DE1477978A1 - Schleuderrad fuer kleinste Teile,insbesondere Schleifmittelteilchen - Google Patents
Schleuderrad fuer kleinste Teile,insbesondere SchleifmittelteilchenInfo
- Publication number
- DE1477978A1 DE1477978A1 DE19641477978 DE1477978A DE1477978A1 DE 1477978 A1 DE1477978 A1 DE 1477978A1 DE 19641477978 DE19641477978 DE 19641477978 DE 1477978 A DE1477978 A DE 1477978A DE 1477978 A1 DE1477978 A1 DE 1477978A1
- Authority
- DE
- Germany
- Prior art keywords
- throwing
- locking bolt
- centrifugal wheel
- shovel
- section
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000002245 particle Substances 0.000 title description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 5
- 230000000295 complement effect Effects 0.000 claims description 2
- 230000006835 compression Effects 0.000 claims description 2
- 238000007906 compression Methods 0.000 claims description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 claims 1
- 230000000694 effects Effects 0.000 description 2
- 239000003082 abrasive agent Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000005496 tempering Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B24—GRINDING; POLISHING
- B24C—ABRASIVE OR RELATED BLASTING WITH PARTICULATE MATERIAL
- B24C5/00—Devices or accessories for generating abrasive blasts
- B24C5/06—Impeller wheels; Rotor blades therefor
- B24C5/062—Rotor blades or vanes; Locking means therefor
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
- Polishing Bodies And Polishing Tools (AREA)
- Turbine Rotor Nozzle Sealing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US294007A US3241266A (en) | 1963-07-10 | 1963-07-10 | Abrasive particle throwing wheel assembly |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1477978A1 true DE1477978A1 (de) | 1969-07-17 |
| DE1477978B2 DE1477978B2 (enExample) | 1973-10-18 |
| DE1477978C3 DE1477978C3 (enExample) | 1974-05-09 |
Family
ID=23131499
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641477978 Granted DE1477978A1 (de) | 1963-07-10 | 1964-07-08 | Schleuderrad fuer kleinste Teile,insbesondere Schleifmittelteilchen |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3241266A (enExample) |
| DE (1) | DE1477978A1 (enExample) |
| GB (1) | GB1026110A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1930122A1 (de) * | 2006-12-07 | 2008-06-11 | Horst-Dieter Schlick | Schleuderrad für eine Strahleinrichtung |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3383804A (en) * | 1965-12-09 | 1968-05-21 | Pangborn Corp | Locking pin retainer for abrasive throwing blades |
| US3654736A (en) * | 1969-09-08 | 1972-04-11 | Benfur Engineering Co | Blade-retention system for a blasting machine |
| US3683556A (en) * | 1970-04-13 | 1972-08-15 | Raymond M Leliaert | Centrifugal blasting wheel |
| US3945150A (en) * | 1975-01-20 | 1976-03-23 | The Carborundum Company | Runnerhead for a throwing wheel |
| CH623770A5 (enExample) * | 1977-11-17 | 1981-06-30 | Fischer Ag Georg | |
| CH623769A5 (enExample) * | 1977-11-17 | 1981-06-30 | Fischer Ag Georg | |
| BE861175A (fr) * | 1977-11-24 | 1978-03-16 | Cockerill Ougree Providence & | Turbine de grenaillage a haute performance |
| USD268114S (en) | 1979-11-13 | 1983-03-01 | Auto Alloys R & D Limited | Impeller wheel blade for an abrasive blasting machine |
| USD269012S (en) | 1979-11-13 | 1983-05-17 | Auto Alloys R & D Limited | Impeller wheel blade for an abrasive blasting machine |
| US4471583A (en) * | 1981-03-18 | 1984-09-18 | The Kennecott Corporation | Vane retention apparatus for abrasive blasting mechanism |
| US4509300A (en) * | 1981-03-18 | 1985-04-09 | Kennecott Corporation | Vane retention apparatus for abrasive blasting machine |
| US4402163A (en) * | 1981-03-18 | 1983-09-06 | Kennecott Corporation | Vane retention apparatus for abrasive blasting machine |
| CA1317765C (en) * | 1989-03-02 | 1993-05-18 | Stefan Fylak | Blasting wheel apparatus and blades therefor |
| GB9014994D0 (en) * | 1990-07-06 | 1990-08-29 | Tilghman Wheelabrator Ltd | Abrasive throwing wheel assemblies |
| GB9211408D0 (en) * | 1992-05-29 | 1992-07-15 | Luttrell Peter B | Rotors for throwing particles centrifugally therefrom |
| US6447378B1 (en) * | 2000-03-08 | 2002-09-10 | Disa Goff, Inc. | Abrasive throwing wheel and abrasive throwing blade |
| JP2004510592A (ja) * | 2000-10-02 | 2004-04-08 | パンボーン・コーポレーション | 研磨剤放出ホィールおよび改良ブレード組立部品 |
| NO327520B1 (no) * | 2007-12-05 | 2009-07-27 | Dynavec As | Anordning ved løpehjul |
| US8043141B1 (en) * | 2009-01-21 | 2011-10-25 | Goff James R | Throwing wheel assembly |
| US8550881B2 (en) * | 2009-11-16 | 2013-10-08 | Pangborn Corporation | Vane, mounting assembly and throwing wheel apparatus having a locking member tapered in two planes |
| DE102010010120B4 (de) * | 2010-03-04 | 2013-04-11 | Rösler Holding GmbH & Co. KG | Schleuderrad |
| BR112017006031A2 (pt) * | 2014-09-25 | 2017-12-12 | Wheelabrator Group Ltd | lâmina para máquina de roda de jateamento centrífuga e método de manutenção de uma máquina de roda de jateamento centrífuga |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US250448A (en) * | 1881-12-06 | Nut-lock | ||
| US1051246A (en) * | 1912-03-09 | 1913-01-21 | David S Marple | Nut-lock. |
| US1893467A (en) * | 1931-06-12 | 1933-01-03 | Chain Belt Co | Locking pin construction |
| US2590576A (en) * | 1934-05-17 | 1952-03-25 | Pangborn Corp | Abrading apparatus |
| US2049466A (en) * | 1935-07-05 | 1936-08-04 | Minich Verne Elwood | Abrasive throwing wheel |
| US2119812A (en) * | 1936-05-14 | 1938-06-07 | Pangborn Corp | Abrading apparatus |
| US2097169A (en) * | 1936-08-24 | 1937-10-26 | Wasserbach Franz | Cotter pin |
| US2369408A (en) * | 1938-02-01 | 1945-02-13 | Pangborn Corp | Abrading apparatus |
| US2320364A (en) * | 1940-03-19 | 1943-06-01 | Pangborn Corp | Abrading apparatus |
| US2439692A (en) * | 1945-12-07 | 1948-04-13 | Frank W Mckay | Dowel pin |
| US2869289A (en) * | 1957-01-24 | 1959-01-20 | Pangborn Corp | Reversible centrifugal blasting method and apparatus |
-
1963
- 1963-07-10 US US294007A patent/US3241266A/en not_active Expired - Lifetime
-
1964
- 1964-07-02 GB GB27320/64A patent/GB1026110A/en not_active Expired
- 1964-07-08 DE DE19641477978 patent/DE1477978A1/de active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1930122A1 (de) * | 2006-12-07 | 2008-06-11 | Horst-Dieter Schlick | Schleuderrad für eine Strahleinrichtung |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1477978C3 (enExample) | 1974-05-09 |
| DE1477978B2 (enExample) | 1973-10-18 |
| US3241266A (en) | 1966-03-22 |
| GB1026110A (en) | 1966-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1477978A1 (de) | Schleuderrad fuer kleinste Teile,insbesondere Schleifmittelteilchen | |
| DE3233884A1 (de) | Einrichtung fuer eine winkellehre zum verbessern der befestigung eines winkelmaessig einstellbaren lineals der winkellehre an deren basis in ausgewaehlten relativstellungen | |
| DE2801460C2 (enExample) | ||
| DE3209610A1 (de) | Schleuderrad fuer schleuderstrahlmaschinen | |
| DE2538228A1 (de) | Schleuderstrahlanlage | |
| DE3309511A1 (de) | Schleuderrad fuer schleuderstrahlmaschinen | |
| DE650607C (de) | Schlaegerkopf fuer Schlaegermuehlen | |
| DE1233701B (de) | Mischvorrichtung fuer koerniges Material | |
| DE1657370B2 (de) | Mischer mit einem liegenden mischtrog und auf einer welle befestigten pilzfoermigen mischfluegeln | |
| DE2339058A1 (de) | Rost fuer eine muehle oder eine andere verarbeitungsanlage | |
| DE68359C (de) | In den Radkörper geklemmte Schaufeln für Dampf- oder Gasturbinen | |
| DE1236990B (de) | Ruehrschaufelanordnung fuer einen Betonzwangsmischer | |
| DE716885C (de) | Kollergang zur Behandlung von Mischguetern | |
| AT250427B (de) | Schneeräumgerät | |
| DE3101875A1 (de) | Container-befestigungsvorrichtung | |
| WO2017089573A1 (de) | Messerkopfscheibe mit verbessertem transportverhalten und verbesserter hygiene | |
| DE2454476B2 (de) | Einzugsbalken fuer schneidmuehlen | |
| DE726926C (de) | Formsandmischmaschine | |
| AT206634B (de) | Rundlaufendes Fräswerkzeug für Holz od. dgl. mit einem auswechselbaren Vorschneider | |
| DE2319810C3 (de) | Rotationsmahlanlage | |
| DE541421C (de) | Drehbar am Maschinengestell angebrachter und in Hoehe verstellbarer Abstreifer, insbesondere fuer Loch- und Stanzmaschinen | |
| DE2705077B2 (de) | Mischer | |
| CH250584A (de) | Obstmühle. | |
| DE856298C (de) | Schaufelring fuer Radialturbinen | |
| DE89783C (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |