DE169746C - - Google Patents
Info
- Publication number
- DE169746C DE169746C DENDAT169746D DE169746DA DE169746C DE 169746 C DE169746 C DE 169746C DE NDAT169746 D DENDAT169746 D DE NDAT169746D DE 169746D A DE169746D A DE 169746DA DE 169746 C DE169746 C DE 169746C
- Authority
- DE
- Germany
- Prior art keywords
- pressure
- boils
- under
- alcohol
- base
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910014033 C-OH Inorganic materials 0.000 claims description 15
- 229910014570 C—OH Inorganic materials 0.000 claims description 15
- 150000003944 halohydrins Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 150000001414 amino alcohols Chemical class 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- 150000003139 primary aliphatic amines Chemical class 0.000 claims 1
- 150000005619 secondary aliphatic amines Chemical class 0.000 claims 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Natural products CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- -1 aminopropyl alcohol Chemical compound 0.000 description 10
- 239000000243 solution Substances 0.000 description 9
- 235000019441 ethanol Nutrition 0.000 description 8
- 239000000155 melt Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 6
- ULUMOPZKZIJJLA-UHFFFAOYSA-N 1-chloro-2,5-dimethylhexan-2-ol Chemical compound CC(C)CCC(C)(O)CCl ULUMOPZKZIJJLA-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZYHGIAPHLSTGMX-UHFFFAOYSA-N beta-Eucaine Chemical compound C1C(C)(C)NC(C)CC1OC(=O)C1=CC=CC=C1 ZYHGIAPHLSTGMX-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229960003920 cocaine Drugs 0.000 description 3
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000003222 pyridines Chemical class 0.000 description 3
- SBMWYHAGQYEVTI-UHFFFAOYSA-N 1-chloro-2-methylpentan-2-ol Chemical compound CCCC(C)(O)CCl SBMWYHAGQYEVTI-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 2
- XQJMXPAEFMWDOZ-UHFFFAOYSA-N 3exo-benzoyloxy-tropane Natural products CN1C(C2)CCC1CC2OC(=O)C1=CC=CC=C1 XQJMXPAEFMWDOZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 2
- 150000003945 chlorohydrins Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 239000003589 local anesthetic agent Substances 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 2
- 125000001650 tertiary alcohol group Chemical group 0.000 description 2
- XQJMXPAEFMWDOZ-BTTYYORXSA-N tropacocaine Chemical compound O([C@@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C1=CC=CC=C1 XQJMXPAEFMWDOZ-BTTYYORXSA-N 0.000 description 2
- VOVBTPLWTCSMLY-UHFFFAOYSA-N 1-(dimethylamino)-1-phenylethanol Chemical compound CN(C)C(C)(O)C1=CC=CC=C1 VOVBTPLWTCSMLY-UHFFFAOYSA-N 0.000 description 1
- UBSWVQLCEGGMRD-UHFFFAOYSA-N 1-chloro-2-methyl-3-phenylpropan-2-ol Chemical compound ClCC(O)(C)CC1=CC=CC=C1 UBSWVQLCEGGMRD-UHFFFAOYSA-N 0.000 description 1
- ZQZXWCZCICKWEQ-UHFFFAOYSA-N 1-chloro-2-methylbutan-2-ol Chemical compound CCC(C)(O)CCl ZQZXWCZCICKWEQ-UHFFFAOYSA-N 0.000 description 1
- VXCZNXLMLBRERI-UHFFFAOYSA-N 1-chloro-2-phenylpropan-2-ol Chemical compound ClCC(O)(C)C1=CC=CC=C1 VXCZNXLMLBRERI-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- FVXYJAFWSQTRMY-UHFFFAOYSA-N 3-(chloromethyl)pentan-3-ol Chemical compound CCC(O)(CC)CCl FVXYJAFWSQTRMY-UHFFFAOYSA-N 0.000 description 1
- VMCSODPPPQQBSY-UHFFFAOYSA-N 3-[(dimethylamino)methyl]pentan-3-ol Chemical compound CCC(O)(CC)CN(C)C VMCSODPPPQQBSY-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- CEAUXVYCASKXIN-UHFFFAOYSA-N CN(C)OC(CC(C)C)(C)C Chemical compound CN(C)OC(CC(C)C)(C)C CEAUXVYCASKXIN-UHFFFAOYSA-N 0.000 description 1
- VDOZOEWKFIBRKB-UHFFFAOYSA-N CN(C)OC(CC1=CC=CC=C1)(C)C Chemical compound CN(C)OC(CC1=CC=CC=C1)(C)C VDOZOEWKFIBRKB-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- HFLXLLSTFCERCT-UHFFFAOYSA-N ClOC(CCC(C)C)(C)C Chemical compound ClOC(CCC(C)C)(C)C HFLXLLSTFCERCT-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- JKGCTGHQGHTSSJ-UHFFFAOYSA-N N-(2,5-dimethylhexan-2-yloxy)-N-methylmethanamine Chemical class CN(C)OC(CCC(C)C)(C)C JKGCTGHQGHTSSJ-UHFFFAOYSA-N 0.000 description 1
- UGXRYVLOOJYDNW-UHFFFAOYSA-N N-ethyl-N-(2-phenylpropan-2-yloxy)ethanamine Chemical compound C(C)N(CC)OC(C1=CC=CC=C1)(C)C UGXRYVLOOJYDNW-UHFFFAOYSA-N 0.000 description 1
- AAPDFQUOUHITNA-UHFFFAOYSA-N N-methyl-N-(2-methylpentan-2-yloxy)methanamine Chemical compound CN(C)OC(CCC)(C)C AAPDFQUOUHITNA-UHFFFAOYSA-N 0.000 description 1
- RDSSCARDOFBKMY-UHFFFAOYSA-N N-methyl-N-(2-phenylpropan-2-yloxy)methanamine Chemical compound CN(C)OC(C1=CC=CC=C1)(C)C RDSSCARDOFBKMY-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical group C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- WJGVYRMMIIWBAU-UHFFFAOYSA-M magnesium;2-methylbutane;bromide Chemical compound [Mg+2].[Br-].CC(C)C[CH2-] WJGVYRMMIIWBAU-UHFFFAOYSA-M 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- SCEZYJKGDJPHQO-UHFFFAOYSA-M magnesium;methanidylbenzene;chloride Chemical compound [Mg+2].[Cl-].[CH2-]C1=CC=CC=C1 SCEZYJKGDJPHQO-UHFFFAOYSA-M 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- ACXCKRZOISAYHH-UHFFFAOYSA-N molecular chlorine hydrate Chemical compound O.ClCl ACXCKRZOISAYHH-UHFFFAOYSA-N 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- RIOKYQVIPFUUSE-UHFFFAOYSA-N n-methyl-n-(2-methylbutan-2-yloxy)methanamine Chemical compound CCC(C)(C)ON(C)C RIOKYQVIPFUUSE-UHFFFAOYSA-N 0.000 description 1
- PWFOLWIQYPIAGA-UHFFFAOYSA-N n-methyl-n-[(2-methylpropan-2-yl)oxy]methanamine Chemical compound CN(C)OC(C)(C)C PWFOLWIQYPIAGA-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000003057 platinum Chemical class 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical group C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- SDKPSXWGRWWLKR-UHFFFAOYSA-M sodium;9,10-dioxoanthracene-1-sulfonate Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2S(=O)(=O)[O-] SDKPSXWGRWWLKR-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 210000001364 upper extremity Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/08—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic with only one hydroxy group and one amino group bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/22—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated
- C07C215/28—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
- C07C215/30—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings containing hydroxy groups and carbon atoms of six-membered aromatic rings bound to the same carbon atom of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE169746C true DE169746C (Direct) |
Family
ID=434842
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT169746D Active DE169746C (Direct) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE169746C (Direct) |
-
0
- DE DENDAT169746D patent/DE169746C/de active Active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1943404A1 (de) | Adamantanylalkylamin-Derivate und Verfahren zu ihrer Herstellung | |
| DE3781322T2 (de) | Verfahren zur herstellung einer mischung eines aldehyds mit dem entsprechenden alkohol. | |
| DE169746C (Direct) | ||
| DE2362648C2 (de) | Verfahren zur Herstellung von o-Hydroxyhalogenbenzolsulfonaten | |
| EP0812821B1 (de) | Kohlensäureesterbetaine und deren Herstellung und Verwendung | |
| DE2704690C2 (de) | Triphenylalkenderivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2636278A1 (de) | Verfahren zur herstellung von dialkylketalen | |
| DE2721265C2 (de) | Verfahren zur Herstellung von Di- n-propylacetonitril | |
| DE905246C (de) | Verfahren zur Herstellung von Aminoalkoholen | |
| DE650380C (de) | Verfahren zur Darstellung von Morpholin bzw. 2, 6-Dimethylmorpholin | |
| DE2605650A1 (de) | Verfahren zur herstellung von para-isobutyl-phenylessigsaeurederivaten | |
| DE617596C (de) | Verfahren zur Darstellung von sekundaeren und tertiaeren ungesaettigten Aminen | |
| DE897565C (de) | Verfahren zur Herstellung von Aminoketonen | |
| DE967826C (de) | Verfahren zur Herstellung von Aryloxyalkanol-schwefelsaeurehalbestersalzen | |
| DE1493620A1 (de) | Diaethylaminderivate | |
| AT265530B (de) | Verfahren zur Herstellung von neuen Isochinolinderivaten | |
| DE2750170A1 (de) | 2-methyl-4-trifluormethyl-anilin, ein verfahren zu seiner herstellung und seine verwendung | |
| DE653073C (de) | Verfahren zur Darstellung von Alkylaminoalkylaethern des Apochinins | |
| DE1100014B (de) | Verfahren zur Herstellung von als Herbicid und Pflanzenwachstums-regulator dienender ª‡,ª‡-Dichlor-isovaleriansaeure oder ihrer Salze | |
| AT305247B (de) | Verfahren zur Herstellung von neuen substituierten 1-Phenoxy-2-hydroxy-3-aminopropanen und von deren Säureadditionssalzen | |
| DE917250C (de) | Verfahren zur Herstellung des trans-1-p-Nitrophenyl-2-amino-1íñ3-propandiols | |
| DE869965C (de) | Verfahren zur Zerlegung der diastereomeren Formen von dl-Aminodiolen | |
| CH638172A5 (de) | 1-phenyl-2-amino-1,3-propandiol-n-alkyl-derivate und verfahren zur herstellung derselben. | |
| DE952715C (de) | Verfahren zur Herstellung neuer antihistaminwirksamer basischer AEther | |
| DE1545714C (de) | 4 eckige Klammer auf 1 Benzylpipendyl (2) eckige Klammer zu 2,2 diphenyl 1,3 dioxolane und Verfahren zu ihrer Herstellung |