DE1617171C3 - - Google Patents
Info
- Publication number
- DE1617171C3 DE1617171C3 DE19661617171 DE1617171A DE1617171C3 DE 1617171 C3 DE1617171 C3 DE 1617171C3 DE 19661617171 DE19661617171 DE 19661617171 DE 1617171 A DE1617171 A DE 1617171A DE 1617171 C3 DE1617171 C3 DE 1617171C3
- Authority
- DE
- Germany
- Prior art keywords
- detergent
- component
- mixture
- sulfonate
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003599 detergent Substances 0.000 claims description 121
- 239000000203 mixture Substances 0.000 claims description 113
- 150000001875 compounds Chemical class 0.000 claims description 41
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 11
- 239000011734 sodium Substances 0.000 description 91
- 125000004432 carbon atom Chemical group C* 0.000 description 55
- 229910052799 carbon Inorganic materials 0.000 description 52
- 150000001721 carbon Chemical group 0.000 description 41
- 239000006260 foam Substances 0.000 description 33
- 101150065749 Churc1 gene Proteins 0.000 description 25
- 102100038239 Protein Churchill Human genes 0.000 description 25
- -1 alkyl radical Chemical class 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 23
- 150000003839 salts Chemical class 0.000 description 22
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 21
- 244000060011 Cocos nucifera Species 0.000 description 18
- 235000013162 Cocos nucifera Nutrition 0.000 description 18
- 230000002195 synergetic effect Effects 0.000 description 18
- 238000005406 washing Methods 0.000 description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 15
- 125000000217 alkyl group Chemical group 0.000 description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 15
- 229910052708 sodium Inorganic materials 0.000 description 14
- 238000005187 foaming Methods 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Natural products CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 150000001336 alkenes Chemical class 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- 238000004851 dishwashing Methods 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 9
- 150000007824 aliphatic compounds Chemical class 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 150000002191 fatty alcohols Chemical class 0.000 description 8
- 230000006872 improvement Effects 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000004615 ingredient Substances 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- 150000003512 tertiary amines Chemical class 0.000 description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- 239000011591 potassium Substances 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 239000003752 hydrotrope Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 159000000001 potassium salts Chemical class 0.000 description 5
- SIDULKZCBGMXJL-UHFFFAOYSA-N 1-dimethylphosphoryldodecane Chemical compound CCCCCCCCCCCCP(C)(C)=O SIDULKZCBGMXJL-UHFFFAOYSA-N 0.000 description 4
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 4
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 4
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000003513 alkali Substances 0.000 description 3
- 150000003868 ammonium compounds Chemical class 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 239000003605 opacifier Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 3
- DDGPBVIAYDDWDH-UHFFFAOYSA-N 3-[dodecyl(dimethyl)azaniumyl]-2-hydroxypropane-1-sulfonate Chemical compound CCCCCCCCCCCC[N+](C)(C)CC(O)CS([O-])(=O)=O DDGPBVIAYDDWDH-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000000656 azaniumyl group Chemical group [H][N+]([H])([H])[*] 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 229940096386 coconut alcohol Drugs 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000001605 fetal effect Effects 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- ONHFWHCMZAJCFB-UHFFFAOYSA-N myristamine oxide Chemical compound CCCCCCCCCCCCCC[N+](C)(C)[O-] ONHFWHCMZAJCFB-UHFFFAOYSA-N 0.000 description 2
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- KCXFHTAICRTXLI-UHFFFAOYSA-M propane-1-sulfonate Chemical compound CCCS([O-])(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-M 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- QUCDWLYKDRVKMI-UHFFFAOYSA-M sodium;3,4-dimethylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1C QUCDWLYKDRVKMI-UHFFFAOYSA-M 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 2
- CXRUQTPIHDKFTG-UHFFFAOYSA-N 1-diethylphosphoryldodecane Chemical compound CCCCCCCCCCCCP(=O)(CC)CC CXRUQTPIHDKFTG-UHFFFAOYSA-N 0.000 description 1
- BQLLFEURQGITEW-UHFFFAOYSA-N 1-diethylphosphoryltetradecane Chemical compound CCCCCCCCCCCCCCP(=O)(CC)CC BQLLFEURQGITEW-UHFFFAOYSA-N 0.000 description 1
- LASQDSJQFSPIIB-UHFFFAOYSA-N 2-(2-aminoethylamino)ethanol;potassium Chemical compound [K].NCCNCCO LASQDSJQFSPIIB-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- HSXUNHYXJWDLDK-UHFFFAOYSA-M 2-hydroxypropane-1-sulfonate Chemical compound CC(O)CS([O-])(=O)=O HSXUNHYXJWDLDK-UHFFFAOYSA-M 0.000 description 1
- BEIMJWMYOIDTCA-UHFFFAOYSA-N 3-[bis(2-hydroxyethyl)-tetradecylazaniumyl]-2-hydroxypropane-1-sulfonate Chemical compound CCCCCCCCCCCCCC[N+](CCO)(CCO)CC(O)CS([O-])(=O)=O BEIMJWMYOIDTCA-UHFFFAOYSA-N 0.000 description 1
- MOMKYJPSVWEWPM-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-methylphenyl)-1,3-thiazole Chemical compound C1=CC(C)=CC=C1C1=NC(CCl)=CS1 MOMKYJPSVWEWPM-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- IRFUGFIHKBVUQA-UHFFFAOYSA-N C(C)[N+](CCCCCCCCCCCCCC)(CC)CC(CS(=O)(=O)[O-])O Chemical compound C(C)[N+](CCCCCCCCCCCCCC)(CC)CC(CS(=O)(=O)[O-])O IRFUGFIHKBVUQA-UHFFFAOYSA-N 0.000 description 1
- GOEYUSNHVGNMKF-UHFFFAOYSA-N C(CCCCCCCCCCCCC)P(C)(C)=O.C(CCCCCCCCCCC)P(C)(C)=O Chemical compound C(CCCCCCCCCCCCC)P(C)(C)=O.C(CCCCCCCCCCC)P(C)(C)=O GOEYUSNHVGNMKF-UHFFFAOYSA-N 0.000 description 1
- QJLSEIOOTUNAPE-UHFFFAOYSA-N CCCCCCCCCCCC[N+](CCO)(CCO)CC(CS([O-])(=O)=O)O Chemical compound CCCCCCCCCCCC[N+](CCO)(CCO)CC(CS([O-])(=O)=O)O QJLSEIOOTUNAPE-UHFFFAOYSA-N 0.000 description 1
- NZNMSOFKMUBTKW-UHFFFAOYSA-N Cyclohexanecarboxylic acid Natural products OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- FPVVYTCTZKCSOJ-UHFFFAOYSA-N Ethylene glycol distearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCCOC(=O)CCCCCCCCCCCCCCCCC FPVVYTCTZKCSOJ-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical class OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 1
- UJHYZJSRAHZNFM-UHFFFAOYSA-N O=P1OCCOP(=O)O1 Chemical class O=P1OCCOP(=O)O1 UJHYZJSRAHZNFM-UHFFFAOYSA-N 0.000 description 1
- HWZUDASOMGNLSM-UHFFFAOYSA-N O=P1OCOP(=O)O1 Chemical class O=P1OCOP(=O)O1 HWZUDASOMGNLSM-UHFFFAOYSA-N 0.000 description 1
- 244000218514 Opuntia robusta Species 0.000 description 1
- 235000003166 Opuntia robusta Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FZQSLXQPHPOTHG-UHFFFAOYSA-N [K+].[K+].O1B([O-])OB2OB([O-])OB1O2 Chemical compound [K+].[K+].O1B([O-])OB2OB([O-])OB1O2 FZQSLXQPHPOTHG-UHFFFAOYSA-N 0.000 description 1
- GPFIZJURHXINSQ-UHFFFAOYSA-N acetic acid;nitric acid Chemical compound CC(O)=O.O[N+]([O-])=O GPFIZJURHXINSQ-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000002009 alkene group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical class 0.000 description 1
- 239000013566 allergen Substances 0.000 description 1
- 230000002009 allergenic effect Effects 0.000 description 1
- AFVLVVWMAFSXCK-VMPITWQZSA-N alpha-cyano-4-hydroxycinnamic acid Chemical group OC(=O)C(\C#N)=C\C1=CC=C(O)C=C1 AFVLVVWMAFSXCK-VMPITWQZSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003254 anti-foaming effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- VNNRSPGTAMTISX-UHFFFAOYSA-N chromium nickel Chemical compound [Cr].[Ni] VNNRSPGTAMTISX-UHFFFAOYSA-N 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 230000003165 hydrotropic effect Effects 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 1
- 229940102859 methylene diphosphonate Drugs 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- OGGIFKYAUCDPFX-UHFFFAOYSA-N n,n-diethyldodecan-1-amine oxide Chemical compound CCCCCCCCCCCC[N+]([O-])(CC)CC OGGIFKYAUCDPFX-UHFFFAOYSA-N 0.000 description 1
- FQLPOSCSKORVRF-UHFFFAOYSA-N n,n-diethyltetradecan-1-amine oxide Chemical compound CCCCCCCCCCCCCC[N+]([O-])(CC)CC FQLPOSCSKORVRF-UHFFFAOYSA-N 0.000 description 1
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 229910001120 nichrome Inorganic materials 0.000 description 1
- 238000010653 organometallic reaction Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical group P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229940068041 phytic acid Drugs 0.000 description 1
- 235000002949 phytic acid Nutrition 0.000 description 1
- 239000000467 phytic acid Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- GHKGUEZUGFJUEJ-UHFFFAOYSA-M potassium;4-methylbenzenesulfonate Chemical compound [K+].CC1=CC=C(S([O-])(=O)=O)C=C1 GHKGUEZUGFJUEJ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007342 radical addition reaction Methods 0.000 description 1
- 229940065287 selenium compound Drugs 0.000 description 1
- 150000003343 selenium compounds Chemical class 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019983 sodium metaphosphate Nutrition 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 239000008234 soft water Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- MDDUHVRJJAFRAU-YZNNVMRBSA-N tert-butyl-[(1r,3s,5z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane Chemical group C1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C(=C)\C1=C/CP(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 MDDUHVRJJAFRAU-YZNNVMRBSA-N 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 125000005208 trialkylammonium group Chemical group 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- JEVFKQIDHQGBFB-UHFFFAOYSA-K tripotassium;2-[bis(carboxylatomethyl)amino]acetate Chemical compound [K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O JEVFKQIDHQGBFB-UHFFFAOYSA-K 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- WFFYGHLDPIIKDT-UHFFFAOYSA-N undecylsulfinylmethanol Chemical compound C(CCCCCCCCCC)S(=O)CO WFFYGHLDPIIKDT-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- GDJZZWYLFXAGFH-UHFFFAOYSA-M xylenesulfonate group Chemical group C1(C(C=CC=C1)C)(C)S(=O)(=O)[O-] GDJZZWYLFXAGFH-UHFFFAOYSA-M 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42300865A | 1965-01-04 | 1965-01-04 | |
| US42300865 | 1965-01-04 | ||
| DEP0038480 | 1966-01-03 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1617171A1 DE1617171A1 (cg-RX-API-DMAC10.html) | 1971-02-18 |
| DE1617171B2 DE1617171B2 (de) | 1975-07-24 |
| DE1617171C3 true DE1617171C3 (cg-RX-API-DMAC10.html) | 1976-03-04 |
Family
ID=23677316
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1617171A Granted DE1617171B2 (de) | 1965-01-04 | 1966-01-03 | Detergensmischung |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3332875A (cg-RX-API-DMAC10.html) |
| AT (1) | AT289271B (cg-RX-API-DMAC10.html) |
| BE (1) | BE674727A (cg-RX-API-DMAC10.html) |
| CA (1) | CA787878A (cg-RX-API-DMAC10.html) |
| CH (1) | CH480431A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1617171B2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK123781B (cg-RX-API-DMAC10.html) |
| FI (1) | FI48198C (cg-RX-API-DMAC10.html) |
| FR (1) | FR1481956A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1073762A (cg-RX-API-DMAC10.html) |
| NL (1) | NL6517236A (cg-RX-API-DMAC10.html) |
| SE (1) | SE341861B (cg-RX-API-DMAC10.html) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4088612A (en) * | 1968-08-15 | 1978-05-09 | Lever Brothers Company | Detergent compositions |
| US3975338A (en) * | 1972-06-30 | 1976-08-17 | Kanegafuchi Chemical Industries Co., Ltd. | Process of producing vinyl chloride polymers |
| US4064076A (en) * | 1973-04-09 | 1977-12-20 | Colgate-Palmolive | Olefin sulfonate detergent compositions |
| US4133779A (en) * | 1975-01-06 | 1979-01-09 | The Procter & Gamble Company | Detergent composition containing semi-polar nonionic detergent and alkaline earth metal anionic detergent |
| CA1052223A (en) * | 1975-01-06 | 1979-04-10 | David S. Lambert | Detergent composition containing semi-polar nonionic detergent and alkaline earth metal anionic detergent |
| JPS5655498A (en) * | 1979-10-11 | 1981-05-16 | Lion Corp | Detergent composition |
| JPS6024836B2 (ja) * | 1979-10-29 | 1985-06-14 | ライオン株式会社 | 固型洗浄剤組成物 |
| US4554098A (en) * | 1982-02-19 | 1985-11-19 | Colgate-Palmolive Company | Mild liquid detergent compositions |
| US4599188A (en) * | 1982-04-26 | 1986-07-08 | The Procter & Gamble Company | Foaming surfactant compositions |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2061620A (en) * | 1936-11-24 | Sulphonated derivatives of aliphat | ||
| US2061618A (en) * | 1936-11-24 | Sulphonated hydrocarbon | ||
| US2061617A (en) * | 1936-11-24 | Stllphonic acid derivatives of aii | ||
| US2477383A (en) * | 1946-12-26 | 1949-07-26 | California Research Corp | Sulfonated detergent and its method of preparation |
| NL250070A (cg-RX-API-DMAC10.html) * | 1959-04-01 | |||
| US3346629A (en) * | 1963-08-15 | 1967-10-10 | Monsanto Co | Process for preparing beta-ethylenically unsaturated organic sulfonates |
-
0
- CA CA787878A patent/CA787878A/en not_active Expired
-
1965
- 1965-12-23 US US524364A patent/US3332875A/en not_active Expired - Lifetime
- 1965-12-30 SE SE16999/65A patent/SE341861B/xx unknown
- 1965-12-31 NL NL6517236A patent/NL6517236A/xx unknown
-
1966
- 1966-01-03 FR FR44682A patent/FR1481956A/fr not_active Expired
- 1966-01-03 DE DE1617171A patent/DE1617171B2/de active Granted
- 1966-01-03 CH CH166A patent/CH480431A/de not_active IP Right Cessation
- 1966-01-04 GB GB395/66A patent/GB1073762A/en not_active Expired
- 1966-01-04 FI FI660012A patent/FI48198C/fi active
- 1966-01-04 BE BE674727D patent/BE674727A/xx unknown
- 1966-01-04 DK DK2766AA patent/DK123781B/da unknown
- 1966-01-04 AT AT6566A patent/AT289271B/de not_active IP Right Cessation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4331297A1 (de) | Stückseifen | |
| EP1064349A2 (de) | Wässriges mehrphasiges reinigungsmittel | |
| DE69111436T2 (de) | Zusammensetzungen von flüssigen, milden geschirrspülmitteln. | |
| CH654325A5 (de) | Phosphobetain- bzw. phosphitain-haltige reinigungs- und waschmittel. | |
| EP0664830B1 (de) | Wässrige detergensgemische | |
| CH671026A5 (cg-RX-API-DMAC10.html) | ||
| DE1617171C3 (cg-RX-API-DMAC10.html) | ||
| DE2525775A1 (de) | Schaumbildendes und konditionierendes mittel | |
| DE19811386A1 (de) | Wäßriges mehrphasiges Reinigungsmittel | |
| EP0666898A1 (de) | Verfahren zur herstellung wä riger lösungen anionischer tenside mit verbesserter kältestabilität. | |
| DE2317076C2 (de) | Geschirrspülmittel | |
| DE1617171B2 (de) | Detergensmischung | |
| DE1812534A1 (de) | Reinigungsmittel fuer harte Oberflaechen | |
| DE1543232C3 (de) | Verfahren zur Herstellung eines biochemisch zersetzbaren Gemisches oderflächenaktiver Alkylsulfate | |
| DE1617185B2 (de) | Waschmittel | |
| DE1617171C (de) | Detergensmischung | |
| DE1617170C3 (de) | Detergensmischung | |
| DE1793510B2 (de) | Detergentienpräparat | |
| DE2642116C2 (de) | Verfahren zur Herstellung einer homogenen flüssigen Hochleistungsreinigungsmittelzubereitung und diese nach diesem Verfahren hergestellten Reinigungsmittelzubereitungen | |
| DE1792163A1 (de) | Detergenzzusammensetzungen | |
| WO1997005223A1 (de) | Wässrige tensidmischung | |
| DE1518087C3 (de) | Tertiäre Aminoxide und deren Verwendung als Waschmittel | |
| DE3132219A1 (de) | Verwendung eines sulfobetaine und quartaere ammoniumalkensulfonate enthaltenden tensidgemisches in fluessig-waschmitteln | |
| DE2402520A1 (de) | Schaumbildendes und konditionierendes detergensgemisch | |
| DE2421925A1 (de) | Geschirrspuelmittelzusammensetzung |