DE1584284C - - Google Patents
Info
- Publication number
- DE1584284C DE1584284C DE1584284C DE 1584284 C DE1584284 C DE 1584284C DE 1584284 C DE1584284 C DE 1584284C
- Authority
- DE
- Germany
- Prior art keywords
- carbide
- abrasion
- grains
- armor plate
- resistant material
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000463 material Substances 0.000 claims description 21
- 238000005299 abrasion Methods 0.000 claims description 10
- 238000005219 brazing Methods 0.000 claims description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 8
- 229910000831 Steel Inorganic materials 0.000 claims description 6
- 239000010959 steel Substances 0.000 claims description 6
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- 229910000906 Bronze Inorganic materials 0.000 claims description 4
- 239000010974 bronze Substances 0.000 claims description 4
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- INZDTEICWPZYJM-UHFFFAOYSA-N 1-(chloromethyl)-4-[4-(chloromethyl)phenyl]benzene Chemical compound C1=CC(CCl)=CC=C1C1=CC=C(CCl)C=C1 INZDTEICWPZYJM-UHFFFAOYSA-N 0.000 claims description 2
- QIJNJJZPYXGIQM-UHFFFAOYSA-N 1lambda4,2lambda4-dimolybdacyclopropa-1,2,3-triene Chemical compound [Mo]=C=[Mo] QIJNJJZPYXGIQM-UHFFFAOYSA-N 0.000 claims description 2
- 229910039444 MoC Inorganic materials 0.000 claims description 2
- 229910052778 Plutonium Inorganic materials 0.000 claims description 2
- 229910052770 Uranium Inorganic materials 0.000 claims description 2
- 229910026551 ZrC Inorganic materials 0.000 claims description 2
- OTCHGXYCWNXDOA-UHFFFAOYSA-N [C].[Zr] Chemical compound [C].[Zr] OTCHGXYCWNXDOA-UHFFFAOYSA-N 0.000 claims description 2
- UFGZSIPAQKLCGR-UHFFFAOYSA-N chromium carbide Chemical compound [Cr]#C[Cr]C#[Cr] UFGZSIPAQKLCGR-UHFFFAOYSA-N 0.000 claims description 2
- YZUCHPMXUOSLOJ-UHFFFAOYSA-N ethyne;thorium Chemical compound [Th].[C-]#[C] YZUCHPMXUOSLOJ-UHFFFAOYSA-N 0.000 claims description 2
- WHJFNYXPKGDKBB-UHFFFAOYSA-N hafnium;methane Chemical compound C.[Hf] WHJFNYXPKGDKBB-UHFFFAOYSA-N 0.000 claims description 2
- UNASZPQZIFZUSI-UHFFFAOYSA-N methylidyneniobium Chemical compound [Nb]#C UNASZPQZIFZUSI-UHFFFAOYSA-N 0.000 claims description 2
- NFFIWVVINABMKP-UHFFFAOYSA-N methylidynetantalum Chemical compound [Ta]#C NFFIWVVINABMKP-UHFFFAOYSA-N 0.000 claims description 2
- OYEHPCDNVJXUIW-UHFFFAOYSA-N plutonium atom Chemical compound [Pu] OYEHPCDNVJXUIW-UHFFFAOYSA-N 0.000 claims description 2
- 229910003468 tantalcarbide Inorganic materials 0.000 claims description 2
- 229910003470 tongbaite Inorganic materials 0.000 claims description 2
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 claims description 2
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000945 filler Substances 0.000 description 4
- 239000002245 particle Substances 0.000 description 3
- 230000035515 penetration Effects 0.000 description 3
- 238000012856 packing Methods 0.000 description 2
- 238000005253 cladding Methods 0.000 description 1
- 238000005553 drilling Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
Family
ID=
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3416126A1 (de) * | 1984-01-11 | 1985-08-08 | Vac-Hyd Processing Gmbh, 2358 Kaltenkirchen | Plattenfoermiges sicherheitslement und dessen verwendung in einer sicherheitsblende |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3416126A1 (de) * | 1984-01-11 | 1985-08-08 | Vac-Hyd Processing Gmbh, 2358 Kaltenkirchen | Plattenfoermiges sicherheitslement und dessen verwendung in einer sicherheitsblende |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1196037B1 (de) | Abteilvorrichtung für unterteilbares füllgut in einer flexiblen schlauchhülle | |
| DE4423257A1 (de) | Implantat zum Einsetzen zwischen Wirbelkörper der Wirbelsäule als Platzhalter | |
| DE3000227C2 (de) | Hammer zum Zerkleinern von Gestein oder ähnlichen Materialien | |
| DE1584284B1 (de) | Panzerplatte | |
| DE1584284C (enExample) | ||
| EP0313864A2 (de) | Schliesszylinder mit Stiftzuhaltungen | |
| DE3119626A1 (de) | Flachschluessel fuer zylinderschloesser | |
| DE2437199A1 (de) | Verfahren und vorrichtung zum verbinden der enden von bewehrungsstaeben | |
| DE1611961C2 (de) | Rohrförmiger Behälter | |
| CH673761A5 (enExample) | ||
| DE2635051A1 (de) | Vorrichtung zum kuppeln zweier benachbarten eimer eines kratzbandfoerderers fuer bergwerke | |
| DE2606557C2 (de) | Wende-Flachschlüssel für einen Schließzylinder | |
| DE2411362B2 (de) | Verschlussvorrichtung, bestehend aus einem drehzylinderschloss und dazugehoerigem flachschluessel | |
| DE4114271A1 (de) | Bohr- und meisselwerkzeug mit grundkoerper und schneidkoerper | |
| EP0086381B1 (de) | Vorhängeschloss zur Verbindung zweier Glieder einer Kette | |
| DE1906989C3 (de) | Blinder Treibstiftniet | |
| DE29612342U1 (de) | Progressivschnecken-Bohrer | |
| EP1749952B1 (de) | Panikstange oder Panikgriff | |
| DE6935564U (de) | Fuer einen container oder dergleichen dienende tuer. | |
| DE10101245C2 (de) | Türdrücker | |
| DE29506880U1 (de) | Bohrkopf einer Hohlbohrschnecke | |
| DE3721647C2 (enExample) | ||
| DE2321346C3 (de) | Gelenkbeschlag für klappbare Leitern | |
| DE2440082C3 (de) | Hammerbohrereinrichtung | |
| DE957726C (de) | Doppel zylinderschloß mit einem Kupplungsglied zwischen Schließglied und Schheßzylindern |