DE1544556A1 - Azofarbstoffe und Verfahren zu deren Herstellung - Google Patents
Azofarbstoffe und Verfahren zu deren HerstellungInfo
- Publication number
- DE1544556A1 DE1544556A1 DE19661544556 DE1544556A DE1544556A1 DE 1544556 A1 DE1544556 A1 DE 1544556A1 DE 19661544556 DE19661544556 DE 19661544556 DE 1544556 A DE1544556 A DE 1544556A DE 1544556 A1 DE1544556 A1 DE 1544556A1
- Authority
- DE
- Germany
- Prior art keywords
- diamino
- methyl
- parts
- hydrogen
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000987 azo dye Substances 0.000 title claims description 12
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title description 2
- -1 arliphatic Chemical group 0.000 claims description 41
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 20
- 239000000975 dye Substances 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 18
- 239000000049 pigment Substances 0.000 claims description 13
- 125000002837 carbocyclic group Chemical group 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 150000004985 diamines Chemical class 0.000 claims description 9
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 238000009833 condensation Methods 0.000 claims description 7
- 230000005494 condensation Effects 0.000 claims description 7
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 6
- 150000002431 hydrogen Chemical group 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 235000019260 propionic acid Nutrition 0.000 claims description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 3
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical group OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 claims description 2
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 claims description 2
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 2
- 229920000578 graft copolymer Polymers 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 150000003738 xylenes Chemical class 0.000 claims description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 claims 2
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims 2
- 150000001875 compounds Chemical class 0.000 claims 1
- 238000004043 dyeing Methods 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 239000000976 ink Substances 0.000 claims 1
- 239000004922 lacquer Substances 0.000 claims 1
- 229920003023 plastic Polymers 0.000 claims 1
- 239000004033 plastic Substances 0.000 claims 1
- 239000004014 plasticizer Substances 0.000 claims 1
- 239000004800 polyvinyl chloride Substances 0.000 claims 1
- 229920000915 polyvinyl chloride Polymers 0.000 claims 1
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 14
- WGLQHUKCXBXUDV-UHFFFAOYSA-N 3-aminophthalic acid Chemical class NC1=CC=CC(C(O)=O)=C1C(O)=O WGLQHUKCXBXUDV-UHFFFAOYSA-N 0.000 description 12
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 12
- 230000008878 coupling Effects 0.000 description 12
- 238000010168 coupling process Methods 0.000 description 12
- 238000005859 coupling reaction Methods 0.000 description 12
- 239000004305 biphenyl Substances 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 150000008064 anhydrides Chemical class 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 6
- 239000001052 yellow pigment Substances 0.000 description 6
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 5
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 4
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- CXWHIRYROUZDOF-UHFFFAOYSA-N 3-amino-6-methoxyphthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C=C1)OC)C(=O)O CXWHIRYROUZDOF-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000005700 Putrescine Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical group C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- MAPWYRGGJSHAAU-UHFFFAOYSA-N 1,3-bis(4-aminophenyl)urea Chemical compound C1=CC(N)=CC=C1NC(=O)NC1=CC=C(N)C=C1 MAPWYRGGJSHAAU-UHFFFAOYSA-N 0.000 description 2
- MGLZGLAFFOMWPB-UHFFFAOYSA-N 2-chloro-1,4-phenylenediamine Chemical compound NC1=CC=C(N)C(Cl)=C1 MGLZGLAFFOMWPB-UHFFFAOYSA-N 0.000 description 2
- FFYKBPHPYPVCAI-UHFFFAOYSA-N 3-amino-6-chlorophthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C=C1)Cl)C(=O)O FFYKBPHPYPVCAI-UHFFFAOYSA-N 0.000 description 2
- CGPKWGWRCHETIK-UHFFFAOYSA-N 3-amino-6-methylphthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C=C1)C)C(=O)O CGPKWGWRCHETIK-UHFFFAOYSA-N 0.000 description 2
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 2
- XPAQFJJCWGSXGJ-UHFFFAOYSA-N 4-amino-n-(4-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC=C(N)C=C1 XPAQFJJCWGSXGJ-UHFFFAOYSA-N 0.000 description 2
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000003791 organic solvent mixture Substances 0.000 description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- IBRQUKZZBXZOBA-UHFFFAOYSA-N 1-chloro-3-(3-chlorophenyl)sulfonylbenzene Chemical compound ClC1=CC=CC(S(=O)(=O)C=2C=C(Cl)C=CC=2)=C1 IBRQUKZZBXZOBA-UHFFFAOYSA-N 0.000 description 1
- JEFLTMZOOWERRP-UHFFFAOYSA-N 2,3,5,6-tetrachlorobenzene-1,4-diamine Chemical compound NC1=C(Cl)C(Cl)=C(N)C(Cl)=C1Cl JEFLTMZOOWERRP-UHFFFAOYSA-N 0.000 description 1
- DTUNENHHMJQMSM-UHFFFAOYSA-N 2,4,5,6-tetrachlorobenzene-1,3-diamine Chemical compound NC1=C(Cl)C(N)=C(Cl)C(Cl)=C1Cl DTUNENHHMJQMSM-UHFFFAOYSA-N 0.000 description 1
- BWAPJIHJXDYDPW-UHFFFAOYSA-N 2,5-dimethyl-p-phenylenediamine Chemical compound CC1=CC(N)=C(C)C=C1N BWAPJIHJXDYDPW-UHFFFAOYSA-N 0.000 description 1
- SFHZZHHJDJNTTD-UHFFFAOYSA-N 2-(4-aminophenyl)benzotriazol-5-amine Chemical compound C1=CC(N)=CC=C1N1N=C2C=C(N)C=CC2=N1 SFHZZHHJDJNTTD-UHFFFAOYSA-N 0.000 description 1
- CKOFBUUFHALZGK-UHFFFAOYSA-N 3-[(3-aminophenyl)methyl]aniline Chemical compound NC1=CC=CC(CC=2C=C(N)C=CC=2)=C1 CKOFBUUFHALZGK-UHFFFAOYSA-N 0.000 description 1
- JBNOQRLGLQXWLO-UHFFFAOYSA-N 3-amino-4,5,6-trimethoxyphthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C(=C1OC)OC)OC)C(=O)O JBNOQRLGLQXWLO-UHFFFAOYSA-N 0.000 description 1
- SDIWKTXTDJBPFW-UHFFFAOYSA-N 3-amino-4-chlorophthalic acid Chemical compound NC1=C(C(C(=O)O)=CC=C1Cl)C(=O)O SDIWKTXTDJBPFW-UHFFFAOYSA-N 0.000 description 1
- GLUAYYYGRPYVKP-UHFFFAOYSA-N 3-amino-4-methoxyphthalic acid Chemical compound NC1=C(C(C(=O)O)=CC=C1OC)C(=O)O GLUAYYYGRPYVKP-UHFFFAOYSA-N 0.000 description 1
- RRHKUABXGSMDHS-UHFFFAOYSA-N 3-amino-4-methylphthalic acid Chemical compound CC1=CC=C(C(O)=O)C(C(O)=O)=C1N RRHKUABXGSMDHS-UHFFFAOYSA-N 0.000 description 1
- WBIJIPZLUPLPQZ-UHFFFAOYSA-N 3-amino-5-cyanophthalic acid Chemical compound NC1=C(C(C(=O)O)=CC(=C1)C#N)C(=O)O WBIJIPZLUPLPQZ-UHFFFAOYSA-N 0.000 description 1
- FDDAOHOLKFVTCU-UHFFFAOYSA-N 3-amino-5-methylphthalic acid Chemical compound NC1=C(C(C(=O)O)=CC(=C1)C)C(=O)O FDDAOHOLKFVTCU-UHFFFAOYSA-N 0.000 description 1
- GDXHUOFOZGPOEK-UHFFFAOYSA-N 3-amino-5-nitrophthalic acid Chemical compound NC1=C(C(C(=O)O)=CC(=C1)[N+](=O)[O-])C(=O)O GDXHUOFOZGPOEK-UHFFFAOYSA-N 0.000 description 1
- WWTKWTCRJNEVSL-UHFFFAOYSA-N 3-amino-6-(trifluoromethyl)phthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C=C1)C(F)(F)F)C(=O)O WWTKWTCRJNEVSL-UHFFFAOYSA-N 0.000 description 1
- HGPYNPQGNLFTII-UHFFFAOYSA-N 3-amino-6-bromophthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C=C1)Br)C(=O)O HGPYNPQGNLFTII-UHFFFAOYSA-N 0.000 description 1
- VFUXNQNUOZZXGE-UHFFFAOYSA-N 3-amino-6-ethoxycarbonylphthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C=C1)C(=O)OCC)C(=O)O VFUXNQNUOZZXGE-UHFFFAOYSA-N 0.000 description 1
- MDZJICZMKNDUDK-UHFFFAOYSA-N 3-amino-6-fluorophthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C=C1)F)C(=O)O MDZJICZMKNDUDK-UHFFFAOYSA-N 0.000 description 1
- IHGCCIAXAAWTSR-UHFFFAOYSA-N 3-amino-6-nitrophthalic acid Chemical compound NC1=CC=C([N+]([O-])=O)C(C(O)=O)=C1C(O)=O IHGCCIAXAAWTSR-UHFFFAOYSA-N 0.000 description 1
- NHLAPJMCARJFOG-UHFFFAOYSA-N 3-methyl-1,4-dihydropyrazol-5-one Chemical compound CC1=NNC(=O)C1 NHLAPJMCARJFOG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 1
- KOGDFDWINXIWHI-OWOJBTEDSA-N 4-[(e)-2-(4-aminophenyl)ethenyl]aniline Chemical compound C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1 KOGDFDWINXIWHI-OWOJBTEDSA-N 0.000 description 1
- HSBOCPVKJMBWTF-UHFFFAOYSA-N 4-[1-(4-aminophenyl)ethyl]aniline Chemical compound C=1C=C(N)C=CC=1C(C)C1=CC=C(N)C=C1 HSBOCPVKJMBWTF-UHFFFAOYSA-N 0.000 description 1
- GQBONCZDJQXPLV-UHFFFAOYSA-N 4-aminoisoindole-1,3-dione Chemical compound NC1=CC=CC2=C1C(=O)NC2=O GQBONCZDJQXPLV-UHFFFAOYSA-N 0.000 description 1
- QEVZFZGTXATUNR-UHFFFAOYSA-N 6-amino-1,3-benzodioxole-4,5-dicarboxylic acid Chemical compound NC1=C(C(C(=O)O)=C2C(=C1)OCO2)C(=O)O QEVZFZGTXATUNR-UHFFFAOYSA-N 0.000 description 1
- IMQWRQAIXSBGOV-UHFFFAOYSA-N 6-amino-3,4-dimethoxyphthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C(=C1)OC)OC)C(=O)O IMQWRQAIXSBGOV-UHFFFAOYSA-N 0.000 description 1
- OHIGOQSQVVKSRW-UHFFFAOYSA-N 6-amino-3-ethoxy-4-methoxyphthalic acid Chemical compound NC1=C(C(C(=O)O)=C(C(=C1)OC)OCC)C(=O)O OHIGOQSQVVKSRW-UHFFFAOYSA-N 0.000 description 1
- OUKZUIOFTUUCEN-UHFFFAOYSA-N 7$l^{6}-thiabicyclo[4.1.0]hepta-1,3,5-triene 7,7-dioxide Chemical compound C1=CC=C2S(=O)(=O)C2=C1 OUKZUIOFTUUCEN-UHFFFAOYSA-N 0.000 description 1
- SNCJAJRILVFXAE-UHFFFAOYSA-N 9h-fluorene-2,7-diamine Chemical compound NC1=CC=C2C3=CC=C(N)C=C3CC2=C1 SNCJAJRILVFXAE-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 125000005603 azodicarboxylic group Chemical group 0.000 description 1
- JCAWSUJCJVBDBW-UHFFFAOYSA-N benzene-1,2-diamine;ethane-1,2-diamine Chemical compound NCCN.NC1=CC=CC=C1N JCAWSUJCJVBDBW-UHFFFAOYSA-N 0.000 description 1
- ZCILODAAHLISPY-UHFFFAOYSA-N biphenyl ether Natural products C1=C(CC=C)C(O)=CC(OC=2C(=CC(CC=C)=CC=2)O)=C1 ZCILODAAHLISPY-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- JIQNMYASOQEKPG-UHFFFAOYSA-N butane-1,4-diamine;ethane-1,2-diamine Chemical compound NCCN.NCCCCN JIQNMYASOQEKPG-UHFFFAOYSA-N 0.000 description 1
- FVZDQGFTRQWGJP-UHFFFAOYSA-N butane-1,4-diamine;hexane-1,6-diamine Chemical compound NCCCCN.NCCCCCCN FVZDQGFTRQWGJP-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000001470 diamides Chemical class 0.000 description 1
- VEJKSNHPNFHCLF-UHFFFAOYSA-N dimethyl 3-aminobenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(N)=C1C(=O)OC VEJKSNHPNFHCLF-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- WBFXQKNQVZMOSQ-UHFFFAOYSA-N ethyl 5-oxo-1-phenyl-4h-pyrazole-3-carboxylate Chemical compound O=C1CC(C(=O)OCC)=NN1C1=CC=CC=C1 WBFXQKNQVZMOSQ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SHTHWCQBJTUESB-UHFFFAOYSA-N ethyl hypofluorite Chemical compound CCOF SHTHWCQBJTUESB-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- OKBVMLGZPNDWJK-UHFFFAOYSA-N naphthalene-1,4-diamine Chemical compound C1=CC=C2C(N)=CC=C(N)C2=C1 OKBVMLGZPNDWJK-UHFFFAOYSA-N 0.000 description 1
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 1
- GOGZBMRXLADNEV-UHFFFAOYSA-N naphthalene-2,6-diamine Chemical compound C1=C(N)C=CC2=CC(N)=CC=C21 GOGZBMRXLADNEV-UHFFFAOYSA-N 0.000 description 1
- HBJPJUGOYJOSLR-UHFFFAOYSA-N naphthalene-2,7-diamine Chemical compound C1=CC(N)=CC2=CC(N)=CC=C21 HBJPJUGOYJOSLR-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
- C09B43/32—Preparation of azo dyes from other azo compounds by reacting carboxylic or sulfonic groups, or derivatives thereof, with amines; by reacting keto-groups with amines
- C09B43/34—Preparation of azo dyes from other azo compounds by reacting carboxylic or sulfonic groups, or derivatives thereof, with amines; by reacting keto-groups with amines by reacting ortho- or peri-dicarboxylic dyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0048167 | 1966-01-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1544556A1 true DE1544556A1 (de) | 1970-04-09 |
Family
ID=7102083
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661544556 Pending DE1544556A1 (de) | 1966-01-14 | 1966-01-14 | Azofarbstoffe und Verfahren zu deren Herstellung |
Country Status (8)
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083842A (en) * | 1971-08-20 | 1978-04-11 | Sandoz Ltd. | Diazo compounds containing two optionally substituted-5-arylazo-6-hydroxypyridone-2 radicals linked through their nitrogen atoms |
| JPS56143437A (en) * | 1980-04-11 | 1981-11-09 | Ricoh Co Ltd | Electrophotographic receptor |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1444729A1 (de) * | 1963-08-29 | 1969-05-14 | Siegle & Co Gmbh G | Verfahren zur Herstellung von neuen Azopigmentfarbstoffen |
-
1966
- 1966-01-14 DE DE19661544556 patent/DE1544556A1/de active Pending
- 1966-07-15 CH CH1030366A patent/CH475314A/de not_active IP Right Cessation
- 1966-07-19 US US566210A patent/US3467643A/en not_active Expired - Lifetime
- 1966-11-18 GB GB51686/66A patent/GB1134257A/en not_active Expired
-
1967
- 1967-01-09 BE BE692354D patent/BE692354A/xx unknown
- 1967-01-13 FR FR91049A patent/FR1507900A/fr not_active Expired
- 1967-01-13 NL NL6700575A patent/NL6700575A/xx unknown
- 1967-01-14 ES ES0335647A patent/ES335647A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES335647A1 (es) | 1967-12-01 |
| GB1134257A (en) | 1968-11-20 |
| CH475314A (de) | 1969-07-15 |
| BE692354A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-06-16 |
| NL6700575A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-07-17 |
| FR1507900A (fr) | 1967-12-29 |
| US3467643A (en) | 1969-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1768892B2 (de) | Disazopigmente und deren Verwendung | |
| DE1544460C3 (de) | Bis-(acetoacetyl)-arylendiamiddisazopigmente | |
| DE2254625C3 (de) | Disazopigmente und deren Verwendung | |
| DE2243999A1 (de) | Neue disazopigmente, verfahren zu deren herstellung und verwendung | |
| DE2243955A1 (de) | Neue disazopigmente und verfahren zu deren herstellung und verwendung | |
| DE1544453A1 (de) | Verfahren zur Herstellung von Disazopigmenten | |
| DE2244035C3 (de) | Disazopigmente, Verfahren zu deren Herstellung und ihre Verwendung zum Pigmentieren von hochmolekularem organischen Material | |
| DE1544556A1 (de) | Azofarbstoffe und Verfahren zu deren Herstellung | |
| DE2032601A1 (de) | Neue Disazopigmente und Verfahren zu deren Herstellung | |
| DE2935974A1 (de) | Disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2145422C3 (de) | Neue Disazopigmente | |
| DE1544459A1 (de) | Verfahren zur Herstellung von Disazopigmenten | |
| DE1544553A1 (de) | Azofarbstoffe und Verfahren zu deren Herstellung | |
| DE1944344A1 (de) | Neue wasserunloesliche Azoverbindungen und Verfahren zu deren Herstellung | |
| EP0162806A2 (de) | Monoazoverbindungen enthaltend mindestens eine Carbonamidgruppe | |
| DE1250033B (de) | Verfahren zur Herstellung von linearen Chinacridindionen | |
| DE2002067A1 (de) | Neue Disazopigmente und Verfahren zu deren Herstellung | |
| DE1544546A1 (de) | Azofarbstoffe und Verfahren zu deren Herstellung | |
| DE2544568C3 (de) | Sulfonsäuregruppenfreie Azofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung als Pigmente in Lacken, Druckfarben oder Kunststoffen | |
| DE1644159C3 (de) | Sulfonsäuregruppenfreie Azofarbstoffe | |
| DE2430197A1 (de) | Neue disazopigmente und verfahren zu deren herstellung | |
| DE1544565A1 (de) | Azofarbstoffe und Verfahren zu deren Herstellung | |
| DE1544537A1 (de) | Azofarbstoffe und Verfahren zu deren Herstellung | |
| DE2342815A1 (de) | Neue dioxazinfarbstoffe | |
| DE1644218A1 (de) | Monoazofarbstoffe |