DE1745342B2 - Lineare Organopolysiloxane - Google Patents
Lineare OrganopolysiloxaneInfo
- Publication number
- DE1745342B2 DE1745342B2 DE1745342A DER0046724A DE1745342B2 DE 1745342 B2 DE1745342 B2 DE 1745342B2 DE 1745342 A DE1745342 A DE 1745342A DE R0046724 A DER0046724 A DE R0046724A DE 1745342 B2 DE1745342 B2 DE 1745342B2
- Authority
- DE
- Germany
- Prior art keywords
- vinyl
- organopolysiloxanes
- formula
- groups
- rubber
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920001296 polysiloxane Polymers 0.000 title description 49
- -1 siloxanes Chemical class 0.000 claims description 44
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Inorganic materials [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 claims description 24
- 229910018557 Si O Inorganic materials 0.000 claims description 14
- 229920001971 elastomer Polymers 0.000 description 44
- 239000005060 rubber Substances 0.000 description 28
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 26
- 239000003054 catalyst Substances 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- 239000000806 elastomer Substances 0.000 description 16
- 238000010438 heat treatment Methods 0.000 description 14
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 12
- 238000000034 method Methods 0.000 description 12
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 10
- 229920002554 vinyl polymer Polymers 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- XLOMVQKBTHCTTD-UHFFFAOYSA-N zinc oxide Inorganic materials [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000007334 copolymerization reaction Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- KHWNBTBDADYZAL-UHFFFAOYSA-N prop-1-enyl(silyloxysilyloxysilyloxysilyloxysilyloxysilyloxy)silane Chemical compound CC=C[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH3] KHWNBTBDADYZAL-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- 239000011787 zinc oxide Substances 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000004205 dimethyl polysiloxane Substances 0.000 description 3
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- UDHXJZHVNHGCEC-UHFFFAOYSA-N Chlorophacinone Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)C(=O)C1C(=O)C2=CC=CC=C2C1=O UDHXJZHVNHGCEC-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CGMFKBXPQJJHBR-UHFFFAOYSA-N [SiH3]O[SiH](C=C)C=C Chemical compound [SiH3]O[SiH](C=C)C=C CGMFKBXPQJJHBR-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- YLJJAVFOBDSYAN-UHFFFAOYSA-N dichloro-ethenyl-methylsilane Chemical compound C[Si](Cl)(Cl)C=C YLJJAVFOBDSYAN-UHFFFAOYSA-N 0.000 description 2
- DIUIBRCQZUEHIF-UHFFFAOYSA-N dimethylsilyl hydrogen sulfate Chemical compound C[SiH](C)OS(O)(=O)=O DIUIBRCQZUEHIF-UHFFFAOYSA-N 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 229940044631 ferric chloride hexahydrate Drugs 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- NQXWGWZJXJUMQB-UHFFFAOYSA-K iron trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].Cl[Fe+]Cl NQXWGWZJXJUMQB-UHFFFAOYSA-K 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 125000002950 monocyclic group Chemical class 0.000 description 2
- 229920006136 organohydrogenpolysiloxane Polymers 0.000 description 2
- 125000005375 organosiloxane group Chemical group 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- BNCFZSZAXPTWAQ-UHFFFAOYSA-N prop-1-enyl(silyloxysilyloxysilyloxysilyloxy)silane Chemical compound CC=C[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH3] BNCFZSZAXPTWAQ-UHFFFAOYSA-N 0.000 description 2
- 230000001698 pyrogenic effect Effects 0.000 description 2
- 239000012763 reinforcing filler Substances 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- UKRDPEFKFJNXQM-UHFFFAOYSA-N vinylsilane Chemical compound [SiH3]C=C UKRDPEFKFJNXQM-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KWISWUFGPUHDRY-UHFFFAOYSA-N 1-Chloro-2-methylpropene Chemical compound CC(C)=CCl KWISWUFGPUHDRY-UHFFFAOYSA-N 0.000 description 1
- VSIKJPJINIDELZ-UHFFFAOYSA-N 2,2,4,4,6,6,8,8-octakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane Chemical compound O1[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)O[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)O[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)O[Si]1(C=1C=CC=CC=1)C1=CC=CC=C1 VSIKJPJINIDELZ-UHFFFAOYSA-N 0.000 description 1
- VCYDUTCMKSROID-UHFFFAOYSA-N 2,2,4,4,6,6-hexakis-phenyl-1,3,5,2,4,6-trioxatrisilinane Chemical compound O1[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)O[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)O[Si]1(C=1C=CC=CC=1)C1=CC=CC=C1 VCYDUTCMKSROID-UHFFFAOYSA-N 0.000 description 1
- IRVZFACCNZRHSJ-UHFFFAOYSA-N 2,4,6,8-tetramethyl-2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane Chemical compound O1[Si](C)(C=2C=CC=CC=2)O[Si](C)(C=2C=CC=CC=2)O[Si](C)(C=2C=CC=CC=2)O[Si]1(C)C1=CC=CC=C1 IRVZFACCNZRHSJ-UHFFFAOYSA-N 0.000 description 1
- VLQZJOLYNOGECD-UHFFFAOYSA-N 2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane Chemical compound C[SiH]1O[SiH](C)O[SiH](C)O1 VLQZJOLYNOGECD-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- MDAYEDPJEFLABI-UHFFFAOYSA-N C[SiH](C=C)O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH3] Chemical compound C[SiH](C=C)O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH3] MDAYEDPJEFLABI-UHFFFAOYSA-N 0.000 description 1
- KPKUDQMLMBNFKL-UHFFFAOYSA-N C[SiH](C=C)O[SiH2]O[SiH2]O[SiH2]O[SiH3] Chemical compound C[SiH](C=C)O[SiH2]O[SiH2]O[SiH2]O[SiH3] KPKUDQMLMBNFKL-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- XMSXQFUHVRWGNA-UHFFFAOYSA-N Decamethylcyclopentasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 XMSXQFUHVRWGNA-UHFFFAOYSA-N 0.000 description 1
- IUMSDRXLFWAGNT-UHFFFAOYSA-N Dodecamethylcyclohexasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 IUMSDRXLFWAGNT-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 229910002656 O–Si–O Inorganic materials 0.000 description 1
- 229910008326 Si-Y Inorganic materials 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 229910006773 Si—Y Inorganic materials 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ADANNTOYRVPQLJ-UHFFFAOYSA-N [dimethyl(trimethylsilyloxy)silyl]oxy-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilane Chemical compound C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C ADANNTOYRVPQLJ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000004964 aerogel Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 229940045985 antineoplastic platinum compound Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- FYBYQXQHBHTWLP-UHFFFAOYSA-N bis(silyloxysilyloxy)silane Chemical class [SiH3]O[SiH2]O[SiH2]O[SiH2]O[SiH3] FYBYQXQHBHTWLP-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 235000015111 chews Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- QABCGOSYZHCPGN-UHFFFAOYSA-N chloro(dimethyl)silicon Chemical compound C[Si](C)Cl QABCGOSYZHCPGN-UHFFFAOYSA-N 0.000 description 1
- XSDCTSITJJJDPY-UHFFFAOYSA-N chloro-ethenyl-dimethylsilane Chemical compound C[Si](C)(Cl)C=C XSDCTSITJJJDPY-UHFFFAOYSA-N 0.000 description 1
- NELRINSZCVVEAD-UHFFFAOYSA-N chloro-ethenyl-methylsilane Chemical compound C[SiH](Cl)C=C NELRINSZCVVEAD-UHFFFAOYSA-N 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- DDJSWKLBKSLAAZ-UHFFFAOYSA-N cyclotetrasiloxane Chemical class O1[SiH2]O[SiH2]O[SiH2]O[SiH2]1 DDJSWKLBKSLAAZ-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 229940032296 ferric chloride Drugs 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 150000003058 platinum compounds Chemical class 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- IALUUOKJPBOFJL-UHFFFAOYSA-N potassium oxidosilane Chemical compound [K+].[SiH3][O-] IALUUOKJPBOFJL-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- 229940008424 tetradecamethylhexasiloxane Drugs 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/20—Polysiloxanes containing silicon bound to unsaturated aliphatic groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR73149 | 1966-08-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1745342A1 DE1745342A1 (de) | 1971-11-18 |
| DE1745342B2 true DE1745342B2 (de) | 1979-10-11 |
Family
ID=8615435
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1745342A Withdrawn DE1745342B2 (de) | 1966-08-16 | 1967-08-16 | Lineare Organopolysiloxane |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3498945A (enExample) |
| DE (1) | DE1745342B2 (enExample) |
| FR (1) | FR1561922A (enExample) |
| GB (1) | GB1156100A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0090382A3 (en) * | 1982-03-26 | 1984-11-07 | Union Carbide Corporation | Organo siloxanes, method for the preparation thereof and polymeric compositions containing same |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5124302B2 (enExample) * | 1972-10-26 | 1976-07-23 | ||
| DE2307776C3 (de) * | 1973-02-16 | 1979-08-30 | Wacker-Chemie Gmbh, 8000 Muenchen | Verwendung von Gemischen auf Basis von OrganopolysUoxanen als Klebstoffe |
| FR2362183A1 (fr) * | 1976-08-17 | 1978-03-17 | Rhone Poulenc Ind | Elastomeres thermoplastiques polysiloxaniques |
| US4785066A (en) * | 1986-08-22 | 1988-11-15 | Dow Corning Corporation | Novel organosiloxane inhibitors for hydrosilation reactions |
| CA1282532C (en) * | 1986-08-22 | 1991-04-02 | Myron Timothy Maxson | Organosiloxane inhibitors for hydrosilation reactions and polyorganosiloxane compositions containing same |
| US5091445A (en) * | 1990-05-04 | 1992-02-25 | Dow Corning Corporation | Silicone sealants |
| JP2522722B2 (ja) * | 1990-09-28 | 1996-08-07 | 東レ・ダウコーニング・シリコーン株式会社 | 圧縮抵抗性シリコ―ンゴム組成物 |
| DE4143203A1 (de) * | 1991-12-30 | 1993-07-01 | Wacker Chemie Gmbh | Alkenylgruppenhaltige organo(poly)siloxane |
| US6962727B2 (en) * | 1998-03-20 | 2005-11-08 | Honeywell International Inc. | Organosiloxanes |
| DE102005008951A1 (de) * | 2005-02-24 | 2006-09-07 | Wacker Chemie Ag | Siliconkautschukmassen und daraus erhaltene dauerbelastungsbeständige Siliconelastomere |
| JP4821986B2 (ja) * | 2006-06-07 | 2011-11-24 | 信越化学工業株式会社 | 艶消し用液状オルガノポリシロキサン組成物からなるポッティング材又はコーティング材及び艶消し硬化物並びに表面光沢度低減方法 |
| FR3000070B1 (fr) | 2012-12-21 | 2015-02-06 | Bluestar Silicones France | Procede de preparation de polyorganosiloxanes fonctionnalises |
| US10829609B2 (en) | 2017-02-08 | 2020-11-10 | Elkem Silicones USA Corp. | Silicone rubber syntactic foam |
| WO2018148282A1 (en) | 2017-02-08 | 2018-08-16 | Elkem Silicones USA Corp. | Secondary battery pack with improved thermal management |
| WO2020072374A1 (en) | 2018-10-02 | 2020-04-09 | Elkem Silicones USA Corp. | A kit for preparing a customizable flesh simulating silicone gel or silicone foam in particular for use in medical devices |
| US20220168217A1 (en) | 2019-02-22 | 2022-06-02 | Elkem Silicones USA Corp. | Drug delivery silicone composition to improve active ingredient elution |
| KR102628072B1 (ko) | 2019-07-30 | 2024-01-24 | 엘켐 실리콘즈 유에스에이 코포레이션 | 사출 성형을 통해 액체 실리콘 고무 조성물로부터 성형된 실리콘 고무 제품을 제조하는 데 유용한 방법 및 디바이스 조립체 |
| EP4344873A1 (en) | 2022-09-27 | 2024-04-03 | Elkem Silicones France SAS | Post-treatment of a 3d-printed elastomer silicone article |
| WO2025224511A1 (en) | 2024-04-25 | 2025-10-30 | 3M Innovative Properties Company | Microsphere-containing silicone foam composites and methods of making them |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2867599A (en) * | 1954-08-16 | 1959-01-06 | Gen Electric | Vulcanizable vinyl-containing organopolysiloxanes and process of preparing elastomers therefrom |
| US3159601A (en) * | 1962-07-02 | 1964-12-01 | Gen Electric | Platinum-olefin complex catalyzed addition of hydrogen- and alkenyl-substituted siloxanes |
| US3192175A (en) * | 1962-09-27 | 1965-06-29 | Dow Corning | Sealant composition of 3, 3, 3-trifluoropropylmethylsiloxane gums |
| US3341490A (en) * | 1964-08-13 | 1967-09-12 | Dow Corning | Blends of two polysiloxane copolymers with silica |
-
1966
- 1966-08-16 FR FR73149A patent/FR1561922A/fr not_active Expired
-
1967
- 1967-08-07 US US658591A patent/US3498945A/en not_active Expired - Lifetime
- 1967-08-15 GB GB37434/67A patent/GB1156100A/en not_active Expired
- 1967-08-16 DE DE1745342A patent/DE1745342B2/de not_active Withdrawn
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0090382A3 (en) * | 1982-03-26 | 1984-11-07 | Union Carbide Corporation | Organo siloxanes, method for the preparation thereof and polymeric compositions containing same |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1745342A1 (de) | 1971-11-18 |
| FR1561922A (enExample) | 1969-04-04 |
| US3498945A (en) | 1970-03-03 |
| GB1156100A (en) | 1969-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1745342B2 (de) | Lineare Organopolysiloxane | |
| DE69117094T2 (de) | Verfahren zur Herstellung von Kopolymeren mit Diphenyl- und Dimethylsiloxankettensegmenten | |
| EP0776935B1 (de) | Niedermolekulare Organosiliciumverbindungen, Verfahren zu deren Herstellung sowie deren Verwendung in vernetzbaren Organopolysiloxanmassen | |
| US4529752A (en) | Solvent resistant vulcanizable silicone rubber composition | |
| EP0118030A1 (de) | Unter Ausschluss von Wasser lagerfähige, bei Zutritt von Wasser bei Raumtemperatur zu Elastomeren vernetzende Massen | |
| DE69401996T2 (de) | Verfahren zur Herstellung von Organopolysiloxanen | |
| DE2618815A1 (de) | Verfahren zum polymerisieren cyclischer diorganopolysiloxane | |
| DE102004014216A1 (de) | Vernetzbare Massen auf der Basis von Organosiliciumverbindungen | |
| DE1495859A1 (de) | Organopolysiloxane und Verfahren zur Herstellung derselben | |
| DE1720496A1 (de) | Verfahren zur Herstellung von Organopolysiloxanen | |
| DE1570446A1 (de) | Verfahren zur Herstellung von Organosiloxanblockmischpolymerisaten | |
| DE4424115B4 (de) | Verfahren zum Herstellen von linearen Triorganosiloxyendgruppen aufweisenden Silicon-Flüssigkeiten mit geringem Silianolgehalt | |
| DE3041686A1 (de) | Verfahren zur herstellung von triorganosilylendgruppen aufweisenden, fluessigen diorganopolysiloxanen | |
| DE69314897T2 (de) | Verfahren zur Herstellung von Organosiloxanen | |
| DE2900707A1 (de) | Hitzehaertbare silikonkautschukmassen | |
| DE1171613B (de) | Verfahren zur Herstellung von Elastomeren auf Grundlage von Organopolysiloxanen | |
| DE4204306A1 (de) | Organopolysiloxanzusammensetzung | |
| DE3725377A1 (de) | Verfahren zum kondensieren und/oder aequilibrieren von organo(poly)siloxanen | |
| DE69634557T2 (de) | Katalysatoren für Redistribution von Organosiloxan-Polymeren | |
| EP0285091A1 (de) | Verfahren zur Herstellung von Diorganopolysiloxanen mit Triorganosiloxygruppen als endständige Einheiten | |
| DE2307085A1 (de) | Platinkomplexe ungesaettigter siloxane und platinhaltige organopolysiloxane | |
| DE2945786A1 (de) | Verfahren zum herstellen von fluorsilikon-polymeren | |
| DE2415670A1 (de) | Organosiloxane und verfahren zu ihrer herstellung | |
| DE3306295A1 (de) | Verfahren zum stabilisieren von organopolysiloxanen | |
| DE2345923A1 (de) | Verfahren zur herstellung von halogenhaltigen organopolysiloxanen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8228 | New agent |
Free format text: ZUMSTEIN SEN., F., DR. ASSMANN, E., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |
|
| 8239 | Disposal/non-payment of the annual fee |