DE1435614A1 - Verfahren zur Herstellung von Kunstfaeden - Google Patents
Verfahren zur Herstellung von KunstfaedenInfo
- Publication number
- DE1435614A1 DE1435614A1 DE19611435614 DE1435614A DE1435614A1 DE 1435614 A1 DE1435614 A1 DE 1435614A1 DE 19611435614 DE19611435614 DE 19611435614 DE 1435614 A DE1435614 A DE 1435614A DE 1435614 A1 DE1435614 A1 DE 1435614A1
- Authority
- DE
- Germany
- Prior art keywords
- thread
- threads
- temperature
- strength
- spinning
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title description 4
- 238000009987 spinning Methods 0.000 claims description 20
- 229920000642 polymer Polymers 0.000 claims description 18
- -1 Polyethylene terephthalate Polymers 0.000 claims description 17
- 238000010438 heat treatment Methods 0.000 claims description 14
- 238000001816 cooling Methods 0.000 claims description 12
- 239000000835 fiber Substances 0.000 claims description 11
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 7
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 7
- 238000005452 bending Methods 0.000 claims description 3
- 230000007423 decrease Effects 0.000 claims description 3
- 238000002074 melt spinning Methods 0.000 claims description 3
- 229920005613 synthetic organic polymer Polymers 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- 239000004952 Polyamide Substances 0.000 description 13
- 229920002647 polyamide Polymers 0.000 description 13
- 229920000728 polyester Polymers 0.000 description 12
- 239000000463 material Substances 0.000 description 10
- 239000013068 control sample Substances 0.000 description 9
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 5
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 5
- 229920002302 Nylon 6,6 Polymers 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 239000004743 Polypropylene Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229920001155 polypropylene Polymers 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 2
- 241000239290 Araneae Species 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- 206010061592 cardiac fibrillation Diseases 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- RWRIWBAIICGTTQ-UHFFFAOYSA-N difluoromethane Chemical compound FCF RWRIWBAIICGTTQ-UHFFFAOYSA-N 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000002600 fibrillogenic effect Effects 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000001000 micrograph Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 229920000620 organic polymer Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- PXGZQGDTEZPERC-UHFFFAOYSA-N 1,4-cyclohexanedicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)CC1 PXGZQGDTEZPERC-UHFFFAOYSA-N 0.000 description 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 241000005672 Baia Species 0.000 description 1
- 101100129922 Caenorhabditis elegans pig-1 gene Proteins 0.000 description 1
- 241000283153 Cetacea Species 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229920001634 Copolyester Polymers 0.000 description 1
- 101100520057 Drosophila melanogaster Pig1 gene Proteins 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 244000025221 Humulus lupulus Species 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 229920002396 Polyurea Polymers 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000001142 dicarboxylic acid group Chemical group 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000000635 electron micrograph Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920006111 poly(hexamethylene terephthalamide) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 229920006295 polythiol Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 125000006839 xylylene group Chemical group 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01D—MECHANICAL METHODS OR APPARATUS IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS
- D01D5/00—Formation of filaments, threads, or the like
- D01D5/08—Melt spinning methods
- D01D5/084—Heating filaments, threads or the like, leaving the spinnerettes
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01D—MECHANICAL METHODS OR APPARATUS IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS
- D01D5/00—Formation of filaments, threads, or the like
- D01D5/08—Melt spinning methods
- D01D5/088—Cooling filaments, threads or the like, leaving the spinnerettes
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Artificial Filaments (AREA)
- Spinning Methods And Devices For Manufacturing Artificial Fibers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2557660A | 1960-04-29 | 1960-04-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1435614A1 true DE1435614A1 (de) | 1969-12-04 |
Family
ID=21826857
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19611435614 Pending DE1435614A1 (de) | 1960-04-29 | 1961-04-28 | Verfahren zur Herstellung von Kunstfaeden |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3361859A (enExample) |
| CA (1) | CA697541A (enExample) |
| DE (1) | DE1435614A1 (enExample) |
| FR (1) | FR1287939A (enExample) |
| GB (1) | GB900009A (enExample) |
| IT (1) | IT650394A (enExample) |
| NL (1) | NL264104A (enExample) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3447202A (en) * | 1964-07-06 | 1969-06-03 | Uniroyal Inc | Spinning apparatus with a spinneret and an elongated chamber with means to perform retarded cooling |
| US3291880A (en) * | 1964-12-23 | 1966-12-13 | Du Pont | Process for preparing an undrawn, low birefringence polyamide yarn |
| GB1111649A (en) * | 1965-07-08 | 1968-05-01 | Fuji Boseki Kabushiki Kaisha | Method and apparatus for melt spinning of synthetic filaments |
| US3539676A (en) * | 1966-08-29 | 1970-11-10 | Celanese Corp | Process for producing filaments and films of polymers of alkylene sulfides |
| US3504078A (en) * | 1967-09-29 | 1970-03-31 | Du Pont | Melt spinning process |
| US3549741A (en) * | 1967-10-30 | 1970-12-22 | Mildred H Caison | Process for preparing improved carpet yarn |
| US3536804A (en) * | 1967-12-19 | 1970-10-27 | Toyo Boseki | Process for producing polyxyleneadipamide fibers |
| US3895090A (en) * | 1968-04-09 | 1975-07-15 | Asahi Chemical Ind | Method for direct spinning of polyethylene-1,2-diphenoxyethane-p,p{40 -dicarboxylate fibers |
| US3624193A (en) * | 1969-02-25 | 1971-11-30 | Du Pont | Polyamide filamentmaking process including solid-state polymerization |
| US3645085A (en) * | 1969-11-13 | 1972-02-29 | Chemcell Ltd | Hairy lustrous yarn |
| US3969462A (en) * | 1971-07-06 | 1976-07-13 | Fiber Industries, Inc. | Polyester yarn production |
| US4113821A (en) * | 1971-09-23 | 1978-09-12 | Allied Chemical Corporation | Process for preparing high strength polyamide and polyester filamentary yarn |
| US4000239A (en) * | 1971-12-13 | 1976-12-28 | Teijin Limited | Process for spinning naphthalate polyester fibers |
| DE2161967C3 (de) * | 1971-12-14 | 1984-07-26 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung eines Drahtes aus hochmolekularen, linearen Polyestern |
| US4043985A (en) * | 1971-12-14 | 1977-08-23 | Hoechst Aktiengesellschaft | Tire monofilaments |
| US4096226A (en) * | 1972-01-03 | 1978-06-20 | Basf Aktiengesellschaft | Integrated spin-draw-texturizing process for manufacture of texturized polyamide filaments |
| NL7304178A (enExample) * | 1972-04-06 | 1973-10-09 | ||
| US3975488A (en) * | 1972-10-24 | 1976-08-17 | Fiber Industries, Inc. | Process for preparing poly(tetramethylene terephthalate) yarn |
| US4195161A (en) * | 1973-09-26 | 1980-03-25 | Celanese Corporation | Polyester fiber |
| FR2246587B1 (enExample) * | 1973-10-03 | 1978-08-11 | Nat Res Dev | |
| GB1506565A (en) * | 1974-03-05 | 1978-04-05 | Nat Res Dev | Production of polyethylene filaments |
| US4045534A (en) * | 1974-05-24 | 1977-08-30 | Allied Chemical Corporation | Process for melt-spinning synthetic fibers |
| US3963678A (en) * | 1974-06-17 | 1976-06-15 | E. I. Du Pont De Nemours And Company | Large denier polyethylene terephthalate monofilaments having good transverse properties |
| US4070432A (en) * | 1975-02-13 | 1978-01-24 | Allied Chemical Corporation | Production of low shrink polyester fiber |
| GB1568964A (en) * | 1975-11-05 | 1980-06-11 | Nat Res Dev | Oriented polymer materials |
| US4101525A (en) * | 1976-10-26 | 1978-07-18 | Celanese Corporation | Polyester yarn of high strength possessing an unusually stable internal structure |
| US4195052A (en) * | 1976-10-26 | 1980-03-25 | Celanese Corporation | Production of improved polyester filaments of high strength possessing an unusually stable internal structure |
| GB2003085B (en) * | 1977-08-19 | 1982-01-13 | Ici Ltd | Process for the manufacture of polyamide yarns |
| ZA784658B (en) * | 1977-08-19 | 1979-08-29 | Ici Ltd | Process for the manufacture of polyester yarns |
| US4228118A (en) * | 1977-11-03 | 1980-10-14 | Monsanto Company | Process for producing high tenacity polyethylene fibers |
| US4193961A (en) * | 1978-04-04 | 1980-03-18 | Kling-Tecs, Inc. | Method of extruding polypropylene yarn |
| US4303606A (en) * | 1978-04-04 | 1981-12-01 | Kling Tecs, Inc. | Method of extruding polypropylene yarn |
| US4204828A (en) * | 1978-08-01 | 1980-05-27 | Allied Chemical Corporation | Quench system for synthetic fibers using fog and flowing air |
| DE3160843D1 (en) * | 1980-05-30 | 1983-10-13 | Ici Plc | Improved melt spinning process |
| US4359557A (en) * | 1980-09-11 | 1982-11-16 | Eastman Kodak Company | Process for producing low pilling textile fiber and product of the process |
| US4352400A (en) * | 1980-12-01 | 1982-10-05 | Christensen, Inc. | Drill bit |
| US4384098A (en) * | 1981-01-13 | 1983-05-17 | Phillips Petroleum Company | Filamentary polypropylene and method of making |
| DE3261799D1 (en) * | 1981-02-26 | 1985-02-21 | Asahi Chemical Ind | Uniformly dyeable nylon 66 fiber and process for the production thereof |
| DE3370976D1 (en) * | 1982-05-28 | 1987-05-21 | Asahi Chemical Ind | Easily dyeable polyethylene terephtalate fibre and process for preparing the same |
| CA1198255A (en) * | 1982-07-08 | 1985-12-24 | Kazuyuki Kitamura | High tenacity polyhexamethylene adipamide fiber |
| US4522773A (en) * | 1983-02-24 | 1985-06-11 | Celanese Corporation | Process for producing self-crimping polyester yarn |
| US4539170A (en) * | 1983-09-26 | 1985-09-03 | E. I. Du Pont De Nemours And Company | Process for steam-conditioning spin-oriented polyamide filaments |
| EP0200472B1 (en) * | 1985-04-23 | 1990-12-05 | Teijin Limited | Wholly aromatic polyamide fibers and composite fibers, process for productiion thereof and use thereof |
| US5049339A (en) * | 1989-07-03 | 1991-09-17 | The Goodyear Tire & Rubber Company | Process for manufacturing industrial yarn |
| US5238740A (en) * | 1990-05-11 | 1993-08-24 | Hoechst Celanese Corporation | Drawn polyester yarn having a high tenacity and high modulus and a low shrinkage |
| US5186879A (en) * | 1990-05-11 | 1993-02-16 | Hoechst Celanese Corporation | Spinning process for producing high strength, high modulus, low shrinkage yarns |
| GB9011464D0 (en) * | 1990-05-22 | 1990-07-11 | Ici Plc | High speed spinning process |
| US5352518A (en) * | 1990-06-22 | 1994-10-04 | Kanebo, Ltd. | Composite elastic filament with rough surface, production thereof, and textile structure comprising the same |
| US5171504A (en) * | 1991-03-28 | 1992-12-15 | North Carolina State University | Process for producing high strength, high modulus thermoplastic fibers |
| DE69324280T2 (de) * | 1992-01-13 | 1999-08-12 | Hercules Inc., Wilmington, Del. | Wärmeverbindbare Fasern für wiederstandsfähige Vliesstoffe |
| US5279783A (en) * | 1992-01-30 | 1994-01-18 | United States Surgical Corporation | Process for manufacture of polyamide monofilament suture |
| CA2088458A1 (en) * | 1992-01-30 | 1993-07-31 | Cheng-Kung Liu | Polyamide monofilament suture manufactured from higher order polyamide |
| KR100408353B1 (ko) * | 1994-12-19 | 2004-03-09 | 헤르큘레스 인코포레이티드 | 고강도부직물용섬유의제조방법,및이로부터제조된섬유및부직물 |
| WO2007059914A1 (de) * | 2005-11-24 | 2007-05-31 | Oerlikon Textile Gmbh & Co. Kg | Verfahren und vorrichtung zum schmelzspinnen und abkühlen eines multifilen fadens mit kühllufttemperaturmessung innerhalb des filamentbündels |
| EP2565304A1 (de) * | 2011-09-02 | 2013-03-06 | Aurotec GmbH | Extrusionsverfahren und -vorrichtung |
| US11746443B1 (en) | 2019-06-07 | 2023-09-05 | Cook Biotech Incorporated | Polycaprolactone-based fibers and implants including same |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2323383A (en) * | 1940-01-06 | 1943-07-06 | Celanese Corp | Production of artificial materials |
| US2296202A (en) * | 1940-03-19 | 1942-09-15 | Du Pont | Process of making artificial wool |
| GB541238A (en) * | 1940-04-17 | 1941-11-19 | Henry Dreyfus | Improvements in or relating to the manufacture of artificial textile materials and the like |
| US2578899A (en) * | 1949-10-22 | 1951-12-18 | Du Pont | Superstretching polyester structures |
| NL77336C (enExample) * | 1952-11-27 | |||
| US2953428A (en) * | 1955-06-22 | 1960-09-20 | Union Carbide Corp | Production of polychlorotrifluoroethylene textiles |
| US3048467A (en) * | 1957-06-10 | 1962-08-07 | Union Carbide Corp | Textile fibers of polyolefins |
| US3030173A (en) * | 1959-09-30 | 1962-04-17 | Hoechst Ag | Process for the uniform preparation of shaped structures such as filaments or foils from high-melting linear polyesters |
| US3216187A (en) * | 1962-01-02 | 1965-11-09 | Du Pont | High strength polyethylene terephthalate yarn |
| FR1347985A (fr) * | 1962-01-02 | 1964-01-04 | Du Pont | Nouveaux filaments de polyesters, plus particulièrement en téréphtalate de polyéthylène, leur fabrication et leur application |
-
0
- NL NL264104D patent/NL264104A/xx unknown
- CA CA697541A patent/CA697541A/en not_active Expired
- IT IT650394D patent/IT650394A/it unknown
-
1961
- 1961-04-19 GB GB14130/61A patent/GB900009A/en not_active Expired
- 1961-04-28 FR FR860311A patent/FR1287939A/fr not_active Expired
- 1961-04-28 DE DE19611435614 patent/DE1435614A1/de active Pending
-
1966
- 1966-05-04 US US554620A patent/US3361859A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR1287939A (fr) | 1962-03-16 |
| IT650394A (enExample) | |
| US3361859A (en) | 1968-01-02 |
| CA697541A (en) | 1964-11-10 |
| GB900009A (en) | 1962-07-04 |
| NL264104A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1435614A1 (de) | Verfahren zur Herstellung von Kunstfaeden | |
| DE752536C (de) | Verfahren zur Verbesserung der Eigenschaften faserbildender, durch Kondensation erhaeltlicher Linearpolymeren | |
| DE60109112T2 (de) | Multifilamentgarne und Herstellungsverfahren | |
| DE871513C (de) | Verfahren zur Herstellung linearer Mischpolyester | |
| DE1202932B (de) | Verfahren zur Herstellung gekraeuselter Verbundfaeden | |
| DE1660181A1 (de) | Verfahren zur Herstellung von Polymeren | |
| CH313960A (de) | Verfahren zur Herstellung von reissfesten Fasern oder Fäden aus einem synthetischen Polyester | |
| DE2316113A1 (de) | Faeden aus kristallinem kunststoff und verfahren zu ihrer herstellung | |
| DE2801164A1 (de) | Polyamidgarn und verfahren zu seiner herstellung | |
| DE2402444A1 (de) | Garne mit mattem aussehen auf der basis von synthetischen polymeren und verfahren zu ihrer herstellung | |
| DE1494719A1 (de) | Kunstfaden bzw. -faser und Herstellung des- bzw. derselben | |
| DE2161967C3 (de) | Verfahren zur Herstellung eines Drahtes aus hochmolekularen, linearen Polyestern | |
| DE2118551A1 (de) | Synthetische Faden fur künstliches Haar und Verfahren zu ihrer Herstellung | |
| DE69715867T2 (de) | Ultra-orientierte kristalline filamente und verfahren eu ihrer herstellung | |
| DE68911115T2 (de) | Nassspinnverfahren für Acrylfilamente. | |
| DE2119097A1 (de) | Kräuselbarer Faden | |
| DE1816138A1 (de) | Verfahren und Vorrichtung zur Herstellung von zusammengesetzten Faeden | |
| DE1660419A1 (de) | Verfahren zur Herstellung von synthetischen Faeden mit nichtkreisfoermigem Querschnitt und Spinnduese zur Durchfuehrung des Verfahrens | |
| DE1660590A1 (de) | Verfahren zum Verstrecken von Verbundfaeden | |
| DE2603029C3 (de) | Verfahren zur Cyclisierung von Acrylnitrilpolymerisat-Fäden | |
| DE1669518A1 (de) | Kristalline,orientierte Faeden | |
| DE1961004A1 (de) | Verfahren zur Herstellung von elastischem Garn | |
| DE2105818C3 (de) | Verfahren zur Herstellung von hochdehnbaren Damenstrümpfen | |
| DE2702717A1 (de) | Verfahren zum verziehen von polyamid- monofilen | |
| DE1794328C3 (de) | Polyamid-Mischgarn |