Process for the catalytic ammoxidation of olefins to nitriles |
| US3445521A (en) * | 1966-11-17 | 1969-05-20 | Standard Oil Co | Promoted antimony-iron oxidation catalyst |
-
0
- IT IT859097D patent/IT859097A/it unknown
-
1968
- 1968-11-19 US US777104A patent/US3668147A/en not_active Expired - Lifetime
- 1968-11-21 GB GB55392/68A patent/GB1208690A/en not_active Expired
- 1968-11-26 DE DE19681811063 patent/DE1811063B2/de active Granted
- 1968-11-27 FR FR1593484D patent/FR1593484A/fr not_active Expired
-
1969
- 1969-03-28 NL NL696904857A patent/NL140163B/xx not_active IP Right Cessation
- 1969-03-28 BE BE730696D patent/BE730696A/xx not_active IP Right Cessation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1811063C (show.php) | ||
| DE1811063B2 (de) | Verwendung eines aktivierten katalysators auf der basis von eisenoxid-antimonoxid bei der oxydation bzw. oxydativen dehydrierung von olefinen | |
| DE69012450T2 (de) | Verfahren zur Herstellung von Eisen-Phosphor und Antimon enthaltenden Metalloxid-Oxidationskatalysatoren. | |
| DE69011495T3 (de) | Katalysator und Verfahren zur Herstellung von Acrylonitril und Methacrylonitril. | |
| DE69603810T2 (de) | Verfahren zur Herstellung von Nitrilen | |
| DE1958290A1 (de) | Oxydehydrierungskatalysator und seine Verwendung zur Umwandlung von Isoamylenen,Methylbutanolen und Gemischen hiervon in Isopren | |
| DE2505249A1 (de) | Verfahren zur herstellung von acrylnitril | |
| DE2043995C3 (show.php) | ||
| DE1255105B (de) | Verfahren zur Herstellung von Acrylsaeurenitril und Methacrylsaeurenitril aus Propylen oder Isobutylen, Ammoniak und Sauerstoff | |
| DE2155109C3 (de) | Verfahren zur gleichzeitigen Herstellung von 13-Butadien und Methacrolein | |
| DE69105890T2 (de) | Eisen-Antimon enthaltender Katalysator sowie Verfahren zur Herstellung desselben. | |
| EP0088328A2 (de) | Oxidationskatalysator, inbesondere für die Herstellung von Methacrylsäure durch Gasphasenoxidation von Methacrolein | |
| DE2147480C2 (de) | Verfahren zur Herstellung von Acrylnitril und Methacrylnitril | |
| DE68907642T2 (de) | Verfahren zur herstellung von cyanwasserstoff durch katalytische ammoxidierung in der gasphase von methanol. | |
| DE1811062A1 (de) | Verfahren zur Herstellung von Acrylnitril | |
| DE1268609B (de) | Verfahren zur Herstellung von (Meth) Acrolein und (Meth) Acrylsaeure durch katalytische Oxydation von Propylen bzw. Isobutylen | |
| DE69818718T2 (de) | Herstellung von Vanadiumantimonatkatalysatoren unter Verwendung von Sn02, nH20 | |
| DE1767268C3 (de) | Verfahren zur Herstellung von Acrylnitril aus Propylen | |
| DE69306099T2 (de) | Verfahren zur Herstellung von Monoalkenylbenzolen | |
| DE2124639A1 (show.php) | ||
| DE69012279T2 (de) | Verfahren zur Herstellung ungesättigter Verbindungen. | |
| EP0046897B1 (de) | Verfahren zur Herstellung von Pyridin | |
| DE2235993C2 (de) | Verfahren zur gleichzeitigen Herstellung von Methacrylnitril und Butadien | |
| DE2125640B2 (de) | Verfahren zur Herstellung von Acryl bzw. Methacrylnitril aus Propylen bzw. Isabutylen | |
| DE2210395A1 (show.php) |