DE1794214B2 - Verwendung von Flammspritzpulvern - Google Patents
Verwendung von FlammspritzpulvernInfo
- Publication number
- DE1794214B2 DE1794214B2 DE1794214A DE1794214A DE1794214B2 DE 1794214 B2 DE1794214 B2 DE 1794214B2 DE 1794214 A DE1794214 A DE 1794214A DE 1794214 A DE1794214 A DE 1794214A DE 1794214 B2 DE1794214 B2 DE 1794214B2
- Authority
- DE
- Germany
- Prior art keywords
- powder
- particles
- spray
- weight
- slip
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000843 powder Substances 0.000 title description 138
- 239000007921 spray Substances 0.000 title description 95
- 239000002245 particle Substances 0.000 claims description 127
- 239000011230 binding agent Substances 0.000 claims description 77
- 239000000463 material Substances 0.000 claims description 50
- 238000010285 flame spraying Methods 0.000 claims description 36
- 238000010438 heat treatment Methods 0.000 claims description 23
- 238000001694 spray drying Methods 0.000 claims description 10
- 239000000047 product Substances 0.000 description 56
- 238000000576 coating method Methods 0.000 description 42
- 239000007787 solid Substances 0.000 description 41
- 239000011248 coating agent Substances 0.000 description 32
- 239000007789 gas Substances 0.000 description 32
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 29
- 239000007788 liquid Substances 0.000 description 24
- 239000011651 chromium Substances 0.000 description 23
- 239000000203 mixture Substances 0.000 description 23
- 239000004372 Polyvinyl alcohol Substances 0.000 description 20
- 229920002451 polyvinyl alcohol Polymers 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 18
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 18
- 238000002474 experimental method Methods 0.000 description 17
- 229910052751 metal Inorganic materials 0.000 description 17
- 239000002184 metal Substances 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- 239000000395 magnesium oxide Substances 0.000 description 15
- 229910045601 alloy Inorganic materials 0.000 description 14
- 239000000956 alloy Substances 0.000 description 14
- 238000001035 drying Methods 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 229910004298 SiO 2 Inorganic materials 0.000 description 12
- 239000000654 additive Substances 0.000 description 12
- 239000002585 base Substances 0.000 description 12
- 239000001768 carboxy methyl cellulose Substances 0.000 description 12
- 238000012360 testing method Methods 0.000 description 12
- 229910052782 aluminium Inorganic materials 0.000 description 11
- 238000009826 distribution Methods 0.000 description 11
- 229910021332 silicide Inorganic materials 0.000 description 11
- 238000005507 spraying Methods 0.000 description 11
- 239000000080 wetting agent Substances 0.000 description 10
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 9
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 9
- 229910010413 TiO 2 Inorganic materials 0.000 description 9
- 230000000996 additive effect Effects 0.000 description 9
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 9
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 9
- 238000002156 mixing Methods 0.000 description 9
- 239000000375 suspending agent Substances 0.000 description 9
- 229910034327 TiC Inorganic materials 0.000 description 8
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000012159 carrier gas Substances 0.000 description 8
- 239000010941 cobalt Substances 0.000 description 8
- 229910017052 cobalt Inorganic materials 0.000 description 8
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 239000001301 oxygen Substances 0.000 description 8
- 229910052760 oxygen Inorganic materials 0.000 description 8
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 229920000084 Gum arabic Polymers 0.000 description 7
- 235000010489 acacia gum Nutrition 0.000 description 7
- 239000000205 acacia gum Substances 0.000 description 7
- 238000000889 atomisation Methods 0.000 description 7
- KZHJGOXRZJKJNY-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Si]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O KZHJGOXRZJKJNY-UHFFFAOYSA-N 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 150000002739 metals Chemical class 0.000 description 7
- 229910052863 mullite Inorganic materials 0.000 description 7
- 229910052759 nickel Inorganic materials 0.000 description 7
- 229910003468 tantalcarbide Inorganic materials 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 229910052750 molybdenum Inorganic materials 0.000 description 6
- 239000011733 molybdenum Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 6
- 229910052710 silicon Inorganic materials 0.000 description 6
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 6
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 6
- 238000012546 transfer Methods 0.000 description 6
- 229910001928 zirconium oxide Inorganic materials 0.000 description 6
- 229910026551 ZrC Inorganic materials 0.000 description 5
- OTCHGXYCWNXDOA-UHFFFAOYSA-N [C].[Zr] Chemical compound [C].[Zr] OTCHGXYCWNXDOA-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000010955 niobium Substances 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 5
- 239000004014 plasticizer Substances 0.000 description 5
- 239000003755 preservative agent Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- 241000978776 Senegalia senegal Species 0.000 description 4
- 239000004115 Sodium Silicate Substances 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 239000000919 ceramic Substances 0.000 description 4
- 239000011195 cermet Substances 0.000 description 4
- 229910052804 chromium Inorganic materials 0.000 description 4
- 239000002131 composite material Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000008394 flocculating agent Substances 0.000 description 4
- 239000000446 fuel Substances 0.000 description 4
- 235000011187 glycerol Nutrition 0.000 description 4
- 230000005484 gravity Effects 0.000 description 4
- 239000008240 homogeneous mixture Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 150000001247 metal acetylides Chemical class 0.000 description 4
- 229910044991 metal oxide Inorganic materials 0.000 description 4
- 150000004706 metal oxides Chemical class 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 4
- 229910052911 sodium silicate Inorganic materials 0.000 description 4
- 239000012798 spherical particle Substances 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- 239000011787 zinc oxide Substances 0.000 description 4
- 244000171897 Acacia nilotica subsp nilotica Species 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000005299 abrasion Methods 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 235000010407 ammonium alginate Nutrition 0.000 description 3
- 239000002518 antifoaming agent Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- LTPBRCUWZOMYOC-UHFFFAOYSA-N beryllium oxide Inorganic materials O=[Be] LTPBRCUWZOMYOC-UHFFFAOYSA-N 0.000 description 3
- -1 cermets Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 3
- 229910052593 corundum Inorganic materials 0.000 description 3
- 239000010419 fine particle Substances 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 235000010981 methylcellulose Nutrition 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 238000005245 sintering Methods 0.000 description 3
- 239000002893 slag Substances 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- 229910052715 tantalum Inorganic materials 0.000 description 3
- 229910001845 yogo sapphire Inorganic materials 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 229910052582 BN Inorganic materials 0.000 description 2
- 229910000906 Bronze Inorganic materials 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 229910021193 La 2 O 3 Inorganic materials 0.000 description 2
- 229910039444 MoC Inorganic materials 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 238000005275 alloying Methods 0.000 description 2
- 239000000728 ammonium alginate Substances 0.000 description 2
- KPGABFJTMYCRHJ-YZOKENDUSA-N ammonium alginate Chemical compound [NH4+].[NH4+].O1[C@@H](C([O-])=O)[C@@H](OC)[C@H](O)[C@H](O)[C@@H]1O[C@@H]1[C@@H](C([O-])=O)O[C@@H](O)[C@@H](O)[C@H]1O KPGABFJTMYCRHJ-YZOKENDUSA-N 0.000 description 2
- NGPGDYLVALNKEG-UHFFFAOYSA-N azanium;azane;2,3,4-trihydroxy-4-oxobutanoate Chemical compound [NH4+].[NH4+].[O-]C(=O)C(O)C(O)C([O-])=O NGPGDYLVALNKEG-UHFFFAOYSA-N 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 239000005388 borosilicate glass Substances 0.000 description 2
- 239000010974 bronze Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003518 caustics Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- PHFQLYPOURZARY-UHFFFAOYSA-N chromium trinitrate Chemical compound [Cr+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PHFQLYPOURZARY-UHFFFAOYSA-N 0.000 description 2
- GVEHJMMRQRRJPM-UHFFFAOYSA-N chromium(2+);methanidylidynechromium Chemical compound [Cr+2].[Cr]#[C-].[Cr]#[C-] GVEHJMMRQRRJPM-UHFFFAOYSA-N 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000011246 composite particle Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000002706 dry binder Substances 0.000 description 2
- 238000005189 flocculation Methods 0.000 description 2
- 230000009969 flowable effect Effects 0.000 description 2
- 239000002737 fuel gas Substances 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229910052758 niobium Inorganic materials 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 150000003891 oxalate salts Chemical class 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 238000001935 peptisation Methods 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 230000002335 preservative effect Effects 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 239000003223 protective agent Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 229910052761 rare earth metal Inorganic materials 0.000 description 2
- 150000002910 rare earth metals Chemical class 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- 229910003470 tongbaite Inorganic materials 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- INZDTEICWPZYJM-UHFFFAOYSA-N 1-(chloromethyl)-4-[4-(chloromethyl)phenyl]benzene Chemical compound C1=CC(CCl)=CC=C1C1=CC=C(CCl)C=C1 INZDTEICWPZYJM-UHFFFAOYSA-N 0.000 description 1
- QRIPJHVJKXPQBX-UHFFFAOYSA-N 1-dodecylsulfanyldodecane;sodium Chemical compound [Na].CCCCCCCCCCCCSCCCCCCCCCCCC QRIPJHVJKXPQBX-UHFFFAOYSA-N 0.000 description 1
- QIJNJJZPYXGIQM-UHFFFAOYSA-N 1lambda4,2lambda4-dimolybdacyclopropa-1,2,3-triene Chemical compound [Mo]=C=[Mo] QIJNJJZPYXGIQM-UHFFFAOYSA-N 0.000 description 1
- DJOYTAUERRJRAT-UHFFFAOYSA-N 2-(n-methyl-4-nitroanilino)acetonitrile Chemical compound N#CCN(C)C1=CC=C([N+]([O-])=O)C=C1 DJOYTAUERRJRAT-UHFFFAOYSA-N 0.000 description 1
- FRWYFWZENXDZMU-UHFFFAOYSA-N 2-iodoquinoline Chemical compound C1=CC=CC2=NC(I)=CC=C21 FRWYFWZENXDZMU-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- SSZWWUDQMAHNAQ-UHFFFAOYSA-N 3-chloropropane-1,2-diol Chemical compound OCC(O)CCl SSZWWUDQMAHNAQ-UHFFFAOYSA-N 0.000 description 1
- MOMKYJPSVWEWPM-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-methylphenyl)-1,3-thiazole Chemical compound C1=CC(C)=CC=C1C1=NC(CCl)=CS1 MOMKYJPSVWEWPM-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229910052580 B4C Inorganic materials 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- PZNSFCLAULLKQX-UHFFFAOYSA-N Boron nitride Chemical compound N#B PZNSFCLAULLKQX-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 229910005191 Ga 2 O 3 Inorganic materials 0.000 description 1
- 229910005793 GeO 2 Inorganic materials 0.000 description 1
- 229910018068 Li 2 O Inorganic materials 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910016006 MoSi Inorganic materials 0.000 description 1
- 229910019802 NbC Inorganic materials 0.000 description 1
- 229910017493 Nd 2 O 3 Inorganic materials 0.000 description 1
- 229910003310 Ni-Al Inorganic materials 0.000 description 1
- 229910000943 NiAl Inorganic materials 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910006404 SnO 2 Inorganic materials 0.000 description 1
- 229910004116 SrO 2 Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- XHCLAFWTIXFWPH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] XHCLAFWTIXFWPH-UHFFFAOYSA-N 0.000 description 1
- FEWHDZOJQQLPEN-UHFFFAOYSA-N [O].[N].[O] Chemical compound [O].[N].[O] FEWHDZOJQQLPEN-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- YYCNOHYMCOXPPJ-UHFFFAOYSA-N alumane;nickel Chemical class [AlH3].[Ni] YYCNOHYMCOXPPJ-UHFFFAOYSA-N 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 229920005550 ammonium lignosulfonate Polymers 0.000 description 1
- VBIXEXWLHSRNKB-UHFFFAOYSA-N ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 150000008378 aryl ethers Chemical class 0.000 description 1
- WEXGAARVZYPLSN-UHFFFAOYSA-N azanium;copper;hydroxide Chemical compound [NH4+].[OH-].[Cu] WEXGAARVZYPLSN-UHFFFAOYSA-N 0.000 description 1
- INAHAJYZKVIDIZ-UHFFFAOYSA-N boron carbide Chemical compound B12B3B4C32B41 INAHAJYZKVIDIZ-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 239000011233 carbonaceous binding agent Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- NUEWEVRJMWXXFB-UHFFFAOYSA-N chromium(iii) boride Chemical compound [Cr]=[B] NUEWEVRJMWXXFB-UHFFFAOYSA-N 0.000 description 1
- 229910000428 cobalt oxide Inorganic materials 0.000 description 1
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 description 1
- 239000000567 combustion gas Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- IQKQUSLYXMWMQZ-UHFFFAOYSA-N copper;oxido-(oxido(dioxo)chromio)oxy-dioxochromium Chemical compound [Cu+2].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O IQKQUSLYXMWMQZ-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- AJNVQOSZGJRYEI-UHFFFAOYSA-N digallium;oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Ga+3].[Ga+3] AJNVQOSZGJRYEI-UHFFFAOYSA-N 0.000 description 1
- GPLRAVKSCUXZTP-UHFFFAOYSA-N diglycerol Chemical compound OCC(O)COCC(O)CO GPLRAVKSCUXZTP-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000010891 electric arc Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 229910001195 gallium oxide Inorganic materials 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910000449 hafnium oxide Inorganic materials 0.000 description 1
- WIHZLLGSGQNAGK-UHFFFAOYSA-N hafnium(4+);oxygen(2-) Chemical compound [O-2].[O-2].[Hf+4] WIHZLLGSGQNAGK-UHFFFAOYSA-N 0.000 description 1
- WHJFNYXPKGDKBB-UHFFFAOYSA-N hafnium;methane Chemical compound C.[Hf] WHJFNYXPKGDKBB-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000002932 luster Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- 229910052752 metalloid Inorganic materials 0.000 description 1
- 150000002738 metalloids Chemical class 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- UNASZPQZIFZUSI-UHFFFAOYSA-N methylidyneniobium Chemical compound [Nb]#C UNASZPQZIFZUSI-UHFFFAOYSA-N 0.000 description 1
- NFFIWVVINABMKP-UHFFFAOYSA-N methylidynetantalum Chemical compound [Ta]#C NFFIWVVINABMKP-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000003345 natural gas Substances 0.000 description 1
- 229920001206 natural gum Polymers 0.000 description 1
- 229910000907 nickel aluminide Inorganic materials 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 229910000623 nickel–chromium alloy Inorganic materials 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910000484 niobium oxide Inorganic materials 0.000 description 1
- URLJKFSTXLNXLG-UHFFFAOYSA-N niobium(5+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Nb+5].[Nb+5] URLJKFSTXLNXLG-UHFFFAOYSA-N 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 1
- SIWVEOZUMHYXCS-UHFFFAOYSA-N oxo(oxoyttriooxy)yttrium Chemical compound O=[Y]O[Y]=O SIWVEOZUMHYXCS-UHFFFAOYSA-N 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 description 1
- 239000011049 pearl Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 235000010408 potassium alginate Nutrition 0.000 description 1
- 238000004663 powder metallurgy Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000010409 propane-1,2-diol alginate Nutrition 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000006479 redox reaction Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000011819 refractory material Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 235000019983 sodium metaphosphate Nutrition 0.000 description 1
- 239000011684 sodium molybdate Substances 0.000 description 1
- 235000015393 sodium molybdate Nutrition 0.000 description 1
- TVXXNOYZHKPKGW-UHFFFAOYSA-N sodium molybdate (anhydrous) Chemical compound [Na+].[Na+].[O-][Mo]([O-])(=O)=O TVXXNOYZHKPKGW-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 238000004528 spin coating Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 229910001936 tantalum oxide Inorganic materials 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- RTKIYNMVFMVABJ-UHFFFAOYSA-L thimerosal Chemical compound [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O RTKIYNMVFMVABJ-UHFFFAOYSA-L 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000002341 toxic gas Substances 0.000 description 1
- YWYZEGXAUVWDED-UHFFFAOYSA-N triammonium citrate Chemical compound [NH4+].[NH4+].[NH4+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O YWYZEGXAUVWDED-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 229910001935 vanadium oxide Inorganic materials 0.000 description 1
- 229920006186 water-soluble synthetic resin Polymers 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C23—COATING METALLIC MATERIAL; COATING MATERIAL WITH METALLIC MATERIAL; CHEMICAL SURFACE TREATMENT; DIFFUSION TREATMENT OF METALLIC MATERIAL; COATING BY VACUUM EVAPORATION, BY SPUTTERING, BY ION IMPLANTATION OR BY CHEMICAL VAPOUR DEPOSITION, IN GENERAL; INHIBITING CORROSION OF METALLIC MATERIAL OR INCRUSTATION IN GENERAL
- C23C—COATING METALLIC MATERIAL; COATING MATERIAL WITH METALLIC MATERIAL; SURFACE TREATMENT OF METALLIC MATERIAL BY DIFFUSION INTO THE SURFACE, BY CHEMICAL CONVERSION OR SUBSTITUTION; COATING BY VACUUM EVAPORATION, BY SPUTTERING, BY ION IMPLANTATION OR BY CHEMICAL VAPOUR DEPOSITION, IN GENERAL
- C23C4/00—Coating by spraying the coating material in the molten state, e.g. by flame, plasma or electric discharge
- C23C4/04—Coating by spraying the coating material in the molten state, e.g. by flame, plasma or electric discharge characterised by the coating material
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/25—Web or sheet containing structurally defined element or component and including a second component containing structurally defined particles
- Y10T428/256—Heavy metal or aluminum or compound thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Physics & Mathematics (AREA)
- Plasma & Fusion (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Coating By Spraying Or Casting (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US67188067A | 1967-09-29 | 1967-09-29 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1794214A1 DE1794214A1 (de) | 1971-07-29 |
| DE1794214B2 true DE1794214B2 (de) | 1979-10-25 |
Family
ID=24696242
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1794214A Withdrawn DE1794214B2 (de) | 1967-09-29 | 1968-09-25 | Verwendung von Flammspritzpulvern |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3617358A (enExample) |
| AT (1) | AT304728B (enExample) |
| DE (1) | DE1794214B2 (enExample) |
| FR (1) | FR1602527A (enExample) |
| GB (1) | GB1198745A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4036932A1 (de) * | 1989-12-18 | 1991-06-20 | Carrier Corp | Verfahren zum herstellen einer einen hohen wirkungsgrad aufweisenden waermeuebertragungsflaeche und auf diese weise hergestellte flaeche |
Families Citing this family (162)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3717564A (en) * | 1971-10-01 | 1973-02-20 | Cogar Corp | Fabrication method for making an aluminum alloy having a high resistance to electromigration |
| JPS526291B2 (enExample) * | 1972-05-11 | 1977-02-21 | ||
| US3816158A (en) * | 1972-07-11 | 1974-06-11 | L Jacobs | Bonding and forming inorganic materials |
| US3855447A (en) * | 1973-05-21 | 1974-12-17 | Starck H | Weld additive for electric-arc deposit welding |
| US3881911A (en) * | 1973-11-01 | 1975-05-06 | Gte Sylvania Inc | Free flowing, sintered, refractory agglomerates |
| US3973948A (en) * | 1973-11-12 | 1976-08-10 | Gte Sylvania Incorporated | Free flowing powder and process for producing it |
| US3907546A (en) * | 1974-03-28 | 1975-09-23 | Gte Sylvania Inc | Molybdenum flame spray powder and process |
| US4312894A (en) * | 1974-05-21 | 1982-01-26 | Union Carbide Corporation | Hard facing of metal substrates |
| US4055742A (en) * | 1974-05-21 | 1977-10-25 | Union Carbide Corporation | Hard facing rod |
| US3918728A (en) * | 1974-06-21 | 1975-11-11 | Walter F Stugger | Snow ski and edge |
| US3989872A (en) * | 1974-12-19 | 1976-11-02 | United Technologies Corporation | Plasma spray powders |
| US3961106A (en) * | 1975-03-03 | 1976-06-01 | The United States Of America As Represented By The Secretary Of The Interior | Method for applying wax or plastic coatings to granular materials |
| US4011073A (en) * | 1975-07-02 | 1977-03-08 | Gte Sylvania Incorporated | Flame spray powder of cobalt-molybdenum mixed metal agglomerates using a molybdenum salt binder and process for producing same |
| US4028095A (en) * | 1975-07-10 | 1977-06-07 | Gte Sylvania Incorporated | Free flowing powder and process for producing it |
| US4013453A (en) * | 1975-07-11 | 1977-03-22 | Eutectic Corporation | Flame spray powder for wear resistant alloy coating containing tungsten carbide |
| US4076883A (en) * | 1975-07-30 | 1978-02-28 | Metco, Inc. | Flame-sprayable flexible wires |
| US4031278A (en) * | 1975-08-18 | 1977-06-21 | Eutectic Corporation | High hardness flame spray nickel-base alloy coating material |
| US4049841A (en) * | 1975-09-08 | 1977-09-20 | Basf Wyandotte Corporation | Sprayed cathodes |
| US4136230A (en) * | 1976-07-29 | 1979-01-23 | Eutectic Corporation | Wear resistant alloy coating containing tungsten carbide |
| CA1085239A (en) * | 1977-04-26 | 1980-09-09 | Sherritt Gordon Mines Limited | Process for producing composite powder particles |
| CH622452A5 (enExample) * | 1977-07-13 | 1981-04-15 | Castolin Sa | |
| DE2737227C2 (de) * | 1977-08-18 | 1987-05-14 | MTU Motoren- und Turbinen-Union München GmbH, 8000 München | Poröser Formkörper aus Keramik mit einer porendichten Beschichtung und Verfahren zu seiner Herstellung |
| GB2034678B (en) * | 1977-09-26 | 1982-07-28 | Hardwick W H Wace P F | Balls containing tungsten carbide |
| DE2819091C2 (de) | 1978-04-29 | 1979-11-15 | Messer Griesheim Gmbh, 6000 Frankfurt | Verwendung einer Metallpulver-Mischung |
| US4202691A (en) * | 1978-11-21 | 1980-05-13 | Eutectic Corporation | Metallo-thermic powder |
| US4239827A (en) * | 1979-01-15 | 1980-12-16 | Union Carbide Corporation | Flame-sprayed thermoplastic substrate is coated with an adhesive layer which bonds particles of an adsorbent like carbon to the substrate |
| US4230750A (en) * | 1979-08-15 | 1980-10-28 | Eutectic Corporation | Metallo-thermic powder |
| US4291089A (en) * | 1979-11-06 | 1981-09-22 | Sherritt Gordon Mines Limited | Composite powders sprayable to form abradable seal coatings |
| CH647555A5 (de) * | 1980-01-17 | 1985-01-31 | Castolin Sa | Heterogene, durch thermisches spritzen auf ein substrat aufgebrachte schicht und spritzpulver zur herstellung derselben. |
| FR2481692B1 (fr) * | 1980-04-30 | 1986-10-10 | Vysoka Skola Chem Tech | Materiau de revetement pulverise pour pulverisation par incandescence ou au plasma, et procede pour la preparation de ce materiau |
| JPS56160653A (en) * | 1980-05-14 | 1981-12-10 | Ngk Spark Plug Co Ltd | Manufacture of oxygen concentration cell |
| US4650722A (en) * | 1980-06-13 | 1987-03-17 | Union Carbide Corporation | Hard faced article |
| CH648357A5 (de) * | 1981-11-16 | 1985-03-15 | Castolin Sa | Flammspritzwerkstoff. |
| WO1983001917A1 (en) * | 1981-11-27 | 1983-06-09 | Gte Prod Corp | Nickel-chromium carbide powder and sintering method |
| US4508788A (en) * | 1982-09-09 | 1985-04-02 | Gte Products Corporation | Plasma spray powder |
| US4599270A (en) * | 1984-05-02 | 1986-07-08 | The Perkin-Elmer Corporation | Zirconium oxide powder containing cerium oxide and yttrium oxide |
| JPS61186465A (ja) * | 1984-09-08 | 1986-08-20 | Awamura Kinzoku Kogyo Kk | 溶射材料 |
| US4593007A (en) * | 1984-12-06 | 1986-06-03 | The Perkin-Elmer Corporation | Aluminum and silica clad refractory oxide thermal spray powder |
| US4645716A (en) * | 1985-04-09 | 1987-02-24 | The Perkin-Elmer Corporation | Flame spray material |
| US4987282A (en) * | 1985-06-12 | 1991-01-22 | K-2 Corporation | Snow ski with treated metal edge |
| US4818839A (en) * | 1985-06-12 | 1989-04-04 | K-2 Corporaton | Process for treating the metal edge of a ski |
| DE3538390A1 (de) * | 1985-10-29 | 1987-04-30 | Deutsche Forsch Luft Raumfahrt | Beschichtung fuer ein substrat und verfahren zu dessen herstellung |
| CH670103A5 (enExample) * | 1986-02-04 | 1989-05-12 | Castolin Sa | |
| GB8610024D0 (en) * | 1986-04-24 | 1986-05-29 | Unilever Plc | Porous structures |
| JP2635046B2 (ja) * | 1987-05-27 | 1997-07-30 | 株式会社 東京機械製作所 | 平版印刷機のインキ装置用ローラーおよび平版印刷機のインキ装置用ローラーの製造方法 |
| US5140005A (en) * | 1988-02-04 | 1992-08-18 | The Perkin-Elmer Corporation | Ceramic superconductive powder |
| US5262206A (en) * | 1988-09-20 | 1993-11-16 | Plasma Technik Ag | Method for making an abradable material by thermal spraying |
| US5139829A (en) * | 1988-12-22 | 1992-08-18 | Ngk Spark Plug Co., Ltd. | Method for producing oxygen detection element |
| US5006321A (en) * | 1989-01-04 | 1991-04-09 | The Perkin-Elmer Corporation | Thermal spray method for producing glass mold plungers |
| US4999225A (en) * | 1989-01-05 | 1991-03-12 | The Perkin-Elmer Corporation | High velocity powder thermal spray method for spraying non-meltable materials |
| US5242639A (en) * | 1989-07-25 | 1993-09-07 | Glaverbel | Ceramic welding process |
| US5059095A (en) * | 1989-10-30 | 1991-10-22 | The Perkin-Elmer Corporation | Turbine rotor blade tip coated with alumina-zirconia ceramic |
| US5122182A (en) * | 1990-05-02 | 1992-06-16 | The Perkin-Elmer Corporation | Composite thermal spray powder of metal and non-metal |
| US5126205A (en) * | 1990-05-09 | 1992-06-30 | The Perkin-Elmer Corporation | Powder of plastic and treated mineral |
| US5049450A (en) * | 1990-05-10 | 1991-09-17 | The Perkin-Elmer Corporation | Aluminum and boron nitride thermal spray powder |
| US5045276A (en) * | 1990-10-11 | 1991-09-03 | Sumitomo Metal Mining Company Limited | Method for production of injection molded powder metallurgy product |
| US5312653A (en) * | 1991-06-17 | 1994-05-17 | Buchanan Edward R | Niobium carbide alloy coating process for improving the erosion resistance of a metal surface |
| US5650130A (en) * | 1991-11-18 | 1997-07-22 | The Johns Hopkins University | Counterflow diffusion flame synthesis of ceramic oxide powders |
| US5268337A (en) * | 1991-11-18 | 1993-12-07 | The Johns Hopkins University | Ceramic oxide powders and the formation thereof |
| JPH07507178A (ja) * | 1992-01-16 | 1995-08-03 | ユニバーシティ・オブ・シンシナティ | 電気加熱素子,関連複合体および組成物,およびこれらの製品を金型を用いないミクロ発熱合成法で製造する方法 |
| US6001236A (en) * | 1992-04-01 | 1999-12-14 | Moltech Invent S.A. | Application of refractory borides to protect carbon-containing components of aluminium production cells |
| US5651874A (en) * | 1993-05-28 | 1997-07-29 | Moltech Invent S.A. | Method for production of aluminum utilizing protected carbon-containing components |
| US5310476A (en) * | 1992-04-01 | 1994-05-10 | Moltech Invent S.A. | Application of refractory protective coatings, particularly on the surface of electrolytic cell components |
| FR2696760B1 (fr) * | 1992-10-09 | 1994-11-04 | Alsthom Gec | Revêtement pour parties frottantes par rotation d'une pièce en acier matensitique. |
| US5334235A (en) * | 1993-01-22 | 1994-08-02 | The Perkin-Elmer Corporation | Thermal spray method for coating cylinder bores for internal combustion engines |
| US5560846A (en) * | 1993-03-08 | 1996-10-01 | Micropyretics Heaters International | Robust ceramic and metal-ceramic radiant heater designs for thin heating elements and method for production |
| US5449886A (en) * | 1993-03-09 | 1995-09-12 | University Of Cincinnati | Electric heating element assembly |
| US5391404A (en) * | 1993-03-15 | 1995-02-21 | The United States Of America As Represented By The National Aeronautics And Space Administration | Plasma sprayed mullite coatings on silicon-base ceramics |
| US5419976A (en) * | 1993-12-08 | 1995-05-30 | Dulin; Bruce E. | Thermal spray powder of tungsten carbide and chromium carbide |
| WO1995031416A1 (en) * | 1994-05-13 | 1995-11-23 | Micropyretics Heaters International | Sinter-homogenized heating products |
| US5506055A (en) | 1994-07-08 | 1996-04-09 | Sulzer Metco (Us) Inc. | Boron nitride and aluminum thermal spray powder |
| CA2199288C (en) * | 1994-09-08 | 2008-06-17 | Vittorio De Nora | Aluminium electrowinning cell with improved carbon cathode blocks |
| US5594931A (en) * | 1995-05-09 | 1997-01-14 | Newcomer Products, Inc. | Layered composite carbide product and method of manufacture |
| US5866515A (en) * | 1995-07-19 | 1999-02-02 | Basf Corporation | Superconductor composite |
| US5753163A (en) * | 1995-08-28 | 1998-05-19 | Moltech. Invent S.A. | Production of bodies of refractory borides |
| GB9520497D0 (en) * | 1995-10-07 | 1995-12-13 | Holset Engineering Co | Improvements in turbines and compressors |
| CN1195884C (zh) | 1995-11-13 | 2005-04-06 | 康涅狄格大学 | 用于热喷涂的纳米结构的进料 |
| DE19649756B4 (de) | 1996-04-18 | 2005-05-25 | Bayer Chemicals Ag | Verfahren zur Herstellung von Brikettier- und Preßgranulaten aus Rußpigmenten und deren Verwendung |
| WO1998000256A1 (en) * | 1996-06-28 | 1998-01-08 | Sandvik Ab (Publ) | Method of spray drying powder mixtures |
| US5939146A (en) * | 1996-12-11 | 1999-08-17 | The Regents Of The University Of California | Method for thermal spraying of nanocrystalline coatings and materials for the same |
| AU6438398A (en) * | 1997-02-24 | 1998-09-09 | Superior Micropowders Llc | Aerosol method and apparatus, particulate products, and electronic devices made therefrom |
| US6338809B1 (en) | 1997-02-24 | 2002-01-15 | Superior Micropowders Llc | Aerosol method and apparatus, particulate products, and electronic devices made therefrom |
| US5853476A (en) * | 1997-08-11 | 1998-12-29 | Elementis Pigments, Inc. | Process for coloring concrete using compacted inorganic granules |
| US5869146A (en) * | 1997-11-12 | 1999-02-09 | United Technologies Corporation | Plasma sprayed mullite coatings on silicon based ceramic materials |
| US6410632B1 (en) * | 1999-03-15 | 2002-06-25 | Michael Howard West | Method for suspending borate particles in aqueous dispersions |
| US6194084B1 (en) | 1999-06-23 | 2001-02-27 | Sulzer Metco Inc. | Thermal spray powder of dicalcium silicate and coating thereof and manufacture thereof |
| US20060121068A1 (en) * | 1999-08-31 | 2006-06-08 | General Electric Company | Boron nitride particles of spherical geometry and process for making thereof |
| US7976941B2 (en) | 1999-08-31 | 2011-07-12 | Momentive Performance Materials Inc. | Boron nitride particles of spherical geometry and process for making thereof |
| US20070241303A1 (en) * | 1999-08-31 | 2007-10-18 | General Electric Company | Thermally conductive composition and method for preparing the same |
| US6713088B2 (en) * | 1999-08-31 | 2004-03-30 | General Electric Company | Low viscosity filler composition of boron nitride particles of spherical geometry and process |
| EP1134302A1 (en) * | 2000-03-17 | 2001-09-19 | Consorzio Interuniversitario per lo Sviluppo dei Sistemi a Grande Interfase, C.S.G.I | New process for the production of nanostructured solid powders and nano-particles films by compartimentalised solution thermal spraying (CSTS) |
| DE10025161A1 (de) * | 2000-05-23 | 2001-11-29 | Joma Chemicals As Limingen | Werstoff und Verfahren zum Herstellen einer korrosions-und verschleißfesten Schicht durch thermisches Spitzen |
| US6638575B1 (en) * | 2000-07-24 | 2003-10-28 | Praxair Technology, Inc. | Plasma sprayed oxygen transport membrane coatings |
| US6544596B2 (en) | 2000-11-29 | 2003-04-08 | Pacific Northwest Coatings | Method of coating a substrate using a thermosetting basecoat composition and a thermoplastic top coat composition |
| JP4463472B2 (ja) | 2000-12-08 | 2010-05-19 | サルツァー・メトコ(ユーエス)・インコーポレーテッド | 予め合金化された安定化ジルコニアパウダー及び改良された熱バリアコーティング |
| ITRM20010125A1 (it) * | 2001-03-12 | 2002-09-12 | Ct Sviluppo Materiali Spa | Procedimento per la realizzazione di strati compositi a matrice ceramica e relativo materiale composito. |
| US6645612B2 (en) | 2001-08-07 | 2003-11-11 | Saint-Gobain Ceramics & Plastics, Inc. | High solids hBN slurry, hBN paste, spherical hBN powder, and methods of making and using them |
| US7326669B2 (en) * | 2001-09-20 | 2008-02-05 | Honda Motor Co., Ltd. | Substrate having catalyst compositions on surfaces of opposite sides |
| US20040005452A1 (en) * | 2002-01-14 | 2004-01-08 | Dorfman Mitchell R. | High temperature spray dried composite abradable powder for combustion spraying and abradable barrier coating produced using same |
| GB2393452B (en) * | 2002-08-28 | 2005-12-28 | C A Technology Ltd | Improvements to powder production and spraying |
| FR2845078B1 (fr) * | 2002-09-26 | 2004-10-29 | Alstom | PROCEDE DE FABRICATION D'UN SUBSTRAT EN NITRURE D'ALUMINIUM AlN |
| US7494635B2 (en) * | 2003-08-21 | 2009-02-24 | Saint-Gobain Ceramics & Plastics, Inc. | Boron nitride agglomerated powder |
| US20050129868A1 (en) * | 2003-12-11 | 2005-06-16 | Siemens Westinghouse Power Corporation | Repair of zirconia-based thermal barrier coatings |
| US20050136279A1 (en) * | 2003-12-22 | 2005-06-23 | Xiangyang Jiang | Chrome composite materials |
| US20050132843A1 (en) * | 2003-12-22 | 2005-06-23 | Xiangyang Jiang | Chrome composite materials |
| US7635515B1 (en) * | 2004-04-08 | 2009-12-22 | Powdermet, Inc | Heterogeneous composite bodies with isolated lenticular shaped cermet regions |
| WO2006034054A1 (en) * | 2004-09-16 | 2006-03-30 | Belashchenko Vladimir E | Deposition system, method and materials for composite coatings |
| US7799111B2 (en) * | 2005-03-28 | 2010-09-21 | Sulzer Metco Venture Llc | Thermal spray feedstock composition |
| US7470307B2 (en) * | 2005-03-29 | 2008-12-30 | Climax Engineered Materials, Llc | Metal powders and methods for producing the same |
| GB2468054B (en) * | 2006-03-24 | 2011-11-09 | Climax Engineered Mat Llc | Metal powders and methods for producing the same |
| US9422616B2 (en) * | 2005-08-12 | 2016-08-23 | Kennametal Inc. | Abrasion-resistant weld overlay |
| US20080280189A1 (en) * | 2005-10-27 | 2008-11-13 | The University Of British Columbia | Fabrication of Electrode Structures by Thermal Spraying |
| US20070099014A1 (en) * | 2005-11-03 | 2007-05-03 | Sulzer Metco (Us), Inc. | Method for applying a low coefficient of friction coating |
| EP1999288B1 (en) * | 2006-03-20 | 2016-09-14 | Oerlikon Metco (US) Inc. | Method for forming a ceramic containing composite structure |
| EP2047149B1 (en) * | 2006-05-26 | 2015-08-12 | Sulzer Metco (US) Inc. | Mechanical seals and method of manufacture |
| FR2901721B1 (fr) * | 2006-05-30 | 2008-08-22 | Commissariat Energie Atomique | Poudres de phase max et procede de fabrication des dites poudres |
| FR2902767B1 (fr) * | 2006-06-22 | 2008-09-19 | J P B Creations Sa | Dispositif de conditionnement d'un produit a base de colle |
| US8802192B2 (en) * | 2006-12-07 | 2014-08-12 | National Institute For Materials Science | Warm spray coating method and particles used therefor |
| JP5058645B2 (ja) * | 2007-03-27 | 2012-10-24 | トーカロ株式会社 | 溶射用粉末、溶射皮膜及びハースロール |
| US20080241490A1 (en) * | 2007-04-02 | 2008-10-02 | Physical Sciences, Inc. | Sprayable Aerogel Insulation |
| WO2008143792A1 (en) | 2007-05-11 | 2008-11-27 | Sdc Materials, Inc. | Formation of catalytic regions within porous structures using supercritical phase processing |
| US8481449B1 (en) | 2007-10-15 | 2013-07-09 | SDCmaterials, Inc. | Method and system for forming plug and play oxide catalysts |
| US20090162546A1 (en) * | 2007-12-19 | 2009-06-25 | Gimvang Bo H | System, formulation and method for producing ceramic vacuum microspheres |
| US8197885B2 (en) | 2008-01-11 | 2012-06-12 | Climax Engineered Materials, Llc | Methods for producing sodium/molybdenum power compacts |
| US20090181179A1 (en) * | 2008-01-11 | 2009-07-16 | Climax Engineered Materials, Llc | Sodium/Molybdenum Composite Metal Powders, Products Thereof, and Methods for Producing Photovoltaic Cells |
| US8163353B2 (en) * | 2008-07-08 | 2012-04-24 | Siemens Energy, Inc. | Fabrication of copper-based anodes via atmosphoric plasma spraying techniques |
| US20100040796A1 (en) * | 2008-08-13 | 2010-02-18 | San-Teng Chueh | Heat-dissipating structure and manufacturing method thereof |
| US8057203B2 (en) * | 2008-10-02 | 2011-11-15 | Gap Engineering LLC | Pyrospherelator |
| US8435485B2 (en) * | 2008-10-28 | 2013-05-07 | Sakai Chemical Industry Co., Ltd. | Method for producing zinc oxide using ammonium bromide, exoergic filler, resin composition, exoergic grease and exoergic coating composition comprising the zinc oxide |
| RU2394937C1 (ru) * | 2008-10-31 | 2010-07-20 | Общество с ограниченной ответственностью "Технологические системы защитных покрытий" | Способ получения наноструктурированного покрытия |
| US8940364B2 (en) | 2008-12-19 | 2015-01-27 | Xurex, Inc. | System, formulation and method for producing ceramic vacuum microspheres |
| US20100276827A1 (en) * | 2009-04-29 | 2010-11-04 | Kevin Smith | Method for Producing Nanoparticles |
| US9126191B2 (en) | 2009-12-15 | 2015-09-08 | SDCmaterials, Inc. | Advanced catalysts for automotive applications |
| US8803025B2 (en) * | 2009-12-15 | 2014-08-12 | SDCmaterials, Inc. | Non-plugging D.C. plasma gun |
| US9039916B1 (en) | 2009-12-15 | 2015-05-26 | SDCmaterials, Inc. | In situ oxide removal, dispersal and drying for copper copper-oxide |
| US8652992B2 (en) | 2009-12-15 | 2014-02-18 | SDCmaterials, Inc. | Pinning and affixing nano-active material |
| US9149797B2 (en) | 2009-12-15 | 2015-10-06 | SDCmaterials, Inc. | Catalyst production method and system |
| US8557727B2 (en) | 2009-12-15 | 2013-10-15 | SDCmaterials, Inc. | Method of forming a catalyst with inhibited mobility of nano-active material |
| EP2528966B1 (en) | 2010-01-26 | 2022-06-29 | Oerlikon Metco (US) Inc. | Abradable composition and method of manufacture |
| US8669202B2 (en) | 2011-02-23 | 2014-03-11 | SDCmaterials, Inc. | Wet chemical and plasma methods of forming stable PtPd catalysts |
| EP2744590A4 (en) | 2011-08-19 | 2016-03-16 | Sdcmaterials Inc | COATED SUBSTRATES FOR USE IN CATALYSIS AND CATALYSTS AND METHOD FOR COATING SUBSTRATES WITH PRIMING COMPOSITIONS |
| US8999514B2 (en) * | 2012-02-03 | 2015-04-07 | General Electric Company | Bond coating powder comprising MCrAlY (M=Ni,Fe,Co), method of making, and a method of applying as bond coating |
| US9238738B2 (en) | 2012-08-22 | 2016-01-19 | Thermatin Industries, LLC | Germanate-containing thermal barrier coating |
| US9156025B2 (en) | 2012-11-21 | 2015-10-13 | SDCmaterials, Inc. | Three-way catalytic converter using nanoparticles |
| US9511352B2 (en) | 2012-11-21 | 2016-12-06 | SDCmaterials, Inc. | Three-way catalytic converter using nanoparticles |
| US9586179B2 (en) | 2013-07-25 | 2017-03-07 | SDCmaterials, Inc. | Washcoats and coated substrates for catalytic converters and methods of making and using same |
| KR20160074574A (ko) | 2013-10-22 | 2016-06-28 | 에스디씨머티리얼스, 인코포레이티드 | 희박 NOx 트랩의 조성물 |
| KR20160074566A (ko) | 2013-10-22 | 2016-06-28 | 에스디씨머티리얼스, 인코포레이티드 | 대형 디젤 연소 엔진용 촉매 디자인 |
| WO2015143225A1 (en) | 2014-03-21 | 2015-09-24 | SDCmaterials, Inc. | Compositions for passive nox adsorption (pna) systems |
| US20170157582A1 (en) * | 2014-07-02 | 2017-06-08 | Corning Incorporated | Spray drying mixed batch material for plasma melting |
| US20170069917A1 (en) * | 2015-09-08 | 2017-03-09 | Institute Of Nuclear Energy Research, Atomic Energy Council, Executive Yuan | Growing method of layers for protecting metal interconnects of solid oxide fuel cells |
| EP3199507A1 (en) | 2016-01-29 | 2017-08-02 | Rolls-Royce Corporation | Plasma spray physical vapor deposition deposited multilayer, multi-microstructure environmental barrier coating |
| FR3055813B1 (fr) | 2016-09-09 | 2020-06-26 | H.E.F | Poudre multimateriaux a grains composites pour la synthese additive |
| RU2710094C1 (ru) * | 2019-05-13 | 2019-12-24 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Кубанский государственный технологический университет" (ФГБОУ ВО "КубГТУ") | Способ получения покрытия на поверхности детали из цветных металлов |
| RU2710246C1 (ru) * | 2019-05-13 | 2019-12-25 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Кубанский государственный технологический университет" (ФГБОУ ВО "КубГТУ") | Способ получения покрытия на поверхности детали из стали |
| EP4041510A4 (en) * | 2019-10-11 | 2023-10-04 | Global Tungsten & Powders LLC | PRINTABLE AND SINTERABLE CARBIDE AND CERMETAL POWDER FOR GENERATIVE MANUFACTURING ON A POWDER BED BASE |
| CN112457002B (zh) * | 2020-12-16 | 2022-08-19 | 常州瑞赛激光技术有限公司 | 一种高强高韧导电氧化钛陶瓷粉末及其制备方法 |
| US20250019814A1 (en) * | 2021-09-27 | 2025-01-16 | Institute of Nuclear Energy Research, Atomic Energy Council, Executive Yuan, R.O.C. | Method of Fabricating Cathode Film Layer of Lithium Ion Battery by Plasma Spraying |
| WO2023091283A1 (en) * | 2021-11-18 | 2023-05-25 | Oerlikon Metco (Us) Inc. | Porous agglomerates and encapsulated agglomerates for abradable sealant materials and methods of manufacturing the same |
| CN114226713B (zh) * | 2021-12-17 | 2023-07-25 | 武汉苏泊尔炊具有限公司 | 热喷涂粉末及其制备方法、烹饪器具 |
| CN114921744B (zh) * | 2022-06-01 | 2022-10-28 | 佳木斯大学 | 一种用于反应热喷涂的四元复合粉体的制备方法 |
| SE2450805A1 (en) * | 2024-07-11 | 2026-01-12 | Tribonex Ab | Manufacturing of tribological hardfacings on pm and am articles |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1601898A (en) * | 1925-07-09 | 1926-10-05 | Roy E Wiley | Granular product and method of producing same |
| US2251454A (en) * | 1932-04-16 | 1941-08-05 | Champion Spark Plug Co | Preparing and molding material |
| US2936229A (en) * | 1957-11-25 | 1960-05-10 | Metallizing Engineering Co Inc | Spray-weld alloys |
| US3322515A (en) * | 1965-03-25 | 1967-05-30 | Metco Inc | Flame spraying exothermically reacting intermetallic compound forming composites |
| US3378392A (en) * | 1963-07-24 | 1968-04-16 | Metco Inc | High temperature flame spray powder and process |
| US3276893A (en) * | 1963-07-31 | 1966-10-04 | Eutectic Welding Alloys | Pigmented metal powder |
| US3419415A (en) * | 1964-09-29 | 1968-12-31 | Metco Inc | Composite carbide flame spray material |
| US3338688A (en) * | 1964-10-06 | 1967-08-29 | Metco Inc | Low smoking nickel aluminum flame spray powder |
| US3372054A (en) * | 1964-10-27 | 1968-03-05 | Eutectic Welding Alloys | Method of flame spraying and powder |
| US3407057A (en) * | 1965-10-23 | 1968-10-22 | American Metal Climax Inc | Molybdenum powder for use in spray coating |
| US3373119A (en) * | 1965-12-01 | 1968-03-12 | Gen Electric | Ternary metallic oxide agglomerate and method of preparation |
-
1967
- 1967-09-29 US US671880A patent/US3617358A/en not_active Expired - Lifetime
-
1968
- 1968-09-20 FR FR1602527D patent/FR1602527A/fr not_active Expired
- 1968-09-25 GB GB45642/68A patent/GB1198745A/en not_active Expired
- 1968-09-25 DE DE1794214A patent/DE1794214B2/de not_active Withdrawn
- 1968-09-27 AT AT946968A patent/AT304728B/de not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4036932A1 (de) * | 1989-12-18 | 1991-06-20 | Carrier Corp | Verfahren zum herstellen einer einen hohen wirkungsgrad aufweisenden waermeuebertragungsflaeche und auf diese weise hergestellte flaeche |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1602527A (enExample) | 1970-12-21 |
| US3617358A (en) | 1971-11-02 |
| GB1198745A (en) | 1970-07-15 |
| DE1794214A1 (de) | 1971-07-29 |
| AT304728B (de) | 1973-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1794214B2 (de) | Verwendung von Flammspritzpulvern | |
| DE69106219T2 (de) | Pulver für thermisches Spritzen aus Aluminium- und Bornitrid. | |
| DE60201922T2 (de) | Sprühpulver und Verfahren zur seiner Herstellung | |
| DE1646683C3 (de) | Flammspritzmaterial | |
| DE69303060T2 (de) | Verfahren zur Herstellung von Überzügen auf Pulver ohne Bindemittel | |
| DE60103784T2 (de) | Sprühpulver, Verfahren zur thermischen Spritzung und gesprühte Beschichtung | |
| DE10003982B4 (de) | Oxidbeschichtete feine Metallteilchen und Verfahren zu deren Herstellung | |
| DE69714172T2 (de) | Verfahren zur Herstellung eines Chromkarbid-Nickel Chrom zerstäubten Metallpulvers | |
| DE69511537T2 (de) | Verfahren zur herstellung von metallkompositpulver | |
| DE69104568T2 (de) | Verfahren zum Aufbringen abriebfester Schichten auf Schaufeloberflächen. | |
| DE1521636A1 (de) | Flammspritzpulver | |
| DE2144156A1 (de) | Hoch hitzebeständige Cermet-Legierung, Verfahren zu ihrer Herstellung | |
| DE2365046A1 (de) | Pulvermetallurgische verarbeitung von hochleistungslegierungen | |
| DE2432125A1 (de) | Flammspritzwerkstoffe | |
| DE1521369A1 (de) | Pulverfoermige,selbstfliessende Flammspritzmasse | |
| DE69426651T2 (de) | Kompositpulver zum thermischen sprühbeschichten | |
| DE2636840A1 (de) | Ueberzugsmaterial hoher haerte in form einer durch flammspritzen auftragbaren legierung auf nickelbasis | |
| DE19752776C1 (de) | Verfahren zur Herstellung eines Bauteils aus Al¶2¶0¶3¶/Titanaluminid-Verbundwerkstoff und dessen Verwendung | |
| DE69225734T2 (de) | Stab für einen flammgespritzten Überzug und seine Verwendung für die Abscheidung einer quasi-kristallinischen Phase | |
| DE60128128T2 (de) | Metall und metalloxyd enthaltendes granulat und verfahren zur herstellung | |
| DE10133209C5 (de) | Nichtoxidisches keramisches Beschichtungspulver und daraus hergestellte Schichten | |
| DE4134144C2 (de) | Karbidisches Spritzpulver | |
| EP1968893A1 (de) | Metallboride | |
| DE3015639A1 (de) | Gegen reaktionsfaehige schmelzfluessige metalle bestaendiges material und daraus hergestellte form sowie verfahren zum verbessern dieser bestaendigkeit | |
| DE102016002890A1 (de) | Verfahren zur Herstellung einer Tinte, Tinte und deren Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BHN | Withdrawal |