DE1443779A1 - Verfahren zur Herstellung von Nortriptylenen - Google Patents
Verfahren zur Herstellung von NortriptylenenInfo
- Publication number
- DE1443779A1 DE1443779A1 DE19631443779 DE1443779A DE1443779A1 DE 1443779 A1 DE1443779 A1 DE 1443779A1 DE 19631443779 DE19631443779 DE 19631443779 DE 1443779 A DE1443779 A DE 1443779A DE 1443779 A1 DE1443779 A1 DE 1443779A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- sodium
- preparation
- cyclohepta
- dibenzo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 229910052708 sodium Inorganic materials 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 150000003509 tertiary alcohols Chemical class 0.000 claims description 3
- 230000018044 dehydration Effects 0.000 claims description 2
- 238000006297 dehydration reaction Methods 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- -1 3-methylaminopropylidene Chemical group 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000001993 dienes Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001345 alkine derivatives Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003385 sodium Chemical class 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 125000001650 tertiary alcohol group Chemical group 0.000 description 2
- MUDBBWMXLXNKTQ-UHFFFAOYSA-N 2-chloro-n-methylprop-2-en-1-amine Chemical compound CNCC(Cl)=C MUDBBWMXLXNKTQ-UHFFFAOYSA-N 0.000 description 1
- 208000020401 Depressive disease Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- DPWPWRLQFGFJFI-UHFFFAOYSA-N Pargyline Chemical compound C#CCN(C)CC1=CC=CC=C1 DPWPWRLQFGFJFI-UHFFFAOYSA-N 0.000 description 1
- 150000000475 acetylene derivatives Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- WAJKHNTVDCZXPH-UHFFFAOYSA-N disodium acetylide Chemical class [Na+].[Na+].[C-]#[C-] WAJKHNTVDCZXPH-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- HQFYIDOMCULPIW-UHFFFAOYSA-N n-methylprop-2-yn-1-amine Chemical compound CNCC#C HQFYIDOMCULPIW-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229960001779 pargyline Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003109 potassium Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical class NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 1
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17579662A | 1962-02-26 | 1962-02-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1443779A1 true DE1443779A1 (de) | 1968-11-07 |
Family
ID=22641664
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19631443779 Pending DE1443779A1 (de) | 1962-02-26 | 1963-02-25 | Verfahren zur Herstellung von Nortriptylenen |
Country Status (6)
| Country | Link |
|---|---|
| BR (1) | BR6347219D0 (https=) |
| CH (1) | CH481855A (https=) |
| DE (1) | DE1443779A1 (https=) |
| DK (1) | DK110218C (https=) |
| FR (1) | FR1553653A (https=) |
| GB (1) | GB1040174A (https=) |
-
1963
- 1963-02-22 BR BR14721963A patent/BR6347219D0/pt unknown
- 1963-02-22 CH CH228063A patent/CH481855A/de not_active IP Right Cessation
- 1963-02-22 FR FR1553653D patent/FR1553653A/fr not_active Expired
- 1963-02-25 GB GB751163A patent/GB1040174A/en not_active Expired
- 1963-02-25 DE DE19631443779 patent/DE1443779A1/de active Pending
- 1963-02-25 DK DK86363A patent/DK110218C/da active
Also Published As
| Publication number | Publication date |
|---|---|
| FR1553653A (https=) | 1969-01-17 |
| CH481855A (de) | 1969-11-30 |
| BR6347219D0 (pt) | 1973-08-28 |
| GB1040174A (en) | 1966-08-24 |
| DK110218C (da) | 1971-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461604C2 (https=) | ||
| DE2411382B2 (de) | 2-Tetrahydrofurfuryl-6,7-benzomorphane, Verfahren zur Herstellung und deren Verwendung | |
| DE2366625C2 (https=) | ||
| DE69027569T2 (de) | Verfahren zur Herstellung von Enynderivaten | |
| CH637935A5 (de) | Verfahren zur herstellung neuer derivate von perhydro-aza-heterocyclen. | |
| DE68924751T2 (de) | Azacyclische Verbindungen, verwendbar als Arzneimittel. | |
| DE3888811T2 (de) | Tricyclische Carbamate, Verfahren zu ihrer Herstellung und ihre therapeutische Verwendung. | |
| DE1952896A1 (de) | Heterocyclische Verbindungen und Verfahren zu ihrer Herstellung | |
| DE1443779A1 (de) | Verfahren zur Herstellung von Nortriptylenen | |
| DE1568762A1 (de) | Verfahren zur Herstellung von substituierten Cyclohexylaminen | |
| DE1301312B (de) | Verfahren zur Herstellung von Pyrryl-(2)-acetonitrilen | |
| CH629776A5 (de) | Verfahren zur herstellung neuer phenylazacycloalkane. | |
| DE2602846C2 (de) | Verfahren zur Herstellung von 2-(2-Thienyl)äthylaminen | |
| DE593192C (de) | Verfahren zur Darstellung von N-substituierten heterocyclischen Verbindungen | |
| DE766207C (de) | Verfahren zur Herstellung von basischen Verbindungen der Diarylmethanreihe | |
| DE901649C (de) | Verfahren zur Herstellung von Derivaten des Imidazols | |
| DE1177633B (de) | Verfahren zur Herstellung aminoalkylierter 9,10-Dihydroanthracene | |
| DE952980C (de) | Verfahren zur Herstellung von Cumaronderivaten | |
| DE1105872B (de) | Verfahren zur Herstellung von substituierten Isonicotinsaeure-(diphenylalkyl)-amiden | |
| DE2201804C3 (de) | Phenyläthylbenzylamine und Verfahren zu ihrer Herstellung | |
| DE2623257A1 (de) | Verfahren zur herstellung von n-alkenyl-2-aminomethyl-pyrrolidinen | |
| DE1103936B (de) | Verfahren zur Herstellung von substituierten 2, 3-Diphenyl-propylaminen | |
| DE1468926A1 (de) | Verfahren zur Herstellung von neuen Acetamidinderivaten | |
| DE2345972A1 (de) | Verfahren zur herstellung von 10-aminodihydrodibenzoazepinen | |
| CH615422A5 (https=) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 |