DE1429249A1 - Mehrteilige Blumenvase - Google Patents
Mehrteilige BlumenvaseInfo
- Publication number
- DE1429249A1 DE1429249A1 DE19641429249 DE1429249A DE1429249A1 DE 1429249 A1 DE1429249 A1 DE 1429249A1 DE 19641429249 DE19641429249 DE 19641429249 DE 1429249 A DE1429249 A DE 1429249A DE 1429249 A1 DE1429249 A1 DE 1429249A1
- Authority
- DE
- Germany
- Prior art keywords
- vase
- bowl
- side wall
- tray
- grid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000007787 solid Substances 0.000 claims description 5
- 238000010276 construction Methods 0.000 description 4
- 238000005192 partition Methods 0.000 description 3
- -1 polyethylene Polymers 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- DNXHEGUUPJUMQT-CBZIJGRNSA-N Estrone Chemical compound OC1=CC=C2[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1 DNXHEGUUPJUMQT-CBZIJGRNSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000007665 sagging Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47G—HOUSEHOLD OR TABLE EQUIPMENT
- A47G7/00—Flower holders or the like
- A47G7/02—Devices for supporting flower-pots or cut flowers
- A47G7/06—Flower vases
- A47G7/07—Guiding means for flowers in vases, e.g. perforated covers
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47G—HOUSEHOLD OR TABLE EQUIPMENT
- A47G7/00—Flower holders or the like
- A47G7/02—Devices for supporting flower-pots or cut flowers
- A47G7/06—Flower vases
Landscapes
- Cultivation Receptacles Or Flower-Pots, Or Pots For Seedlings (AREA)
- Lift Valve (AREA)
- Packging For Living Organisms, Food Or Medicinal Products That Are Sensitive To Environmental Conditiond (AREA)
- Packaging Of Annular Or Rod-Shaped Articles, Wearing Apparel, Cassettes, Or The Like (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US301078A US3183624A (en) | 1963-08-09 | 1963-08-09 | Floral arranger |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1429249A1 true DE1429249A1 (de) | 1968-11-21 |
Family
ID=23161843
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641429249 Withdrawn DE1429249A1 (de) | 1963-08-09 | 1964-07-28 | Mehrteilige Blumenvase |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3183624A (cg-RX-API-DMAC10.html) |
| AT (1) | AT258015B (cg-RX-API-DMAC10.html) |
| BE (1) | BE651535A (cg-RX-API-DMAC10.html) |
| CH (1) | CH419489A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1429249A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK111648B (cg-RX-API-DMAC10.html) |
| ES (1) | ES302107A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1034018A (cg-RX-API-DMAC10.html) |
| LU (1) | LU46713A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL6408995A (cg-RX-API-DMAC10.html) |
| NO (1) | NO116337B (cg-RX-API-DMAC10.html) |
| OA (1) | OA02177A (cg-RX-API-DMAC10.html) |
| SE (1) | SE328382B (cg-RX-API-DMAC10.html) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3369687A (en) * | 1966-05-02 | 1968-02-20 | Lewals Inc | Plastic container |
| DE1529393B1 (de) * | 1966-11-19 | 1969-09-25 | Erich Schumm | Gefaess zur Halterung von Blumen,Graesern od.dgl. |
| US3477175A (en) * | 1967-03-03 | 1969-11-11 | Mitchell T Sakamato | Separable vase assembly |
| US3447262A (en) * | 1968-06-06 | 1969-06-03 | John J Uhl | Flower arranging device |
| US3526334A (en) * | 1968-08-12 | 1970-09-01 | Dart Ind Inc | Device for storing and serving foodstuffs |
| US3651601A (en) * | 1970-07-31 | 1972-03-28 | Richard L La Montagne | Flower holders |
| US3906666A (en) * | 1974-07-29 | 1975-09-23 | Dart Ind Inc | Multi-unit flora display assembly |
| US4145841A (en) * | 1976-11-05 | 1979-03-27 | Woolpert John C | Extendable planter |
| US4092804A (en) * | 1977-02-16 | 1978-06-06 | Packer Plastics, Inc. | Flower pot and interlocking saucer |
| US4159597A (en) * | 1977-02-28 | 1979-07-03 | Illinois Tool Works Inc. | Planting system including articles of manufacture |
| US4216621A (en) * | 1977-02-28 | 1980-08-12 | Illinois Tool Works, Inc. | Planting system including articles of manufacture |
| US4204367A (en) * | 1978-05-10 | 1980-05-27 | Questor Corporation | Plant pot holder or reservoir |
| FR2476998A1 (fr) * | 1980-02-29 | 1981-09-04 | Briere Bernard | Presentoir pour fleurs et analogues |
| US4387534A (en) * | 1981-08-10 | 1983-06-14 | Lewandowski Raymond J | Book end planter |
| US4899487A (en) * | 1988-01-12 | 1990-02-13 | Brownlee Richard W | Storage and display receptacle assembly |
| US5172517A (en) * | 1988-09-29 | 1992-12-22 | Poul Timmermann | Plant tube for use in flower pots |
| USD322768S (en) | 1989-07-24 | 1991-12-31 | Dart Industries | Flower arranging insert for a container |
| US4978019A (en) * | 1990-02-27 | 1990-12-18 | Ioannis Maroudas | Modular frame for fruit baskets |
| US5309671A (en) * | 1992-05-13 | 1994-05-10 | Byun Bok K | Stack type plant-pots |
| US5645168A (en) * | 1995-02-17 | 1997-07-08 | Teleflora Llc | Combined floral display and keepsake |
| USRE36438E (en) * | 1995-02-17 | 1999-12-14 | Teleflora Llc | Combined floral display and keepsake |
| GB2298136A (en) * | 1995-02-23 | 1996-08-28 | Zyl Johan Van | Flower holder |
| NL1004972C2 (nl) * | 1997-01-10 | 1998-03-06 | Macek Technika B V | Houder voor bloemen en dergelijke. |
| IT1303388B1 (it) * | 1998-12-22 | 2000-11-06 | Gennaker Holding S A | Struttura di barriera protettiva. |
| GB2362569A (en) * | 2000-05-25 | 2001-11-28 | Virginia Catherine Bliss | A flower holder |
| US7310910B2 (en) * | 2003-07-18 | 2007-12-25 | Terry Miller | Floral arrangement holding assembly and method |
| US7096623B2 (en) * | 2003-12-03 | 2006-08-29 | Cardamone Lisa P | Floral design container system |
| US7296773B2 (en) * | 2005-02-07 | 2007-11-20 | Golden State Silk Flowers, Inc. | Stand for holding silk floral arrangements |
| WO2009152464A1 (en) * | 2008-06-12 | 2009-12-17 | Driscoll Daniel G | Conical container |
| USD744700S1 (en) * | 2014-04-15 | 2015-12-01 | HMD Aquatic, LLC | Clam planter |
| US11653776B2 (en) * | 2020-03-06 | 2023-05-23 | Woods IP Holdings LLC | Vase with retainer mounted on securing ring |
| USD995212S1 (en) * | 2020-09-22 | 2023-08-15 | Guangdong Industry Polytechnic | Tea set |
| USD1070520S1 (en) * | 2021-09-16 | 2025-04-15 | Omielife, Inc. | Stackable container |
| US12075736B1 (en) | 2022-11-12 | 2024-09-03 | Justin Clay Thompson | Platform tray |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US165456A (en) * | 1875-07-13 | Improvement in stands for flowers | ||
| US125003A (en) * | 1872-03-26 | Improvement in epergnes for fruits and flowers | ||
| US1462947A (en) * | 1922-01-21 | 1923-07-24 | Dazey Mfg Company | Flower holder |
| US1685056A (en) * | 1927-07-19 | 1928-09-18 | Max L Kramer | Flower holder |
| US1868802A (en) * | 1930-12-30 | 1932-07-26 | Okai Luis Soji | Basin flower holder |
| US2487400A (en) * | 1947-06-02 | 1949-11-08 | Earl S Tupper | Open mouth container and nonsnap type of closure therefor |
| US2637143A (en) * | 1949-06-14 | 1953-05-05 | Roy L Reynolds | Adjustable frog |
| US2900760A (en) * | 1956-04-17 | 1959-08-25 | Tupper Corp | Straining and stem holding structure |
-
1963
- 1963-08-09 US US301078A patent/US3183624A/en not_active Expired - Lifetime
-
1964
- 1964-05-19 DK DK248964AA patent/DK111648B/da unknown
- 1964-05-27 NO NO153409A patent/NO116337B/no unknown
- 1964-07-01 SE SE07990/64A patent/SE328382B/xx unknown
- 1964-07-14 ES ES0302107A patent/ES302107A1/es not_active Expired
- 1964-07-28 DE DE19641429249 patent/DE1429249A1/de not_active Withdrawn
- 1964-08-04 GB GB31595/64A patent/GB1034018A/en not_active Expired
- 1964-08-06 NL NL6408995A patent/NL6408995A/xx unknown
- 1964-08-06 AT AT677264A patent/AT258015B/de active
- 1964-08-07 BE BE651535D patent/BE651535A/xx unknown
- 1964-08-07 CH CH1037864A patent/CH419489A/de unknown
- 1964-08-07 LU LU46713D patent/LU46713A1/xx unknown
-
1966
- 1966-11-29 OA OA52670A patent/OA02177A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT258015B (de) | 1967-11-10 |
| DK111648B (da) | 1968-09-23 |
| BE651535A (cg-RX-API-DMAC10.html) | 1965-02-08 |
| ES302107A1 (es) | 1965-01-01 |
| SE328382B (cg-RX-API-DMAC10.html) | 1970-09-14 |
| NO116337B (cg-RX-API-DMAC10.html) | 1969-03-10 |
| GB1034018A (en) | 1966-06-29 |
| NL6408995A (cg-RX-API-DMAC10.html) | 1965-02-10 |
| CH419489A (de) | 1966-08-31 |
| OA02177A (fr) | 1970-05-05 |
| LU46713A1 (cg-RX-API-DMAC10.html) | 1965-02-08 |
| US3183624A (en) | 1965-05-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1429249A1 (de) | Mehrteilige Blumenvase | |
| DE69112361T2 (de) | Universeller faltbarer Lampenschirmbezug. | |
| DE1299102B (de) | Staender fuer Lockenwickler | |
| EP3451872A1 (de) | Falttisch | |
| DE7919538U1 (de) | Bausatz zur herstellung eines lampenschirmes | |
| EP1731056B1 (de) | Schirm mit auf einem Standrohr angebrachtem Spanngestell für eine Bespannung | |
| DE2156778A1 (de) | Kombinationsmoebel | |
| DE2427147C3 (cg-RX-API-DMAC10.html) | ||
| DE2109242A1 (de) | Sitz- oder Liegemöbel | |
| DE29915244U1 (de) | Vogelfutterhaus | |
| DE202012103769U1 (de) | Sockenanziehhilfe | |
| DE2427147B2 (de) | Stuhl | |
| DE3428993C2 (cg-RX-API-DMAC10.html) | ||
| DE202011004882U1 (de) | Polygonmodul zur Herstellung einer Möbelvorrichtung sowie Möbelvorrichtung mit mehreren Polygonmodulen | |
| CH687805A5 (de) | Fussstuetze mit verstellbarer Trittplatte. | |
| DE2528708C3 (de) | Mehrteilige Blumenvase o.dgl | |
| DE9204383U1 (de) | Vorrichtung zum Aufhängen von Müllsäcken | |
| DE102013114857B4 (de) | Falthocker | |
| DE1111329B (de) | Bauelement fuer Gebrauchsgegenstaende in Form von Koerben, Matten u. dgl. | |
| DE1429249C (de) | Mehrteilige Vase fur Blumen od dgl | |
| DE202020101592U1 (de) | Blumenkasten | |
| DE7014985U (de) | Bauteil für Kunststoffmöbel | |
| DE1805308A1 (de) | Beleuchtungskoerper | |
| DE202018104047U1 (de) | Weihnachtsbaumständer für künstliche Weihnachtsbäume | |
| CH443582A (de) | Verkürzbarer Schirm |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |