DE1568982A1 - Verfahren zur Herstellung von Organozinnverbindungen - Google Patents
Verfahren zur Herstellung von OrganozinnverbindungenInfo
- Publication number
- DE1568982A1 DE1568982A1 DE19661568982 DE1568982A DE1568982A1 DE 1568982 A1 DE1568982 A1 DE 1568982A1 DE 19661568982 DE19661568982 DE 19661568982 DE 1568982 A DE1568982 A DE 1568982A DE 1568982 A1 DE1568982 A1 DE 1568982A1
- Authority
- DE
- Germany
- Prior art keywords
- halide
- aqueous phase
- metal halide
- inorganic
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 24
- 150000001875 compounds Chemical class 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000000203 mixture Substances 0.000 claims description 23
- 229910052718 tin Inorganic materials 0.000 claims description 18
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 17
- 229910001507 metal halide Inorganic materials 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 239000008346 aqueous phase Substances 0.000 claims description 15
- 150000005309 metal halides Chemical class 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 claims description 14
- 150000004820 halides Chemical class 0.000 claims description 14
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 14
- 229910052782 aluminium Inorganic materials 0.000 claims description 10
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 8
- 239000012071 phase Substances 0.000 claims description 8
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 239000011780 sodium chloride Substances 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical group [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 150000001805 chlorine compounds Chemical group 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims description 2
- 229910001502 inorganic halide Inorganic materials 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 2
- 150000002894 organic compounds Chemical class 0.000 claims 2
- 241001459693 Dipterocarpus zeylanicus Species 0.000 claims 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 210000003462 vein Anatomy 0.000 claims 1
- 239000000047 product Substances 0.000 description 34
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 12
- -1 η-butyl Chemical group 0.000 description 12
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- SQBBHCOIQXKPHL-UHFFFAOYSA-N tributylalumane Chemical compound CCCC[Al](CCCC)CCCC SQBBHCOIQXKPHL-UHFFFAOYSA-N 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 125000005234 alkyl aluminium group Chemical group 0.000 description 2
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 2
- 229910001626 barium chloride Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- QPBYLOWPSRZOFX-UHFFFAOYSA-J tin(iv) iodide Chemical compound I[Sn](I)(I)I QPBYLOWPSRZOFX-UHFFFAOYSA-J 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 101100271445 Emericella nidulans (strain FGSC A4 / ATCC 38163 / CBS 112.46 / NRRL 194 / M139) atp9 gene Proteins 0.000 description 1
- 101000634835 Homo sapiens M1-specific T cell receptor alpha chain Proteins 0.000 description 1
- 101000634836 Homo sapiens T cell receptor alpha chain MC.7.G5 Proteins 0.000 description 1
- 102100029450 M1-specific T cell receptor alpha chain Human genes 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GCTFWCDSFPMHHS-UHFFFAOYSA-M Tributyltin chloride Chemical compound CCCC[Sn](Cl)(CCCC)CCCC GCTFWCDSFPMHHS-UHFFFAOYSA-M 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- GXWLHTAAGCHDAV-UHFFFAOYSA-L dichloro-bis(2-methylpropyl)stannane Chemical compound CC(C)C[Sn](Cl)(Cl)CC(C)C GXWLHTAAGCHDAV-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- LNHZORZALMMUQW-UHFFFAOYSA-N oxane-2-carbonitrile Chemical compound N#CC1CCCCO1 LNHZORZALMMUQW-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YJPVTCSBVRMESK-UHFFFAOYSA-L strontium bromide Chemical compound [Br-].[Br-].[Sr+2] YJPVTCSBVRMESK-UHFFFAOYSA-L 0.000 description 1
- 229910001625 strontium bromide Inorganic materials 0.000 description 1
- 229940074155 strontium bromide Drugs 0.000 description 1
- 229910001631 strontium chloride Inorganic materials 0.000 description 1
- AHBGXTDRMVNFER-UHFFFAOYSA-L strontium dichloride Chemical compound [Cl-].[Cl-].[Sr+2] AHBGXTDRMVNFER-UHFFFAOYSA-L 0.000 description 1
- KRIJWFBRWPCESA-UHFFFAOYSA-L strontium iodide Chemical compound [Sr+2].[I-].[I-] KRIJWFBRWPCESA-UHFFFAOYSA-L 0.000 description 1
- 229910001643 strontium iodide Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- NHSGFFFVCFHOBS-UHFFFAOYSA-M tris(2-methylpropyl)stannanylium;chloride Chemical compound CC(C)C[Sn](Cl)(CC(C)C)CC(C)C NHSGFFFVCFHOBS-UHFFFAOYSA-M 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
- C07F7/2208—Compounds having tin linked only to carbon, hydrogen and/or halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42988265A | 1965-02-02 | 1965-02-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1568982A1 true DE1568982A1 (de) | 1970-06-18 |
Family
ID=23705103
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661568982 Pending DE1568982A1 (de) | 1965-02-02 | 1966-01-28 | Verfahren zur Herstellung von Organozinnverbindungen |
Country Status (4)
| Country | Link |
|---|---|
| CH (1) | CH472432A (enExample) |
| DE (1) | DE1568982A1 (enExample) |
| GB (1) | GB1085002A (enExample) |
| NL (1) | NL6601352A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3184532B1 (en) | 2015-12-22 | 2018-09-26 | Arkema B.V. | Process for making alkyltin trihalides and their use |
-
1966
- 1966-01-28 GB GB396466A patent/GB1085002A/en not_active Expired
- 1966-01-28 DE DE19661568982 patent/DE1568982A1/de active Pending
- 1966-02-01 CH CH137866A patent/CH472432A/de not_active IP Right Cessation
- 1966-02-02 NL NL6601352A patent/NL6601352A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1085002A (en) | 1967-09-27 |
| NL6601352A (enExample) | 1966-08-03 |
| CH472432A (de) | 1969-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2540210B2 (de) | Verfahren zur Herstellung von Organozinntrihalogeniden und sich davon ableitende Organozinn-Stabilisatoren | |
| DE1445024A1 (de) | Verfahren zur Herstellung von monomeren N-heterocyclischen Verbindungen | |
| CH623333A5 (en) | Process for the preparation of organo-tin dihalides | |
| DE1178064B (de) | Verfahren zur Herstellung von Vinylzinnverbindungen | |
| DE2826498A1 (de) | In kohlenwasserstoffen loeslicher organomagnesiumkomplex und verfahren zu seiner herstellung | |
| DE1568982A1 (de) | Verfahren zur Herstellung von Organozinnverbindungen | |
| EP0027577B1 (de) | Organomagnesiumalkoxide, Verfahren zu ihrer Herstellung und stabile Lösungen dieser Verbindungen | |
| EP0003317A1 (de) | Verfahren zum Herstellen von Acyloxysilanen und gegebenenfalls Acyloxysiloxanen | |
| DE1668425A1 (de) | Verfahren zur Herstellung von Diorganoantimonacylaten | |
| DE1493222A1 (de) | Verfahren zur Herstellung von Diorganozinkverbindungen | |
| DE2630633A1 (de) | Verfahren zur herstellung substituierter benzylnitrilderivate | |
| DE1618677A1 (de) | Verfahren zur Herstellung von Tricyclohexylzinnhydroxyd | |
| DE2226774B2 (de) | Verfahren zur Herstellung von Distannanen der Formel R3 Sn-Sn R3 | |
| EP0158163B1 (de) | Herstellung von Organozinn-halogeniden durch katalysierte Redistribution von höher alkylierten Organozinn-Verbindungen mit niedriger alkylierten | |
| DE2460288C3 (de) | Verfahren zur Herstellung von Tricyclohexylzinnchlorid oder -bromid | |
| DE3883394T2 (de) | Verfahren zur herstellung von dialkyltellur und dialkylselen. | |
| DE2506917C3 (de) | Verfahren zur Herstellung eines Alkylzinnchlorids | |
| DE2060259A1 (de) | Phenyl-vinyl-phosphonsaeuren,sowie Verfahren zu deren Herstellung | |
| DE1693112B1 (de) | Verfahren zur Herstellung von Tricyclohexylzinnchlorid oder -bromid | |
| DE2002066A1 (de) | Verfahren zur Herstellung von N-Trialkylsilyl-vinylsulfonamiden | |
| DD270713A1 (de) | Verfahren zur herstellung von triorganostannylmagnesium-verbindungen | |
| DE60202639T2 (de) | 2-Halo-1-Cycloalkenkarboxamide und deren Herstellung | |
| EP0057893B1 (de) | Organische Barium-Magnesium-Komplexe und Verfahren zu ihrer Herstellung | |
| DE977532C (de) | Verfahren zur Herstellung von Alkylzinnverbindungen neben Alkylzinnhalogenverbindungen | |
| DE2218211C2 (de) | Verfahren zur Herstellung von asymmetrischen Triorganozinnhalogeniden |