DE1594877C3 - Bleichmittel - Google Patents
BleichmittelInfo
- Publication number
- DE1594877C3 DE1594877C3 DE1594877A DE1594877A DE1594877C3 DE 1594877 C3 DE1594877 C3 DE 1594877C3 DE 1594877 A DE1594877 A DE 1594877A DE 1594877 A DE1594877 A DE 1594877A DE 1594877 C3 DE1594877 C3 DE 1594877C3
- Authority
- DE
- Germany
- Prior art keywords
- bleaching
- sodium
- activator
- detergent
- transition metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007844 bleaching agent Substances 0.000 title claims description 21
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 claims description 38
- 239000012190 activator Substances 0.000 claims description 30
- 239000003599 detergent Substances 0.000 claims description 27
- 239000002738 chelating agent Substances 0.000 claims description 20
- 238000004061 bleaching Methods 0.000 claims description 18
- 229940081066 picolinic acid Drugs 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 13
- -1 Transition metal salt Chemical class 0.000 claims description 12
- 229910052723 transition metal Inorganic materials 0.000 claims description 11
- 150000003624 transition metals Chemical class 0.000 claims description 10
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 claims description 8
- 238000005406 washing Methods 0.000 claims description 8
- 230000009918 complex formation Effects 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 4
- 239000012459 cleaning agent Substances 0.000 claims description 3
- 150000001879 copper Chemical class 0.000 claims description 3
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 239000004615 ingredient Substances 0.000 claims description 2
- 229910052748 manganese Inorganic materials 0.000 claims description 2
- 239000011572 manganese Substances 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 36
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 13
- 230000000694 effects Effects 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 11
- 229940077388 benzenesulfonate Drugs 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 238000002310 reflectometry Methods 0.000 description 10
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical compound N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 229960001922 sodium perborate Drugs 0.000 description 9
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- UMHTVKGNHVUENZ-UHFFFAOYSA-N n,n',n'-triacetylacetohydrazide Chemical compound CC(=O)N(C(C)=O)N(C(C)=O)C(C)=O UMHTVKGNHVUENZ-UHFFFAOYSA-N 0.000 description 8
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 6
- 229910000365 copper sulfate Inorganic materials 0.000 description 6
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 6
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 4
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 4
- 229910021645 metal ion Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- RVJVIJWVARVDEJ-UHFFFAOYSA-L cobalt(2+);1,10-phenanthroline;dichloride Chemical compound [Cl-].[Cl-].[Co+2].C1=CN=C2C3=NC=CC=C3C=CC2=C1 RVJVIJWVARVDEJ-UHFFFAOYSA-L 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- NWPMTMCXJZTLSO-UHFFFAOYSA-M sodium;4-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 NWPMTMCXJZTLSO-UHFFFAOYSA-M 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 239000001856 Ethyl cellulose Substances 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Chemical compound OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229920001249 ethyl cellulose Polymers 0.000 description 2
- 235000019325 ethyl cellulose Nutrition 0.000 description 2
- 235000003891 ferrous sulphate Nutrition 0.000 description 2
- 239000011790 ferrous sulphate Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 2
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- 229940099596 manganese sulfate Drugs 0.000 description 2
- 235000007079 manganese sulphate Nutrition 0.000 description 2
- 239000011702 manganese sulphate Substances 0.000 description 2
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 2
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- JPSKCQCQZUGWNM-UHFFFAOYSA-N 2,7-Oxepanedione Chemical compound O=C1CCCCC(=O)O1 JPSKCQCQZUGWNM-UHFFFAOYSA-N 0.000 description 1
- LAZUHOPLTJOKNS-UHFFFAOYSA-N 2-(2-chloroacetyl)oxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC(=O)CCl LAZUHOPLTJOKNS-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- LTUUGSGSUZRPRV-UHFFFAOYSA-N 6-methylpyridine-2-carboxylic acid Chemical compound CC1=CC=CC(C(O)=O)=N1 LTUUGSGSUZRPRV-UHFFFAOYSA-N 0.000 description 1
- BJZLNMXZKIZLAW-UHFFFAOYSA-N C1CO1.[Na] Chemical compound C1CO1.[Na] BJZLNMXZKIZLAW-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 229920003123 carboxymethyl cellulose sodium Polymers 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 229940063834 carboxymethylcellulose sodium Drugs 0.000 description 1
- 238000003421 catalytic decomposition reaction Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 1
- 229940044175 cobalt sulfate Drugs 0.000 description 1
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- GYAJYVWLRPABNA-UHFFFAOYSA-L dichlorocobalt 2-pyridin-2-ylpyridine Chemical compound N1=C(C=CC=C1)C1=NC=CC=C1.[Co](Cl)Cl GYAJYVWLRPABNA-UHFFFAOYSA-L 0.000 description 1
- SPCNPOWOBZQWJK-UHFFFAOYSA-N dimethoxy-(2-propan-2-ylsulfanylethylsulfanyl)-sulfanylidene-$l^{5}-phosphane Chemical compound COP(=S)(OC)SCCSC(C)C SPCNPOWOBZQWJK-UHFFFAOYSA-N 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- NDORGWUNFGHGKU-UHFFFAOYSA-N dodecanoic acid;sodium Chemical compound [Na].CCCCCCCCCCCC(O)=O NDORGWUNFGHGKU-UHFFFAOYSA-N 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 238000004453 electron probe microanalysis Methods 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- UFZOPKFMKMAWLU-UHFFFAOYSA-N ethoxy(methyl)phosphinic acid Chemical compound CCOP(C)(O)=O UFZOPKFMKMAWLU-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- LVPMIMZXDYBCDF-UHFFFAOYSA-N isocinchomeronic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)N=C1 LVPMIMZXDYBCDF-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- SFHWWDJQCBOMAW-UHFFFAOYSA-N oxolane-2,5-dione;sodium Chemical compound [Na].O=C1CCC(=O)O1 SFHWWDJQCBOMAW-UHFFFAOYSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- GJAWHXHKYYXBSV-UHFFFAOYSA-N quinolinic acid Chemical compound OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- BOYKIWOLPHVJGW-UHFFFAOYSA-M sodium;4-butanoyloxybenzenesulfonate Chemical compound [Na+].CCCC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 BOYKIWOLPHVJGW-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3932—Inorganic compounds or complexes
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US53078966A | 1966-03-01 | 1966-03-01 | |
| US81610269A | 1969-04-14 | 1969-04-14 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1594877A1 DE1594877A1 (de) | 1971-05-06 |
| DE1594877B2 DE1594877B2 (enExample) | 1974-11-14 |
| DE1594877C3 true DE1594877C3 (de) | 1975-06-26 |
Family
ID=27063371
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1594877A Expired DE1594877C3 (de) | 1966-03-01 | 1967-03-01 | Bleichmittel |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3532634A (enExample) |
| AT (1) | AT277143B (enExample) |
| BE (1) | BE694721A (enExample) |
| CH (1) | CH497595A (enExample) |
| DE (1) | DE1594877C3 (enExample) |
| FR (1) | FR1515338A (enExample) |
| GB (1) | GB1182143A (enExample) |
| NL (1) | NL6703189A (enExample) |
| SE (1) | SE346021B (enExample) |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU61828A1 (enExample) * | 1970-10-07 | 1972-06-28 | ||
| US3919107A (en) * | 1973-03-23 | 1975-11-11 | Procter & Gamble | Built detergent compositions containing dextrin esters of poly carboxylic acids |
| US4395344A (en) * | 1973-05-21 | 1983-07-26 | The Clorox Company | Drain opener composition |
| JPS5313355B2 (enExample) * | 1974-03-18 | 1978-05-09 | ||
| GB1541576A (en) | 1975-06-20 | 1979-03-07 | Procter & Gamble Ltd | Inhibiting dye ltransfer in washing |
| GB1565807A (en) * | 1975-12-18 | 1980-04-23 | Uilever Ltd | Process and compositions for cleaning fabrics |
| US4179390A (en) * | 1976-10-06 | 1979-12-18 | The Procter & Gamble Company | Laundry additive product |
| DE2719235B2 (de) * | 1977-04-29 | 1980-07-17 | Bosch-Siemens Hausgeraete Gmbh, 7000 Stuttgart | Waschverfahren und automatische Waschmaschine zur Durchführung des Waschverfahrens |
| DE2733849A1 (de) * | 1977-07-27 | 1979-02-15 | Basf Ag | Feste kaltbleichaktivatoren fuer aktivsauerstoff abgebende verbindungen enthaltende wasch- und reinigungsmittel |
| US4111651A (en) * | 1977-10-03 | 1978-09-05 | Fmc Corporation | Sulfonic anhydrides in peroxygen bleaching |
| US4115058A (en) * | 1977-10-03 | 1978-09-19 | Fmc Corporation | Aromatic sulfonic anhydrides as peroxygen activators |
| US4133637A (en) * | 1977-10-03 | 1979-01-09 | Fmc Corporation | Oxybis(diacyloxyboranes) as peroxygen activators |
| US4128490A (en) * | 1977-10-03 | 1978-12-05 | Fmc Corporation | Phenyl sulfonate esters as peroxygen activators |
| US4110074A (en) * | 1977-10-03 | 1978-08-29 | Fmc Corporation | Mixed carboxylic/sulfonic anhydrides in peroxygen bleaching |
| US4207070A (en) * | 1978-10-10 | 1980-06-10 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| US4214061A (en) * | 1978-11-03 | 1980-07-22 | The B. F. Goodrich Company | Pressure-sensitive adhesive |
| US4215003A (en) * | 1978-11-20 | 1980-07-29 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| US4202786A (en) * | 1978-12-22 | 1980-05-13 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| US4212757A (en) * | 1978-12-22 | 1980-07-15 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| US4194987A (en) * | 1978-12-26 | 1980-03-25 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| JPS5598750A (en) * | 1979-01-23 | 1980-07-28 | Fuji Photo Film Co Ltd | Photographic bleaching composition |
| GR76237B (enExample) | 1981-08-08 | 1984-08-04 | Procter & Gamble | |
| US4481129A (en) * | 1981-12-23 | 1984-11-06 | Lever Brothers Company | Bleach compositions |
| US4488980A (en) * | 1982-12-17 | 1984-12-18 | Lever Brothers Company | Detergent compositions |
| US4478733A (en) * | 1982-12-17 | 1984-10-23 | Lever Brothers Company | Detergent compositions |
| GB8311865D0 (en) * | 1983-04-29 | 1983-06-02 | Procter & Gamble Ltd | Bleach compositions |
| GB8312185D0 (en) * | 1983-05-04 | 1983-06-08 | Unilever Plc | Bleaching and cleaning composition |
| GB8316760D0 (en) * | 1983-06-20 | 1983-07-20 | Unilever Plc | Detergent bleach compositions |
| GB8316761D0 (en) * | 1983-06-20 | 1983-07-20 | Unilever Plc | Detergent bleach compositions |
| GB8329761D0 (en) * | 1983-11-08 | 1983-12-14 | Unilever Plc | Metal adjuncts |
| GB8329762D0 (en) * | 1983-11-08 | 1983-12-14 | Unilever Plc | Manganese adjuncts |
| NZ210397A (en) * | 1983-12-06 | 1986-11-12 | Unilever Plc | Alkaline built detergent bleach composition containing a peroxide compound and a manganese compound |
| NZ210398A (en) * | 1983-12-06 | 1986-11-12 | Unilever Plc | Detergent bleach composition containing a peroxide compound and a manganese compound |
| GB8405189D0 (en) * | 1984-02-28 | 1984-04-04 | Interox Chemicals Ltd | Peroxide activation |
| CS249980B1 (en) * | 1984-02-29 | 1987-04-16 | Jaroslav Simunek | Laundry agent with bleaching efficiency |
| US4536183A (en) * | 1984-04-09 | 1985-08-20 | Lever Brothers Company | Manganese bleach activators |
| US4601845A (en) * | 1985-04-02 | 1986-07-22 | Lever Brothers Company | Bleaching compositions containing mixed metal cations adsorbed onto aluminosilicate support materials |
| US4623357A (en) * | 1985-04-02 | 1986-11-18 | Lever Brothers Company | Bleach compositions |
| US4711748A (en) * | 1985-12-06 | 1987-12-08 | Lever Brothers Company | Preparation of bleach catalyst aggregates of manganese cation impregnated aluminosilicates by high velocity granulation |
| US4655782A (en) * | 1985-12-06 | 1987-04-07 | Lever Brothers Company | Bleach composition of detergent base powder and agglomerated manganese-alluminosilicate catalyst having phosphate salt distributed therebetween |
| US4731196A (en) * | 1986-10-28 | 1988-03-15 | Ethyl Corporation | Process for making bleach activator |
| GB8629837D0 (en) * | 1986-12-13 | 1987-01-21 | Interox Chemicals Ltd | Bleach activation |
| GB8908416D0 (en) * | 1989-04-13 | 1989-06-01 | Unilever Plc | Bleach activation |
| GB8915781D0 (en) * | 1989-07-10 | 1989-08-31 | Unilever Plc | Bleach activation |
| GB9003741D0 (en) * | 1990-02-19 | 1990-04-18 | Unilever Plc | Bleach activation |
| US5041142A (en) * | 1990-03-23 | 1991-08-20 | Lever Brothers Company, Division Of Conopco Inc. | Peroxymetallates and their use as bleach activating catalysts |
| US5380458A (en) * | 1992-10-02 | 1995-01-10 | Colgate-Palmolive Co. | Stabilized hypohalite compositions |
| AU2614895A (en) * | 1994-06-13 | 1996-01-05 | Unilever N.V. | Bleach activation |
| ES2163006T3 (es) * | 1995-02-02 | 2002-01-16 | Procter & Gamble | Metodo para eliminar manchas de te en lavavajillas automaticos usando composiciones que comprenden catalizadores de cobalto (iii). |
| BR9607008A (pt) * | 1995-02-02 | 1997-10-28 | Procter & Gamble | Composições de lavagem de prato automática compreendendo catalísadores quelatados por cobalto |
| WO1996023859A1 (en) * | 1995-02-02 | 1996-08-08 | The Procter & Gamble Company | Automatic dishwashing compositions comprising cobalt catalysts |
| DE19600159A1 (de) | 1996-01-04 | 1997-07-10 | Hoechst Ag | Bleichmittelsysteme enthaltend Bis- und Tris-(mu-oxo)-di-Mangan-Komplexsalze |
| DE19606343A1 (de) | 1996-02-21 | 1997-08-28 | Hoechst Ag | Bleichmittel |
| KR100470891B1 (ko) * | 1997-12-30 | 2005-06-07 | 주식회사 엘지생활건강 | 망간 착화합물을 함유한 표백세제 조성물 |
| GB0118932D0 (en) * | 2001-08-02 | 2001-09-26 | Unilever Plc | Improvements relating to laundry compositions |
| US7476333B2 (en) * | 2005-06-22 | 2009-01-13 | Truox, Inc. | Composition and method for reducing chemical oxygen demand in water |
| US7794607B2 (en) * | 2005-06-22 | 2010-09-14 | Truox, Inc. | Composition and method for enhanced sanitation and oxidation of aqueous systems |
| US7695631B2 (en) * | 2005-06-22 | 2010-04-13 | Truox, Inc. | Composition and method for reducing chemical oxygen demand in water |
| US7572390B2 (en) * | 2005-06-22 | 2009-08-11 | Truox, Inc. | Composition and method for reducing chemical oxygen demand in water |
| JP5401034B2 (ja) * | 2007-12-19 | 2014-01-29 | ライオン株式会社 | 漂白助剤、および該漂白助剤を含有する漂白助剤粒子 |
| JP5150237B2 (ja) * | 2007-12-19 | 2013-02-20 | ライオン株式会社 | 殺菌・除菌用酸化触媒、および該触媒を含有する殺菌・除菌用酸化触媒粒子 |
| DE102008038376A1 (de) * | 2008-08-19 | 2010-02-25 | Clariant International Ltd. | Verfahren zur Herstellung von 3,7-Diaza-bicyclo[3.3.1]nonan-Verbindungen |
| DE102008045207A1 (de) * | 2008-08-30 | 2010-03-04 | Clariant International Limited | Bleichkatalysatormischungen bestehend aus Mangansalzen und Oxalsäure oder deren Salze |
| DE102008045215A1 (de) * | 2008-08-30 | 2010-03-04 | Clariant International Ltd. | Verwendung von Mangan-Oxalatenn als Bleichkatalysatoren |
| DE102008064009A1 (de) | 2008-12-19 | 2010-06-24 | Clariant International Ltd. | Verfahren zur Herstellung von 3,7-Diaza-bicyclo[3.3.1]nonan-Metall-Komplexen |
| EP3677665B1 (en) * | 2019-01-04 | 2021-05-05 | Henkel AG & Co. KGaA | Detergents, especially dishwashing detergents, comprising salicylidene-serine |
| EP3677664B1 (en) * | 2019-01-04 | 2021-05-19 | Henkel AG & Co. KGaA | Non-enzymatic removal of proteinaceous soils |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB855735A (en) * | 1958-05-09 | 1960-12-07 | Unilever Ltd | Bleaching processes and compositions |
| CA678942A (en) * | 1959-06-19 | 1964-01-28 | U. Kloosterman Cornelis | Process for the preparation of a washing and/or bleaching agent |
| BE614629A (enExample) * | 1961-03-24 | |||
| US3156654A (en) * | 1961-06-19 | 1964-11-10 | Shell Oil Co | Bleaching |
| US3332882A (en) * | 1964-12-18 | 1967-07-25 | Fmc Corp | Peroxygen compositions |
| CA793720A (en) * | 1964-12-28 | 1968-09-03 | G. Mackellar Donald | Peroxygen compositions |
-
1967
- 1967-02-21 GB GB8253/67A patent/GB1182143A/en not_active Expired
- 1967-02-27 BE BE694721D patent/BE694721A/xx unknown
- 1967-02-28 NL NL6703189A patent/NL6703189A/xx unknown
- 1967-02-28 AT AT194267A patent/AT277143B/de not_active IP Right Cessation
- 1967-03-01 CH CH297867A patent/CH497595A/de not_active IP Right Cessation
- 1967-03-01 DE DE1594877A patent/DE1594877C3/de not_active Expired
- 1967-03-01 SE SE2829/67A patent/SE346021B/xx unknown
- 1967-03-01 FR FR97007A patent/FR1515338A/fr not_active Expired
-
1969
- 1969-04-14 US US816102A patent/US3532634A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AT277143B (de) | 1969-12-10 |
| NL6703189A (enExample) | 1967-09-04 |
| CH497595A (de) | 1970-10-15 |
| DE1594877B2 (enExample) | 1974-11-14 |
| US3532634A (en) | 1970-10-06 |
| GB1182143A (en) | 1970-02-25 |
| BE694721A (enExample) | 1967-08-28 |
| FR1515338A (fr) | 1968-03-01 |
| DE1594877A1 (de) | 1971-05-06 |
| SE346021B (enExample) | 1972-06-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1594877C3 (de) | Bleichmittel | |
| DE69014384T2 (de) | Bleichaktivierung. | |
| DE69222620T2 (de) | Bleichaktivierung unter Verwendung einer Mangan- verbindung und einem organischen Ligand | |
| DE69827738T2 (de) | Bleichaktivierung | |
| DE2657043C2 (enExample) | ||
| DE69021129T2 (de) | Bleichaktivierung und Bleichmittel-Zusammensetzungen. | |
| DE69125310T2 (de) | Bleichmittelaktivierung | |
| DE3885956T2 (de) | Zusammensetzung von Bleich-Aktivatoren. | |
| DE69434227T3 (de) | Durchsichtige, isotrope, wässrige Bleichmittelzusammensetzung | |
| DE2450524A1 (de) | Schaeumende bleichmittelmischung | |
| DE4416438A1 (de) | Ein- oder mehrkernige Metall-Komplexe und ihre Verwendung als Bleich- und Oxidationskatalysatoren | |
| DE2652424C2 (de) | Peroxysäuren und ihre Verwendung | |
| DE2054019A1 (en) | Bleaching detergent | |
| DE2422735A1 (de) | Bleichmittel und verwendung desselben zum bleichen von textilien | |
| DE1792377A1 (de) | Reinigungsmittel fuer Zahnprothesen | |
| AT394864B (de) | Im wesentlichen wasserfreies, fluessiges grobwaschmittel und verfahren zu seiner herstellung | |
| DE2226779A1 (de) | Quartare Ammoniumslaze und ihre Ver wendung in Wasch und Bleichmitteln | |
| DE2652423A1 (de) | Bleich- oder reinigungsmittel und verfahren zum bleichen und/oder reinigen | |
| CH655945A5 (de) | Silikatfreie, bleichende waschmittelzusammensetzung. | |
| DE2530539C3 (de) | Addukt aus Natriumsulfat, Wasserstoffperoxyd und Natriumchlorid und dessen Verwendung | |
| DE2910403A1 (de) | Bleichmittel | |
| DE3540933A1 (de) | Verfahren zum bleichen von haushaltswaesche in einem haushalts-waschzyklus | |
| DE2128945A1 (de) | Bleichmittel | |
| DE2510184A1 (de) | Schaeumende bleichmittelmischung | |
| DE2536283B2 (de) | Verfahren zur Herstellung von Natrium-percarboant mit hohem spezifischen Volumen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EHJ | Ceased/non-payment of the annual fee |