DE1644218A1 - Monoazofarbstoffe - Google Patents
MonoazofarbstoffeInfo
- Publication number
- DE1644218A1 DE1644218A1 DE19671644218 DE1644218A DE1644218A1 DE 1644218 A1 DE1644218 A1 DE 1644218A1 DE 19671644218 DE19671644218 DE 19671644218 DE 1644218 A DE1644218 A DE 1644218A DE 1644218 A1 DE1644218 A1 DE 1644218A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- amino
- parts
- anilide
- tetrahydro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 title claims description 31
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 12
- 150000001412 amines Chemical class 0.000 claims description 20
- 230000008878 coupling Effects 0.000 claims description 19
- 238000010168 coupling process Methods 0.000 claims description 19
- 238000005859 coupling reaction Methods 0.000 claims description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 16
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 16
- -1 aryl amides Chemical class 0.000 claims description 14
- 239000000049 pigment Substances 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 11
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical group OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 6
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 239000000976 ink Substances 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 4
- 150000002085 enols Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 239000004033 plastic Substances 0.000 claims description 4
- 229920003023 plastic Polymers 0.000 claims description 4
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 239000000123 paper Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000002966 varnish Substances 0.000 claims description 3
- 238000004040 coloring Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 235000019260 propionic acid Nutrition 0.000 claims description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims 1
- 150000001991 dicarboxylic acids Chemical class 0.000 claims 1
- 239000004922 lacquer Substances 0.000 claims 1
- QOMNJPSRBRDQSU-UHFFFAOYSA-N 5-aminobenzimidazol-2-one Chemical compound C1=C(N)C=CC2=NC(=O)N=C21 QOMNJPSRBRDQSU-UHFFFAOYSA-N 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000203 mixture Substances 0.000 description 14
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical class C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 11
- HNWOXIYAKHJJIM-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoxalin-6-amine Chemical compound N1CCNC2=CC(N)=CC=C21 HNWOXIYAKHJJIM-UHFFFAOYSA-N 0.000 description 10
- 150000008064 anhydrides Chemical class 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 9
- WGLQHUKCXBXUDV-UHFFFAOYSA-N 3-aminophthalic acid Chemical compound NC1=CC=CC(C(O)=O)=C1C(O)=O WGLQHUKCXBXUDV-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 150000003931 anilides Chemical class 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 6
- AIHIKIZCFCEKEX-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinazolin-6-amine Chemical compound N1CNCC2=CC(N)=CC=C21 AIHIKIZCFCEKEX-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- OXSANYRLJHSQEP-UHFFFAOYSA-N 4-aminophthalic acid Chemical class NC1=CC=C(C(O)=O)C(C(O)=O)=C1 OXSANYRLJHSQEP-UHFFFAOYSA-N 0.000 description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 239000000987 azo dye Substances 0.000 description 3
- 150000005690 diesters Chemical class 0.000 description 3
- 239000003791 organic solvent mixture Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000001054 red pigment Substances 0.000 description 3
- 235000002639 sodium chloride Nutrition 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- JWIYQPMZNYYEGP-UHFFFAOYSA-N 1,2,3,4-tetrahydrophthalazin-6-amine Chemical compound NC=1C=C2CNNCC2=CC=1 JWIYQPMZNYYEGP-UHFFFAOYSA-N 0.000 description 2
- JYPZEZKWBAEHJG-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoxalin-5-amine Chemical compound N1CCNC2=C1C=CC=C2N JYPZEZKWBAEHJG-UHFFFAOYSA-N 0.000 description 2
- KFIRODWJCYBBHY-UHFFFAOYSA-N 3-nitrophthalic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1C(O)=O KFIRODWJCYBBHY-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000005603 azodicarboxylic group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000019864 coconut oil Nutrition 0.000 description 2
- 239000003240 coconut oil Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- BFVHBHKMLIBQNN-UHFFFAOYSA-N n-(2-chlorophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1Cl BFVHBHKMLIBQNN-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 1
- OFUIFLZWMQEMFY-UHFFFAOYSA-N 1,2-dihydropyridazine-3,4-dione Chemical group O=C1C=CNNC1=O OFUIFLZWMQEMFY-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- MSKNUZSVGYXUBM-UHFFFAOYSA-N 1-aminocyclohexa-3,5-diene-1,2-dicarboxylic acid Chemical compound OC(=O)C1(N)C=CC=CC1C(O)=O MSKNUZSVGYXUBM-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- PRIUALOJYOZZOJ-UHFFFAOYSA-L 2-ethylhexyl 2-[dibutyl-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylstannyl]sulfanylacetate Chemical compound CCCCC(CC)COC(=O)CS[Sn](CCCC)(CCCC)SCC(=O)OCC(CC)CCCC PRIUALOJYOZZOJ-UHFFFAOYSA-L 0.000 description 1
- RNELSSOIEGVRNT-UHFFFAOYSA-N 2-hydroxydibenzofuran-1-carboxylic acid Chemical compound O1C2=CC=CC=C2C2=C1C=CC(O)=C2C(=O)O RNELSSOIEGVRNT-UHFFFAOYSA-N 0.000 description 1
- JBNOQRLGLQXWLO-UHFFFAOYSA-N 3-amino-4,5,6-trimethoxyphthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C(=C1OC)OC)OC)C(=O)O JBNOQRLGLQXWLO-UHFFFAOYSA-N 0.000 description 1
- WBIJIPZLUPLPQZ-UHFFFAOYSA-N 3-amino-5-cyanophthalic acid Chemical compound NC1=C(C(C(=O)O)=CC(=C1)C#N)C(=O)O WBIJIPZLUPLPQZ-UHFFFAOYSA-N 0.000 description 1
- WWTKWTCRJNEVSL-UHFFFAOYSA-N 3-amino-6-(trifluoromethyl)phthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C=C1)C(F)(F)F)C(=O)O WWTKWTCRJNEVSL-UHFFFAOYSA-N 0.000 description 1
- IHGCCIAXAAWTSR-UHFFFAOYSA-N 3-amino-6-nitrophthalic acid Chemical compound NC1=CC=C([N+]([O-])=O)C(C(O)=O)=C1C(O)=O IHGCCIAXAAWTSR-UHFFFAOYSA-N 0.000 description 1
- SIXWIUJQBBANGK-UHFFFAOYSA-N 4-(4-fluorophenyl)-1h-pyrazol-5-amine Chemical compound N1N=CC(C=2C=CC(F)=CC=2)=C1N SIXWIUJQBBANGK-UHFFFAOYSA-N 0.000 description 1
- PGJVSQNULKBTJW-UHFFFAOYSA-N 4-amino-5-methoxyphthalic acid Chemical compound COC1=CC(C(O)=O)=C(C(O)=O)C=C1N PGJVSQNULKBTJW-UHFFFAOYSA-N 0.000 description 1
- RUOKEIXYFOZSIS-UHFFFAOYSA-N 4-amino-5-nitrophthalic acid Chemical compound NC1=CC(C(O)=O)=C(C(O)=O)C=C1[N+]([O-])=O RUOKEIXYFOZSIS-UHFFFAOYSA-N 0.000 description 1
- CRXVBLLLPNWFBS-UHFFFAOYSA-N 4-aminobenzimidazol-2-one Chemical compound NC1=CC=CC2=NC(=O)N=C12 CRXVBLLLPNWFBS-UHFFFAOYSA-N 0.000 description 1
- ROFZMKDROVBLNY-UHFFFAOYSA-N 4-nitro-2-benzofuran-1,3-dione Chemical compound [O-][N+](=O)C1=CC=CC2=C1C(=O)OC2=O ROFZMKDROVBLNY-UHFFFAOYSA-N 0.000 description 1
- SLBQXWXKPNIVSQ-UHFFFAOYSA-N 4-nitrophthalic acid Chemical class OC(=O)C1=CC=C([N+]([O-])=O)C=C1C(O)=O SLBQXWXKPNIVSQ-UHFFFAOYSA-N 0.000 description 1
- OIVLITBTBDPEFK-UHFFFAOYSA-N 5,6-dihydrouracil Chemical compound O=C1CCNC(=O)N1 OIVLITBTBDPEFK-UHFFFAOYSA-N 0.000 description 1
- WUAZKQCAABBHSK-UHFFFAOYSA-N 5-amino-4,7-dimethylbenzimidazol-2-one Chemical compound CC1=CC(N)=C(C)C2=NC(=O)N=C12 WUAZKQCAABBHSK-UHFFFAOYSA-N 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PCTPXAOHSBZIAQ-UHFFFAOYSA-N CC(CC(NC(C(Cl)=C(C(Cl)=C1Cl)Cl)=C1Cl)=O)=O Chemical compound CC(CC(NC(C(Cl)=C(C(Cl)=C1Cl)Cl)=C1Cl)=O)=O PCTPXAOHSBZIAQ-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 239000004640 Melamine resin Substances 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- LURIVIMAEYPZHP-UHFFFAOYSA-N NC1=CC=2C(=NC(N2)=O)C=C1.NC1=CC=2C(=NC(N2)=O)C=C1 Chemical compound NC1=CC=2C(=NC(N2)=O)C=C1.NC1=CC=2C(=NC(N2)=O)C=C1 LURIVIMAEYPZHP-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 1
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000001470 diamides Chemical class 0.000 description 1
- MPCAOTRSCWFYIJ-UHFFFAOYSA-N diethyl 4-aminobenzene-1,2-dicarboxylate Chemical compound CCOC(=O)C1=CC=C(N)C=C1C(=O)OCC MPCAOTRSCWFYIJ-UHFFFAOYSA-N 0.000 description 1
- NTBHQNDXAJXRPU-UHFFFAOYSA-N dimethyl 4-aminobenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=C(N)C=C1C(=O)OC NTBHQNDXAJXRPU-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 125000002587 enol group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- HGVIAKXYAZRSEG-UHFFFAOYSA-N n-(2,4-dimethylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(C)C=C1C HGVIAKXYAZRSEG-UHFFFAOYSA-N 0.000 description 1
- BZKOGFAXBSPQRB-UHFFFAOYSA-N n-(2-chloro-4-nitrophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C([N+]([O-])=O)C=C1Cl BZKOGFAXBSPQRB-UHFFFAOYSA-N 0.000 description 1
- JTVHJWVDFCVGBG-UHFFFAOYSA-N n-(2-methyl-5-nitrophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC([N+]([O-])=O)=CC=C1C JTVHJWVDFCVGBG-UHFFFAOYSA-N 0.000 description 1
- ODFRAIZRJMUPCP-UHFFFAOYSA-N n-(4-chloro-2-methylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(Cl)C=C1C ODFRAIZRJMUPCP-UHFFFAOYSA-N 0.000 description 1
- KLMIREBDPKVUQJ-UHFFFAOYSA-N n-(4-chloro-2-nitrophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(Cl)C=C1[N+]([O-])=O KLMIREBDPKVUQJ-UHFFFAOYSA-N 0.000 description 1
- WWROGCAUSKGAMX-UHFFFAOYSA-N n-(4-ethoxyphenyl)-3-oxobutanamide Chemical compound CCOC1=CC=C(NC(=O)CC(C)=O)C=C1 WWROGCAUSKGAMX-UHFFFAOYSA-N 0.000 description 1
- ZZSDMAAHJFGGSU-UHFFFAOYSA-N n-(4-methyl-2-nitrophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(C)C=C1[N+]([O-])=O ZZSDMAAHJFGGSU-UHFFFAOYSA-N 0.000 description 1
- MJGLMEMIYDUEHA-UHFFFAOYSA-N n-(4-methylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(C)C=C1 MJGLMEMIYDUEHA-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- JTHRRMFZHSDGNJ-UHFFFAOYSA-N piperazine-2,3-dione Chemical compound O=C1NCCNC1=O JTHRRMFZHSDGNJ-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
- C09B43/32—Preparation of azo dyes from other azo compounds by reacting carboxylic or sulfonic groups, or derivatives thereof, with amines; by reacting keto-groups with amines
- C09B43/34—Preparation of azo dyes from other azo compounds by reacting carboxylic or sulfonic groups, or derivatives thereof, with amines; by reacting keto-groups with amines by reacting ortho- or peri-dicarboxylic dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0052727 | 1967-06-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1644218A1 true DE1644218A1 (de) | 1970-12-17 |
Family
ID=7105687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671644218 Pending DE1644218A1 (de) | 1967-06-19 | 1967-06-19 | Monoazofarbstoffe |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE716794A (enExample) |
| CH (1) | CH499595A (enExample) |
| DE (1) | DE1644218A1 (enExample) |
| FR (1) | FR1570220A (enExample) |
| GB (1) | GB1182859A (enExample) |
| NL (1) | NL6808612A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3734745A1 (de) * | 1987-10-09 | 1989-04-20 | Schering Ag | Tetrahydropyrrolo(2,1-c)(1,2,4)-thiadiazol-3-ylideniminobenzoxazinone und andere heterocyclisch substituierte azole und azine, verfahren zu ihrer herstellung und ihre verwendung als mittel mit herbizider wirkung |
-
1967
- 1967-06-19 DE DE19671644218 patent/DE1644218A1/de active Pending
-
1968
- 1968-05-24 CH CH768768A patent/CH499595A/de not_active IP Right Cessation
- 1968-05-30 GB GB2601968A patent/GB1182859A/en not_active Expired
- 1968-06-19 FR FR1570220D patent/FR1570220A/fr not_active Expired
- 1968-06-19 BE BE716794D patent/BE716794A/xx unknown
- 1968-06-19 NL NL6808612A patent/NL6808612A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH499595A (de) | 1970-11-30 |
| NL6808612A (enExample) | 1968-12-20 |
| BE716794A (enExample) | 1968-12-02 |
| FR1570220A (enExample) | 1969-06-06 |
| GB1182859A (en) | 1970-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2041999C3 (de) | Pigmentfarbstoffe | |
| DE1544460B2 (de) | Bfs (Acetoacet)-arykliamid-Disazopigmentfarbstoffe | |
| DE1297259B (de) | Verfahren zur Herstellung von Farbstoffen | |
| DE2244035C3 (de) | Disazopigmente, Verfahren zu deren Herstellung und ihre Verwendung zum Pigmentieren von hochmolekularem organischen Material | |
| DE1544453A1 (de) | Verfahren zur Herstellung von Disazopigmenten | |
| DE2457687B2 (de) | Azofarbstoffe, deren Herstellung und Verwendung zum Farben von Lacken, Druckfarben oder Kunststoffen | |
| DE2145422C3 (de) | Neue Disazopigmente | |
| DE1644218A1 (de) | Monoazofarbstoffe | |
| DE1544459A1 (de) | Verfahren zur Herstellung von Disazopigmenten | |
| DE2832456A1 (de) | Neue monoazopigmente und verfahren zu deren herstellung | |
| EP0006154B1 (de) | Monoazopigmente und deren Verwendung zum Pigmentieren von hochmolekularem organischem Material | |
| DE2460490A1 (de) | Wasserunloesliche disazomethinverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2544568C3 (de) | Sulfonsäuregruppenfreie Azofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung als Pigmente in Lacken, Druckfarben oder Kunststoffen | |
| DE2417217C3 (de) | Pigmentfarbstoffe mit Oxidazolylresten, Verfahren zu deren Herstellung und ihre Verwendung | |
| EP0000737B1 (de) | Monoazopigmente der Acetoacetylaminobenzimidazolonreihe, Verfahren zu deren Herstellung, und deren Verwendung zum Pigmentieren von hochmolekularem organischem Material | |
| DE2429286A1 (de) | Neue disazopigmente und verfahren zu deren herstellung und verwendung | |
| AT277416B (de) | Verfahren zur herstellung von neuen farbstoffen der perylenreihe | |
| AT237152B (de) | Verfahren zur Herstellung von neuen wasserunlöslichen Monoazofarbstoffen | |
| DE2841532C2 (de) | Neue Disazopigmentfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zur Färbung von Kunststoffen, Lacken und Druckfarben | |
| DE1769789C3 (de) | Gemische aus Chinophthalonfarbstoffen, deren Herstellung und Verwendung | |
| DE1544556A1 (de) | Azofarbstoffe und Verfahren zu deren Herstellung | |
| DE1644159C3 (de) | Sulfonsäuregruppenfreie Azofarbstoffe | |
| DE1644236A1 (de) | Phthalimid-Azofarbstoffe | |
| DE2523175A1 (de) | Organische verbindungen | |
| DE1944702A1 (de) | Monoazopigmente |