DE1418028B - - Google Patents
Info
- Publication number
- DE1418028B DE1418028B DE1418028B DE 1418028 B DE1418028 B DE 1418028B DE 1418028 B DE1418028 B DE 1418028B
- Authority
- DE
- Germany
- Prior art keywords
- benzene
- reaction
- aluminum chloride
- propylene
- diisopropylbenzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 79
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 46
- 238000006243 chemical reaction Methods 0.000 claims description 27
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 20
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 15
- SPPWGCYEYAMHDT-UHFFFAOYSA-N 1,4-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=C(C(C)C)C=C1 SPPWGCYEYAMHDT-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 238000001035 drying Methods 0.000 claims description 7
- 229930195733 hydrocarbon Natural products 0.000 claims description 7
- 150000002430 hydrocarbons Chemical class 0.000 claims description 7
- 239000006227 byproduct Substances 0.000 claims description 5
- 239000011541 reaction mixture Substances 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 4
- 239000003426 co-catalyst Substances 0.000 claims description 2
- -1 propylene Chemical class 0.000 claims description 2
- 238000004064 recycling Methods 0.000 claims 2
- 238000002360 preparation method Methods 0.000 claims 1
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical class CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 20
- OKIRBHVFJGXOIS-UHFFFAOYSA-N 1,2-di(propan-2-yl)benzene Chemical class CC(C)C1=CC=CC=C1C(C)C OKIRBHVFJGXOIS-UHFFFAOYSA-N 0.000 description 10
- 239000007795 chemical reaction product Substances 0.000 description 10
- LGXAANYJEHLUEM-UHFFFAOYSA-N 1,2,3-tri(propan-2-yl)benzene Chemical compound CC(C)C1=CC=CC(C(C)C)=C1C(C)C LGXAANYJEHLUEM-UHFFFAOYSA-N 0.000 description 9
- UNEATYXSUBPPKP-UHFFFAOYSA-N 1,3-Diisopropylbenzene Chemical compound CC(C)C1=CC=CC(C(C)C)=C1 UNEATYXSUBPPKP-UHFFFAOYSA-N 0.000 description 6
- 230000029936 alkylation Effects 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 150000001555 benzenes Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- 230000020335 dealkylation Effects 0.000 description 4
- 238000006900 dealkylation reaction Methods 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010555 transalkylation reaction Methods 0.000 description 3
- 239000002253 acid Substances 0.000 description 2
- 150000004996 alkyl benzenes Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- ODLMAHJVESYWTB-UHFFFAOYSA-N propylbenzene Chemical compound CCCC1=CC=CC=C1 ODLMAHJVESYWTB-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- RWGMANKDYBWNNP-UHFFFAOYSA-N 1,2,4-tri(propan-2-yl)benzene Chemical compound CC(C)C1=CC=C(C(C)C)C(C(C)C)=C1 RWGMANKDYBWNNP-UHFFFAOYSA-N 0.000 description 1
- PEQXUXPSUIXZOB-UHFFFAOYSA-N 1,2-di(propan-2-yl)-3-propylbenzene Chemical class C(C)(C)C=1C(=C(C=CC1)CCC)C(C)C PEQXUXPSUIXZOB-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241001676573 Minium Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- KLWWVZYLMNXWLI-UHFFFAOYSA-N benzene cumene Chemical compound C1=CC=CC=C1.C1(=CC=CC=C1)C(C)C.C1=CC=CC=C1 KLWWVZYLMNXWLI-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 229920000582 polyisocyanurate Polymers 0.000 description 1
- 239000011495 polyisocyanurate Substances 0.000 description 1
- 230000006207 propylation Effects 0.000 description 1
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1518622C3 (enrdf_load_stackoverflow) | ||
| DE1418028C (enrdf_load_stackoverflow) | ||
| DE1418028B (enrdf_load_stackoverflow) | ||
| DE2061531A1 (de) | Verfahren zur Herstellung von hoch reinem 2,2 Di (4 hydroxyphenyl) propan | |
| DE1668473C2 (de) | Verfahren zum Herstellen von Alkylarylverbindungen | |
| DE1418028A1 (de) | Verfahren zur kontinuierlichen Herstellung von p-Diisopropylbenzol | |
| DE2340064A1 (de) | Verfahren zur herstellung von alkylierten aromatischen kohlenwasserstoffen | |
| DE1935750C3 (de) | Verfahren zur Herstellung von Alkylbenzolen | |
| DE1443648B2 (de) | Verfahren zur kontinuierlichen herstellung von monoalkylbenzolen durch zweistufige alkylierung | |
| DE1921209C3 (de) | Verfahren zur Herstellung von Benzol und Xylol aus Toluol | |
| DE1568698A1 (de) | Verfahren zur Herstellung von schwerem Alkylat | |
| DE2813502C2 (de) | Verfahren zur selektiven Verminderung des m-Xylolgehalts und des Gehalts an aromatischen Olefinen in einem Nebenproduktöl | |
| DE2256282A1 (de) | Verfahren zur herstellung von n-alkylbenzolen | |
| DE2024604C (enrdf_load_stackoverflow) | ||
| AT208352B (de) | Verfahren zur Herstellung von Monoisopropylbenzol und Diisopropylbenzolen | |
| CH283399A (de) | Verfahren zur Herstellung von Sulfonierungsprodukten alkylaromatischer Kohlenwasserstoffe. | |
| DE1618911C3 (de) | Verfahren zur Herstellung eines zu waschaktiven Substanzen sulfonierbaren Alkylats | |
| DE970957C (de) | Verfahren zur kontinuierlichen Herstellung hellfarbiger Alkylbenzolsulfonsaeuren | |
| AT260208B (de) | Verfahren zur Herstellung von alkylaromatischen Kohlenwasserstoffen | |
| DE2247308A1 (de) | Verfahren zur herstellung von mcymol | |
| DE1443454A1 (de) | Verfahren zur Herstellung von waschaktiven Alkylatfraktionen | |
| AT215413B (de) | Verfahren zur Herstellung von Monoalkylbenzolen mit 9-18 C-Atomen im Alkylteil | |
| DE1905071A1 (de) | Verfahren zur Raffination linearer Alkylbenzole | |
| DE1114174B (de) | Verfahren zur Raffination aromatischer Kohlenwasserstoffe mit wasserfreiem Fluorwasserstoff in fluessiger Phase | |
| DE1152099B (de) | Verfahren zur Sulfonierung von alkylaromatischen Kohlenwasserstoffen |