DE1512406B2 - Vertikalablenkschaltung fur Fernseh empfanger - Google Patents
Vertikalablenkschaltung fur Fernseh empfangerInfo
- Publication number
- DE1512406B2 DE1512406B2 DE19671512406 DE1512406A DE1512406B2 DE 1512406 B2 DE1512406 B2 DE 1512406B2 DE 19671512406 DE19671512406 DE 19671512406 DE 1512406 A DE1512406 A DE 1512406A DE 1512406 B2 DE1512406 B2 DE 1512406B2
- Authority
- DE
- Germany
- Prior art keywords
- voltage
- capacitor
- resistor
- circuit
- deflection
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003990 capacitor Substances 0.000 claims description 37
- 238000004804 winding Methods 0.000 claims description 14
- 230000001419 dependent effect Effects 0.000 claims description 4
- 239000004065 semiconductor Substances 0.000 claims description 3
- 230000000903 blocking effect Effects 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000010355 oscillation Effects 0.000 description 2
- PCLIRWBVOVZTOK-UHFFFAOYSA-M 2-(1-methylpyrrolidin-1-ium-1-yl)ethyl 2-hydroxy-2,2-diphenylacetate;iodide Chemical compound [I-].C=1C=CC=CC=1C(O)(C=1C=CC=CC=1)C(=O)OCC[N+]1(C)CCCC1 PCLIRWBVOVZTOK-UHFFFAOYSA-M 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 230000001360 synchronised effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K4/00—Generating pulses having essentially a finite slope or stepped portions
- H03K4/06—Generating pulses having essentially a finite slope or stepped portions having triangular shape
- H03K4/08—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape
- H03K4/085—Protection of sawtooth generators
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K4/00—Generating pulses having essentially a finite slope or stepped portions
- H03K4/06—Generating pulses having essentially a finite slope or stepped portions having triangular shape
- H03K4/08—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape
- H03K4/48—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices
- H03K4/60—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices in which a sawtooth current is produced through an inductor
- H03K4/69—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices in which a sawtooth current is produced through an inductor using a semiconductor device operating as an amplifier
- H03K4/72—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements semiconductor devices in which a sawtooth current is produced through an inductor using a semiconductor device operating as an amplifier combined with means for generating the driving pulses
Landscapes
- Details Of Television Scanning (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US538076A US3402319A (en) | 1966-03-28 | 1966-03-28 | Television deflection circuit with temperature compensation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1512406A1 DE1512406A1 (de) | 1969-04-30 |
| DE1512406B2 true DE1512406B2 (de) | 1971-01-21 |
Family
ID=24145377
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671512406 Pending DE1512406B2 (de) | 1966-03-28 | 1967-03-28 | Vertikalablenkschaltung fur Fernseh empfanger |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3402319A (enExample) |
| JP (1) | JPS4921443B1 (enExample) |
| AT (1) | AT278924B (enExample) |
| BE (1) | BE696200A (enExample) |
| DE (1) | DE1512406B2 (enExample) |
| ES (1) | ES338440A1 (enExample) |
| GB (1) | GB1179961A (enExample) |
| NL (1) | NL160690C (enExample) |
| SE (1) | SE324801B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3492527A (en) * | 1968-04-25 | 1970-01-27 | Motorola Inc | Deflection system with temperature compensated linearity correction network |
| JPS5432427Y2 (enExample) * | 1973-03-19 | 1979-10-08 | ||
| JPS5114861U (enExample) * | 1974-07-17 | 1976-02-03 | ||
| JPS5229657U (enExample) * | 1975-08-22 | 1977-03-02 | ||
| JPS52140458U (enExample) * | 1976-04-20 | 1977-10-25 | ||
| JPS5326557U (enExample) * | 1976-08-13 | 1978-03-07 | ||
| US4096416A (en) * | 1976-11-19 | 1978-06-20 | Rca Corporation | Vertical deflection circuit with retrace switch protection |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3134928A (en) * | 1962-03-23 | 1964-05-26 | Rca Corp | Transistor vertical deflection circuits |
| NL294728A (enExample) * | 1962-07-05 |
-
1966
- 1966-03-28 US US538076A patent/US3402319A/en not_active Expired - Lifetime
-
1967
- 1967-03-21 GB GB03322/67A patent/GB1179961A/en not_active Expired
- 1967-03-22 SE SE4023/67A patent/SE324801B/xx unknown
- 1967-03-23 NL NL6704315.A patent/NL160690C/xx not_active IP Right Cessation
- 1967-03-25 JP JP42018789A patent/JPS4921443B1/ja active Pending
- 1967-03-25 ES ES338440A patent/ES338440A1/es not_active Expired
- 1967-03-28 BE BE696200D patent/BE696200A/xx unknown
- 1967-03-28 AT AT295267A patent/AT278924B/de not_active IP Right Cessation
- 1967-03-28 DE DE19671512406 patent/DE1512406B2/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NL6704315A (enExample) | 1967-09-29 |
| NL160690C (nl) | 1979-11-15 |
| GB1179961A (en) | 1970-02-04 |
| NL160690B (nl) | 1979-06-15 |
| AT278924B (de) | 1970-02-25 |
| DE1512406A1 (de) | 1969-04-30 |
| SE324801B (enExample) | 1970-06-15 |
| BE696200A (enExample) | 1967-09-01 |
| JPS4921443B1 (enExample) | 1974-06-01 |
| ES338440A1 (es) | 1968-04-01 |
| US3402319A (en) | 1968-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1099577B (de) | Vertikalablenkschaltung mit Transistoren fuer Fernsehzwecke | |
| DE4113921B4 (de) | Abschalteinrichtung für eine mit einer Ablenkfrequenz arbeitende Schaltung | |
| DE1512406B2 (de) | Vertikalablenkschaltung fur Fernseh empfanger | |
| DE1085914B (de) | Transistorschaltung zum Zufuehren von Saegezahnstroemen an einen Belastungswiderstand | |
| DE1156844B (de) | Saegezahnspannungsgenerator, insbesondere zur zeitlinearen Ablenkung des Abtastflecks von Elektronenstrahlen | |
| DE2166155C3 (de) | Transistorisierte Vertikalablenkschaltung | |
| DE2533599C3 (de) | Integrierbare Ablenk-Schaltungsanordnung | |
| DE845213C (de) | Schaltungsanordnung zur Erzeugung eines saegezahnfoermigen Stromes | |
| DE2119438B2 (de) | Ablenkschaltung mit rueckkopplungskreisen, um ein unverzerrtes raster zu erhalten | |
| DE1462926C3 (de) | Vertikalablenkschaltung für Fernsehempfänger | |
| DE1288124B (de) | Vertikalablenkschaltung für Fernsehempfänger | |
| DE2111750A1 (de) | Schaltungsanordnung zum Erzeugen einer elektrischen Schwingung | |
| DE69013743T2 (de) | Ablenkantriebsstufe in einem Videogerät. | |
| DE3339195C2 (enExample) | ||
| DE3535570C2 (enExample) | ||
| DE3242127C2 (enExample) | ||
| DE2751174B1 (de) | Transistorisierte Vertikalablenkschaltung | |
| DE3728856A1 (de) | Fernseh-ablenkschaltung mit einrichtung zum einstellen einer service-betriebsart | |
| DE2150277C3 (de) | Selbstschwingende Sägezahngeneratorschaltung vorzugsweise für Ablenkschaltungen in Fernsehempfängern | |
| EP0495141B1 (de) | Amplitudenregeleinrichtung | |
| DE1512405C (de) | Vertikalablenkschaltung fur Fernseh empfänger | |
| DE1462925C3 (de) | Transistorisierte Vertikalablenkschaltung mit Ladekondensator für Fernsehempfänger | |
| DE1512405B2 (de) | Vertikalablenkschaltung für Fernsehempfänger | |
| DE2855880A1 (de) | Schaltungsanordnung mit einem regelbaren verstaerker | |
| DE1462927C (de) | Selbstschwingende Vertikalablenk schaltung fur Fernsehempfanger |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 |