DE1620033A1 - Verfahren zur Herstellung von Sulfonamidoindolen - Google Patents
Verfahren zur Herstellung von SulfonamidoindolenInfo
- Publication number
- DE1620033A1 DE1620033A1 DE19661620033 DE1620033A DE1620033A1 DE 1620033 A1 DE1620033 A1 DE 1620033A1 DE 19661620033 DE19661620033 DE 19661620033 DE 1620033 A DE1620033 A DE 1620033A DE 1620033 A1 DE1620033 A1 DE 1620033A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- carbon atoms
- hydrogen
- base
- lower alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title description 7
- -1 sulfonyl anhydride Chemical class 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 239000002585 base Substances 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 229910052740 iodine Inorganic materials 0.000 claims description 7
- IHWDSEPNZDYMNF-UHFFFAOYSA-N 1H-indol-2-amine Chemical compound C1=CC=C2NC(N)=CC2=C1 IHWDSEPNZDYMNF-UHFFFAOYSA-N 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- 150000003461 sulfonyl halides Chemical class 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 4
- 125000001041 indolyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 230000036760 body temperature Effects 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 5
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- FUCXHYNBFBTGJX-UHFFFAOYSA-N n-(1h-indol-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C2NC=CC2=C1 FUCXHYNBFBTGJX-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- HCGYMSSYSAKGPK-UHFFFAOYSA-N 2-nitro-1h-indole Chemical class C1=CC=C2NC([N+](=O)[O-])=CC2=C1 HCGYMSSYSAKGPK-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 210000003169 central nervous system Anatomy 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 150000002475 indoles Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- ZCBIFHNDZBSCEP-UHFFFAOYSA-N 1H-indol-5-amine Chemical compound NC1=CC=C2NC=CC2=C1 ZCBIFHNDZBSCEP-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- WSJQSJKBVHGABJ-UHFFFAOYSA-N n-(1h-indol-2-yl)methanesulfonamide Chemical class C1=CC=C2NC(NS(=O)(=O)C)=CC2=C1 WSJQSJKBVHGABJ-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229940125723 sedative agent Drugs 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- QQZPUGDUSPXQEI-UHFFFAOYSA-N 2,3-dimethyl-6-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2C(C)=C(C)NC2=C1 QQZPUGDUSPXQEI-UHFFFAOYSA-N 0.000 description 1
- FZVZUIBYLZZOEW-UHFFFAOYSA-N 2,5-dimethylbenzenesulfonyl chloride Chemical compound CC1=CC=C(C)C(S(Cl)(=O)=O)=C1 FZVZUIBYLZZOEW-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ABFBQRNCEJBMCX-UHFFFAOYSA-N 3-bromobenzenesulfonyl bromide Chemical compound BrC=1C=C(C=CC1)S(=O)(=O)Br ABFBQRNCEJBMCX-UHFFFAOYSA-N 0.000 description 1
- GIOGAGOTZWZCLF-UHFFFAOYSA-N 3-ethyl-4-nitro-1H-indole Chemical compound C(C)C1=CNC2=CC=CC(=C12)[N+](=O)[O-] GIOGAGOTZWZCLF-UHFFFAOYSA-N 0.000 description 1
- MYLQPXGXHOIHNJ-UHFFFAOYSA-N 3-ethyl-6-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2C(CC)=CNC2=C1 MYLQPXGXHOIHNJ-UHFFFAOYSA-N 0.000 description 1
- BFXHJFKKRGVUMU-UHFFFAOYSA-N 4-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C=C1 BFXHJFKKRGVUMU-UHFFFAOYSA-N 0.000 description 1
- DTJVECUKADWGMO-UHFFFAOYSA-N 4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1 DTJVECUKADWGMO-UHFFFAOYSA-N 0.000 description 1
- LAVZKLJDKGRZJG-UHFFFAOYSA-N 4-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=CC2=C1C=CN2 LAVZKLJDKGRZJG-UHFFFAOYSA-N 0.000 description 1
- PSWCIARYGITEOY-UHFFFAOYSA-N 6-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2C=CNC2=C1 PSWCIARYGITEOY-UHFFFAOYSA-N 0.000 description 1
- QVGKPBGCQAGWMS-UHFFFAOYSA-N 6-nitro-2-propyl-1h-indole Chemical compound C1=C([N+]([O-])=O)C=C2NC(CCC)=CC2=C1 QVGKPBGCQAGWMS-UHFFFAOYSA-N 0.000 description 1
- LZJGQIVWUKFTRD-UHFFFAOYSA-N 7-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=CC2=C1NC=C2 LZJGQIVWUKFTRD-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- AMHAQOBUZCQMHN-UHFFFAOYSA-N Indo-1 dye Chemical compound CC1=CC=C(N(CC(O)=O)CC(O)=O)C(OCCOC=2C(=CC=C(C=2)C=2NC3=CC(=CC=C3C=2)C(O)=O)N(CC(O)=O)CC(O)=O)=C1 AMHAQOBUZCQMHN-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- DLDCRPNPVZHBOJ-UHFFFAOYSA-N N-(1H-indol-4-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=C2C=CNC2=CC=C1 DLDCRPNPVZHBOJ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- ZJXZSIYSNXKHEA-UHFFFAOYSA-N ethyl dihydrogen phosphate Chemical compound CCOP(O)(O)=O ZJXZSIYSNXKHEA-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- GLAYOWOSUNHQKY-UHFFFAOYSA-N n-(1h-indol-2-yl)ethanesulfonamide Chemical compound C1=CC=C2NC(NS(=O)(=O)CC)=CC2=C1 GLAYOWOSUNHQKY-UHFFFAOYSA-N 0.000 description 1
- ZALHYHBETCQBJX-UHFFFAOYSA-N n-(1h-indol-5-yl)-4-methylbenzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC=C(NC=C2)C2=C1 ZALHYHBETCQBJX-UHFFFAOYSA-N 0.000 description 1
- MEWQFKSUHJZGCA-UHFFFAOYSA-N n-(1h-indol-7-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=CC2=C1NC=C2 MEWQFKSUHJZGCA-UHFFFAOYSA-N 0.000 description 1
- MENMMRPCCZJATM-UHFFFAOYSA-N n-(2-methyl-1h-indol-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C2NC(C)=CC2=C1 MENMMRPCCZJATM-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- DASJFYAPNPUBGG-UHFFFAOYSA-N naphthalene-1-sulfonyl chloride Chemical compound C1=CC=C2C(S(=O)(=O)Cl)=CC=CC2=C1 DASJFYAPNPUBGG-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US492836A US3297717A (en) | 1965-10-04 | 1965-10-04 | Sulfonamido indole derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1620033A1 true DE1620033A1 (de) | 1970-04-16 |
Family
ID=23957830
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661620033 Pending DE1620033A1 (de) | 1965-10-04 | 1966-10-03 | Verfahren zur Herstellung von Sulfonamidoindolen |
Country Status (4)
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4428962A (en) | 1981-10-30 | 1984-01-31 | Schering Corporation | Indoles in treatment of peptic ulcers |
-
1965
- 1965-10-04 US US492836A patent/US3297717A/en not_active Expired - Lifetime
-
1966
- 1966-09-30 GB GB43908/66A patent/GB1135859A/en not_active Expired
- 1966-10-03 DE DE19661620033 patent/DE1620033A1/de active Pending
- 1966-10-04 FR FR78721A patent/FR5773M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1135859A (en) | 1968-12-04 |
| FR5773M (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1968-02-05 |
| US3297717A (en) | 1967-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461604C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| US2778824A (en) | Basic alkoxyalkyl esters of phenothiazine-10-carboxylic acid | |
| DE1620033A1 (de) | Verfahren zur Herstellung von Sulfonamidoindolen | |
| DE1593728A1 (de) | Verfahren zur Herstellung von substituierten Amidinen | |
| DE1670552A1 (de) | Verfahren zur Herstellung von in 5,5-Stellung zweifach substituierten 1-Sulfonylhydantoinen | |
| DE1695092C3 (de) | N-(4-Sulfonamidophenyl)-a-alkylsuccin!mideund deren Salze mit Basen, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| DE1150077B (de) | Verfahren zur Herstellung von Mono- und Diacylferrocenen | |
| DE2823712C2 (de) | Verfahren zur Herstellung von Pleuromutilin-Derivaten | |
| EP0001098B1 (de) | Verfahren zur Herstellung von Morpholino-dithio-thiazolen | |
| DE1695176A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE938017C (de) | Verfahren zur Herstellung von quaternaeren Ammoniumsalzen von 4-Amino-2-(tert.-amino-alkoxy)-benzoesaeurealkylestern | |
| AT240373B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1793731C3 (de) | 5-Chlor-2-(hydroxyamino-acetamino)benzophenon | |
| DE2210121A1 (de) | Indole, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1122070C2 (de) | Verfahren zur Herstellung von diuretisch wirksamen Disulfamylanilinverbindungen | |
| EP0480006A1 (de) | Verfahren zur herstellung von gramin-derivaten | |
| DE951270C (de) | Verfahren zur Reinigung von bis-quaternaeren Ammoniumsalzen | |
| DE1695222A1 (de) | Verfahren zur Herstellung von Benzazepinopyridoindolderivaten | |
| DE2518516C3 (de) | 2-(3,45-Trimethoxybenzyl)-3,4-dimethylpyridin | |
| AT250342B (de) | Verfahren zur Herstellung von neuen Derivaten des 1-Phenyl-2, 3-dimethyl-4-amino-pyrazolons-(5) | |
| AT240365B (de) | Verfahren zur Herstellung von neuen Sulfonamidderivaten und von deren Salzen | |
| DE926848C (de) | Verfahren zur Herstellung von Derivaten des Cumarans | |
| AT260916B (de) | Verfahren zur Herstellung von neuen α-(Aminoalkoxyphenyl)-α'-nitrostilbenen und deren Säureadditionssalzen bzw. quaternären Ammoniumverbindungen | |
| DE804572C (de) | Verfahren zur Herstellung von Sulfensaeurehalogeniden | |
| AT266838B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten |