DE1665136C3 - Lichtbogenlöschvorrichtung - Google Patents
LichtbogenlöschvorrichtungInfo
- Publication number
- DE1665136C3 DE1665136C3 DE1967M0073825 DEM0073825A DE1665136C3 DE 1665136 C3 DE1665136 C3 DE 1665136C3 DE 1967M0073825 DE1967M0073825 DE 1967M0073825 DE M0073825 A DEM0073825 A DE M0073825A DE 1665136 C3 DE1665136 C3 DE 1665136C3
- Authority
- DE
- Germany
- Prior art keywords
- arc
- walls
- binder
- additive
- grains
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011230 binding agent Substances 0.000 claims description 20
- 239000000463 material Substances 0.000 claims description 18
- 239000000654 additive Substances 0.000 claims description 7
- 230000000996 additive effect Effects 0.000 claims description 7
- 230000009471 action Effects 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- BRCWHGIUHLWZBK-UHFFFAOYSA-K bismuth;trifluoride Chemical compound F[Bi](F)F BRCWHGIUHLWZBK-UHFFFAOYSA-K 0.000 claims description 3
- 238000010276 construction Methods 0.000 claims description 3
- 238000010891 electric arc Methods 0.000 claims description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 3
- 229910001887 tin oxide Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000004020 conductor Substances 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N zinc oxide Inorganic materials [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 2
- 229910000416 bismuth oxide Inorganic materials 0.000 claims 1
- 230000001747 exhibiting effect Effects 0.000 claims 1
- 238000005245 sintering Methods 0.000 claims 1
- 239000003513 alkali Substances 0.000 description 5
- 239000010408 film Substances 0.000 description 5
- 230000004907 flux Effects 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 150000001639 boron compounds Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- -1 T1O2 Inorganic materials 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052593 corundum Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 238000002242 deionisation method Methods 0.000 description 2
- QDOXWKRWXJOMAK-UHFFFAOYSA-N dichromium trioxide Chemical compound O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000003779 heat-resistant material Substances 0.000 description 2
- 239000011810 insulating material Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 235000010210 aluminium Nutrition 0.000 description 1
- ILRRQNADMUWWFW-UHFFFAOYSA-K aluminium phosphate Chemical compound O1[Al]2OP1(=O)O2 ILRRQNADMUWWFW-UHFFFAOYSA-K 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052614 beryl Inorganic materials 0.000 description 1
- HUTDDBSSHVOYJR-UHFFFAOYSA-H bis[(2-oxo-1,3,2$l^{5},4$l^{2}-dioxaphosphaplumbetan-2-yl)oxy]lead Chemical compound [Pb+2].[Pb+2].[Pb+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O HUTDDBSSHVOYJR-UHFFFAOYSA-H 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- YZYDPPZYDIRSJT-UHFFFAOYSA-K boron phosphate Chemical compound [B+3].[O-]P([O-])([O-])=O YZYDPPZYDIRSJT-UHFFFAOYSA-K 0.000 description 1
- 229910000149 boron phosphate Inorganic materials 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- CXKCTMHTOKXKQT-UHFFFAOYSA-N cadmium oxide Inorganic materials [Cd]=O CXKCTMHTOKXKQT-UHFFFAOYSA-N 0.000 description 1
- CFEAAQFZALKQPA-UHFFFAOYSA-N cadmium(2+);oxygen(2-) Chemical compound [O-2].[Cd+2] CFEAAQFZALKQPA-UHFFFAOYSA-N 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 1
- 239000010431 corundum Substances 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 230000005264 electron capture Effects 0.000 description 1
- 239000005350 fused silica glass Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- YAFKGUAJYKXPDI-UHFFFAOYSA-J lead tetrafluoride Chemical compound F[Pb](F)(F)F YAFKGUAJYKXPDI-UHFFFAOYSA-J 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- VASIZKWUTCETSD-UHFFFAOYSA-N manganese(II) oxide Inorganic materials [Mn]=O VASIZKWUTCETSD-UHFFFAOYSA-N 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 230000006798 recombination Effects 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/02—Details
- H01H33/04—Means for extinguishing or preventing arc between current-carrying parts
- H01H33/16—Impedances connected with contacts
- H01H33/165—Details concerning the impedances
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/70—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid
- H01H33/72—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid having stationary parts for directing the flow of arc-extinguishing fluid, e.g. arc-extinguishing chamber
Landscapes
- Compositions Of Oxide Ceramics (AREA)
- Arc-Extinguishing Devices That Are Switches (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR60180 | 1966-05-04 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1665136A1 DE1665136A1 (de) | 1970-12-23 |
| DE1665136B2 DE1665136B2 (de) | 1977-01-13 |
| DE1665136C3 true DE1665136C3 (de) | 1981-11-05 |
Family
ID=8607773
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1967M0073825 Expired DE1665136C3 (de) | 1966-05-04 | 1967-05-02 | Lichtbogenlöschvorrichtung |
Country Status (3)
| Country | Link |
|---|---|
| BE (1) | BE697845A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1665136C3 (cg-RX-API-DMAC10.html) |
| FR (1) | FR1553672A (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3735074A (en) * | 1971-07-14 | 1973-05-22 | Gen Electric | Arc chute for an electric circuit breaker |
| US3838375A (en) * | 1973-01-29 | 1974-09-24 | Gen Electric | Current limiting fuse |
| US4489291A (en) * | 1981-10-12 | 1984-12-18 | Tokyo Shibaura Denki Kabushiki Kaisha | Circuit breaker provided with parallel resistor |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE510192A (cg-RX-API-DMAC10.html) * | 1951-03-28 | |||
| BE502180A (cg-RX-API-DMAC10.html) * | 1951-03-28 | Merlin Gerin | ||
| US2864919A (en) * | 1955-05-11 | 1958-12-16 | Ite Circuit Breaker Ltd | Ceramic arcing plate material |
| DE1028660B (de) * | 1957-08-16 | 1958-04-24 | Siemens Ag | Elektrischer Schalter fuer hohe Schaltleistungen |
-
1966
- 1966-05-04 FR FR1553672D patent/FR1553672A/fr not_active Expired
-
1967
- 1967-04-28 BE BE697845D patent/BE697845A/xx unknown
- 1967-05-02 DE DE1967M0073825 patent/DE1665136C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE697845A (cg-RX-API-DMAC10.html) | 1967-10-30 |
| DE1665136A1 (de) | 1970-12-23 |
| DE1665136B2 (de) | 1977-01-13 |
| FR1553672A (cg-RX-API-DMAC10.html) | 1969-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0251372B1 (de) | Elektrische Glühlampe für Reihenschaltung | |
| DE2353378C2 (de) | Natriumborat-Natriumhalogenid-Glas und seine Verwendung | |
| DE2753039C2 (de) | Elektrode für eine Entladungslampe | |
| DE1243078B (de) | Sinterkoerper, vorzugsweise zur Verwendung als Heizelement | |
| DE69317407T2 (de) | Widerstandselement mit nichtlinearer spannungsabhängigkeit und herstellungsverfahren | |
| DE1665136C3 (de) | Lichtbogenlöschvorrichtung | |
| DE1465467A1 (de) | Auf Temperatur ansprechende elektrische Widerstandsvorrichtung | |
| DE1066654B (cg-RX-API-DMAC10.html) | ||
| DE69526657T2 (de) | Niederdruckentladungslampe | |
| DE3106763C2 (de) | Verfahren zur Herstellung eines Überspannungsableiters mit bariumhaltiger Elektrodenbeschichtung | |
| DE4131806A1 (de) | Entladungsroehre und verfahren zu deren herstellung | |
| EP2057103B1 (de) | Katalytisch aktives bauelement für thermoionisationsdetektoren zum nachweis von halogenhaltigen verbindungen und verfahren zur herstellung eines oxidkeramischen werkstoffs für das bauelement | |
| DE2525441A1 (de) | Verfahren zur herstellung von rohrfuellungen mit hohem elektrischem widerstand aus geschmolzenem magnesiumoxid fuer elektrische rohrheizkoerper | |
| DE1903582B2 (de) | Keramischer werkstoff fuer elektroden magnetohydrodynami scher generatoren | |
| DE2106511C3 (de) | Gasentladungs-Überspannungsableiter | |
| DE2038645C3 (de) | Verwendung von Hafnium-, Zirkonium- und oder Tantalnitrid als Werkstoff für Elektroden | |
| DE587504C (de) | Indirekt beheizte Kathode fuer Entladungsroehren | |
| DE2933255A1 (de) | Keramisches material fuer die kathode einer elektronen-kanone | |
| CH379600A (de) | Elektrischer Widerstand in einem Leistungsschalter | |
| DE931423C (de) | Hochintensitaets-Bogenlicht-Elektrode | |
| EP4121986B1 (de) | Elektronen emittierende keramik | |
| DE2828591A1 (de) | Ueberspannungsableiter mit innerem kurzschluss bei ueberlastung | |
| DE591042C (de) | Elektrische Leuchtroehre mit einer oder mehreren huelsenfoermigen Elektroden | |
| DE2731784A1 (de) | Elektrisch isolierende einbettungsmasse | |
| DE3104742C2 (de) | Starkstrom-Schmelzsicherung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |