DE1643151C - - Google Patents
Info
- Publication number
- DE1643151C DE1643151C DE1643151C DE 1643151 C DE1643151 C DE 1643151C DE 1643151 C DE1643151 C DE 1643151C
- Authority
- DE
- Germany
- Prior art keywords
- peroxide
- radical
- saturated
- epoxy
- epoxy groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 125000003700 epoxy group Chemical group 0.000 claims description 29
- 150000002978 peroxides Chemical class 0.000 claims description 28
- -1 Acetyl oleoyl peroxide Chemical compound 0.000 claims description 26
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 claims description 14
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 13
- 229920006395 saturated elastomer Chemical group 0.000 claims description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- 229930195733 hydrocarbon Natural products 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 8
- 150000001451 organic peroxides Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000002015 acyclic group Chemical group 0.000 claims description 4
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- WMFSXSFYPOFVPS-UHFFFAOYSA-N cyclohex-2-ene-1-carbonyl cyclohex-2-ene-1-carboperoxoate Chemical compound C(C1CCCC=C1)(=O)OOC(C1CCCC=C1)=O WMFSXSFYPOFVPS-UHFFFAOYSA-N 0.000 claims description 4
- BWBVNPNIHQQWIR-YAFCTCPESA-N [(e)-octadec-9-enoyl] (z)-octadec-9-eneperoxoate Chemical compound CCCCCCCC\C=C\CCCCCCCC(=O)OOC(=O)CCCCCCC\C=C/CCCCCCCC BWBVNPNIHQQWIR-YAFCTCPESA-N 0.000 claims description 3
- UMWQVGVEAWTQJC-UHFFFAOYSA-N decanoyl cyclohex-2-ene-1-carboperoxoate Chemical compound C(C1CCCC=C1)(=O)OOC(CCCCCCCCC)=O UMWQVGVEAWTQJC-UHFFFAOYSA-N 0.000 claims description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- 150000003254 radicals Chemical class 0.000 description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 239000001301 oxygen Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 7
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- CABDEMAGSHRORS-UHFFFAOYSA-N oxirane;hydrate Chemical compound O.C1CO1 CABDEMAGSHRORS-UHFFFAOYSA-N 0.000 description 5
- 150000002976 peresters Chemical class 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000012933 diacyl peroxide Substances 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 229930195734 saturated hydrocarbon Natural products 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 3
- 229960001826 dimethylphthalate Drugs 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000013504 Triton X-100 Substances 0.000 description 2
- 229920004890 Triton X-100 Polymers 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000002811 oleoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- IFABLCIRROMTAN-MDZDMXLPSA-N (e)-1-chlorooctadec-9-ene Chemical compound CCCCCCCC\C=C\CCCCCCCCCl IFABLCIRROMTAN-MDZDMXLPSA-N 0.000 description 1
- MKTOIPPVFPJEQO-UHFFFAOYSA-N 4-(3-carboxypropanoylperoxy)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)OOC(=O)CCC(O)=O MKTOIPPVFPJEQO-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 240000001987 Pyrus communis Species 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- JYQKHHVUAQPNMZ-UHFFFAOYSA-N cyclohex-2-ene-1-carbonyl chloride Chemical compound ClC(=O)C1CCCC=C1 JYQKHHVUAQPNMZ-UHFFFAOYSA-N 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- DPMBYNZUQXBRQJ-UHFFFAOYSA-N tert-butyl cyclohex-2-ene-1-carboxylate Chemical compound CC(C)(C)OC(=O)C1CCCC=C1 DPMBYNZUQXBRQJ-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE851496C (de) | Verfahren zur Herstellung symmetrischer oder unsymmetrischer aliphatischer, ditertiaerer Peroxyde | |
| DE1643151C (enFirst) | ||
| EP0262639B1 (de) | Verfahren zur Herstellung von t-Alkyl-t-aralkylperoxiden | |
| DE1643151B (de) | Verfahren zur Herstellung von Epoxyd gruppen enthaltenden organischen Peroxyden | |
| DE1793652C3 (de) | Epoxydierte Acylperoxyde. Ausscheidung aus: 1643151 | |
| EP0008112B1 (de) | Verfahren zur Herstellung von Glycidylestern aromatischer Polycarbonsäuren | |
| DE2740849A1 (de) | Verfahren zur herstellung von halogenvinylsubstituierten tetrahydrofuran-2-onen | |
| DE2417615A1 (de) | Cyclische ketone und verfahren zu ihrer herstellung | |
| DE3101459C2 (de) | Verfahren zur Herstellung von Peroxyestern | |
| DE1178854B (de) | Verfahren zur Herstellung von Carbonsaeure-estern, AEthern oder Acetalen des 2, 5-Dimethyl-hexan-2, 5-dihydroperoxyds | |
| DE2803757A1 (de) | Verfahren zur epoxidation von olefinen in anwesenheit eines katalysators auf arsenbasis | |
| EP0347689A1 (de) | Verfahren zur Herstellung von N-Hydroxypyrazolen | |
| DE2201456C3 (de) | Verfahren zur Herstellung von Aldehyden und Diolen | |
| DE2556844C3 (de) | Verfahren zur Herstellung von Perfluorcarbonsäuren | |
| DE1643150A1 (de) | Verfahren zur Herstellung von aethylenisch ungesaettigten Peroxyden | |
| AT354457B (de) | Verfahren zur herstellung von neuen 0-(2,3- epoxypropyl)-hydroximsaeureestern | |
| DE3247255A1 (de) | Verfahren zur herstellung von isolierung von polyglycidylverbindungen | |
| AT358059B (de) | Verfahren zur herstellung von neuen oxiranen | |
| DE1543353C3 (enFirst) | ||
| DE3243048C2 (enFirst) | ||
| EP2112137A1 (de) | Verfahren zur Herstellung von quarternären Salzen von Piperidyl Estern der Mandelsäure | |
| EP0008114A1 (de) | Verfahren zur Herstellung von Maleinsäureglycidylestern | |
| EP0137176B1 (de) | N,N'-Bis-(2,3-epoxypropyl)-derivate cyclischer Dicarbonsäurehydrazide und ein Verfahren zu ihrer Herstellung | |
| EP0121838A1 (de) | Verfahren zur Herstellung von in 1,4-Stellung substituierten 2-Buten-1,4-dionen | |
| AT248432B (de) | Verfahren zur Herstellung von Derivaten der 2-Alkyl-isonicotinsäure |