DE1519475C - - Google Patents
Info
- Publication number
- DE1519475C DE1519475C DE1519475C DE 1519475 C DE1519475 C DE 1519475C DE 1519475 C DE1519475 C DE 1519475C
- Authority
- DE
- Germany
- Prior art keywords
- impregnated
- formula
- polyester
- terephthalic acid
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920000728 polyester Polymers 0.000 claims description 10
- 239000002657 fibrous material Substances 0.000 claims description 9
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 7
- 239000006185 dispersion Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 4
- 238000001035 drying Methods 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 230000003287 optical Effects 0.000 claims description 3
- 238000005282 brightening Methods 0.000 claims description 2
- 239000004744 fabric Substances 0.000 description 13
- 230000000694 effects Effects 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 229920000742 Cotton Polymers 0.000 description 6
- -1 ethyleneoxy groups Chemical group 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 230000002087 whitening Effects 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- QPKOBORKPHRBPS-UHFFFAOYSA-N Bis(2-Hydroxyethyl) terephthalate Chemical compound OCCOC(=O)C1=CC=C(C(=O)OCCO)C=C1 QPKOBORKPHRBPS-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- UKLNMMHNWFDKNT-UHFFFAOYSA-M Sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N Stearyl alcohol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920002401 polyacrylamide Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 229960002218 sodium chlorite Drugs 0.000 description 2
- RRZWDHKKHBGBLX-UHFFFAOYSA-N C1=CC(C=CC=2C=CC(NC=3N=NN=CC=3)=CC=2)=C(S(O)(=O)=O)C(S(=O)(=O)O)=C1NC1=CC=NN=N1 Chemical class C1=CC(C=CC=2C=CC(NC=3N=NN=CC=3)=CC=2)=C(S(O)(=O)=O)C(S(=O)(=O)O)=C1NC1=CC=NN=N1 RRZWDHKKHBGBLX-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920002456 HOTAIR Polymers 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N Sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 230000001681 protective Effects 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 210000001519 tissues Anatomy 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0713882B1 (de) | Phosphonomethylierte Chitosane | |
| DE69221955T2 (de) | Mischung von Dispersionfarbstoffen | |
| DE1519475B1 (de) | Verfahren zum optischen Aufhellen von Polyester der Terephthalsaeure enthaltendem Fasermaterial | |
| DE2828416A1 (de) | Stabilisatorzubereitung fuer wasserstoffperoxidhaltige baeder und deren verwendung | |
| DE1519475C (xx) | ||
| DE973632C (de) | Verfahren zum Bleichen von Holzzellstoff | |
| DE2148590A1 (de) | Verfahren zum bleichen mit chloriten | |
| DE1904424C3 (de) | Verfahren zum optischen Aufhellen von Fasermaterialien aus Polyacrylnitril | |
| EP0017190B1 (de) | Verfahren zum oxidativen Entschlichten | |
| AT143295B (xx) | ||
| DE849986C (de) | Verfahren zur Erhoehung des Weissgehaltes von Textilien und anderen Waren | |
| DE1419357A1 (de) | Verfahren zum Beuchen und Bleichen von Textilien | |
| CH248565A (de) | Scherkopf für Rasiergeräte. | |
| DE2155941C3 (de) | Verfahren zur Herstellung von quaternären kationenaktiven Stärkeäthern und diese enthaltende flüssige Wäschepflegemittel | |
| DE3888475T2 (de) | Verfahren zum Behandeln von Textilien mit Harzen. | |
| DE1955310A1 (de) | Verwendung von waessrigen Dispersionen von Mischungen aus Benzoxazol- und Phenyloxazolderivaten zum optischen Aufhellen | |
| AT151635B (de) | Verfahren zur Erzielung eines weißen Farbtones bei Textilien und Stärkepräparat. | |
| DE857790C (de) | Verfahren zum Bleichen von natuerlichen oder kuenstlichen Harzen, einschliesslich synthetischer Fasern auf Kunstharzbasis, wie Fasern aus Polyamiden oder Celluloseesterkunstseide | |
| DE656195C (de) | Verfahren zum Bleichen von tierischer Faser | |
| DE744609C (de) | Wasch-, Netz-, Dispergier- und Emulgiermittel | |
| DE1594855B2 (de) | Verfahren zum optischen aufhellen von textilmaterialien und mittel zu dessen durchfuehrung | |
| DE1519486C3 (de) | Optisches Aufhellungsmittel | |
| DE1928814A1 (de) | Verfahren zur Permanentausruestung von Cellulosefasern enthaltenden Textilmaterialien | |
| DE1007726B (de) | Appreturmasse fuer Textilien | |
| AT156592B (de) | Verfahren zur Herstellung von Stärkelösungen, insbesondere für das Schlichten und Appretieren von Textilien, und Mittel zur Durchführung dieses Verfahrens. |