DE1620341A1 - Verfahren zur Herstellung neuer Tropyliumverbindungen - Google Patents
Verfahren zur Herstellung neuer TropyliumverbindungenInfo
- Publication number
- DE1620341A1 DE1620341A1 DE19661620341 DE1620341A DE1620341A1 DE 1620341 A1 DE1620341 A1 DE 1620341A1 DE 19661620341 DE19661620341 DE 19661620341 DE 1620341 A DE1620341 A DE 1620341A DE 1620341 A1 DE1620341 A1 DE 1620341A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- sulfate
- reaction
- compounds
- dimethyl sulfate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title description 19
- OJOSABWCUVCSTQ-UHFFFAOYSA-N cyclohepta-2,4,6-trienylium Chemical class C1=CC=C[CH+]=C[CH]1 OJOSABWCUVCSTQ-UHFFFAOYSA-N 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- 125000006501 nitrophenyl group Chemical group 0.000 claims 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000000047 product Substances 0.000 description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- -1 p-ethylphenyl Chemical group 0.000 description 11
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 10
- 238000000354 decomposition reaction Methods 0.000 description 9
- 239000000155 melt Substances 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000008050 dialkyl sulfates Chemical class 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000008051 alkyl sulfates Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000000967 suction filtration Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- QVWDCTQRORVHHT-UHFFFAOYSA-N tropone Chemical class O=C1C=CC=CC=C1 QVWDCTQRORVHHT-UHFFFAOYSA-N 0.000 description 2
- USKZHEQYENVSMH-YDFGWWAZSA-N 1,3,5-Heptatriene Chemical compound C\C=C\C=C\C=C USKZHEQYENVSMH-YDFGWWAZSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RTLHSHBNJUIQLG-UHFFFAOYSA-N 2h-cyclohepta[d][1,3]oxazole Chemical compound C1=CC=CC2=NCOC2=C1 RTLHSHBNJUIQLG-UHFFFAOYSA-N 0.000 description 1
- SXNMUZQWTWBSBL-UHFFFAOYSA-N 2h-cyclohepta[d][1,3]thiazole Chemical class C1=CC=CC2=NCSC2=C1 SXNMUZQWTWBSBL-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- RJFAYQIBOAGBLC-BYPYZUCNSA-N Selenium-L-methionine Chemical compound C[Se]CC[C@H](N)C(O)=O RJFAYQIBOAGBLC-BYPYZUCNSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- CHVJITGCYZJHLR-UHFFFAOYSA-N cyclohepta-1,3,5-triene Chemical group C1C=CC=CC=C1 CHVJITGCYZJHLR-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP388965 | 1965-01-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1620341A1 true DE1620341A1 (de) | 1970-03-19 |
Family
ID=11569731
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661620341 Pending DE1620341A1 (de) | 1965-01-25 | 1966-01-25 | Verfahren zur Herstellung neuer Tropyliumverbindungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3467665A (enExample) |
| CH (1) | CH462814A (enExample) |
| DE (1) | DE1620341A1 (enExample) |
| DK (1) | DK110014C (enExample) |
| FR (1) | FR1465276A (enExample) |
| GB (1) | GB1087001A (enExample) |
| NL (1) | NL6600777A (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL123451C (enExample) * | 1959-07-16 |
-
1966
- 1966-01-20 NL NL6600777A patent/NL6600777A/xx unknown
- 1966-01-24 DK DK38066AA patent/DK110014C/da active
- 1966-01-25 CH CH97366A patent/CH462814A/de unknown
- 1966-01-25 DE DE19661620341 patent/DE1620341A1/de active Pending
- 1966-01-25 FR FR47053A patent/FR1465276A/fr not_active Expired
- 1966-01-25 GB GB3252/66A patent/GB1087001A/en not_active Expired
-
1967
- 1967-05-31 US US642350A patent/US3467665A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB1087001A (en) | 1967-10-11 |
| NL6600777A (enExample) | 1966-07-26 |
| DK110014C (da) | 1968-08-26 |
| CH462814A (de) | 1968-09-30 |
| US3467665A (en) | 1969-09-16 |
| FR1465276A (fr) | 1967-01-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69731835T3 (de) | Verfahren zur herstellung von zwischenprodukten des florfenicols | |
| DE1793767A1 (de) | Acetale und ein verfahren zu ihrer herstellung | |
| DE2429562A1 (de) | Benzoxazolinon-derivate | |
| DE1695594A1 (de) | In 2-Stellung substituierte delta1-Pyrrolinverbindungen und Verfahren zu ihrer Herstellung | |
| DE69707860T2 (de) | Verfahren zur herstellung von tetrahydroindolizinen | |
| DE1768943B2 (de) | Verfahren zur herstellung eines kobalt-chelatkomplexes | |
| DE1620341A1 (de) | Verfahren zur Herstellung neuer Tropyliumverbindungen | |
| DE2249460A1 (de) | Orthokohlensaeureester | |
| CH417630A (de) | Verfahren zur Herstellung von neuen cyclischen 2,3-O-Acetalen und 2,3-O-Ketalen von Butantetrolestern | |
| DE2512702C2 (de) | Substituierte 1-Amino-3-phenyl-indole, deren Salze und Verfahren zu ihrer Herstellung | |
| DE2642608A1 (de) | 4-hydroxymethyl-2-pyrrolidinone und verfahren zu ihrer herstellung | |
| DE3729094A1 (de) | 2,5-substituierte cyclohexan-1,4-dione und verfahren zu deren herstellung | |
| DE2246376A1 (de) | Verfahren zur herstellung von cyanacetylcarbamaten | |
| AT331804B (de) | Verfahren zur herstellung von neuen 6-aza-3h-1,4-benzodiazepinen, deren optischen isomeren und deren salzen | |
| DE1468624B2 (de) | Verfahren zur herstellung von beta-cyanketonen | |
| DE2628469B2 (de) | Verfahren zur Herstellung von γ -Aminoalkoholen | |
| EP0294686B1 (de) | Verfahren zur Herstellung von Iminokohlensäurediarylestern | |
| DE1921341C3 (de) | Verfahren zur Herstellung von 2- Carbamyl-A2 -imidazolinen | |
| DE2923697A1 (de) | Neue 1-pyrrol- und pyrrolidin-carbonsaeure-derivate und verfahren zu deren herstellung | |
| DE1570034A1 (de) | Verfahren zur Herstellung von Nikotinsaeureamiden | |
| AT259562B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT236969B (de) | Verfahren zur Herstellung neuer cyclischer 2,3-O-Acetale und 2,3-O-Ketale von Butan-1,2,3,4-tetrol-1,4-di-(methansulfonat) | |
| AT257617B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE19832146B4 (de) | Verfahren zur Herstellung von 3-Methylpyrazol bzw. dessen Salze | |
| DE1543995C (de) | Verfahren zur Herstellung von 5 (3 see AminoalkyhdenH0,11 dihydro 5H dibenzo eckige Klammer auf a,d ecki ge Klammer zu cycloheptenen |