DE1593320B1 - Verfahren zur Herstellung von Carbonsaeureamiden - Google Patents
Verfahren zur Herstellung von CarbonsaeureamidenInfo
- Publication number
- DE1593320B1 DE1593320B1 DE19661593320 DE1593320A DE1593320B1 DE 1593320 B1 DE1593320 B1 DE 1593320B1 DE 19661593320 DE19661593320 DE 19661593320 DE 1593320 A DE1593320 A DE 1593320A DE 1593320 B1 DE1593320 B1 DE 1593320B1
- Authority
- DE
- Germany
- Prior art keywords
- manganese dioxide
- nitrile
- water
- reaction
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 20
- 238000002360 preparation method Methods 0.000 title claims description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 title 1
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 52
- 150000002825 nitriles Chemical class 0.000 claims description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 29
- 239000003054 catalyst Substances 0.000 claims description 18
- 230000015572 biosynthetic process Effects 0.000 claims description 11
- 150000003857 carboxamides Chemical class 0.000 claims description 7
- 230000036571 hydration Effects 0.000 claims description 6
- 238000006703 hydration reaction Methods 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 5
- 230000007935 neutral effect Effects 0.000 claims description 5
- 238000010992 reflux Methods 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 239000002002 slurry Substances 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 23
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- -1 nitrile boron nitriles Chemical class 0.000 description 7
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical group S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- MSXVEPNJUHWQHW-UHFFFAOYSA-N 2-methylbutan-2-ol Chemical compound CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- XCTQPMCULSZKLT-UHFFFAOYSA-N 2-cyano-n-phenylacetamide Chemical compound N#CCC(=O)NC1=CC=CC=C1 XCTQPMCULSZKLT-UHFFFAOYSA-N 0.000 description 2
- NWPNXBQSRGKSJB-UHFFFAOYSA-N 2-methylbenzonitrile Chemical compound CC1=CC=CC=C1C#N NWPNXBQSRGKSJB-UHFFFAOYSA-N 0.000 description 2
- OWISXYQFTOYGRO-UHFFFAOYSA-N 3,4-dimethylbenzonitrile Chemical compound CC1=CC=C(C#N)C=C1C OWISXYQFTOYGRO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 2
- MGWYSXZGBRHJNE-UHFFFAOYSA-N cyclohexane-1,4-dicarbonitrile Chemical compound N#CC1CCC(C#N)CC1 MGWYSXZGBRHJNE-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- NEBPTMCRLHKPOB-UHFFFAOYSA-N 2,2-diphenylacetonitrile Chemical compound C=1C=CC=CC=1C(C#N)C1=CC=CC=C1 NEBPTMCRLHKPOB-UHFFFAOYSA-N 0.000 description 1
- PACGLQCRGWFBJH-UHFFFAOYSA-N 2-(4-methoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1 PACGLQCRGWFBJH-UHFFFAOYSA-N 0.000 description 1
- PXNJGLAVKOXITN-UHFFFAOYSA-N 2-(4-nitrophenyl)acetonitrile Chemical compound [O-][N+](=O)C1=CC=C(CC#N)C=C1 PXNJGLAVKOXITN-UHFFFAOYSA-N 0.000 description 1
- FDWRKVKXYZRYOD-UHFFFAOYSA-N 2-[2-[bis(cyanomethyl)amino]ethyl-(cyanomethyl)amino]acetonitrile Chemical compound N#CCN(CC#N)CCN(CC#N)CC#N FDWRKVKXYZRYOD-UHFFFAOYSA-N 0.000 description 1
- LJAIDEYQVIJERM-UHFFFAOYSA-N 2-[bis(cyanomethyl)amino]acetonitrile Chemical compound N#CCN(CC#N)CC#N LJAIDEYQVIJERM-UHFFFAOYSA-N 0.000 description 1
- JXPDNDHCMMOJPC-UHFFFAOYSA-N 2-hydroxybutanedinitrile Chemical compound N#CC(O)CC#N JXPDNDHCMMOJPC-UHFFFAOYSA-N 0.000 description 1
- SBAJRGRUGUQKAF-UHFFFAOYSA-N 3-(2-cyanoethylamino)propanenitrile Chemical compound N#CCCNCCC#N SBAJRGRUGUQKAF-UHFFFAOYSA-N 0.000 description 1
- NDVLTZFQVDXFAN-UHFFFAOYSA-N 3-(2-cyanoethylsulfanyl)propanenitrile Chemical compound N#CCCSCCC#N NDVLTZFQVDXFAN-UHFFFAOYSA-N 0.000 description 1
- XCKPLVGWGCWOMD-YYEYMFTQSA-N 3-[[(2r,3r,4s,5r,6r)-6-[(2s,3s,4r,5r)-3,4-bis(2-cyanoethoxy)-2,5-bis(2-cyanoethoxymethyl)oxolan-2-yl]oxy-3,4,5-tris(2-cyanoethoxy)oxan-2-yl]methoxy]propanenitrile Chemical compound N#CCCO[C@H]1[C@H](OCCC#N)[C@@H](COCCC#N)O[C@@]1(COCCC#N)O[C@@H]1[C@H](OCCC#N)[C@@H](OCCC#N)[C@H](OCCC#N)[C@@H](COCCC#N)O1 XCKPLVGWGCWOMD-YYEYMFTQSA-N 0.000 description 1
- GNHMRTZZNHZDDM-UHFFFAOYSA-N 3-chloropropionitrile Chemical compound ClCCC#N GNHMRTZZNHZDDM-UHFFFAOYSA-N 0.000 description 1
- BOHCMQZJWOGWTA-UHFFFAOYSA-N 3-methylbenzonitrile Chemical compound CC1=CC=CC(C#N)=C1 BOHCMQZJWOGWTA-UHFFFAOYSA-N 0.000 description 1
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 description 1
- QWEAKHSNGQKSCB-UHFFFAOYSA-N 4,5,6-trihydroxyhexanenitrile Chemical compound OCC(O)C(O)CCC#N QWEAKHSNGQKSCB-UHFFFAOYSA-N 0.000 description 1
- CQPGDDAKTTWVDD-UHFFFAOYSA-N 4-bromobutanenitrile Chemical compound BrCCCC#N CQPGDDAKTTWVDD-UHFFFAOYSA-N 0.000 description 1
- IVYMIRMKXZAHRV-UHFFFAOYSA-N 4-chlorophenylacetonitrile Chemical compound ClC1=CC=C(CC#N)C=C1 IVYMIRMKXZAHRV-UHFFFAOYSA-N 0.000 description 1
- VCZNNAKNUVJVGX-UHFFFAOYSA-N 4-methylbenzonitrile Chemical compound CC1=CC=C(C#N)C=C1 VCZNNAKNUVJVGX-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 241000243251 Hydra Species 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- RFFFKMOABOFIDF-UHFFFAOYSA-N Pentanenitrile Chemical compound CCCCC#N RFFFKMOABOFIDF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- AUQDITHEDVOTCU-UHFFFAOYSA-N cyclopropyl cyanide Chemical compound N#CC1CC1 AUQDITHEDVOTCU-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- OAGOUCJGXNLJNL-UHFFFAOYSA-N dimethylcyanamide Chemical compound CN(C)C#N OAGOUCJGXNLJNL-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- ZTOMUSMDRMJOTH-UHFFFAOYSA-N glutaronitrile Chemical compound N#CCCCC#N ZTOMUSMDRMJOTH-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- LLEVMYXEJUDBTA-UHFFFAOYSA-N heptanedinitrile Chemical compound N#CCCCCCC#N LLEVMYXEJUDBTA-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- AILKHAQXUAOOFU-UHFFFAOYSA-N hexanenitrile Chemical compound CCCCCC#N AILKHAQXUAOOFU-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- BSRDNMMLQYNQQD-UHFFFAOYSA-N iminodiacetonitrile Chemical compound N#CCNCC#N BSRDNMMLQYNQQD-UHFFFAOYSA-N 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229940099596 manganese sulfate Drugs 0.000 description 1
- 239000011702 manganese sulphate Substances 0.000 description 1
- 235000007079 manganese sulphate Nutrition 0.000 description 1
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 229920006391 phthalonitrile polymer Polymers 0.000 description 1
- 229920005554 polynitrile Polymers 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- GPHQHTOMRSGBNZ-UHFFFAOYSA-N pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC=C1 GPHQHTOMRSGBNZ-UHFFFAOYSA-N 0.000 description 1
- DHERNFAJQNHYBM-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1.O=C1CCCN1 DHERNFAJQNHYBM-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- IAHFWCOBPZCAEA-UHFFFAOYSA-N succinonitrile Chemical compound N#CCCC#N IAHFWCOBPZCAEA-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- WKJHMKQSIBMURP-UHFFFAOYSA-N tridecanenitrile Chemical compound CCCCCCCCCCCCC#N WKJHMKQSIBMURP-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/06—Preparation of carboxylic acid amides from nitriles by transformation of cyano groups into carboxamide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
- C07C233/09—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with carbon atoms of carboxamide groups bound to carbon atoms of an acyclic unsaturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US510384A US3366639A (en) | 1965-11-29 | 1965-11-29 | Synthesis of amides from nitriles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1593320B1 true DE1593320B1 (de) | 1971-10-28 |
Family
ID=24030535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661593320 Pending DE1593320B1 (de) | 1965-11-29 | 1966-08-11 | Verfahren zur Herstellung von Carbonsaeureamiden |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3366639A (enExample) |
| BE (1) | BE685506A (enExample) |
| CH (1) | CH471081A (enExample) |
| DE (1) | DE1593320B1 (enExample) |
| GB (1) | GB1133013A (enExample) |
| NL (2) | NL6611236A (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0412310A1 (en) * | 1989-08-08 | 1991-02-13 | Mitsubishi Gas Chemical Company, Inc. | Process for producing Manganese dioxide catalyst for the hydration reaction of cyanohydrins |
| EP0418512A1 (en) * | 1989-09-07 | 1991-03-27 | Mitsubishi Gas Chemical Company, Inc. | Process for production of alpha-hydroxycarboxylic acid amide |
| US6302979B1 (en) | 1994-12-21 | 2001-10-16 | Daicel Chemical Industries, Ltd. | Gas generant composition |
| WO2007039536A1 (de) | 2005-10-05 | 2007-04-12 | Evonik Degussa Gmbh | Mangandioxid-katalysator zur hydrolyse von carbonsäurenitrilen |
| DE102008001319A1 (de) | 2008-04-22 | 2009-10-29 | Evonik Röhm Gmbh | Katalysator zur Umsetzung von Carbonsäurenitrilen |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3699164A (en) * | 1970-03-13 | 1972-10-17 | American Cyanamid Co | Catalytic hydration of nitriles |
| US4222960A (en) * | 1978-06-08 | 1980-09-16 | Chemie Linz Aktiengesellschaft | Process for the manufacture of α-hydroxycarboxylic acid amides |
| JPS61205221A (ja) * | 1985-03-08 | 1986-09-11 | Univ Osaka | ニトリルとアミンからのアミドの製造方法 |
| US5292821A (en) * | 1988-12-28 | 1994-03-08 | Mitsui Toatsu Chemicals, Inc. | Catonic acrylamide polymers and the applications of these polymers |
| US4950801A (en) * | 1989-01-19 | 1990-08-21 | Mitsubishi Gas Chemical Company, Inc. | Process for producing alpha-hydroxycarboxylic acid amide |
| GB8904799D0 (en) * | 1989-03-02 | 1989-04-12 | Interox Chemicals Ltd | Amide preparation |
| US5175366A (en) * | 1989-08-08 | 1992-12-29 | Mitsubishi Gas Chemical Company, Inc. | Process for producing a denaturated manganese dioxide catalyst for the hydration reaction of cyanohydrins |
| US5276185A (en) * | 1990-06-11 | 1994-01-04 | Mitsui Toatsu Chemicals, Inc. | Process for producing amide compounds |
| US5387715A (en) * | 1991-12-03 | 1995-02-07 | Mitsui Toatsu Chemicals, Inc. | Process for producing α-hydroxy-isobutyramide |
| WO2004056776A1 (en) | 2002-12-23 | 2004-07-08 | Council Of Scientific And Industrial Research | Process for conversion of cyanopyridines to nicotinamides and catalyst therefor, process for preparing said catalyst |
| US7455827B2 (en) | 2003-03-20 | 2008-11-25 | Council Of Scientific And Industrial Research | Process for preparing a catalyst for conversion of cyanopyridines to nicotinamides |
| EP1930314A4 (en) * | 2005-09-28 | 2009-06-17 | Mitsubishi Gas Chemical Co | PROCESS FOR PRODUCING CARNITINAMIDE |
| TW201102365A (en) * | 2009-07-03 | 2011-01-16 | China Petrochemical Dev Corp | Method for producing organic carboxylic acid amide |
| CN109232292A (zh) * | 2018-09-11 | 2019-01-18 | 浙江中山化工集团股份有限公司 | 一种2,6-二乙基-4-甲基苯基丙二酰胺的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE551869C (de) * | 1931-02-22 | 1932-06-07 | I G Farbenindustrie Akt Ges | Verfahren zur Darstellung von Saeureamiden |
-
0
- NL NL131718D patent/NL131718C/xx active
-
1965
- 1965-11-29 US US510384A patent/US3366639A/en not_active Expired - Lifetime
-
1966
- 1966-07-25 GB GB33435/66A patent/GB1133013A/en not_active Expired
- 1966-08-10 NL NL6611236A patent/NL6611236A/xx unknown
- 1966-08-11 DE DE19661593320 patent/DE1593320B1/de active Pending
- 1966-08-12 BE BE685506D patent/BE685506A/xx unknown
- 1966-08-15 CH CH1172166A patent/CH471081A/de not_active IP Right Cessation
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0412310A1 (en) * | 1989-08-08 | 1991-02-13 | Mitsubishi Gas Chemical Company, Inc. | Process for producing Manganese dioxide catalyst for the hydration reaction of cyanohydrins |
| EP0418512A1 (en) * | 1989-09-07 | 1991-03-27 | Mitsubishi Gas Chemical Company, Inc. | Process for production of alpha-hydroxycarboxylic acid amide |
| US6302979B1 (en) | 1994-12-21 | 2001-10-16 | Daicel Chemical Industries, Ltd. | Gas generant composition |
| WO2007039536A1 (de) | 2005-10-05 | 2007-04-12 | Evonik Degussa Gmbh | Mangandioxid-katalysator zur hydrolyse von carbonsäurenitrilen |
| US7670986B2 (en) | 2005-10-05 | 2010-03-02 | Degussa Ag | Manganese dioxide catalyst for the hydrolysis of carbonitriles |
| DE102008001319A1 (de) | 2008-04-22 | 2009-10-29 | Evonik Röhm Gmbh | Katalysator zur Umsetzung von Carbonsäurenitrilen |
Also Published As
| Publication number | Publication date |
|---|---|
| CH471081A (de) | 1969-04-15 |
| GB1133013A (en) | 1968-11-06 |
| NL6611236A (enExample) | 1967-05-30 |
| NL131718C (enExample) | |
| BE685506A (enExample) | 1967-02-13 |
| US3366639A (en) | 1968-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1593320B1 (de) | Verfahren zur Herstellung von Carbonsaeureamiden | |
| DE3249628C2 (enExample) | ||
| DE1127351B (de) | Verfahren zur Herstellung von ª, ª-ungesaettigten aliphatischen Nitrilen durch Umsetzen von Olefinen mit Ammoniak und Sauerstoff | |
| DE1593277B2 (de) | Verfahren zur herstellung von gemischen aliphatischer nitrile | |
| DE2314151A1 (de) | Verfahren zur herstellung eines aromatischen oder heterocyclischen aromatischen nitrils | |
| DE60104244T2 (de) | Verfahren zur Herstellung von Amiden | |
| DE2812151A1 (de) | Verfahren zur herstellung von organischen nitrilen | |
| DE3390062C2 (enExample) | ||
| DE3109534A1 (de) | Verfahren zur herstellung von n-substituiertem acrylamid oder methacrylamid | |
| DE2427191C3 (de) | Katalysator und Verfahren zur Herstellung aromatischer Nitrile | |
| DE1593320C (de) | Verfahren zur Herstellung von Carbonsäureamiden | |
| DE2526799A1 (de) | 5-aryl-2-furamidine | |
| DE2505704C3 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten 2-Alkylamino-4,6-dichlor-s-triazinen und 2,4-Bis alkylamino-6-chlor-s-triazinen | |
| DE2738975C2 (de) | Acyloxy-N,N'-diacylmalonamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Aktivatoren für Persalze | |
| DE1232127B (de) | Verfahren zur Herstellung von gesaettigten aliphatischen oder aromatischen Nitrilen | |
| EP0275470B1 (de) | N-substituierte, Estergruppen enthaltende Acrylamide | |
| DE1290125C2 (de) | Verfahren zur herstellung von benzonitrilen | |
| DE2242420B2 (de) | Halogenacetanilide, Verfahren zu ihrer Herstellung und Selektivherbizide mit den Halogenacetaniliden als Wirkstoff | |
| DE1770840C3 (de) | Verfahren zur Herstellung von Pyromellitsäurediimid | |
| DE2239799C3 (de) | Verfahren zur Herstellung von Nitrilen | |
| DE69605131T2 (de) | Nitrierung von pyridin-2,6-diamine | |
| DE2527157C2 (de) | Verfahren zur Herstellung von 2-Formylchinoxalin-N↑1↑,N↑4↑-dioxyddimethylacetal | |
| CH634827A5 (en) | Process for the preparation of nitroguanidine from guanidine nitrate by dehydration | |
| CH648025A5 (de) | Chinoxalin-1,4-dioxyd-derivate. | |
| DE2639874C2 (de) | Kontinuierliches Verfahren zur Herstellung von Iminodiacetonitril |