DE1593412C3 - Verfahren zur kontinuierlichen Herstellung von Isocyansäureestern - Google Patents
Verfahren zur kontinuierlichen Herstellung von IsocyansäureesternInfo
- Publication number
- DE1593412C3 DE1593412C3 DE1593412A DE1593412A DE1593412C3 DE 1593412 C3 DE1593412 C3 DE 1593412C3 DE 1593412 A DE1593412 A DE 1593412A DE 1593412 A DE1593412 A DE 1593412A DE 1593412 C3 DE1593412 C3 DE 1593412C3
- Authority
- DE
- Germany
- Prior art keywords
- phosgene
- column
- pressure
- isocyanate
- hydrogen chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 29
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical class N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 title claims description 4
- 238000010924 continuous production Methods 0.000 title claims description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 84
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 46
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 39
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 39
- 239000012948 isocyanate Substances 0.000 claims description 39
- 150000002513 isocyanates Chemical class 0.000 claims description 39
- 238000006243 chemical reaction Methods 0.000 claims description 33
- 239000003085 diluting agent Substances 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 24
- 150000001412 amines Chemical class 0.000 claims description 20
- 239000007789 gas Substances 0.000 claims description 20
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 claims description 14
- 239000011541 reaction mixture Substances 0.000 claims description 13
- 238000000354 decomposition reaction Methods 0.000 claims description 10
- 238000004821 distillation Methods 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 8
- 238000001816 cooling Methods 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 2
- 238000010992 reflux Methods 0.000 claims description 2
- 239000012267 brine Substances 0.000 claims 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 claims 1
- 239000007788 liquid Substances 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- 239000012071 phase Substances 0.000 description 6
- 238000011084 recovery Methods 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000010494 dissociation reaction Methods 0.000 description 4
- 230000005593 dissociations Effects 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 4
- SQCZQTSHSZLZIQ-UHFFFAOYSA-N 1-chloropentane Chemical compound CCCCCCl SQCZQTSHSZLZIQ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- JLVWYWVLMFVCDI-UHFFFAOYSA-N diethyl benzene-1,3-dicarboxylate Chemical compound CCOC(=O)C1=CC=CC(C(=O)OCC)=C1 JLVWYWVLMFVCDI-UHFFFAOYSA-N 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- RXGUIWHIADMCFC-UHFFFAOYSA-N 2-Methylpropyl 2-methylpropionate Chemical compound CC(C)COC(=O)C(C)C RXGUIWHIADMCFC-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- MGWAVDBGNNKXQV-UHFFFAOYSA-N diisobutyl phthalate Chemical compound CC(C)COC(=O)C1=CC=CC=C1C(=O)OCC(C)C MGWAVDBGNNKXQV-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- -1 for example Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- RGFNRWTWDWVHDD-UHFFFAOYSA-N isobutyl butyrate Chemical compound CCCC(=O)OCC(C)C RGFNRWTWDWVHDD-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VOZKAJLKRJDJLL-UHFFFAOYSA-N tolylenediamine group Chemical group CC1=C(C=C(C=C1)N)N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 2
- OUCGJMIVSYHBEC-UHFFFAOYSA-N 2-ethylhexyl 2-ethylhexanoate Chemical compound CCCCC(CC)COC(=O)C(CC)CCCC OUCGJMIVSYHBEC-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- 241000566113 Branta sandvicensis Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- XTJFFFGAUHQWII-UHFFFAOYSA-N Dibutyl adipate Chemical compound CCCCOC(=O)CCCCC(=O)OCCCC XTJFFFGAUHQWII-UHFFFAOYSA-N 0.000 description 1
- RDOFJDLLWVCMRU-UHFFFAOYSA-N Diisobutyl adipate Chemical compound CC(C)COC(=O)CCCCC(=O)OCC(C)C RDOFJDLLWVCMRU-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- OBNCKNCVKJNDBV-UHFFFAOYSA-N butanoic acid ethyl ester Natural products CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 1
- XUPYJHCZDLZNFP-UHFFFAOYSA-N butyl ester butanoic acid Natural products CCCCOC(=O)CCC XUPYJHCZDLZNFP-UHFFFAOYSA-N 0.000 description 1
- NVTXFBCAIQXOLE-UHFFFAOYSA-N carbonyl dichloride;hydrate Chemical class O.ClC(Cl)=O NVTXFBCAIQXOLE-UHFFFAOYSA-N 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- JSLCOZYBKYHZNL-UHFFFAOYSA-N isobutyric acid butyl ester Natural products CCCCOC(=O)C(C)C JSLCOZYBKYHZNL-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012749 thinning agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/10—Preparation of derivatives of isocyanic acid by reaction of amines with carbonyl halides, e.g. with phosgene
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/18—Separation; Purification; Stabilisation; Use of additives
- C07C263/20—Separation; Purification
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR43800A FR1469105A (fr) | 1965-12-27 | 1965-12-27 | Procédé de fabrication d'esters isocyaniques |
| FR57470A FR90392E (fr) | 1965-12-27 | 1966-04-13 | Procédé de fabrication d'esters isocyaniques |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1593412A1 DE1593412A1 (de) | 1970-08-27 |
| DE1593412B2 DE1593412B2 (enExample) | 1973-10-31 |
| DE1593412C3 true DE1593412C3 (de) | 1974-06-12 |
Family
ID=26167860
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1593412A Expired DE1593412C3 (de) | 1965-12-27 | 1966-08-11 | Verfahren zur kontinuierlichen Herstellung von Isocyansäureestern |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3544611A (enExample) |
| JP (1) | JPS516126B1 (enExample) |
| BE (1) | BE685280A (enExample) |
| DE (1) | DE1593412C3 (enExample) |
| ES (1) | ES334169A1 (enExample) |
| FR (2) | FR1469105A (enExample) |
| GB (1) | GB1136656A (enExample) |
| NL (1) | NL143908B (enExample) |
| YU (1) | YU34192B (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3892634A (en) * | 1973-02-20 | 1975-07-01 | Upjohn Co | Separation of 2,4{40 {0 and 4,4{40 {0 methylene bis(phenyl isocyanate) from polymethylene polyphenyl polyisocyanates |
| US3912600A (en) * | 1974-05-09 | 1975-10-14 | Upjohn Co | Recovery of polymethylene polyphenyl polyisocyanate from a phoshenosed polyamine feed |
| JPS5533635U (enExample) * | 1978-08-22 | 1980-03-04 | ||
| US4422976A (en) * | 1981-04-07 | 1983-12-27 | Mitsui Toatsu Chemicals, Incorporated | Continuous preparation of organic isocyanates |
| DE3129270A1 (de) * | 1981-07-24 | 1983-02-10 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyisocyanaten |
| JPS60126273U (ja) * | 1984-01-27 | 1985-08-24 | 株式会社 富士電機総合研究所 | ハンダ付用鏝先 |
| US4922005A (en) * | 1985-11-13 | 1990-05-01 | Mitsui Toatsu Chemicals, Incorporated | Preparation process of hexamethylene |
| EP0618170B1 (en) * | 1993-03-31 | 1996-09-04 | Basf Corporation | Process for producing reagent grade hydrochloric acid from the manufacture of organic isocyanates |
| DE19817691A1 (de) | 1998-04-21 | 1999-10-28 | Basf Ag | Verfahren zur Herstellung von Mischungen aus Diphenylmehandiisocyanaten und Polyphenylen-polymethylen-polyisocyanaten mit vermindertem Gehalt an chlorierten Nebenprodukten und verminderter Jodfarbzahl |
| DE10260082A1 (de) * | 2002-12-19 | 2004-07-01 | Basf Ag | Verfahren zur kontinuierlichen Herstellung von Isocyanaten |
| DE10260084A1 (de) * | 2002-12-19 | 2004-07-01 | Basf Ag | Auftrennung eines Stoffgemisches aus Clorwasserstoff und Phosgen |
| DE10310888A1 (de) | 2003-03-11 | 2004-09-23 | Basf Ag | Verfahren zur Herstellung von Polyisocyanaten |
| DE102004032871A1 (de) † | 2004-07-07 | 2006-02-09 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polyisocyanaten durch adiabate Phosgenierung von primären Aminen |
| DE102004044592A1 (de) | 2004-09-13 | 2006-03-30 | Basf Ag | Verfahren zur Trennung von Chlorwasserstoff und Phosgen |
| ES2663870T3 (es) | 2005-09-22 | 2018-04-17 | Huntsman International Llc | Método para la producción de poliisocianatos |
| US7504533B2 (en) * | 2006-04-24 | 2009-03-17 | Bayer Materialscience Llc | Process for the production of isocyanates |
| US7547801B2 (en) * | 2006-06-26 | 2009-06-16 | Bayer Materialscience Llc | Process for the continuous preparation of isocyanates |
| DE102007020444A1 (de) | 2007-04-27 | 2008-11-06 | Bayer Materialscience Ag | Verfahren zur Oxidation eines Chlorwasserstoffenthaltenden Gasgemisches |
| EP2014641A3 (en) * | 2007-06-06 | 2009-03-18 | Huntsman International Llc | Process for preparing mixtures of diphenylmethane diisocyanates and polyphenyl polymethylene polyisocyanates |
| DE102008009761A1 (de) | 2008-02-19 | 2009-08-27 | Bayer Materialscience Ag | Verfahren zur Herstellung von Isocyanaten |
| FR2940283B1 (fr) | 2008-12-18 | 2011-03-11 | Perstorp Tolonates France | Utilisation d'un reacteur de type piston pour la mise en oeuvre d'un procede de phosgenation. |
| KR102048110B1 (ko) | 2012-07-11 | 2019-11-22 | 코베스트로 도이칠란드 아게 | 이소시아네이트 제조에서 증류 잔류물의 후처리 방법 |
| KR102209958B1 (ko) * | 2012-10-24 | 2021-02-01 | 바스프 에스이 | 액상으로의 아민의 포스겐화에 의한 이소시아네이트의 제조 방법 |
| US9266824B2 (en) | 2014-01-13 | 2016-02-23 | Warsaw Orthopedic, Inc. | Methods and compositions for making an amino acid triisocyanate |
| EP3160630B1 (de) * | 2014-06-24 | 2022-08-31 | Covestro Intellectual Property GmbH & Co. KG | Verfahren zur herstellung von chemischen produkten mit betriebsunterbrechungen |
| HUE048607T2 (hu) * | 2015-03-12 | 2020-08-28 | Basf Se | Eljárás foszgént és sósavat tartalmazó anyagáram szétválasztására |
| US10815193B2 (en) | 2015-06-29 | 2020-10-27 | Covestro Deutschland Ag | Process for providing hydrogen chloride for chemical reactions |
| KR20180022843A (ko) | 2015-06-29 | 2018-03-06 | 코베스트로 도이칠란트 아게 | 폴리이소시아네이트를 제조하는 방법 |
| CN107848960B (zh) | 2015-07-16 | 2020-09-22 | 科思创德国股份有限公司 | 用于制备异氰酸酯的方法 |
| CN107935889B (zh) * | 2017-11-29 | 2020-08-28 | 万华化学集团股份有限公司 | 一种单异氰酸酯的制备方法及装置 |
| US10626084B2 (en) | 2018-08-03 | 2020-04-21 | Covestro Llc | Method for producing two isocyanates |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2822373A (en) * | 1958-02-04 | Amine | ||
| US2642449A (en) * | 1953-06-16 | Preparation of polyisocyanates | ||
| US3226410A (en) * | 1962-07-20 | 1965-12-28 | Fmc Corp | Continuous method of preparing aromatic isocyanates |
| US3287387A (en) * | 1963-07-29 | 1966-11-22 | Olin Mathieson | Process for the production of aromatic isocyanates |
-
1965
- 1965-12-27 FR FR43800A patent/FR1469105A/fr not_active Expired
-
1966
- 1966-04-13 FR FR57470A patent/FR90392E/fr not_active Expired
- 1966-08-09 BE BE685280D patent/BE685280A/xx not_active IP Right Cessation
- 1966-08-11 DE DE1593412A patent/DE1593412C3/de not_active Expired
- 1966-09-09 US US578417A patent/US3544611A/en not_active Expired - Lifetime
- 1966-09-28 NL NL666613704A patent/NL143908B/xx not_active IP Right Cessation
- 1966-11-01 GB GB48997/66A patent/GB1136656A/en not_active Expired
- 1966-12-05 ES ES0334169A patent/ES334169A1/es not_active Expired
- 1966-12-26 YU YU2443/66A patent/YU34192B/xx unknown
- 1966-12-26 JP JP41084716A patent/JPS516126B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS516126B1 (enExample) | 1976-02-25 |
| NL143908B (nl) | 1974-11-15 |
| ES334169A1 (es) | 1967-10-16 |
| YU34192B (en) | 1979-02-28 |
| US3544611A (en) | 1970-12-01 |
| BE685280A (enExample) | 1967-02-09 |
| DE1593412B2 (enExample) | 1973-10-31 |
| FR1469105A (fr) | 1967-02-10 |
| YU244366A (en) | 1978-06-30 |
| GB1136656A (en) | 1968-12-11 |
| DE1593412A1 (de) | 1970-08-27 |
| FR90392E (fr) | 1967-12-01 |
| NL6613704A (enExample) | 1967-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1593412C3 (de) | Verfahren zur kontinuierlichen Herstellung von Isocyansäureestern | |
| EP0134506B1 (de) | Verfahren zur Herstellung von Phosgen unter gleichzeitiger Erzeugung von Dampf | |
| DE3545954A1 (de) | Verfahren zum pyrolytischen aufarbeiten von ausgangsmaterial | |
| DD206782A5 (de) | Verfahren zur kontinuierlichen herstellung von organischen mono- oder polyisocyanaten | |
| DE2633640C3 (de) | Verfahren zur Gewinnung von gasförmigem Chlorwasserstoff aus verdünnter wäBriger Salzsäure | |
| EP0124010B1 (de) | Verfahren zur kontinuierlichen Herstellung von aromatischen Diaminen unter gleichzeitiger Erzeugung von Dampf | |
| DE2234663A1 (de) | Verfahren zum abscheiden und reinigen von azetylen aus einem gasgemisch | |
| DE69711531T2 (de) | Verbessertes Verfahren zur Herstellung von Ureum und Vorrichtung dafür | |
| DE10002791A1 (de) | Verfahren zur Gewinnung von wasserfreier Ameisensäure | |
| DE3329124A1 (de) | Verfahren zur reinigung von polyisocyanaten und die so gereinigten polyisocyanate | |
| DE2410505A1 (de) | Verfahren zur herstellung von isocyanaten aus urethanen | |
| DE1768652A1 (de) | Verfahren zum herstellen von aethylen | |
| DE4428459A1 (de) | Verfahren zur Herstellung von Dinitrotoluol | |
| DE2800153A1 (de) | Verfahren zur herstellung von methylisocyanat | |
| DE1948426C3 (de) | Verfahren zur Gewinnung von Schwefelwasserstoff und Ammoniak aus einer wässrigen Lösung | |
| DE1197857B (de) | Verfahren zur Herstellung von Ammonnitrat | |
| EP0003570B1 (de) | Verfahren zur kontinuierlichen Aufarbeitung von bei der Phosgenierung von Monoaminen anfallenden Lösungen | |
| DE1212065B (de) | Verfahren zur Abtrennung von Acetylenen aus gasfoermigen Kohlenwasserstoffgemischen | |
| DE2817509C2 (de) | Verfahren zur Isolierung von Terephthalonitril | |
| DE2124498C3 (de) | Verfahren zur Gewinnung aromatischer Isocyanate | |
| DE1261494B (de) | Verfahren zur Herstellung von 1,1,2-Trichloraethan aus 1,2-Dichloraethan und Chlor | |
| DE1805957A1 (de) | Verfahren zur Reinigung von Xylylendiisocyanat | |
| DE873598C (de) | Verfahren und Vorrichtung zum Abtrennen und unmittelbaren Gewinnen reiner Kohlenwasserstoffe aus solche enthaltenden Gasen | |
| DE3540863C1 (en) | Process for preparing hexamethylene diisocyanate | |
| DE2331391C3 (de) | Verfahren zur Dehydratisierung von Maleinsäure zu Maleinsäureanhydrid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |