DE1693012B - - Google Patents
Info
- Publication number
- DE1693012B DE1693012B DE1693012B DE 1693012 B DE1693012 B DE 1693012B DE 1693012 B DE1693012 B DE 1693012B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- oxamide
- dicyan
- percent
- saponification
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 claims description 20
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical compound N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 claims description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- -1 carboxylic acid halide Chemical class 0.000 claims description 9
- 238000007127 saponification reaction Methods 0.000 claims description 9
- 150000001735 carboxylic acids Chemical class 0.000 claims description 8
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 230000035484 reaction time Effects 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 4
- 239000012433 hydrogen halide Substances 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 239000006227 byproduct Substances 0.000 claims description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims 12
- 239000002253 acid Substances 0.000 claims 9
- 150000007513 acids Chemical class 0.000 claims 4
- 235000006408 oxalic acid Nutrition 0.000 claims 4
- 239000007788 liquid Substances 0.000 claims 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 claims 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 2
- 230000007062 hydrolysis Effects 0.000 claims 2
- 238000006460 hydrolysis reaction Methods 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 101150107341 RERE gene Proteins 0.000 claims 1
- 150000001649 bromium compounds Chemical class 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 239000012141 concentrate Substances 0.000 claims 1
- 230000009089 cytolysis Effects 0.000 claims 1
- 230000018044 dehydration Effects 0.000 claims 1
- 238000006297 dehydration reaction Methods 0.000 claims 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- BBJSDUUHGVDNKL-UHFFFAOYSA-J oxalate;titanium(4+) Chemical compound [Ti+4].[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O BBJSDUUHGVDNKL-UHFFFAOYSA-J 0.000 claims 1
- XHTYLMIRTKBVHT-UHFFFAOYSA-N oxamide Chemical compound NC(=O)C(N)=O.NC(=O)C(N)=O XHTYLMIRTKBVHT-UHFFFAOYSA-N 0.000 claims 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- 238000007086 side reaction Methods 0.000 claims 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 4
- 239000012346 acetyl chloride Substances 0.000 description 4
- WJGAPUXHSQQWQF-UHFFFAOYSA-N acetic acid;hydrochloride Chemical compound Cl.CC(O)=O WJGAPUXHSQQWQF-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000012224 working solution Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2318941C2 (de) | Verfahren zur Herstellung von Polyfluoralkylestern und/oder -alkoholen | |
| EP0068219A1 (de) | Verfahren zur Herstellung von Carbonsäuren und N-tert. Alkylaminen | |
| DE1693012B (enrdf_load_stackoverflow) | ||
| DE1693012C (de) | Verfahren zur Herstellung von Oxamid | |
| DE2758759C2 (enrdf_load_stackoverflow) | ||
| DE2323867A1 (de) | Verfahren zur herstellung ungesaettigter aldehydcyanhydrine | |
| DE3120969A1 (de) | Verfahren zur herstellung von 2,2-dihalogenvinylsubstituierten cyclopropancarbonsaeure-estern | |
| DE2202204A1 (de) | Verfahren zur kontinuierlichen herstellung von 2-mercaptobenzimidazol | |
| CH522598A (de) | Verfahren zur Herstellung von Oxamid | |
| DE2549036C3 (de) | Verfahren zur Herstellung von 4,4'-Dinitro-diphenylcarbonat | |
| DE60219036T2 (de) | Einstufiges verfahren zur herstellung von dicarbonsäuren | |
| DE2714799C3 (de) | Verfahren zur Herstellung von 1,4-Dicyan-buten aus Butendiolestern | |
| DE3229311C2 (enrdf_load_stackoverflow) | ||
| AT273912B (de) | Verfahren zur Überführung von gesättigten Kohlenwasserstoffen mit 5 bis 8 Kohlenstoffatomen pro Molekül in die entsprechenden Alkohole mit der gleichen Kohlenstoffanzahl | |
| DE3326210A1 (de) | Verfahren zur herstellung von fluorcarbonsaeuren | |
| AT262954B (de) | Verfahren zur Herstellung von ɛ-Caprolacton und seiner Alkylderivate | |
| DE2155360B2 (de) | Verfahren zur Herstellung von Acylbernsteinsäuredialkylestern | |
| DE2160674C3 (de) | Verfahren zur Herstellung von 4(5)-Aminoimidazol-5(4)-carboxamid aus 4(5)-Aminoimidazol-5(4)-carbonitril | |
| DE2201899A1 (de) | Verfahren zur Herstellung von 2,2,6-Trichlorcyclohexanon und -Masse | |
| DE2831555A1 (de) | Verfahren zur herstellung von cyclopropancarbonsaeure-methyl- und -aethylestern | |
| DE1768154C3 (de) | Verfahren zur Herstellung von Malonsäuredinitril | |
| DE1693012A1 (de) | Verfahren zur Herstellung von Oxamid | |
| DE2062679B2 (de) | Verfahren zur herstellung von alphaaminocycloalkanonoximhydrochloriden | |
| DE1793350C3 (de) | Verfahren zur Herstellung von alkylsubstituierten Glutarsäuren | |
| DE1003204B (de) | Verfahren zur Herstellung von Trichloressigsaeure |