DE1418862C - - Google Patents
Info
- Publication number
- DE1418862C DE1418862C DE1418862C DE 1418862 C DE1418862 C DE 1418862C DE 1418862 C DE1418862 C DE 1418862C
- Authority
- DE
- Germany
- Prior art keywords
- tert
- sulfuric acid
- dimethylindane
- butyl
- butylbenzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 33
- RRHGJUQNOFWUDK-UHFFFAOYSA-N isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 13
- RWGFKTVRMDUZSP-UHFFFAOYSA-N Cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 7
- 230000000875 corresponding Effects 0.000 claims description 6
- PWATWSYOIIXYMA-UHFFFAOYSA-N Pentylbenzene Chemical compound CCCCCC1=CC=CC=C1 PWATWSYOIIXYMA-UHFFFAOYSA-N 0.000 claims description 4
- OCKPCBLVNKHBMX-UHFFFAOYSA-N butylbenzene Chemical compound CCCCC1=CC=CC=C1 OCKPCBLVNKHBMX-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- -1 alkyl 1,1-dimethylindanes Chemical class 0.000 claims description 3
- 238000009835 boiling Methods 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M NaHCO3 Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 7
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N Indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 238000007792 addition Methods 0.000 description 5
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 235000016068 Berberis vulgaris Nutrition 0.000 description 4
- 241000335053 Beta vulgaris Species 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N Carbon tetrachloride Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 238000006640 acetylation reaction Methods 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- UTTMVTDJCFSOFF-UHFFFAOYSA-N 3,3-dimethyl-1,2-dihydroindene Chemical compound C1=CC=C2C(C)(C)CCC2=C1 UTTMVTDJCFSOFF-UHFFFAOYSA-N 0.000 description 3
- KWKXNDCHNDYVRT-UHFFFAOYSA-N Dodecylbenzene Chemical compound CCCCCCCCCCCCC1=CC=CC=C1 KWKXNDCHNDYVRT-UHFFFAOYSA-N 0.000 description 3
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 3
- 150000001993 dienes Chemical class 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- ZJMWRROPUADPEA-UHFFFAOYSA-N sec-butylbenzene Chemical compound CCC(C)C1=CC=CC=C1 ZJMWRROPUADPEA-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K Aluminium chloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- WTWBUQJHJGUZCY-UHFFFAOYSA-N Cuminaldehyde Chemical compound CC(C)C1=CC=C(C=O)C=C1 WTWBUQJHJGUZCY-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000003205 fragrance Substances 0.000 description 2
- 150000002468 indanes Chemical class 0.000 description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- QHTJSSMHBLGUHV-UHFFFAOYSA-N 2-methylbutan-2-ylbenzene Chemical compound CCC(C)(C)C1=CC=CC=C1 QHTJSSMHBLGUHV-UHFFFAOYSA-N 0.000 description 1
- BDVXGLCBHPSEGG-UHFFFAOYSA-N 3,3,8,8-tetramethyl-5-propan-2-yl-1,2,6,7-tetrahydro-as-indacene Chemical compound C1CC(C)(C)C2=C1C(C(C)C)=CC1=C2CCC1(C)C BDVXGLCBHPSEGG-UHFFFAOYSA-N 0.000 description 1
- QWZAOSKLFKAEOK-UHFFFAOYSA-N 3,3-dimethyl-2H-inden-1-one Chemical compound C1=CC=C2C(C)(C)CC(=O)C2=C1 QWZAOSKLFKAEOK-UHFFFAOYSA-N 0.000 description 1
- BYVKOUYLJZATEQ-UHFFFAOYSA-N 3,3-dimethyl-5-propan-2-yl-1,2-dihydroindene Chemical compound CC(C)C1=CC=C2CCC(C)(C)C2=C1 BYVKOUYLJZATEQ-UHFFFAOYSA-N 0.000 description 1
- JTZZMXVIHNHASS-UHFFFAOYSA-N 3-methyl-3-phenylbutanoic acid Chemical compound OC(=O)CC(C)(C)C1=CC=CC=C1 JTZZMXVIHNHASS-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N Acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000006210 cyclodehydration reaction Methods 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000002469 indenes Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000006011 modification reaction Methods 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001264 neutralization Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing Effects 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1418862A1 (de) | Verfahren zur Herstellung von Alkyl-1,1-dimethylindanen | |
| DE1266754B (de) | Verfahren zur Herstellung von 1, 1, 3, 4, 4, 6-Hexamethyl-1, 2, 3, 4-tetrahydronaphthalin | |
| DE2461076A1 (de) | Verfahren zur reinigung von umsetzungsgemischen | |
| DE1418862C (fr) | ||
| DE857042C (de) | Verfahren zur Umwandlung von Phenanthren in Anthracen | |
| EP0860415B1 (fr) | Procédé pour l'isomérisation d'alcohols allyliques | |
| EP0025940B1 (fr) | Procédé pour l'hydroxylation de composés oléfiniquement insaturés | |
| DE2630835A1 (de) | Neue moschusartige riechstoffe und verfahren zu deren herstellung | |
| DE2031900C3 (de) | Verfahren zur Herstellung von Isopren | |
| DE1418862B (fr) | ||
| DE3878104T2 (de) | Verfahren zur isomerisierung und oxydativen jodierung von aromatischen verbindungen. | |
| EP0268826B1 (fr) | Procédé de traitement de mélanges de réaction contenant du cyclohexylhydroperoxyde | |
| DE1618451A1 (de) | Verfahren zur Herstellung von Hydrindacenen | |
| DE2222342C3 (de) | Verfahren zur Isomerisierung von α -Isopropylnaphthalin zu β -Isopropylnaphthalin | |
| CH630049A5 (en) | Process for the preparation of certain ring-chlorinated benzotrichlorides | |
| DE1950434C3 (de) | Verfahren zur kontinuierlichen Herstellung von 1-Methyl-3-phenylindanen | |
| DE2202249A1 (de) | Isolierung von alpha-Cedren aus Zedernholzoelkohlenwasserstoffen | |
| EP0564979B1 (fr) | Procédé pour la fabrication de dixylylpropane | |
| DE1960941A1 (de) | Verfahren zur Herstellung von Methylcyclohexenen | |
| DE2920173A1 (de) | Verfahren zur herstellung von 1,3,5-trichlorbenzol | |
| EP0949237B1 (fr) | Procédé pour la préparation de dihydrocitral | |
| DE1643617B2 (fr) | ||
| DE2205030C3 (de) | Verfahren zur Herstellung von Polymethylbenzolen aus aromatischen Arylkohlenwasserstoffe!! | |
| DE2203459C3 (de) | Verfahren zur Reinigung von Cyclopenten | |
| DE2352054C3 (de) | Verfahren zur Reinigung von 2-Methyl-2-hydroxy-heptanon-6 |